done

lib/python3.11/site-packages/numpy/lib/__init__.py

@@ -0,0 +1,97 @@
+"""
+``numpy.lib`` is mostly a space for implementing functions that don't
+belong in core or in another NumPy submodule with a clear purpose
+(e.g. ``random``, ``fft``, ``linalg``, ``ma``).
+
+``numpy.lib``'s private submodules contain basic functions that are used by
+other public modules and are useful to have in the main name-space.
+
+"""
+
+# Public submodules
+# Note: recfunctions is public, but not imported
+from numpy._core._multiarray_umath import add_docstring, tracemalloc_domain
+from numpy._core.function_base import add_newdoc
+
+# Private submodules
+# load module names. See https://github.com/networkx/networkx/issues/5838
+from . import (
+    _arraypad_impl,
+    _arraysetops_impl,
+    _arrayterator_impl,
+    _function_base_impl,
+    _histograms_impl,
+    _index_tricks_impl,
+    _nanfunctions_impl,
+    _npyio_impl,
+    _polynomial_impl,
+    _shape_base_impl,
+    _stride_tricks_impl,
+    _twodim_base_impl,
+    _type_check_impl,
+    _ufunclike_impl,
+    _utils_impl,
+    _version,
+    array_utils,
+    format,
+    introspect,
+    mixins,
+    npyio,
+    scimath,
+    stride_tricks,
+)
+
+# numpy.lib namespace members
+from ._arrayterator_impl import Arrayterator
+from ._version import NumpyVersion
+
+__all__ = [
+    "Arrayterator", "add_docstring", "add_newdoc", "array_utils",
+    "format", "introspect", "mixins", "NumpyVersion", "npyio", "scimath",
+    "stride_tricks", "tracemalloc_domain",
+]
+
+add_newdoc.__module__ = "numpy.lib"
+
+from numpy._pytesttester import PytestTester
+
+test = PytestTester(__name__)
+del PytestTester
+
+def __getattr__(attr):
+    # Warn for deprecated/removed aliases
+    import math
+    import warnings
+
+    if attr == "math":
+        warnings.warn(
+            "`np.lib.math` is a deprecated alias for the standard library "
+            "`math` module (Deprecated Numpy 1.25). Replace usages of "
+            "`numpy.lib.math` with `math`", DeprecationWarning, stacklevel=2)
+        return math
+    elif attr == "emath":
+        raise AttributeError(
+            "numpy.lib.emath was an alias for emath module that was removed "
+            "in NumPy 2.0. Replace usages of numpy.lib.emath with "
+            "numpy.emath.",
+            name=None
+        )
+    elif attr in (
+        "histograms", "type_check", "nanfunctions", "function_base",
+        "arraypad", "arraysetops", "ufunclike", "utils", "twodim_base",
+        "shape_base", "polynomial", "index_tricks",
+    ):
+        raise AttributeError(
+            f"numpy.lib.{attr} is now private. If you are using a public "
+            "function, it should be available in the main numpy namespace, "
+            "otherwise check the NumPy 2.0 migration guide.",
+            name=None
+        )
+    elif attr == "arrayterator":
+        raise AttributeError(
+            "numpy.lib.arrayterator submodule is now private. To access "
+            "Arrayterator class use numpy.lib.Arrayterator.",
+            name=None
+        )
+    else:
+        raise AttributeError(f"module {__name__!r} has no attribute {attr!r}")

lib/python3.11/site-packages/numpy/lib/__init__.pyi

@@ -0,0 +1,44 @@
+from numpy._core.function_base import add_newdoc
+from numpy._core.multiarray import add_docstring, tracemalloc_domain
+
+# all submodules of `lib` are accessible at runtime through `__getattr__`,
+# so we implicitly re-export them here
+from . import _array_utils_impl as _array_utils_impl
+from . import _arraypad_impl as _arraypad_impl
+from . import _arraysetops_impl as _arraysetops_impl
+from . import _arrayterator_impl as _arrayterator_impl
+from . import _datasource as _datasource
+from . import _format_impl as _format_impl
+from . import _function_base_impl as _function_base_impl
+from . import _histograms_impl as _histograms_impl
+from . import _index_tricks_impl as _index_tricks_impl
+from . import _iotools as _iotools
+from . import _nanfunctions_impl as _nanfunctions_impl
+from . import _npyio_impl as _npyio_impl
+from . import _polynomial_impl as _polynomial_impl
+from . import _scimath_impl as _scimath_impl
+from . import _shape_base_impl as _shape_base_impl
+from . import _stride_tricks_impl as _stride_tricks_impl
+from . import _twodim_base_impl as _twodim_base_impl
+from . import _type_check_impl as _type_check_impl
+from . import _ufunclike_impl as _ufunclike_impl
+from . import _utils_impl as _utils_impl
+from . import _version as _version
+from . import array_utils, format, introspect, mixins, npyio, scimath, stride_tricks
+from ._arrayterator_impl import Arrayterator
+from ._version import NumpyVersion
+
+__all__ = [
+    "Arrayterator",
+    "add_docstring",
+    "add_newdoc",
+    "array_utils",
+    "format",
+    "introspect",
+    "mixins",
+    "NumpyVersion",
+    "npyio",
+    "scimath",
+    "stride_tricks",
+    "tracemalloc_domain",
+]

lib/python3.11/site-packages/numpy/lib/_array_utils_impl.py

@@ -0,0 +1,62 @@
+"""
+Miscellaneous utils.
+"""
+from numpy._core import asarray
+from numpy._core.numeric import normalize_axis_index, normalize_axis_tuple
+from numpy._utils import set_module
+
+__all__ = ["byte_bounds", "normalize_axis_tuple", "normalize_axis_index"]
+
+
+@set_module("numpy.lib.array_utils")
+def byte_bounds(a):
+    """
+    Returns pointers to the end-points of an array.
+
+    Parameters
+    ----------
+    a : ndarray
+        Input array. It must conform to the Python-side of the array
+        interface.
+
+    Returns
+    -------
+    (low, high) : tuple of 2 integers
+        The first integer is the first byte of the array, the second
+        integer is just past the last byte of the array.  If `a` is not
+        contiguous it will not use every byte between the (`low`, `high`)
+        values.
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> I = np.eye(2, dtype='f'); I.dtype
+    dtype('float32')
+    >>> low, high = np.lib.array_utils.byte_bounds(I)
+    >>> high - low == I.size*I.itemsize
+    True
+    >>> I = np.eye(2); I.dtype
+    dtype('float64')
+    >>> low, high = np.lib.array_utils.byte_bounds(I)
+    >>> high - low == I.size*I.itemsize
+    True
+
+    """
+    ai = a.__array_interface__
+    a_data = ai['data'][0]
+    astrides = ai['strides']
+    ashape = ai['shape']
+    bytes_a = asarray(a).dtype.itemsize
+
+    a_low = a_high = a_data
+    if astrides is None:
+        # contiguous case
+        a_high += a.size * bytes_a
+    else:
+        for shape, stride in zip(ashape, astrides):
+            if stride < 0:
+                a_low += (shape - 1) * stride
+            else:
+                a_high += (shape - 1) * stride
+        a_high += bytes_a
+    return a_low, a_high

lib/python3.11/site-packages/numpy/lib/_array_utils_impl.pyi

@@ -0,0 +1,26 @@
+from collections.abc import Iterable
+from typing import Any
+
+from numpy import generic
+from numpy.typing import NDArray
+
+__all__ = ["byte_bounds", "normalize_axis_tuple", "normalize_axis_index"]
+
+# NOTE: In practice `byte_bounds` can (potentially) take any object
+# implementing the `__array_interface__` protocol. The caveat is
+# that certain keys, marked as optional in the spec, must be present for
+#  `byte_bounds`. This concerns `"strides"` and `"data"`.
+def byte_bounds(a: generic | NDArray[Any]) -> tuple[int, int]: ...
+
+def normalize_axis_tuple(
+    axis: int | Iterable[int],
+    ndim: int = ...,
+    argname: str | None = ...,
+    allow_duplicate: bool | None = ...,
+) -> tuple[int, int]: ...
+
+def normalize_axis_index(
+    axis: int = ...,
+    ndim: int = ...,
+    msg_prefix: str | None = ...,
+) -> int: ...

lib/python3.11/site-packages/numpy/lib/_arraypad_impl.py

@@ -0,0 +1,890 @@
+"""
+The arraypad module contains a group of functions to pad values onto the edges
+of an n-dimensional array.
+
+"""
+import numpy as np
+from numpy._core.overrides import array_function_dispatch
+from numpy.lib._index_tricks_impl import ndindex
+
+__all__ = ['pad']
+
+
+###############################################################################
+# Private utility functions.
+
+
+def _round_if_needed(arr, dtype):
+    """
+    Rounds arr inplace if destination dtype is integer.
+
+    Parameters
+    ----------
+    arr : ndarray
+        Input array.
+    dtype : dtype
+        The dtype of the destination array.
+    """
+    if np.issubdtype(dtype, np.integer):
+        arr.round(out=arr)
+
+
+def _slice_at_axis(sl, axis):
+    """
+    Construct tuple of slices to slice an array in the given dimension.
+
+    Parameters
+    ----------
+    sl : slice
+        The slice for the given dimension.
+    axis : int
+        The axis to which `sl` is applied. All other dimensions are left
+        "unsliced".
+
+    Returns
+    -------
+    sl : tuple of slices
+        A tuple with slices matching `shape` in length.
+
+    Examples
+    --------
+    >>> np._slice_at_axis(slice(None, 3, -1), 1)
+    (slice(None, None, None), slice(None, 3, -1), (...,))
+    """
+    return (slice(None),) * axis + (sl,) + (...,)
+
+
+def _view_roi(array, original_area_slice, axis):
+    """
+    Get a view of the current region of interest during iterative padding.
+
+    When padding multiple dimensions iteratively corner values are
+    unnecessarily overwritten multiple times. This function reduces the
+    working area for the first dimensions so that corners are excluded.
+
+    Parameters
+    ----------
+    array : ndarray
+        The array with the region of interest.
+    original_area_slice : tuple of slices
+        Denotes the area with original values of the unpadded array.
+    axis : int
+        The currently padded dimension assuming that `axis` is padded before
+        `axis` + 1.
+
+    Returns
+    -------
+    roi : ndarray
+        The region of interest of the original `array`.
+    """
+    axis += 1
+    sl = (slice(None),) * axis + original_area_slice[axis:]
+    return array[sl]
+
+
+def _pad_simple(array, pad_width, fill_value=None):
+    """
+    Pad array on all sides with either a single value or undefined values.
+
+    Parameters
+    ----------
+    array : ndarray
+        Array to grow.
+    pad_width : sequence of tuple[int, int]
+        Pad width on both sides for each dimension in `arr`.
+    fill_value : scalar, optional
+        If provided the padded area is filled with this value, otherwise
+        the pad area left undefined.
+
+    Returns
+    -------
+    padded : ndarray
+        The padded array with the same dtype as`array`. Its order will default
+        to C-style if `array` is not F-contiguous.
+    original_area_slice : tuple
+        A tuple of slices pointing to the area of the original array.
+    """
+    # Allocate grown array
+    new_shape = tuple(
+        left + size + right
+        for size, (left, right) in zip(array.shape, pad_width)
+    )
+    order = 'F' if array.flags.fnc else 'C'  # Fortran and not also C-order
+    padded = np.empty(new_shape, dtype=array.dtype, order=order)
+
+    if fill_value is not None:
+        padded.fill(fill_value)
+
+    # Copy old array into correct space
+    original_area_slice = tuple(
+        slice(left, left + size)
+        for size, (left, right) in zip(array.shape, pad_width)
+    )
+    padded[original_area_slice] = array
+
+    return padded, original_area_slice
+
+
+def _set_pad_area(padded, axis, width_pair, value_pair):
+    """
+    Set empty-padded area in given dimension.
+
+    Parameters
+    ----------
+    padded : ndarray
+        Array with the pad area which is modified inplace.
+    axis : int
+        Dimension with the pad area to set.
+    width_pair : (int, int)
+        Pair of widths that mark the pad area on both sides in the given
+        dimension.
+    value_pair : tuple of scalars or ndarrays
+        Values inserted into the pad area on each side. It must match or be
+        broadcastable to the shape of `arr`.
+    """
+    left_slice = _slice_at_axis(slice(None, width_pair[0]), axis)
+    padded[left_slice] = value_pair[0]
+
+    right_slice = _slice_at_axis(
+        slice(padded.shape[axis] - width_pair[1], None), axis)
+    padded[right_slice] = value_pair[1]
+
+
+def _get_edges(padded, axis, width_pair):
+    """
+    Retrieve edge values from empty-padded array in given dimension.
+
+    Parameters
+    ----------
+    padded : ndarray
+        Empty-padded array.
+    axis : int
+        Dimension in which the edges are considered.
+    width_pair : (int, int)
+        Pair of widths that mark the pad area on both sides in the given
+        dimension.
+
+    Returns
+    -------
+    left_edge, right_edge : ndarray
+        Edge values of the valid area in `padded` in the given dimension. Its
+        shape will always match `padded` except for the dimension given by
+        `axis` which will have a length of 1.
+    """
+    left_index = width_pair[0]
+    left_slice = _slice_at_axis(slice(left_index, left_index + 1), axis)
+    left_edge = padded[left_slice]
+
+    right_index = padded.shape[axis] - width_pair[1]
+    right_slice = _slice_at_axis(slice(right_index - 1, right_index), axis)
+    right_edge = padded[right_slice]
+
+    return left_edge, right_edge
+
+
+def _get_linear_ramps(padded, axis, width_pair, end_value_pair):
+    """
+    Construct linear ramps for empty-padded array in given dimension.
+
+    Parameters
+    ----------
+    padded : ndarray
+        Empty-padded array.
+    axis : int
+        Dimension in which the ramps are constructed.
+    width_pair : (int, int)
+        Pair of widths that mark the pad area on both sides in the given
+        dimension.
+    end_value_pair : (scalar, scalar)
+        End values for the linear ramps which form the edge of the fully padded
+        array. These values are included in the linear ramps.
+
+    Returns
+    -------
+    left_ramp, right_ramp : ndarray
+        Linear ramps to set on both sides of `padded`.
+    """
+    edge_pair = _get_edges(padded, axis, width_pair)
+
+    left_ramp, right_ramp = (
+        np.linspace(
+            start=end_value,
+            stop=edge.squeeze(axis),  # Dimension is replaced by linspace
+            num=width,
+            endpoint=False,
+            dtype=padded.dtype,
+            axis=axis
+        )
+        for end_value, edge, width in zip(
+            end_value_pair, edge_pair, width_pair
+        )
+    )
+
+    # Reverse linear space in appropriate dimension
+    right_ramp = right_ramp[_slice_at_axis(slice(None, None, -1), axis)]
+
+    return left_ramp, right_ramp
+
+
+def _get_stats(padded, axis, width_pair, length_pair, stat_func):
+    """
+    Calculate statistic for the empty-padded array in given dimension.
+
+    Parameters
+    ----------
+    padded : ndarray
+        Empty-padded array.
+    axis : int
+        Dimension in which the statistic is calculated.
+    width_pair : (int, int)
+        Pair of widths that mark the pad area on both sides in the given
+        dimension.
+    length_pair : 2-element sequence of None or int
+        Gives the number of values in valid area from each side that is
+        taken into account when calculating the statistic. If None the entire
+        valid area in `padded` is considered.
+    stat_func : function
+        Function to compute statistic. The expected signature is
+        ``stat_func(x: ndarray, axis: int, keepdims: bool) -> ndarray``.
+
+    Returns
+    -------
+    left_stat, right_stat : ndarray
+        Calculated statistic for both sides of `padded`.
+    """
+    # Calculate indices of the edges of the area with original values
+    left_index = width_pair[0]
+    right_index = padded.shape[axis] - width_pair[1]
+    # as well as its length
+    max_length = right_index - left_index
+
+    # Limit stat_lengths to max_length
+    left_length, right_length = length_pair
+    if left_length is None or max_length < left_length:
+        left_length = max_length
+    if right_length is None or max_length < right_length:
+        right_length = max_length
+
+    if (left_length == 0 or right_length == 0) \
+            and stat_func in {np.amax, np.amin}:
+        # amax and amin can't operate on an empty array,
+        # raise a more descriptive warning here instead of the default one
+        raise ValueError("stat_length of 0 yields no value for padding")
+
+    # Calculate statistic for the left side
+    left_slice = _slice_at_axis(
+        slice(left_index, left_index + left_length), axis)
+    left_chunk = padded[left_slice]
+    left_stat = stat_func(left_chunk, axis=axis, keepdims=True)
+    _round_if_needed(left_stat, padded.dtype)
+
+    if left_length == right_length == max_length:
+        # return early as right_stat must be identical to left_stat
+        return left_stat, left_stat
+
+    # Calculate statistic for the right side
+    right_slice = _slice_at_axis(
+        slice(right_index - right_length, right_index), axis)
+    right_chunk = padded[right_slice]
+    right_stat = stat_func(right_chunk, axis=axis, keepdims=True)
+    _round_if_needed(right_stat, padded.dtype)
+
+    return left_stat, right_stat
+
+
+def _set_reflect_both(padded, axis, width_pair, method,
+                      original_period, include_edge=False):
+    """
+    Pad `axis` of `arr` with reflection.
+
+    Parameters
+    ----------
+    padded : ndarray
+        Input array of arbitrary shape.
+    axis : int
+        Axis along which to pad `arr`.
+    width_pair : (int, int)
+        Pair of widths that mark the pad area on both sides in the given
+        dimension.
+    method : str
+        Controls method of reflection; options are 'even' or 'odd'.
+    original_period : int
+        Original length of data on `axis` of `arr`.
+    include_edge : bool
+        If true, edge value is included in reflection, otherwise the edge
+        value forms the symmetric axis to the reflection.
+
+    Returns
+    -------
+    pad_amt : tuple of ints, length 2
+        New index positions of padding to do along the `axis`. If these are
+        both 0, padding is done in this dimension.
+    """
+    left_pad, right_pad = width_pair
+    old_length = padded.shape[axis] - right_pad - left_pad
+
+    if include_edge:
+        # Avoid wrapping with only a subset of the original area
+        # by ensuring period can only be a multiple of the original
+        # area's length.
+        old_length = old_length // original_period * original_period
+        # Edge is included, we need to offset the pad amount by 1
+        edge_offset = 1
+    else:
+        # Avoid wrapping with only a subset of the original area
+        # by ensuring period can only be a multiple of the original
+        # area's length.
+        old_length = ((old_length - 1) // (original_period - 1)
+            * (original_period - 1) + 1)
+        edge_offset = 0  # Edge is not included, no need to offset pad amount
+        old_length -= 1  # but must be omitted from the chunk
+
+    if left_pad > 0:
+        # Pad with reflected values on left side:
+        # First limit chunk size which can't be larger than pad area
+        chunk_length = min(old_length, left_pad)
+        # Slice right to left, stop on or next to edge, start relative to stop
+        stop = left_pad - edge_offset
+        start = stop + chunk_length
+        left_slice = _slice_at_axis(slice(start, stop, -1), axis)
+        left_chunk = padded[left_slice]
+
+        if method == "odd":
+            # Negate chunk and align with edge
+            edge_slice = _slice_at_axis(slice(left_pad, left_pad + 1), axis)
+            left_chunk = 2 * padded[edge_slice] - left_chunk
+
+        # Insert chunk into padded area
+        start = left_pad - chunk_length
+        stop = left_pad
+        pad_area = _slice_at_axis(slice(start, stop), axis)
+        padded[pad_area] = left_chunk
+        # Adjust pointer to left edge for next iteration
+        left_pad -= chunk_length
+
+    if right_pad > 0:
+        # Pad with reflected values on right side:
+        # First limit chunk size which can't be larger than pad area
+        chunk_length = min(old_length, right_pad)
+        # Slice right to left, start on or next to edge, stop relative to start
+        start = -right_pad + edge_offset - 2
+        stop = start - chunk_length
+        right_slice = _slice_at_axis(slice(start, stop, -1), axis)
+        right_chunk = padded[right_slice]
+
+        if method == "odd":
+            # Negate chunk and align with edge
+            edge_slice = _slice_at_axis(
+                slice(-right_pad - 1, -right_pad), axis)
+            right_chunk = 2 * padded[edge_slice] - right_chunk
+
+        # Insert chunk into padded area
+        start = padded.shape[axis] - right_pad
+        stop = start + chunk_length
+        pad_area = _slice_at_axis(slice(start, stop), axis)
+        padded[pad_area] = right_chunk
+        # Adjust pointer to right edge for next iteration
+        right_pad -= chunk_length
+
+    return left_pad, right_pad
+
+
+def _set_wrap_both(padded, axis, width_pair, original_period):
+    """
+    Pad `axis` of `arr` with wrapped values.
+
+    Parameters
+    ----------
+    padded : ndarray
+        Input array of arbitrary shape.
+    axis : int
+        Axis along which to pad `arr`.
+    width_pair : (int, int)
+        Pair of widths that mark the pad area on both sides in the given
+        dimension.
+    original_period : int
+        Original length of data on `axis` of `arr`.
+
+    Returns
+    -------
+    pad_amt : tuple of ints, length 2
+        New index positions of padding to do along the `axis`. If these are
+        both 0, padding is done in this dimension.
+    """
+    left_pad, right_pad = width_pair
+    period = padded.shape[axis] - right_pad - left_pad
+    # Avoid wrapping with only a subset of the original area by ensuring period
+    # can only be a multiple of the original area's length.
+    period = period // original_period * original_period
+
+    # If the current dimension of `arr` doesn't contain enough valid values
+    # (not part of the undefined pad area) we need to pad multiple times.
+    # Each time the pad area shrinks on both sides which is communicated with
+    # these variables.
+    new_left_pad = 0
+    new_right_pad = 0
+
+    if left_pad > 0:
+        # Pad with wrapped values on left side
+        # First slice chunk from left side of the non-pad area.
+        # Use min(period, left_pad) to ensure that chunk is not larger than
+        # pad area.
+        slice_end = left_pad + period
+        slice_start = slice_end - min(period, left_pad)
+        right_slice = _slice_at_axis(slice(slice_start, slice_end), axis)
+        right_chunk = padded[right_slice]
+
+        if left_pad > period:
+            # Chunk is smaller than pad area
+            pad_area = _slice_at_axis(slice(left_pad - period, left_pad), axis)
+            new_left_pad = left_pad - period
+        else:
+            # Chunk matches pad area
+            pad_area = _slice_at_axis(slice(None, left_pad), axis)
+        padded[pad_area] = right_chunk
+
+    if right_pad > 0:
+        # Pad with wrapped values on right side
+        # First slice chunk from right side of the non-pad area.
+        # Use min(period, right_pad) to ensure that chunk is not larger than
+        # pad area.
+        slice_start = -right_pad - period
+        slice_end = slice_start + min(period, right_pad)
+        left_slice = _slice_at_axis(slice(slice_start, slice_end), axis)
+        left_chunk = padded[left_slice]
+
+        if right_pad > period:
+            # Chunk is smaller than pad area
+            pad_area = _slice_at_axis(
+                slice(-right_pad, -right_pad + period), axis)
+            new_right_pad = right_pad - period
+        else:
+            # Chunk matches pad area
+            pad_area = _slice_at_axis(slice(-right_pad, None), axis)
+        padded[pad_area] = left_chunk
+
+    return new_left_pad, new_right_pad
+
+
+def _as_pairs(x, ndim, as_index=False):
+    """
+    Broadcast `x` to an array with the shape (`ndim`, 2).
+
+    A helper function for `pad` that prepares and validates arguments like
+    `pad_width` for iteration in pairs.
+
+    Parameters
+    ----------
+    x : {None, scalar, array-like}
+        The object to broadcast to the shape (`ndim`, 2).
+    ndim : int
+        Number of pairs the broadcasted `x` will have.
+    as_index : bool, optional
+        If `x` is not None, try to round each element of `x` to an integer
+        (dtype `np.intp`) and ensure every element is positive.
+
+    Returns
+    -------
+    pairs : nested iterables, shape (`ndim`, 2)
+        The broadcasted version of `x`.
+
+    Raises
+    ------
+    ValueError
+        If `as_index` is True and `x` contains negative elements.
+        Or if `x` is not broadcastable to the shape (`ndim`, 2).
+    """
+    if x is None:
+        # Pass through None as a special case, otherwise np.round(x) fails
+        # with an AttributeError
+        return ((None, None),) * ndim
+
+    x = np.array(x)
+    if as_index:
+        x = np.round(x).astype(np.intp, copy=False)
+
+    if x.ndim < 3:
+        # Optimization: Possibly use faster paths for cases where `x` has
+        # only 1 or 2 elements. `np.broadcast_to` could handle these as well
+        # but is currently slower
+
+        if x.size == 1:
+            # x was supplied as a single value
+            x = x.ravel()  # Ensure x[0] works for x.ndim == 0, 1, 2
+            if as_index and x < 0:
+                raise ValueError("index can't contain negative values")
+            return ((x[0], x[0]),) * ndim
+
+        if x.size == 2 and x.shape != (2, 1):
+            # x was supplied with a single value for each side
+            # but except case when each dimension has a single value
+            # which should be broadcasted to a pair,
+            # e.g. [[1], [2]] -> [[1, 1], [2, 2]] not [[1, 2], [1, 2]]
+            x = x.ravel()  # Ensure x[0], x[1] works
+            if as_index and (x[0] < 0 or x[1] < 0):
+                raise ValueError("index can't contain negative values")
+            return ((x[0], x[1]),) * ndim
+
+    if as_index and x.min() < 0:
+        raise ValueError("index can't contain negative values")
+
+    # Converting the array with `tolist` seems to improve performance
+    # when iterating and indexing the result (see usage in `pad`)
+    return np.broadcast_to(x, (ndim, 2)).tolist()
+
+
+def _pad_dispatcher(array, pad_width, mode=None, **kwargs):
+    return (array,)
+
+
+###############################################################################
+# Public functions
+
+
+@array_function_dispatch(_pad_dispatcher, module='numpy')
+def pad(array, pad_width, mode='constant', **kwargs):
+    """
+    Pad an array.
+
+    Parameters
+    ----------
+    array : array_like of rank N
+        The array to pad.
+    pad_width : {sequence, array_like, int}
+        Number of values padded to the edges of each axis.
+        ``((before_1, after_1), ... (before_N, after_N))`` unique pad widths
+        for each axis.
+        ``(before, after)`` or ``((before, after),)`` yields same before
+        and after pad for each axis.
+        ``(pad,)`` or ``int`` is a shortcut for before = after = pad width
+        for all axes.
+    mode : str or function, optional
+        One of the following string values or a user supplied function.
+
+        'constant' (default)
+            Pads with a constant value.
+        'edge'
+            Pads with the edge values of array.
+        'linear_ramp'
+            Pads with the linear ramp between end_value and the
+            array edge value.
+        'maximum'
+            Pads with the maximum value of all or part of the
+            vector along each axis.
+        'mean'
+            Pads with the mean value of all or part of the
+            vector along each axis.
+        'median'
+            Pads with the median value of all or part of the
+            vector along each axis.
+        'minimum'
+            Pads with the minimum value of all or part of the
+            vector along each axis.
+        'reflect'
+            Pads with the reflection of the vector mirrored on
+            the first and last values of the vector along each
+            axis.
+        'symmetric'
+            Pads with the reflection of the vector mirrored
+            along the edge of the array.
+        'wrap'
+            Pads with the wrap of the vector along the axis.
+            The first values are used to pad the end and the
+            end values are used to pad the beginning.
+        'empty'
+            Pads with undefined values.
+
+        <function>
+            Padding function, see Notes.
+    stat_length : sequence or int, optional
+        Used in 'maximum', 'mean', 'median', and 'minimum'.  Number of
+        values at edge of each axis used to calculate the statistic value.
+
+        ``((before_1, after_1), ... (before_N, after_N))`` unique statistic
+        lengths for each axis.
+
+        ``(before, after)`` or ``((before, after),)`` yields same before
+        and after statistic lengths for each axis.
+
+        ``(stat_length,)`` or ``int`` is a shortcut for
+        ``before = after = statistic`` length for all axes.
+
+        Default is ``None``, to use the entire axis.
+    constant_values : sequence or scalar, optional
+        Used in 'constant'.  The values to set the padded values for each
+        axis.
+
+        ``((before_1, after_1), ... (before_N, after_N))`` unique pad constants
+        for each axis.
+
+        ``(before, after)`` or ``((before, after),)`` yields same before
+        and after constants for each axis.
+
+        ``(constant,)`` or ``constant`` is a shortcut for
+        ``before = after = constant`` for all axes.
+
+        Default is 0.
+    end_values : sequence or scalar, optional
+        Used in 'linear_ramp'.  The values used for the ending value of the
+        linear_ramp and that will form the edge of the padded array.
+
+        ``((before_1, after_1), ... (before_N, after_N))`` unique end values
+        for each axis.
+
+        ``(before, after)`` or ``((before, after),)`` yields same before
+        and after end values for each axis.
+
+        ``(constant,)`` or ``constant`` is a shortcut for
+        ``before = after = constant`` for all axes.
+
+        Default is 0.
+    reflect_type : {'even', 'odd'}, optional
+        Used in 'reflect', and 'symmetric'.  The 'even' style is the
+        default with an unaltered reflection around the edge value.  For
+        the 'odd' style, the extended part of the array is created by
+        subtracting the reflected values from two times the edge value.
+
+    Returns
+    -------
+    pad : ndarray
+        Padded array of rank equal to `array` with shape increased
+        according to `pad_width`.
+
+    Notes
+    -----
+    For an array with rank greater than 1, some of the padding of later
+    axes is calculated from padding of previous axes.  This is easiest to
+    think about with a rank 2 array where the corners of the padded array
+    are calculated by using padded values from the first axis.
+
+    The padding function, if used, should modify a rank 1 array in-place. It
+    has the following signature::
+
+        padding_func(vector, iaxis_pad_width, iaxis, kwargs)
+
+    where
+
+    vector : ndarray
+        A rank 1 array already padded with zeros.  Padded values are
+        vector[:iaxis_pad_width[0]] and vector[-iaxis_pad_width[1]:].
+    iaxis_pad_width : tuple
+        A 2-tuple of ints, iaxis_pad_width[0] represents the number of
+        values padded at the beginning of vector where
+        iaxis_pad_width[1] represents the number of values padded at
+        the end of vector.
+    iaxis : int
+        The axis currently being calculated.
+    kwargs : dict
+        Any keyword arguments the function requires.
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> a = [1, 2, 3, 4, 5]
+    >>> np.pad(a, (2, 3), 'constant', constant_values=(4, 6))
+    array([4, 4, 1, ..., 6, 6, 6])
+
+    >>> np.pad(a, (2, 3), 'edge')
+    array([1, 1, 1, ..., 5, 5, 5])
+
+    >>> np.pad(a, (2, 3), 'linear_ramp', end_values=(5, -4))
+    array([ 5,  3,  1,  2,  3,  4,  5,  2, -1, -4])
+
+    >>> np.pad(a, (2,), 'maximum')
+    array([5, 5, 1, 2, 3, 4, 5, 5, 5])
+
+    >>> np.pad(a, (2,), 'mean')
+    array([3, 3, 1, 2, 3, 4, 5, 3, 3])
+
+    >>> np.pad(a, (2,), 'median')
+    array([3, 3, 1, 2, 3, 4, 5, 3, 3])
+
+    >>> a = [[1, 2], [3, 4]]
+    >>> np.pad(a, ((3, 2), (2, 3)), 'minimum')
+    array([[1, 1, 1, 2, 1, 1, 1],
+           [1, 1, 1, 2, 1, 1, 1],
+           [1, 1, 1, 2, 1, 1, 1],
+           [1, 1, 1, 2, 1, 1, 1],
+           [3, 3, 3, 4, 3, 3, 3],
+           [1, 1, 1, 2, 1, 1, 1],
+           [1, 1, 1, 2, 1, 1, 1]])
+
+    >>> a = [1, 2, 3, 4, 5]
+    >>> np.pad(a, (2, 3), 'reflect')
+    array([3, 2, 1, 2, 3, 4, 5, 4, 3, 2])
+
+    >>> np.pad(a, (2, 3), 'reflect', reflect_type='odd')
+    array([-1,  0,  1,  2,  3,  4,  5,  6,  7,  8])
+
+    >>> np.pad(a, (2, 3), 'symmetric')
+    array([2, 1, 1, 2, 3, 4, 5, 5, 4, 3])
+
+    >>> np.pad(a, (2, 3), 'symmetric', reflect_type='odd')
+    array([0, 1, 1, 2, 3, 4, 5, 5, 6, 7])
+
+    >>> np.pad(a, (2, 3), 'wrap')
+    array([4, 5, 1, 2, 3, 4, 5, 1, 2, 3])
+
+    >>> def pad_with(vector, pad_width, iaxis, kwargs):
+    ...     pad_value = kwargs.get('padder', 10)
+    ...     vector[:pad_width[0]] = pad_value
+    ...     vector[-pad_width[1]:] = pad_value
+    >>> a = np.arange(6)
+    >>> a = a.reshape((2, 3))
+    >>> np.pad(a, 2, pad_with)
+    array([[10, 10, 10, 10, 10, 10, 10],
+           [10, 10, 10, 10, 10, 10, 10],
+           [10, 10,  0,  1,  2, 10, 10],
+           [10, 10,  3,  4,  5, 10, 10],
+           [10, 10, 10, 10, 10, 10, 10],
+           [10, 10, 10, 10, 10, 10, 10]])
+    >>> np.pad(a, 2, pad_with, padder=100)
+    array([[100, 100, 100, 100, 100, 100, 100],
+           [100, 100, 100, 100, 100, 100, 100],
+           [100, 100,   0,   1,   2, 100, 100],
+           [100, 100,   3,   4,   5, 100, 100],
+           [100, 100, 100, 100, 100, 100, 100],
+           [100, 100, 100, 100, 100, 100, 100]])
+    """
+    array = np.asarray(array)
+    pad_width = np.asarray(pad_width)
+
+    if not pad_width.dtype.kind == 'i':
+        raise TypeError('`pad_width` must be of integral type.')
+
+    # Broadcast to shape (array.ndim, 2)
+    pad_width = _as_pairs(pad_width, array.ndim, as_index=True)
+
+    if callable(mode):
+        # Old behavior: Use user-supplied function with np.apply_along_axis
+        function = mode
+        # Create a new zero padded array
+        padded, _ = _pad_simple(array, pad_width, fill_value=0)
+        # And apply along each axis
+
+        for axis in range(padded.ndim):
+            # Iterate using ndindex as in apply_along_axis, but assuming that
+            # function operates inplace on the padded array.
+
+            # view with the iteration axis at the end
+            view = np.moveaxis(padded, axis, -1)
+
+            # compute indices for the iteration axes, and append a trailing
+            # ellipsis to prevent 0d arrays decaying to scalars (gh-8642)
+            inds = ndindex(view.shape[:-1])
+            inds = (ind + (Ellipsis,) for ind in inds)
+            for ind in inds:
+                function(view[ind], pad_width[axis], axis, kwargs)
+
+        return padded
+
+    # Make sure that no unsupported keywords were passed for the current mode
+    allowed_kwargs = {
+        'empty': [], 'edge': [], 'wrap': [],
+        'constant': ['constant_values'],
+        'linear_ramp': ['end_values'],
+        'maximum': ['stat_length'],
+        'mean': ['stat_length'],
+        'median': ['stat_length'],
+        'minimum': ['stat_length'],
+        'reflect': ['reflect_type'],
+        'symmetric': ['reflect_type'],
+    }
+    try:
+        unsupported_kwargs = set(kwargs) - set(allowed_kwargs[mode])
+    except KeyError:
+        raise ValueError(f"mode '{mode}' is not supported") from None
+    if unsupported_kwargs:
+        raise ValueError("unsupported keyword arguments for mode "
+                         f"'{mode}': {unsupported_kwargs}")
+
+    stat_functions = {"maximum": np.amax, "minimum": np.amin,
+                      "mean": np.mean, "median": np.median}
+
+    # Create array with final shape and original values
+    # (padded area is undefined)
+    padded, original_area_slice = _pad_simple(array, pad_width)
+    # And prepare iteration over all dimensions
+    # (zipping may be more readable than using enumerate)
+    axes = range(padded.ndim)
+
+    if mode == "constant":
+        values = kwargs.get("constant_values", 0)
+        values = _as_pairs(values, padded.ndim)
+        for axis, width_pair, value_pair in zip(axes, pad_width, values):
+            roi = _view_roi(padded, original_area_slice, axis)
+            _set_pad_area(roi, axis, width_pair, value_pair)
+
+    elif mode == "empty":
+        pass  # Do nothing as _pad_simple already returned the correct result
+
+    elif array.size == 0:
+        # Only modes "constant" and "empty" can extend empty axes, all other
+        # modes depend on `array` not being empty
+        # -> ensure every empty axis is only "padded with 0"
+        for axis, width_pair in zip(axes, pad_width):
+            if array.shape[axis] == 0 and any(width_pair):
+                raise ValueError(
+                    f"can't extend empty axis {axis} using modes other than "
+                    "'constant' or 'empty'"
+                )
+        # passed, don't need to do anything more as _pad_simple already
+        # returned the correct result
+
+    elif mode == "edge":
+        for axis, width_pair in zip(axes, pad_width):
+            roi = _view_roi(padded, original_area_slice, axis)
+            edge_pair = _get_edges(roi, axis, width_pair)
+            _set_pad_area(roi, axis, width_pair, edge_pair)
+
+    elif mode == "linear_ramp":
+        end_values = kwargs.get("end_values", 0)
+        end_values = _as_pairs(end_values, padded.ndim)
+        for axis, width_pair, value_pair in zip(axes, pad_width, end_values):
+            roi = _view_roi(padded, original_area_slice, axis)
+            ramp_pair = _get_linear_ramps(roi, axis, width_pair, value_pair)
+            _set_pad_area(roi, axis, width_pair, ramp_pair)
+
+    elif mode in stat_functions:
+        func = stat_functions[mode]
+        length = kwargs.get("stat_length")
+        length = _as_pairs(length, padded.ndim, as_index=True)
+        for axis, width_pair, length_pair in zip(axes, pad_width, length):
+            roi = _view_roi(padded, original_area_slice, axis)
+            stat_pair = _get_stats(roi, axis, width_pair, length_pair, func)
+            _set_pad_area(roi, axis, width_pair, stat_pair)
+
+    elif mode in {"reflect", "symmetric"}:
+        method = kwargs.get("reflect_type", "even")
+        include_edge = mode == "symmetric"
+        for axis, (left_index, right_index) in zip(axes, pad_width):
+            if array.shape[axis] == 1 and (left_index > 0 or right_index > 0):
+                # Extending singleton dimension for 'reflect' is legacy
+                # behavior; it really should raise an error.
+                edge_pair = _get_edges(padded, axis, (left_index, right_index))
+                _set_pad_area(
+                    padded, axis, (left_index, right_index), edge_pair)
+                continue
+
+            roi = _view_roi(padded, original_area_slice, axis)
+            while left_index > 0 or right_index > 0:
+                # Iteratively pad until dimension is filled with reflected
+                # values. This is necessary if the pad area is larger than
+                # the length of the original values in the current dimension.
+                left_index, right_index = _set_reflect_both(
+                    roi, axis, (left_index, right_index),
+                    method, array.shape[axis], include_edge
+                )
+
+    elif mode == "wrap":
+        for axis, (left_index, right_index) in zip(axes, pad_width):
+            roi = _view_roi(padded, original_area_slice, axis)
+            original_period = padded.shape[axis] - right_index - left_index
+            while left_index > 0 or right_index > 0:
+                # Iteratively pad until dimension is filled with wrapped
+                # values. This is necessary if the pad area is larger than
+                # the length of the original values in the current dimension.
+                left_index, right_index = _set_wrap_both(
+                    roi, axis, (left_index, right_index), original_period)
+
+    return padded

lib/python3.11/site-packages/numpy/lib/_arraypad_impl.pyi

@@ -0,0 +1,89 @@
+from typing import (
+    Any,
+    Protocol,
+    TypeAlias,
+    TypeVar,
+    overload,
+    type_check_only,
+)
+from typing import (
+    Literal as L,
+)
+
+from numpy import generic
+from numpy._typing import (
+    ArrayLike,
+    NDArray,
+    _ArrayLike,
+    _ArrayLikeInt,
+)
+
+__all__ = ["pad"]
+
+_ScalarT = TypeVar("_ScalarT", bound=generic)
+
+@type_check_only
+class _ModeFunc(Protocol):
+    def __call__(
+        self,
+        vector: NDArray[Any],
+        iaxis_pad_width: tuple[int, int],
+        iaxis: int,
+        kwargs: dict[str, Any],
+        /,
+    ) -> None: ...
+
+_ModeKind: TypeAlias = L[
+    "constant",
+    "edge",
+    "linear_ramp",
+    "maximum",
+    "mean",
+    "median",
+    "minimum",
+    "reflect",
+    "symmetric",
+    "wrap",
+    "empty",
+]
+
+# TODO: In practice each keyword argument is exclusive to one or more
+# specific modes. Consider adding more overloads to express this in the future.
+
+# Expand `**kwargs` into explicit keyword-only arguments
+@overload
+def pad(
+    array: _ArrayLike[_ScalarT],
+    pad_width: _ArrayLikeInt,
+    mode: _ModeKind = ...,
+    *,
+    stat_length: _ArrayLikeInt | None = ...,
+    constant_values: ArrayLike = ...,
+    end_values: ArrayLike = ...,
+    reflect_type: L["odd", "even"] = ...,
+) -> NDArray[_ScalarT]: ...
+@overload
+def pad(
+    array: ArrayLike,
+    pad_width: _ArrayLikeInt,
+    mode: _ModeKind = ...,
+    *,
+    stat_length: _ArrayLikeInt | None = ...,
+    constant_values: ArrayLike = ...,
+    end_values: ArrayLike = ...,
+    reflect_type: L["odd", "even"] = ...,
+) -> NDArray[Any]: ...
+@overload
+def pad(
+    array: _ArrayLike[_ScalarT],
+    pad_width: _ArrayLikeInt,
+    mode: _ModeFunc,
+    **kwargs: Any,
+) -> NDArray[_ScalarT]: ...
+@overload
+def pad(
+    array: ArrayLike,
+    pad_width: _ArrayLikeInt,
+    mode: _ModeFunc,
+    **kwargs: Any,
+) -> NDArray[Any]: ...

lib/python3.11/site-packages/numpy/lib/_arraysetops_impl.pyi

@@ -0,0 +1,444 @@
+from typing import Any, Generic, NamedTuple, SupportsIndex, TypeAlias, overload
+from typing import Literal as L
+
+from typing_extensions import TypeVar, deprecated
+
+import numpy as np
+from numpy._typing import (
+    ArrayLike,
+    NDArray,
+    _ArrayLike,
+    _ArrayLikeBool_co,
+    _ArrayLikeNumber_co,
+)
+
+__all__ = [
+    "ediff1d",
+    "in1d",
+    "intersect1d",
+    "isin",
+    "setdiff1d",
+    "setxor1d",
+    "union1d",
+    "unique",
+    "unique_all",
+    "unique_counts",
+    "unique_inverse",
+    "unique_values",
+]
+
+_ScalarT = TypeVar("_ScalarT", bound=np.generic)
+_NumericT = TypeVar("_NumericT", bound=np.number | np.timedelta64 | np.object_)
+
+# Explicitly set all allowed values to prevent accidental castings to
+# abstract dtypes (their common super-type).
+# Only relevant if two or more arguments are parametrized, (e.g. `setdiff1d`)
+# which could result in, for example, `int64` and `float64`producing a
+# `number[_64Bit]` array
+_EitherSCT = TypeVar(
+    "_EitherSCT",
+    np.bool,
+    np.int8, np.int16, np.int32, np.int64, np.intp,
+    np.uint8, np.uint16, np.uint32, np.uint64, np.uintp,
+    np.float16, np.float32, np.float64, np.longdouble,
+    np.complex64, np.complex128, np.clongdouble,
+    np.timedelta64, np.datetime64,
+    np.bytes_, np.str_, np.void, np.object_,
+    np.integer, np.floating, np.complexfloating, np.character,
+)  # fmt: skip
+
+_AnyArray: TypeAlias = NDArray[Any]
+_IntArray: TypeAlias = NDArray[np.intp]
+
+###
+
+class UniqueAllResult(NamedTuple, Generic[_ScalarT]):
+    values: NDArray[_ScalarT]
+    indices: _IntArray
+    inverse_indices: _IntArray
+    counts: _IntArray
+
+class UniqueCountsResult(NamedTuple, Generic[_ScalarT]):
+    values: NDArray[_ScalarT]
+    counts: _IntArray
+
+class UniqueInverseResult(NamedTuple, Generic[_ScalarT]):
+    values: NDArray[_ScalarT]
+    inverse_indices: _IntArray
+
+#
+@overload
+def ediff1d(
+    ary: _ArrayLikeBool_co,
+    to_end: ArrayLike | None = None,
+    to_begin: ArrayLike | None = None,
+) -> NDArray[np.int8]: ...
+@overload
+def ediff1d(
+    ary: _ArrayLike[_NumericT],
+    to_end: ArrayLike | None = None,
+    to_begin: ArrayLike | None = None,
+) -> NDArray[_NumericT]: ...
+@overload
+def ediff1d(
+    ary: _ArrayLike[np.datetime64[Any]],
+    to_end: ArrayLike | None = None,
+    to_begin: ArrayLike | None = None,
+) -> NDArray[np.timedelta64]: ...
+@overload
+def ediff1d(
+    ary: _ArrayLikeNumber_co,
+    to_end: ArrayLike | None = None,
+    to_begin: ArrayLike | None = None,
+) -> _AnyArray: ...
+
+#
+@overload  # known scalar-type, FFF
+def unique(
+    ar: _ArrayLike[_ScalarT],
+    return_index: L[False] = False,
+    return_inverse: L[False] = False,
+    return_counts: L[False] = False,
+    axis: SupportsIndex | None = None,
+    *,
+    equal_nan: bool = True,
+) -> NDArray[_ScalarT]: ...
+@overload  # unknown scalar-type, FFF
+def unique(
+    ar: ArrayLike,
+    return_index: L[False] = False,
+    return_inverse: L[False] = False,
+    return_counts: L[False] = False,
+    axis: SupportsIndex | None = None,
+    *,
+    equal_nan: bool = True,
+) -> _AnyArray: ...
+@overload  # known scalar-type, TFF
+def unique(
+    ar: _ArrayLike[_ScalarT],
+    return_index: L[True],
+    return_inverse: L[False] = False,
+    return_counts: L[False] = False,
+    axis: SupportsIndex | None = None,
+    *,
+    equal_nan: bool = True,
+) -> tuple[NDArray[_ScalarT], _IntArray]: ...
+@overload  # unknown scalar-type, TFF
+def unique(
+    ar: ArrayLike,
+    return_index: L[True],
+    return_inverse: L[False] = False,
+    return_counts: L[False] = False,
+    axis: SupportsIndex | None = None,
+    *,
+    equal_nan: bool = True,
+) -> tuple[_AnyArray, _IntArray]: ...
+@overload  # known scalar-type, FTF (positional)
+def unique(
+    ar: _ArrayLike[_ScalarT],
+    return_index: L[False],
+    return_inverse: L[True],
+    return_counts: L[False] = False,
+    axis: SupportsIndex | None = None,
+    *,
+    equal_nan: bool = True,
+) -> tuple[NDArray[_ScalarT], _IntArray]: ...
+@overload  # known scalar-type, FTF (keyword)
+def unique(
+    ar: _ArrayLike[_ScalarT],
+    return_index: L[False] = False,
+    *,
+    return_inverse: L[True],
+    return_counts: L[False] = False,
+    axis: SupportsIndex | None = None,
+    equal_nan: bool = True,
+) -> tuple[NDArray[_ScalarT], _IntArray]: ...
+@overload  # unknown scalar-type, FTF (positional)
+def unique(
+    ar: ArrayLike,
+    return_index: L[False],
+    return_inverse: L[True],
+    return_counts: L[False] = False,
+    axis: SupportsIndex | None = None,
+    *,
+    equal_nan: bool = True,
+) -> tuple[_AnyArray, _IntArray]: ...
+@overload  # unknown scalar-type, FTF (keyword)
+def unique(
+    ar: ArrayLike,
+    return_index: L[False] = False,
+    *,
+    return_inverse: L[True],
+    return_counts: L[False] = False,
+    axis: SupportsIndex | None = None,
+    equal_nan: bool = True,
+) -> tuple[_AnyArray, _IntArray]: ...
+@overload  # known scalar-type, FFT (positional)
+def unique(
+    ar: _ArrayLike[_ScalarT],
+    return_index: L[False],
+    return_inverse: L[False],
+    return_counts: L[True],
+    axis: SupportsIndex | None = None,
+    *,
+    equal_nan: bool = True,
+) -> tuple[NDArray[_ScalarT], _IntArray]: ...
+@overload  # known scalar-type, FFT (keyword)
+def unique(
+    ar: _ArrayLike[_ScalarT],
+    return_index: L[False] = False,
+    return_inverse: L[False] = False,
+    *,
+    return_counts: L[True],
+    axis: SupportsIndex | None = None,
+    equal_nan: bool = True,
+) -> tuple[NDArray[_ScalarT], _IntArray]: ...
+@overload  # unknown scalar-type, FFT (positional)
+def unique(
+    ar: ArrayLike,
+    return_index: L[False],
+    return_inverse: L[False],
+    return_counts: L[True],
+    axis: SupportsIndex | None = None,
+    *,
+    equal_nan: bool = True,
+) -> tuple[_AnyArray, _IntArray]: ...
+@overload  # unknown scalar-type, FFT (keyword)
+def unique(
+    ar: ArrayLike,
+    return_index: L[False] = False,
+    return_inverse: L[False] = False,
+    *,
+    return_counts: L[True],
+    axis: SupportsIndex | None = None,
+    equal_nan: bool = True,
+) -> tuple[_AnyArray, _IntArray]: ...
+@overload  # known scalar-type, TTF
+def unique(
+    ar: _ArrayLike[_ScalarT],
+    return_index: L[True],
+    return_inverse: L[True],
+    return_counts: L[False] = False,
+    axis: SupportsIndex | None = None,
+    *,
+    equal_nan: bool = True,
+) -> tuple[NDArray[_ScalarT], _IntArray, _IntArray]: ...
+@overload  # unknown scalar-type, TTF
+def unique(
+    ar: ArrayLike,
+    return_index: L[True],
+    return_inverse: L[True],
+    return_counts: L[False] = False,
+    axis: SupportsIndex | None = None,
+    *,
+    equal_nan: bool = True,
+) -> tuple[_AnyArray, _IntArray, _IntArray]: ...
+@overload  # known scalar-type, TFT (positional)
+def unique(
+    ar: _ArrayLike[_ScalarT],
+    return_index: L[True],
+    return_inverse: L[False],
+    return_counts: L[True],
+    axis: SupportsIndex | None = None,
+    *,
+    equal_nan: bool = True,
+) -> tuple[NDArray[_ScalarT], _IntArray, _IntArray]: ...
+@overload  # known scalar-type, TFT (keyword)
+def unique(
+    ar: _ArrayLike[_ScalarT],
+    return_index: L[True],
+    return_inverse: L[False] = False,
+    *,
+    return_counts: L[True],
+    axis: SupportsIndex | None = None,
+    equal_nan: bool = True,
+) -> tuple[NDArray[_ScalarT], _IntArray, _IntArray]: ...
+@overload  # unknown scalar-type, TFT (positional)
+def unique(
+    ar: ArrayLike,
+    return_index: L[True],
+    return_inverse: L[False],
+    return_counts: L[True],
+    axis: SupportsIndex | None = None,
+    *,
+    equal_nan: bool = True,
+) -> tuple[_AnyArray, _IntArray, _IntArray]: ...
+@overload  # unknown scalar-type, TFT (keyword)
+def unique(
+    ar: ArrayLike,
+    return_index: L[True],
+    return_inverse: L[False] = False,
+    *,
+    return_counts: L[True],
+    axis: SupportsIndex | None = None,
+    equal_nan: bool = True,
+) -> tuple[_AnyArray, _IntArray, _IntArray]: ...
+@overload  # known scalar-type, FTT (positional)
+def unique(
+    ar: _ArrayLike[_ScalarT],
+    return_index: L[False],
+    return_inverse: L[True],
+    return_counts: L[True],
+    axis: SupportsIndex | None = None,
+    *,
+    equal_nan: bool = True,
+) -> tuple[NDArray[_ScalarT], _IntArray, _IntArray]: ...
+@overload  # known scalar-type, FTT (keyword)
+def unique(
+    ar: _ArrayLike[_ScalarT],
+    return_index: L[False] = False,
+    *,
+    return_inverse: L[True],
+    return_counts: L[True],
+    axis: SupportsIndex | None = None,
+    equal_nan: bool = True,
+) -> tuple[NDArray[_ScalarT], _IntArray, _IntArray]: ...
+@overload  # unknown scalar-type, FTT (positional)
+def unique(
+    ar: ArrayLike,
+    return_index: L[False],
+    return_inverse: L[True],
+    return_counts: L[True],
+    axis: SupportsIndex | None = None,
+    *,
+    equal_nan: bool = True,
+) -> tuple[_AnyArray, _IntArray, _IntArray]: ...
+@overload  # unknown scalar-type, FTT (keyword)
+def unique(
+    ar: ArrayLike,
+    return_index: L[False] = False,
+    *,
+    return_inverse: L[True],
+    return_counts: L[True],
+    axis: SupportsIndex | None = None,
+    equal_nan: bool = True,
+) -> tuple[_AnyArray, _IntArray, _IntArray]: ...
+@overload  # known scalar-type, TTT
+def unique(
+    ar: _ArrayLike[_ScalarT],
+    return_index: L[True],
+    return_inverse: L[True],
+    return_counts: L[True],
+    axis: SupportsIndex | None = None,
+    *,
+    equal_nan: bool = True,
+) -> tuple[NDArray[_ScalarT], _IntArray, _IntArray, _IntArray]: ...
+@overload  # unknown scalar-type, TTT
+def unique(
+    ar: ArrayLike,
+    return_index: L[True],
+    return_inverse: L[True],
+    return_counts: L[True],
+    axis: SupportsIndex | None = None,
+    *,
+    equal_nan: bool = True,
+) -> tuple[_AnyArray, _IntArray, _IntArray, _IntArray]: ...
+
+#
+@overload
+def unique_all(x: _ArrayLike[_ScalarT]) -> UniqueAllResult[_ScalarT]: ...
+@overload
+def unique_all(x: ArrayLike) -> UniqueAllResult[Any]: ...
+
+#
+@overload
+def unique_counts(x: _ArrayLike[_ScalarT]) -> UniqueCountsResult[_ScalarT]: ...
+@overload
+def unique_counts(x: ArrayLike) -> UniqueCountsResult[Any]: ...
+
+#
+@overload
+def unique_inverse(x: _ArrayLike[_ScalarT]) -> UniqueInverseResult[_ScalarT]: ...
+@overload
+def unique_inverse(x: ArrayLike) -> UniqueInverseResult[Any]: ...
+
+#
+@overload
+def unique_values(x: _ArrayLike[_ScalarT]) -> NDArray[_ScalarT]: ...
+@overload
+def unique_values(x: ArrayLike) -> _AnyArray: ...
+
+#
+@overload  # known scalar-type, return_indices=False (default)
+def intersect1d(
+    ar1: _ArrayLike[_EitherSCT],
+    ar2: _ArrayLike[_EitherSCT],
+    assume_unique: bool = False,
+    return_indices: L[False] = False,
+) -> NDArray[_EitherSCT]: ...
+@overload  # known scalar-type, return_indices=True (positional)
+def intersect1d(
+    ar1: _ArrayLike[_EitherSCT],
+    ar2: _ArrayLike[_EitherSCT],
+    assume_unique: bool,
+    return_indices: L[True],
+) -> tuple[NDArray[_EitherSCT], _IntArray, _IntArray]: ...
+@overload  # known scalar-type, return_indices=True (keyword)
+def intersect1d(
+    ar1: _ArrayLike[_EitherSCT],
+    ar2: _ArrayLike[_EitherSCT],
+    assume_unique: bool = False,
+    *,
+    return_indices: L[True],
+) -> tuple[NDArray[_EitherSCT], _IntArray, _IntArray]: ...
+@overload  # unknown scalar-type, return_indices=False (default)
+def intersect1d(
+    ar1: ArrayLike,
+    ar2: ArrayLike,
+    assume_unique: bool = False,
+    return_indices: L[False] = False,
+) -> _AnyArray: ...
+@overload  # unknown scalar-type, return_indices=True (positional)
+def intersect1d(
+    ar1: ArrayLike,
+    ar2: ArrayLike,
+    assume_unique: bool,
+    return_indices: L[True],
+) -> tuple[_AnyArray, _IntArray, _IntArray]: ...
+@overload  # unknown scalar-type, return_indices=True (keyword)
+def intersect1d(
+    ar1: ArrayLike,
+    ar2: ArrayLike,
+    assume_unique: bool = False,
+    *,
+    return_indices: L[True],
+) -> tuple[_AnyArray, _IntArray, _IntArray]: ...
+
+#
+@overload
+def setxor1d(ar1: _ArrayLike[_EitherSCT], ar2: _ArrayLike[_EitherSCT], assume_unique: bool = False) -> NDArray[_EitherSCT]: ...
+@overload
+def setxor1d(ar1: ArrayLike, ar2: ArrayLike, assume_unique: bool = False) -> _AnyArray: ...
+
+#
+@overload
+def union1d(ar1: _ArrayLike[_EitherSCT], ar2: _ArrayLike[_EitherSCT]) -> NDArray[_EitherSCT]: ...
+@overload
+def union1d(ar1: ArrayLike, ar2: ArrayLike) -> _AnyArray: ...
+
+#
+@overload
+def setdiff1d(ar1: _ArrayLike[_EitherSCT], ar2: _ArrayLike[_EitherSCT], assume_unique: bool = False) -> NDArray[_EitherSCT]: ...
+@overload
+def setdiff1d(ar1: ArrayLike, ar2: ArrayLike, assume_unique: bool = False) -> _AnyArray: ...
+
+#
+def isin(
+    element: ArrayLike,
+    test_elements: ArrayLike,
+    assume_unique: bool = False,
+    invert: bool = False,
+    *,
+    kind: L["sort", "table"] | None = None,
+) -> NDArray[np.bool]: ...
+
+#
+@deprecated("Use 'isin' instead")
+def in1d(
+    element: ArrayLike,
+    test_elements: ArrayLike,
+    assume_unique: bool = False,
+    invert: bool = False,
+    *,
+    kind: L["sort", "table"] | None = None,
+) -> NDArray[np.bool]: ...

lib/python3.11/site-packages/numpy/lib/_arrayterator_impl.py

@@ -0,0 +1,224 @@
+"""
+A buffered iterator for big arrays.
+
+This module solves the problem of iterating over a big file-based array
+without having to read it into memory. The `Arrayterator` class wraps
+an array object, and when iterated it will return sub-arrays with at most
+a user-specified number of elements.
+
+"""
+from functools import reduce
+from operator import mul
+
+__all__ = ['Arrayterator']
+
+
+class Arrayterator:
+    """
+    Buffered iterator for big arrays.
+
+    `Arrayterator` creates a buffered iterator for reading big arrays in small
+    contiguous blocks. The class is useful for objects stored in the
+    file system. It allows iteration over the object *without* reading
+    everything in memory; instead, small blocks are read and iterated over.
+
+    `Arrayterator` can be used with any object that supports multidimensional
+    slices. This includes NumPy arrays, but also variables from
+    Scientific.IO.NetCDF or pynetcdf for example.
+
+    Parameters
+    ----------
+    var : array_like
+        The object to iterate over.
+    buf_size : int, optional
+        The buffer size. If `buf_size` is supplied, the maximum amount of
+        data that will be read into memory is `buf_size` elements.
+        Default is None, which will read as many element as possible
+        into memory.
+
+    Attributes
+    ----------
+    var
+    buf_size
+    start
+    stop
+    step
+    shape
+    flat
+
+    See Also
+    --------
+    numpy.ndenumerate : Multidimensional array iterator.
+    numpy.flatiter : Flat array iterator.
+    numpy.memmap : Create a memory-map to an array stored
+                   in a binary file on disk.
+
+    Notes
+    -----
+    The algorithm works by first finding a "running dimension", along which
+    the blocks will be extracted. Given an array of dimensions
+    ``(d1, d2, ..., dn)``, e.g. if `buf_size` is smaller than ``d1``, the
+    first dimension will be used. If, on the other hand,
+    ``d1 < buf_size < d1*d2`` the second dimension will be used, and so on.
+    Blocks are extracted along this dimension, and when the last block is
+    returned the process continues from the next dimension, until all
+    elements have been read.
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> a = np.arange(3 * 4 * 5 * 6).reshape(3, 4, 5, 6)
+    >>> a_itor = np.lib.Arrayterator(a, 2)
+    >>> a_itor.shape
+    (3, 4, 5, 6)
+
+    Now we can iterate over ``a_itor``, and it will return arrays of size
+    two. Since `buf_size` was smaller than any dimension, the first
+    dimension will be iterated over first:
+
+    >>> for subarr in a_itor:
+    ...     if not subarr.all():
+    ...         print(subarr, subarr.shape) # doctest: +SKIP
+    >>> # [[[[0 1]]]] (1, 1, 1, 2)
+
+    """
+
+    __module__ = "numpy.lib"
+
+    def __init__(self, var, buf_size=None):
+        self.var = var
+        self.buf_size = buf_size
+
+        self.start = [0 for dim in var.shape]
+        self.stop = list(var.shape)
+        self.step = [1 for dim in var.shape]
+
+    def __getattr__(self, attr):
+        return getattr(self.var, attr)
+
+    def __getitem__(self, index):
+        """
+        Return a new arrayterator.
+
+        """
+        # Fix index, handling ellipsis and incomplete slices.
+        if not isinstance(index, tuple):
+            index = (index,)
+        fixed = []
+        length, dims = len(index), self.ndim
+        for slice_ in index:
+            if slice_ is Ellipsis:
+                fixed.extend([slice(None)] * (dims - length + 1))
+                length = len(fixed)
+            elif isinstance(slice_, int):
+                fixed.append(slice(slice_, slice_ + 1, 1))
+            else:
+                fixed.append(slice_)
+        index = tuple(fixed)
+        if len(index) < dims:
+            index += (slice(None),) * (dims - len(index))
+
+        # Return a new arrayterator object.
+        out = self.__class__(self.var, self.buf_size)
+        for i, (start, stop, step, slice_) in enumerate(
+                zip(self.start, self.stop, self.step, index)):
+            out.start[i] = start + (slice_.start or 0)
+            out.step[i] = step * (slice_.step or 1)
+            out.stop[i] = start + (slice_.stop or stop - start)
+            out.stop[i] = min(stop, out.stop[i])
+        return out
+
+    def __array__(self, dtype=None, copy=None):
+        """
+        Return corresponding data.
+
+        """
+        slice_ = tuple(slice(*t) for t in zip(
+                self.start, self.stop, self.step))
+        return self.var[slice_]
+
+    @property
+    def flat(self):
+        """
+        A 1-D flat iterator for Arrayterator objects.
+
+        This iterator returns elements of the array to be iterated over in
+        `~lib.Arrayterator` one by one.
+        It is similar to `flatiter`.
+
+        See Also
+        --------
+        lib.Arrayterator
+        flatiter
+
+        Examples
+        --------
+        >>> a = np.arange(3 * 4 * 5 * 6).reshape(3, 4, 5, 6)
+        >>> a_itor = np.lib.Arrayterator(a, 2)
+
+        >>> for subarr in a_itor.flat:
+        ...     if not subarr:
+        ...         print(subarr, type(subarr))
+        ...
+        0 <class 'numpy.int64'>
+
+        """
+        for block in self:
+            yield from block.flat
+
+    @property
+    def shape(self):
+        """
+        The shape of the array to be iterated over.
+
+        For an example, see `Arrayterator`.
+
+        """
+        return tuple(((stop - start - 1) // step + 1) for start, stop, step in
+                zip(self.start, self.stop, self.step))
+
+    def __iter__(self):
+        # Skip arrays with degenerate dimensions
+        if [dim for dim in self.shape if dim <= 0]:
+            return
+
+        start = self.start[:]
+        stop = self.stop[:]
+        step = self.step[:]
+        ndims = self.var.ndim
+
+        while True:
+            count = self.buf_size or reduce(mul, self.shape)
+
+            # iterate over each dimension, looking for the
+            # running dimension (ie, the dimension along which
+            # the blocks will be built from)
+            rundim = 0
+            for i in range(ndims - 1, -1, -1):
+                # if count is zero we ran out of elements to read
+                # along higher dimensions, so we read only a single position
+                if count == 0:
+                    stop[i] = start[i] + 1
+                elif count <= self.shape[i]:
+                    # limit along this dimension
+                    stop[i] = start[i] + count * step[i]
+                    rundim = i
+                else:
+                    # read everything along this dimension
+                    stop[i] = self.stop[i]
+                stop[i] = min(self.stop[i], stop[i])
+                count = count // self.shape[i]
+
+            # yield a block
+            slice_ = tuple(slice(*t) for t in zip(start, stop, step))
+            yield self.var[slice_]
+
+            # Update start position, taking care of overflow to
+            # other dimensions
+            start[rundim] = stop[rundim]  # start where we stopped
+            for i in range(ndims - 1, 0, -1):
+                if start[i] >= self.stop[i]:
+                    start[i] = self.start[i]
+                    start[i - 1] += self.step[i - 1]
+            if start[0] >= self.stop[0]:
+                return

lib/python3.11/site-packages/numpy/lib/_arrayterator_impl.pyi

@@ -0,0 +1,46 @@
+# pyright: reportIncompatibleMethodOverride=false
+
+from collections.abc import Generator
+from types import EllipsisType
+from typing import Any, Final, TypeAlias, overload
+
+from typing_extensions import TypeVar
+
+import numpy as np
+from numpy._typing import _AnyShape, _Shape
+
+__all__ = ["Arrayterator"]
+
+_ShapeT_co = TypeVar("_ShapeT_co", bound=_Shape, default=_AnyShape, covariant=True)
+_DTypeT = TypeVar("_DTypeT", bound=np.dtype)
+_DTypeT_co = TypeVar("_DTypeT_co", bound=np.dtype, default=np.dtype, covariant=True)
+_ScalarT = TypeVar("_ScalarT", bound=np.generic)
+
+_AnyIndex: TypeAlias = EllipsisType | int | slice | tuple[EllipsisType | int | slice, ...]
+
+# NOTE: In reality `Arrayterator` does not actually inherit from `ndarray`,
+# but its ``__getattr__` method does wrap around the former and thus has
+# access to all its methods
+
+class Arrayterator(np.ndarray[_ShapeT_co, _DTypeT_co]):
+    var: np.ndarray[_ShapeT_co, _DTypeT_co]  # type: ignore[assignment]
+    buf_size: Final[int | None]
+    start: Final[list[int]]
+    stop: Final[list[int]]
+    step: Final[list[int]]
+
+    @property  # type: ignore[misc]
+    def shape(self) -> _ShapeT_co: ...
+    @property
+    def flat(self: Arrayterator[Any, np.dtype[_ScalarT]]) -> Generator[_ScalarT]: ...  # type: ignore[override]
+
+    #
+    def __init__(self, /, var: np.ndarray[_ShapeT_co, _DTypeT_co], buf_size: int | None = None) -> None: ...
+    def __getitem__(self, index: _AnyIndex, /) -> Arrayterator[_AnyShape, _DTypeT_co]: ...  # type: ignore[override]
+    def __iter__(self) -> Generator[np.ndarray[_AnyShape, _DTypeT_co]]: ...
+
+    #
+    @overload  # type: ignore[override]
+    def __array__(self, /, dtype: None = None, copy: bool | None = None) -> np.ndarray[_ShapeT_co, _DTypeT_co]: ...
+    @overload
+    def __array__(self, /, dtype: _DTypeT, copy: bool | None = None) -> np.ndarray[_ShapeT_co, _DTypeT]: ...

lib/python3.11/site-packages/numpy/lib/_datasource.py

@@ -0,0 +1,700 @@
+"""A file interface for handling local and remote data files.
+
+The goal of datasource is to abstract some of the file system operations
+when dealing with data files so the researcher doesn't have to know all the
+low-level details.  Through datasource, a researcher can obtain and use a
+file with one function call, regardless of location of the file.
+
+DataSource is meant to augment standard python libraries, not replace them.
+It should work seamlessly with standard file IO operations and the os
+module.
+
+DataSource files can originate locally or remotely:
+
+- local files : '/home/guido/src/local/data.txt'
+- URLs (http, ftp, ...) : 'http://www.scipy.org/not/real/data.txt'
+
+DataSource files can also be compressed or uncompressed.  Currently only
+gzip, bz2 and xz are supported.
+
+Example::
+
+    >>> # Create a DataSource, use os.curdir (default) for local storage.
+    >>> from numpy import DataSource
+    >>> ds = DataSource()
+    >>>
+    >>> # Open a remote file.
+    >>> # DataSource downloads the file, stores it locally in:
+    >>> #     './www.google.com/index.html'
+    >>> # opens the file and returns a file object.
+    >>> fp = ds.open('http://www.google.com/') # doctest: +SKIP
+    >>>
+    >>> # Use the file as you normally would
+    >>> fp.read() # doctest: +SKIP
+    >>> fp.close() # doctest: +SKIP
+
+"""
+import os
+
+from numpy._utils import set_module
+
+_open = open
+
+
+def _check_mode(mode, encoding, newline):
+    """Check mode and that encoding and newline are compatible.
+
+    Parameters
+    ----------
+    mode : str
+        File open mode.
+    encoding : str
+        File encoding.
+    newline : str
+        Newline for text files.
+
+    """
+    if "t" in mode:
+        if "b" in mode:
+            raise ValueError(f"Invalid mode: {mode!r}")
+    else:
+        if encoding is not None:
+            raise ValueError("Argument 'encoding' not supported in binary mode")
+        if newline is not None:
+            raise ValueError("Argument 'newline' not supported in binary mode")
+
+
+# Using a class instead of a module-level dictionary
+# to reduce the initial 'import numpy' overhead by
+# deferring the import of lzma, bz2 and gzip until needed
+
+# TODO: .zip support, .tar support?
+class _FileOpeners:
+    """
+    Container for different methods to open (un-)compressed files.
+
+    `_FileOpeners` contains a dictionary that holds one method for each
+    supported file format. Attribute lookup is implemented in such a way
+    that an instance of `_FileOpeners` itself can be indexed with the keys
+    of that dictionary. Currently uncompressed files as well as files
+    compressed with ``gzip``, ``bz2`` or ``xz`` compression are supported.
+
+    Notes
+    -----
+    `_file_openers`, an instance of `_FileOpeners`, is made available for
+    use in the `_datasource` module.
+
+    Examples
+    --------
+    >>> import gzip
+    >>> np.lib._datasource._file_openers.keys()
+    [None, '.bz2', '.gz', '.xz', '.lzma']
+    >>> np.lib._datasource._file_openers['.gz'] is gzip.open
+    True
+
+    """
+
+    def __init__(self):
+        self._loaded = False
+        self._file_openers = {None: open}
+
+    def _load(self):
+        if self._loaded:
+            return
+
+        try:
+            import bz2
+            self._file_openers[".bz2"] = bz2.open
+        except ImportError:
+            pass
+
+        try:
+            import gzip
+            self._file_openers[".gz"] = gzip.open
+        except ImportError:
+            pass
+
+        try:
+            import lzma
+            self._file_openers[".xz"] = lzma.open
+            self._file_openers[".lzma"] = lzma.open
+        except (ImportError, AttributeError):
+            # There are incompatible backports of lzma that do not have the
+            # lzma.open attribute, so catch that as well as ImportError.
+            pass
+
+        self._loaded = True
+
+    def keys(self):
+        """
+        Return the keys of currently supported file openers.
+
+        Parameters
+        ----------
+        None
+
+        Returns
+        -------
+        keys : list
+            The keys are None for uncompressed files and the file extension
+            strings (i.e. ``'.gz'``, ``'.xz'``) for supported compression
+            methods.
+
+        """
+        self._load()
+        return list(self._file_openers.keys())
+
+    def __getitem__(self, key):
+        self._load()
+        return self._file_openers[key]
+
+
+_file_openers = _FileOpeners()
+
+def open(path, mode='r', destpath=os.curdir, encoding=None, newline=None):
+    """
+    Open `path` with `mode` and return the file object.
+
+    If ``path`` is an URL, it will be downloaded, stored in the
+    `DataSource` `destpath` directory and opened from there.
+
+    Parameters
+    ----------
+    path : str or pathlib.Path
+        Local file path or URL to open.
+    mode : str, optional
+        Mode to open `path`. Mode 'r' for reading, 'w' for writing, 'a' to
+        append. Available modes depend on the type of object specified by
+        path.  Default is 'r'.
+    destpath : str, optional
+        Path to the directory where the source file gets downloaded to for
+        use.  If `destpath` is None, a temporary directory will be created.
+        The default path is the current directory.
+    encoding : {None, str}, optional
+        Open text file with given encoding. The default encoding will be
+        what `open` uses.
+    newline : {None, str}, optional
+        Newline to use when reading text file.
+
+    Returns
+    -------
+    out : file object
+        The opened file.
+
+    Notes
+    -----
+    This is a convenience function that instantiates a `DataSource` and
+    returns the file object from ``DataSource.open(path)``.
+
+    """
+
+    ds = DataSource(destpath)
+    return ds.open(path, mode, encoding=encoding, newline=newline)
+
+
+@set_module('numpy.lib.npyio')
+class DataSource:
+    """
+    DataSource(destpath='.')
+
+    A generic data source file (file, http, ftp, ...).
+
+    DataSources can be local files or remote files/URLs.  The files may
+    also be compressed or uncompressed. DataSource hides some of the
+    low-level details of downloading the file, allowing you to simply pass
+    in a valid file path (or URL) and obtain a file object.
+
+    Parameters
+    ----------
+    destpath : str or None, optional
+        Path to the directory where the source file gets downloaded to for
+        use.  If `destpath` is None, a temporary directory will be created.
+        The default path is the current directory.
+
+    Notes
+    -----
+    URLs require a scheme string (``http://``) to be used, without it they
+    will fail::
+
+        >>> repos = np.lib.npyio.DataSource()
+        >>> repos.exists('www.google.com/index.html')
+        False
+        >>> repos.exists('http://www.google.com/index.html')
+        True
+
+    Temporary directories are deleted when the DataSource is deleted.
+
+    Examples
+    --------
+    ::
+
+        >>> ds = np.lib.npyio.DataSource('/home/guido')
+        >>> urlname = 'http://www.google.com/'
+        >>> gfile = ds.open('http://www.google.com/')
+        >>> ds.abspath(urlname)
+        '/home/guido/www.google.com/index.html'
+
+        >>> ds = np.lib.npyio.DataSource(None)  # use with temporary file
+        >>> ds.open('/home/guido/foobar.txt')
+        <open file '/home/guido.foobar.txt', mode 'r' at 0x91d4430>
+        >>> ds.abspath('/home/guido/foobar.txt')
+        '/tmp/.../home/guido/foobar.txt'
+
+    """
+
+    def __init__(self, destpath=os.curdir):
+        """Create a DataSource with a local path at destpath."""
+        if destpath:
+            self._destpath = os.path.abspath(destpath)
+            self._istmpdest = False
+        else:
+            import tempfile  # deferring import to improve startup time
+            self._destpath = tempfile.mkdtemp()
+            self._istmpdest = True
+
+    def __del__(self):
+        # Remove temp directories
+        if hasattr(self, '_istmpdest') and self._istmpdest:
+            import shutil
+
+            shutil.rmtree(self._destpath)
+
+    def _iszip(self, filename):
+        """Test if the filename is a zip file by looking at the file extension.
+
+        """
+        fname, ext = os.path.splitext(filename)
+        return ext in _file_openers.keys()
+
+    def _iswritemode(self, mode):
+        """Test if the given mode will open a file for writing."""
+
+        # Currently only used to test the bz2 files.
+        _writemodes = ("w", "+")
+        return any(c in _writemodes for c in mode)
+
+    def _splitzipext(self, filename):
+        """Split zip extension from filename and return filename.
+
+        Returns
+        -------
+        base, zip_ext : {tuple}
+
+        """
+
+        if self._iszip(filename):
+            return os.path.splitext(filename)
+        else:
+            return filename, None
+
+    def _possible_names(self, filename):
+        """Return a tuple containing compressed filename variations."""
+        names = [filename]
+        if not self._iszip(filename):
+            for zipext in _file_openers.keys():
+                if zipext:
+                    names.append(filename + zipext)
+        return names
+
+    def _isurl(self, path):
+        """Test if path is a net location.  Tests the scheme and netloc."""
+
+        # We do this here to reduce the 'import numpy' initial import time.
+        from urllib.parse import urlparse
+
+        # BUG : URLs require a scheme string ('http://') to be used.
+        #       www.google.com will fail.
+        #       Should we prepend the scheme for those that don't have it and
+        #       test that also?  Similar to the way we append .gz and test for
+        #       for compressed versions of files.
+
+        scheme, netloc, upath, uparams, uquery, ufrag = urlparse(path)
+        return bool(scheme and netloc)
+
+    def _cache(self, path):
+        """Cache the file specified by path.
+
+        Creates a copy of the file in the datasource cache.
+
+        """
+        # We import these here because importing them is slow and
+        # a significant fraction of numpy's total import time.
+        import shutil
+        from urllib.request import urlopen
+
+        upath = self.abspath(path)
+
+        # ensure directory exists
+        if not os.path.exists(os.path.dirname(upath)):
+            os.makedirs(os.path.dirname(upath))
+
+        # TODO: Doesn't handle compressed files!
+        if self._isurl(path):
+            with urlopen(path) as openedurl:
+                with _open(upath, 'wb') as f:
+                    shutil.copyfileobj(openedurl, f)
+        else:
+            shutil.copyfile(path, upath)
+        return upath
+
+    def _findfile(self, path):
+        """Searches for ``path`` and returns full path if found.
+
+        If path is an URL, _findfile will cache a local copy and return the
+        path to the cached file.  If path is a local file, _findfile will
+        return a path to that local file.
+
+        The search will include possible compressed versions of the file
+        and return the first occurrence found.
+
+        """
+
+        # Build list of possible local file paths
+        if not self._isurl(path):
+            # Valid local paths
+            filelist = self._possible_names(path)
+            # Paths in self._destpath
+            filelist += self._possible_names(self.abspath(path))
+        else:
+            # Cached URLs in self._destpath
+            filelist = self._possible_names(self.abspath(path))
+            # Remote URLs
+            filelist = filelist + self._possible_names(path)
+
+        for name in filelist:
+            if self.exists(name):
+                if self._isurl(name):
+                    name = self._cache(name)
+                return name
+        return None
+
+    def abspath(self, path):
+        """
+        Return absolute path of file in the DataSource directory.
+
+        If `path` is an URL, then `abspath` will return either the location
+        the file exists locally or the location it would exist when opened
+        using the `open` method.
+
+        Parameters
+        ----------
+        path : str or pathlib.Path
+            Can be a local file or a remote URL.
+
+        Returns
+        -------
+        out : str
+            Complete path, including the `DataSource` destination directory.
+
+        Notes
+        -----
+        The functionality is based on `os.path.abspath`.
+
+        """
+        # We do this here to reduce the 'import numpy' initial import time.
+        from urllib.parse import urlparse
+
+        # TODO:  This should be more robust.  Handles case where path includes
+        #        the destpath, but not other sub-paths. Failing case:
+        #        path = /home/guido/datafile.txt
+        #        destpath = /home/alex/
+        #        upath = self.abspath(path)
+        #        upath == '/home/alex/home/guido/datafile.txt'
+
+        # handle case where path includes self._destpath
+        splitpath = path.split(self._destpath, 2)
+        if len(splitpath) > 1:
+            path = splitpath[1]
+        scheme, netloc, upath, uparams, uquery, ufrag = urlparse(path)
+        netloc = self._sanitize_relative_path(netloc)
+        upath = self._sanitize_relative_path(upath)
+        return os.path.join(self._destpath, netloc, upath)
+
+    def _sanitize_relative_path(self, path):
+        """Return a sanitised relative path for which
+        os.path.abspath(os.path.join(base, path)).startswith(base)
+        """
+        last = None
+        path = os.path.normpath(path)
+        while path != last:
+            last = path
+            # Note: os.path.join treats '/' as os.sep on Windows
+            path = path.lstrip(os.sep).lstrip('/')
+            path = path.lstrip(os.pardir).removeprefix('..')
+            drive, path = os.path.splitdrive(path)  # for Windows
+        return path
+
+    def exists(self, path):
+        """
+        Test if path exists.
+
+        Test if `path` exists as (and in this order):
+
+        - a local file.
+        - a remote URL that has been downloaded and stored locally in the
+          `DataSource` directory.
+        - a remote URL that has not been downloaded, but is valid and
+          accessible.
+
+        Parameters
+        ----------
+        path : str or pathlib.Path
+            Can be a local file or a remote URL.
+
+        Returns
+        -------
+        out : bool
+            True if `path` exists.
+
+        Notes
+        -----
+        When `path` is an URL, `exists` will return True if it's either
+        stored locally in the `DataSource` directory, or is a valid remote
+        URL.  `DataSource` does not discriminate between the two, the file
+        is accessible if it exists in either location.
+
+        """
+
+        # First test for local path
+        if os.path.exists(path):
+            return True
+
+        # We import this here because importing urllib is slow and
+        # a significant fraction of numpy's total import time.
+        from urllib.error import URLError
+        from urllib.request import urlopen
+
+        # Test cached url
+        upath = self.abspath(path)
+        if os.path.exists(upath):
+            return True
+
+        # Test remote url
+        if self._isurl(path):
+            try:
+                netfile = urlopen(path)
+                netfile.close()
+                del netfile
+                return True
+            except URLError:
+                return False
+        return False
+
+    def open(self, path, mode='r', encoding=None, newline=None):
+        """
+        Open and return file-like object.
+
+        If `path` is an URL, it will be downloaded, stored in the
+        `DataSource` directory and opened from there.
+
+        Parameters
+        ----------
+        path : str or pathlib.Path
+            Local file path or URL to open.
+        mode : {'r', 'w', 'a'}, optional
+            Mode to open `path`.  Mode 'r' for reading, 'w' for writing,
+            'a' to append. Available modes depend on the type of object
+            specified by `path`. Default is 'r'.
+        encoding : {None, str}, optional
+            Open text file with given encoding. The default encoding will be
+            what `open` uses.
+        newline : {None, str}, optional
+            Newline to use when reading text file.
+
+        Returns
+        -------
+        out : file object
+            File object.
+
+        """
+
+        # TODO: There is no support for opening a file for writing which
+        #       doesn't exist yet (creating a file).  Should there be?
+
+        # TODO: Add a ``subdir`` parameter for specifying the subdirectory
+        #       used to store URLs in self._destpath.
+
+        if self._isurl(path) and self._iswritemode(mode):
+            raise ValueError("URLs are not writeable")
+
+        # NOTE: _findfile will fail on a new file opened for writing.
+        found = self._findfile(path)
+        if found:
+            _fname, ext = self._splitzipext(found)
+            if ext == 'bz2':
+                mode.replace("+", "")
+            return _file_openers[ext](found, mode=mode,
+                                      encoding=encoding, newline=newline)
+        else:
+            raise FileNotFoundError(f"{path} not found.")
+
+
+class Repository (DataSource):
+    """
+    Repository(baseurl, destpath='.')
+
+    A data repository where multiple DataSource's share a base
+    URL/directory.
+
+    `Repository` extends `DataSource` by prepending a base URL (or
+    directory) to all the files it handles. Use `Repository` when you will
+    be working with multiple files from one base URL.  Initialize
+    `Repository` with the base URL, then refer to each file by its filename
+    only.
+
+    Parameters
+    ----------
+    baseurl : str
+        Path to the local directory or remote location that contains the
+        data files.
+    destpath : str or None, optional
+        Path to the directory where the source file gets downloaded to for
+        use.  If `destpath` is None, a temporary directory will be created.
+        The default path is the current directory.
+
+    Examples
+    --------
+    To analyze all files in the repository, do something like this
+    (note: this is not self-contained code)::
+
+        >>> repos = np.lib._datasource.Repository('/home/user/data/dir/')
+        >>> for filename in filelist:
+        ...     fp = repos.open(filename)
+        ...     fp.analyze()
+        ...     fp.close()
+
+    Similarly you could use a URL for a repository::
+
+        >>> repos = np.lib._datasource.Repository('http://www.xyz.edu/data')
+
+    """
+
+    def __init__(self, baseurl, destpath=os.curdir):
+        """Create a Repository with a shared url or directory of baseurl."""
+        DataSource.__init__(self, destpath=destpath)
+        self._baseurl = baseurl
+
+    def __del__(self):
+        DataSource.__del__(self)
+
+    def _fullpath(self, path):
+        """Return complete path for path.  Prepends baseurl if necessary."""
+        splitpath = path.split(self._baseurl, 2)
+        if len(splitpath) == 1:
+            result = os.path.join(self._baseurl, path)
+        else:
+            result = path    # path contains baseurl already
+        return result
+
+    def _findfile(self, path):
+        """Extend DataSource method to prepend baseurl to ``path``."""
+        return DataSource._findfile(self, self._fullpath(path))
+
+    def abspath(self, path):
+        """
+        Return absolute path of file in the Repository directory.
+
+        If `path` is an URL, then `abspath` will return either the location
+        the file exists locally or the location it would exist when opened
+        using the `open` method.
+
+        Parameters
+        ----------
+        path : str or pathlib.Path
+            Can be a local file or a remote URL. This may, but does not
+            have to, include the `baseurl` with which the `Repository` was
+            initialized.
+
+        Returns
+        -------
+        out : str
+            Complete path, including the `DataSource` destination directory.
+
+        """
+        return DataSource.abspath(self, self._fullpath(path))
+
+    def exists(self, path):
+        """
+        Test if path exists prepending Repository base URL to path.
+
+        Test if `path` exists as (and in this order):
+
+        - a local file.
+        - a remote URL that has been downloaded and stored locally in the
+          `DataSource` directory.
+        - a remote URL that has not been downloaded, but is valid and
+          accessible.
+
+        Parameters
+        ----------
+        path : str or pathlib.Path
+            Can be a local file or a remote URL. This may, but does not
+            have to, include the `baseurl` with which the `Repository` was
+            initialized.
+
+        Returns
+        -------
+        out : bool
+            True if `path` exists.
+
+        Notes
+        -----
+        When `path` is an URL, `exists` will return True if it's either
+        stored locally in the `DataSource` directory, or is a valid remote
+        URL.  `DataSource` does not discriminate between the two, the file
+        is accessible if it exists in either location.
+
+        """
+        return DataSource.exists(self, self._fullpath(path))
+
+    def open(self, path, mode='r', encoding=None, newline=None):
+        """
+        Open and return file-like object prepending Repository base URL.
+
+        If `path` is an URL, it will be downloaded, stored in the
+        DataSource directory and opened from there.
+
+        Parameters
+        ----------
+        path : str or pathlib.Path
+            Local file path or URL to open. This may, but does not have to,
+            include the `baseurl` with which the `Repository` was
+            initialized.
+        mode : {'r', 'w', 'a'}, optional
+            Mode to open `path`.  Mode 'r' for reading, 'w' for writing,
+            'a' to append. Available modes depend on the type of object
+            specified by `path`. Default is 'r'.
+        encoding : {None, str}, optional
+            Open text file with given encoding. The default encoding will be
+            what `open` uses.
+        newline : {None, str}, optional
+            Newline to use when reading text file.
+
+        Returns
+        -------
+        out : file object
+            File object.
+
+        """
+        return DataSource.open(self, self._fullpath(path), mode,
+                               encoding=encoding, newline=newline)
+
+    def listdir(self):
+        """
+        List files in the source Repository.
+
+        Returns
+        -------
+        files : list of str or pathlib.Path
+            List of file names (not containing a directory part).
+
+        Notes
+        -----
+        Does not currently work for remote repositories.
+
+        """
+        if self._isurl(self._baseurl):
+            raise NotImplementedError(
+                  "Directory listing of URLs, not supported yet.")
+        else:
+            return os.listdir(self._baseurl)

lib/python3.11/site-packages/numpy/lib/_datasource.pyi

@@ -0,0 +1,31 @@
+from pathlib import Path
+from typing import IO, Any, TypeAlias
+
+from _typeshed import OpenBinaryMode, OpenTextMode
+
+_Mode: TypeAlias = OpenBinaryMode | OpenTextMode
+
+###
+
+# exported in numpy.lib.nppyio
+class DataSource:
+    def __init__(self, /, destpath: Path | str | None = ...) -> None: ...
+    def __del__(self, /) -> None: ...
+    def abspath(self, /, path: str) -> str: ...
+    def exists(self, /, path: str) -> bool: ...
+
+    # Whether the file-object is opened in string or bytes mode (by default)
+    # depends on the file-extension of `path`
+    def open(self, /, path: str, mode: _Mode = "r", encoding: str | None = None, newline: str | None = None) -> IO[Any]: ...
+
+class Repository(DataSource):
+    def __init__(self, /, baseurl: str, destpath: str | None = ...) -> None: ...
+    def listdir(self, /) -> list[str]: ...
+
+def open(
+    path: str,
+    mode: _Mode = "r",
+    destpath: str | None = ...,
+    encoding: str | None = None,
+    newline: str | None = None,
+) -> IO[Any]: ...

lib/python3.11/site-packages/numpy/lib/_format_impl.pyi

@@ -0,0 +1,26 @@
+from typing import Final, Literal
+
+from numpy.lib._utils_impl import drop_metadata  # noqa: F401
+
+__all__: list[str] = []
+
+EXPECTED_KEYS: Final[set[str]]
+MAGIC_PREFIX: Final[bytes]
+MAGIC_LEN: Literal[8]
+ARRAY_ALIGN: Literal[64]
+BUFFER_SIZE: Literal[262144]  # 2**18
+GROWTH_AXIS_MAX_DIGITS: Literal[21]
+
+def magic(major, minor): ...
+def read_magic(fp): ...
+def dtype_to_descr(dtype): ...
+def descr_to_dtype(descr): ...
+def header_data_from_array_1_0(array): ...
+def write_array_header_1_0(fp, d): ...
+def write_array_header_2_0(fp, d): ...
+def read_array_header_1_0(fp): ...
+def read_array_header_2_0(fp): ...
+def write_array(fp, array, version=..., allow_pickle=..., pickle_kwargs=...): ...
+def read_array(fp, allow_pickle=..., pickle_kwargs=...): ...
+def open_memmap(filename, mode=..., dtype=..., shape=..., fortran_order=..., version=...): ...
+def isfileobj(f): ...

lib/python3.11/site-packages/numpy/lib/_function_base_impl.pyi

@@ -0,0 +1,985 @@
+# ruff: noqa: ANN401
+from collections.abc import Callable, Iterable, Sequence
+from typing import (
+    Any,
+    Concatenate,
+    ParamSpec,
+    Protocol,
+    SupportsIndex,
+    SupportsInt,
+    TypeAlias,
+    TypeVar,
+    overload,
+    type_check_only,
+)
+from typing import Literal as L
+
+from _typeshed import Incomplete
+from typing_extensions import TypeIs, deprecated
+
+import numpy as np
+from numpy import (
+    _OrderKACF,
+    bool_,
+    complex128,
+    complexfloating,
+    datetime64,
+    float64,
+    floating,
+    generic,
+    integer,
+    intp,
+    object_,
+    timedelta64,
+    vectorize,
+)
+from numpy._core.multiarray import bincount
+from numpy._globals import _NoValueType
+from numpy._typing import (
+    ArrayLike,
+    DTypeLike,
+    NDArray,
+    _ArrayLike,
+    _ArrayLikeBool_co,
+    _ArrayLikeComplex_co,
+    _ArrayLikeDT64_co,
+    _ArrayLikeFloat_co,
+    _ArrayLikeInt_co,
+    _ArrayLikeNumber_co,
+    _ArrayLikeObject_co,
+    _ArrayLikeTD64_co,
+    _ComplexLike_co,
+    _DTypeLike,
+    _FloatLike_co,
+    _NestedSequence,
+    _NumberLike_co,
+    _ScalarLike_co,
+    _ShapeLike,
+)
+
+__all__ = [
+    "select",
+    "piecewise",
+    "trim_zeros",
+    "copy",
+    "iterable",
+    "percentile",
+    "diff",
+    "gradient",
+    "angle",
+    "unwrap",
+    "sort_complex",
+    "flip",
+    "rot90",
+    "extract",
+    "place",
+    "vectorize",
+    "asarray_chkfinite",
+    "average",
+    "bincount",
+    "digitize",
+    "cov",
+    "corrcoef",
+    "median",
+    "sinc",
+    "hamming",
+    "hanning",
+    "bartlett",
+    "blackman",
+    "kaiser",
+    "trapezoid",
+    "trapz",
+    "i0",
+    "meshgrid",
+    "delete",
+    "insert",
+    "append",
+    "interp",
+    "quantile",
+]
+
+_T = TypeVar("_T")
+_T_co = TypeVar("_T_co", covariant=True)
+# The `{}ss` suffix refers to the Python 3.12 syntax: `**P`
+_Pss = ParamSpec("_Pss")
+_ScalarT = TypeVar("_ScalarT", bound=generic)
+_ScalarT1 = TypeVar("_ScalarT1", bound=generic)
+_ScalarT2 = TypeVar("_ScalarT2", bound=generic)
+_ArrayT = TypeVar("_ArrayT", bound=np.ndarray)
+
+_2Tuple: TypeAlias = tuple[_T, _T]
+_MeshgridIdx: TypeAlias = L['ij', 'xy']
+
+@type_check_only
+class _TrimZerosSequence(Protocol[_T_co]):
+    def __len__(self, /) -> int: ...
+    @overload
+    def __getitem__(self, key: int, /) -> object: ...
+    @overload
+    def __getitem__(self, key: slice, /) -> _T_co: ...
+
+###
+
+@overload
+def rot90(
+    m: _ArrayLike[_ScalarT],
+    k: int = ...,
+    axes: tuple[int, int] = ...,
+) -> NDArray[_ScalarT]: ...
+@overload
+def rot90(
+    m: ArrayLike,
+    k: int = ...,
+    axes: tuple[int, int] = ...,
+) -> NDArray[Any]: ...
+
+@overload
+def flip(m: _ScalarT, axis: None = ...) -> _ScalarT: ...
+@overload
+def flip(m: _ScalarLike_co, axis: None = ...) -> Any: ...
+@overload
+def flip(m: _ArrayLike[_ScalarT], axis: _ShapeLike | None = ...) -> NDArray[_ScalarT]: ...
+@overload
+def flip(m: ArrayLike, axis: _ShapeLike | None = ...) -> NDArray[Any]: ...
+
+def iterable(y: object) -> TypeIs[Iterable[Any]]: ...
+
+@overload
+def average(
+    a: _ArrayLikeFloat_co,
+    axis: None = None,
+    weights: _ArrayLikeFloat_co | None = None,
+    returned: L[False] = False,
+    *,
+    keepdims: L[False] | _NoValueType = ...,
+) -> floating: ...
+@overload
+def average(
+    a: _ArrayLikeFloat_co,
+    axis: None = None,
+    weights: _ArrayLikeFloat_co | None = None,
+    *,
+    returned: L[True],
+    keepdims: L[False] | _NoValueType = ...,
+) -> _2Tuple[floating]: ...
+@overload
+def average(
+    a: _ArrayLikeComplex_co,
+    axis: None = None,
+    weights: _ArrayLikeComplex_co | None = None,
+    returned: L[False] = False,
+    *,
+    keepdims: L[False] | _NoValueType = ...,
+) -> complexfloating: ...
+@overload
+def average(
+    a: _ArrayLikeComplex_co,
+    axis: None = None,
+    weights: _ArrayLikeComplex_co | None = None,
+    *,
+    returned: L[True],
+    keepdims: L[False] | _NoValueType = ...,
+) -> _2Tuple[complexfloating]: ...
+@overload
+def average(
+    a: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    axis: _ShapeLike | None = None,
+    weights: object | None = None,
+    *,
+    returned: L[True],
+    keepdims: bool | bool_ | _NoValueType = ...,
+) -> _2Tuple[Incomplete]: ...
+@overload
+def average(
+    a: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    axis: _ShapeLike | None = None,
+    weights: object | None = None,
+    returned: bool | bool_ = False,
+    *,
+    keepdims: bool | bool_ | _NoValueType = ...,
+) -> Incomplete: ...
+
+@overload
+def asarray_chkfinite(
+    a: _ArrayLike[_ScalarT],
+    dtype: None = ...,
+    order: _OrderKACF = ...,
+) -> NDArray[_ScalarT]: ...
+@overload
+def asarray_chkfinite(
+    a: object,
+    dtype: None = ...,
+    order: _OrderKACF = ...,
+) -> NDArray[Any]: ...
+@overload
+def asarray_chkfinite(
+    a: Any,
+    dtype: _DTypeLike[_ScalarT],
+    order: _OrderKACF = ...,
+) -> NDArray[_ScalarT]: ...
+@overload
+def asarray_chkfinite(
+    a: Any,
+    dtype: DTypeLike,
+    order: _OrderKACF = ...,
+) -> NDArray[Any]: ...
+
+@overload
+def piecewise(
+    x: _ArrayLike[_ScalarT],
+    condlist: _ArrayLike[bool_] | Sequence[_ArrayLikeBool_co],
+    funclist: Sequence[
+        Callable[Concatenate[NDArray[_ScalarT], _Pss], NDArray[_ScalarT | Any]]
+        | _ScalarT | object
+    ],
+    /,
+    *args: _Pss.args,
+    **kw: _Pss.kwargs,
+) -> NDArray[_ScalarT]: ...
+@overload
+def piecewise(
+    x: ArrayLike,
+    condlist: _ArrayLike[bool_] | Sequence[_ArrayLikeBool_co],
+    funclist: Sequence[
+        Callable[Concatenate[NDArray[Any], _Pss], NDArray[Any]]
+        | object
+    ],
+    /,
+    *args: _Pss.args,
+    **kw: _Pss.kwargs,
+) -> NDArray[Any]: ...
+
+def select(
+    condlist: Sequence[ArrayLike],
+    choicelist: Sequence[ArrayLike],
+    default: ArrayLike = ...,
+) -> NDArray[Any]: ...
+
+@overload
+def copy(
+    a: _ArrayT,
+    order: _OrderKACF,
+    subok: L[True],
+) -> _ArrayT: ...
+@overload
+def copy(
+    a: _ArrayT,
+    order: _OrderKACF = ...,
+    *,
+    subok: L[True],
+) -> _ArrayT: ...
+@overload
+def copy(
+    a: _ArrayLike[_ScalarT],
+    order: _OrderKACF = ...,
+    subok: L[False] = ...,
+) -> NDArray[_ScalarT]: ...
+@overload
+def copy(
+    a: ArrayLike,
+    order: _OrderKACF = ...,
+    subok: L[False] = ...,
+) -> NDArray[Any]: ...
+
+def gradient(
+    f: ArrayLike,
+    *varargs: ArrayLike,
+    axis: _ShapeLike | None = ...,
+    edge_order: L[1, 2] = ...,
+) -> Any: ...
+
+@overload
+def diff(
+    a: _T,
+    n: L[0],
+    axis: SupportsIndex = ...,
+    prepend: ArrayLike = ...,
+    append: ArrayLike = ...,
+) -> _T: ...
+@overload
+def diff(
+    a: ArrayLike,
+    n: int = ...,
+    axis: SupportsIndex = ...,
+    prepend: ArrayLike = ...,
+    append: ArrayLike = ...,
+) -> NDArray[Any]: ...
+
+@overload  # float scalar
+def interp(
+    x: _FloatLike_co,
+    xp: _ArrayLikeFloat_co,
+    fp: _ArrayLikeFloat_co,
+    left: _FloatLike_co | None = None,
+    right: _FloatLike_co | None = None,
+    period: _FloatLike_co | None = None,
+) -> float64: ...
+@overload  # float array
+def interp(
+    x: NDArray[floating | integer | np.bool] | _NestedSequence[_FloatLike_co],
+    xp: _ArrayLikeFloat_co,
+    fp: _ArrayLikeFloat_co,
+    left: _FloatLike_co | None = None,
+    right: _FloatLike_co | None = None,
+    period: _FloatLike_co | None = None,
+) -> NDArray[float64]: ...
+@overload  # float scalar or array
+def interp(
+    x: _ArrayLikeFloat_co,
+    xp: _ArrayLikeFloat_co,
+    fp: _ArrayLikeFloat_co,
+    left: _FloatLike_co | None = None,
+    right: _FloatLike_co | None = None,
+    period: _FloatLike_co | None = None,
+) -> NDArray[float64] | float64: ...
+@overload  # complex scalar
+def interp(
+    x: _FloatLike_co,
+    xp: _ArrayLikeFloat_co,
+    fp: _ArrayLike[complexfloating],
+    left: _NumberLike_co | None = None,
+    right: _NumberLike_co | None = None,
+    period: _FloatLike_co | None = None,
+) -> complex128: ...
+@overload  # complex or float scalar
+def interp(
+    x: _FloatLike_co,
+    xp: _ArrayLikeFloat_co,
+    fp: Sequence[complex | complexfloating],
+    left: _NumberLike_co | None = None,
+    right: _NumberLike_co | None = None,
+    period: _FloatLike_co | None = None,
+) -> complex128 | float64: ...
+@overload  # complex array
+def interp(
+    x: NDArray[floating | integer | np.bool] | _NestedSequence[_FloatLike_co],
+    xp: _ArrayLikeFloat_co,
+    fp: _ArrayLike[complexfloating],
+    left: _NumberLike_co | None = None,
+    right: _NumberLike_co | None = None,
+    period: _FloatLike_co | None = None,
+) -> NDArray[complex128]: ...
+@overload  # complex or float array
+def interp(
+    x: NDArray[floating | integer | np.bool] | _NestedSequence[_FloatLike_co],
+    xp: _ArrayLikeFloat_co,
+    fp: Sequence[complex | complexfloating],
+    left: _NumberLike_co | None = None,
+    right: _NumberLike_co | None = None,
+    period: _FloatLike_co | None = None,
+) -> NDArray[complex128 | float64]: ...
+@overload  # complex scalar or array
+def interp(
+    x: _ArrayLikeFloat_co,
+    xp: _ArrayLikeFloat_co,
+    fp: _ArrayLike[complexfloating],
+    left: _NumberLike_co | None = None,
+    right: _NumberLike_co | None = None,
+    period: _FloatLike_co | None = None,
+) -> NDArray[complex128] | complex128: ...
+@overload  # complex or float scalar or array
+def interp(
+    x: _ArrayLikeFloat_co,
+    xp: _ArrayLikeFloat_co,
+    fp: _ArrayLikeNumber_co,
+    left: _NumberLike_co | None = None,
+    right: _NumberLike_co | None = None,
+    period: _FloatLike_co | None = None,
+) -> NDArray[complex128 | float64] | complex128 | float64: ...
+
+@overload
+def angle(z: _ComplexLike_co, deg: bool = ...) -> floating: ...
+@overload
+def angle(z: object_, deg: bool = ...) -> Any: ...
+@overload
+def angle(z: _ArrayLikeComplex_co, deg: bool = ...) -> NDArray[floating]: ...
+@overload
+def angle(z: _ArrayLikeObject_co, deg: bool = ...) -> NDArray[object_]: ...
+
+@overload
+def unwrap(
+    p: _ArrayLikeFloat_co,
+    discont: float | None = ...,
+    axis: int = ...,
+    *,
+    period: float = ...,
+) -> NDArray[floating]: ...
+@overload
+def unwrap(
+    p: _ArrayLikeObject_co,
+    discont: float | None = ...,
+    axis: int = ...,
+    *,
+    period: float = ...,
+) -> NDArray[object_]: ...
+
+def sort_complex(a: ArrayLike) -> NDArray[complexfloating]: ...
+
+def trim_zeros(
+    filt: _TrimZerosSequence[_T],
+    trim: L["f", "b", "fb", "bf"] = ...,
+) -> _T: ...
+
+@overload
+def extract(condition: ArrayLike, arr: _ArrayLike[_ScalarT]) -> NDArray[_ScalarT]: ...
+@overload
+def extract(condition: ArrayLike, arr: ArrayLike) -> NDArray[Any]: ...
+
+def place(arr: NDArray[Any], mask: ArrayLike, vals: Any) -> None: ...
+
+@overload
+def cov(
+    m: _ArrayLikeFloat_co,
+    y: _ArrayLikeFloat_co | None = ...,
+    rowvar: bool = ...,
+    bias: bool = ...,
+    ddof: SupportsIndex | SupportsInt | None = ...,
+    fweights: ArrayLike | None = ...,
+    aweights: ArrayLike | None = ...,
+    *,
+    dtype: None = ...,
+) -> NDArray[floating]: ...
+@overload
+def cov(
+    m: _ArrayLikeComplex_co,
+    y: _ArrayLikeComplex_co | None = ...,
+    rowvar: bool = ...,
+    bias: bool = ...,
+    ddof: SupportsIndex | SupportsInt | None = ...,
+    fweights: ArrayLike | None = ...,
+    aweights: ArrayLike | None = ...,
+    *,
+    dtype: None = ...,
+) -> NDArray[complexfloating]: ...
+@overload
+def cov(
+    m: _ArrayLikeComplex_co,
+    y: _ArrayLikeComplex_co | None = ...,
+    rowvar: bool = ...,
+    bias: bool = ...,
+    ddof: SupportsIndex | SupportsInt | None = ...,
+    fweights: ArrayLike | None = ...,
+    aweights: ArrayLike | None = ...,
+    *,
+    dtype: _DTypeLike[_ScalarT],
+) -> NDArray[_ScalarT]: ...
+@overload
+def cov(
+    m: _ArrayLikeComplex_co,
+    y: _ArrayLikeComplex_co | None = ...,
+    rowvar: bool = ...,
+    bias: bool = ...,
+    ddof: SupportsIndex | SupportsInt | None = ...,
+    fweights: ArrayLike | None = ...,
+    aweights: ArrayLike | None = ...,
+    *,
+    dtype: DTypeLike,
+) -> NDArray[Any]: ...
+
+# NOTE `bias` and `ddof` are deprecated and ignored
+@overload
+def corrcoef(
+    m: _ArrayLikeFloat_co,
+    y: _ArrayLikeFloat_co | None = None,
+    rowvar: bool = True,
+    bias: _NoValueType = ...,
+    ddof: _NoValueType = ...,
+    *,
+    dtype: None = None,
+) -> NDArray[floating]: ...
+@overload
+def corrcoef(
+    m: _ArrayLikeComplex_co,
+    y: _ArrayLikeComplex_co | None = None,
+    rowvar: bool = True,
+    bias: _NoValueType = ...,
+    ddof: _NoValueType = ...,
+    *,
+    dtype: None = None,
+) -> NDArray[complexfloating]: ...
+@overload
+def corrcoef(
+    m: _ArrayLikeComplex_co,
+    y: _ArrayLikeComplex_co | None = None,
+    rowvar: bool = True,
+    bias: _NoValueType = ...,
+    ddof: _NoValueType = ...,
+    *,
+    dtype: _DTypeLike[_ScalarT],
+) -> NDArray[_ScalarT]: ...
+@overload
+def corrcoef(
+    m: _ArrayLikeComplex_co,
+    y: _ArrayLikeComplex_co | None = None,
+    rowvar: bool = True,
+    bias: _NoValueType = ...,
+    ddof: _NoValueType = ...,
+    *,
+    dtype: DTypeLike | None = None,
+) -> NDArray[Any]: ...
+
+def blackman(M: _FloatLike_co) -> NDArray[floating]: ...
+
+def bartlett(M: _FloatLike_co) -> NDArray[floating]: ...
+
+def hanning(M: _FloatLike_co) -> NDArray[floating]: ...
+
+def hamming(M: _FloatLike_co) -> NDArray[floating]: ...
+
+def i0(x: _ArrayLikeFloat_co) -> NDArray[floating]: ...
+
+def kaiser(
+    M: _FloatLike_co,
+    beta: _FloatLike_co,
+) -> NDArray[floating]: ...
+
+@overload
+def sinc(x: _FloatLike_co) -> floating: ...
+@overload
+def sinc(x: _ComplexLike_co) -> complexfloating: ...
+@overload
+def sinc(x: _ArrayLikeFloat_co) -> NDArray[floating]: ...
+@overload
+def sinc(x: _ArrayLikeComplex_co) -> NDArray[complexfloating]: ...
+
+@overload
+def median(
+    a: _ArrayLikeFloat_co,
+    axis: None = ...,
+    out: None = ...,
+    overwrite_input: bool = ...,
+    keepdims: L[False] = ...,
+) -> floating: ...
+@overload
+def median(
+    a: _ArrayLikeComplex_co,
+    axis: None = ...,
+    out: None = ...,
+    overwrite_input: bool = ...,
+    keepdims: L[False] = ...,
+) -> complexfloating: ...
+@overload
+def median(
+    a: _ArrayLikeTD64_co,
+    axis: None = ...,
+    out: None = ...,
+    overwrite_input: bool = ...,
+    keepdims: L[False] = ...,
+) -> timedelta64: ...
+@overload
+def median(
+    a: _ArrayLikeObject_co,
+    axis: None = ...,
+    out: None = ...,
+    overwrite_input: bool = ...,
+    keepdims: L[False] = ...,
+) -> Any: ...
+@overload
+def median(
+    a: _ArrayLikeFloat_co | _ArrayLikeComplex_co | _ArrayLikeTD64_co | _ArrayLikeObject_co,
+    axis: _ShapeLike | None = ...,
+    out: None = ...,
+    overwrite_input: bool = ...,
+    keepdims: bool = ...,
+) -> Any: ...
+@overload
+def median(
+    a: _ArrayLikeFloat_co | _ArrayLikeComplex_co | _ArrayLikeTD64_co | _ArrayLikeObject_co,
+    axis: _ShapeLike | None,
+    out: _ArrayT,
+    overwrite_input: bool = ...,
+    keepdims: bool = ...,
+) -> _ArrayT: ...
+@overload
+def median(
+    a: _ArrayLikeFloat_co | _ArrayLikeComplex_co | _ArrayLikeTD64_co | _ArrayLikeObject_co,
+    axis: _ShapeLike | None = ...,
+    *,
+    out: _ArrayT,
+    overwrite_input: bool = ...,
+    keepdims: bool = ...,
+) -> _ArrayT: ...
+
+_MethodKind = L[
+    "inverted_cdf",
+    "averaged_inverted_cdf",
+    "closest_observation",
+    "interpolated_inverted_cdf",
+    "hazen",
+    "weibull",
+    "linear",
+    "median_unbiased",
+    "normal_unbiased",
+    "lower",
+    "higher",
+    "midpoint",
+    "nearest",
+]
+
+@overload
+def percentile(
+    a: _ArrayLikeFloat_co,
+    q: _FloatLike_co,
+    axis: None = ...,
+    out: None = ...,
+    overwrite_input: bool = ...,
+    method: _MethodKind = ...,
+    keepdims: L[False] = ...,
+    *,
+    weights: _ArrayLikeFloat_co | None = ...,
+) -> floating: ...
+@overload
+def percentile(
+    a: _ArrayLikeComplex_co,
+    q: _FloatLike_co,
+    axis: None = ...,
+    out: None = ...,
+    overwrite_input: bool = ...,
+    method: _MethodKind = ...,
+    keepdims: L[False] = ...,
+    *,
+    weights: _ArrayLikeFloat_co | None = ...,
+) -> complexfloating: ...
+@overload
+def percentile(
+    a: _ArrayLikeTD64_co,
+    q: _FloatLike_co,
+    axis: None = ...,
+    out: None = ...,
+    overwrite_input: bool = ...,
+    method: _MethodKind = ...,
+    keepdims: L[False] = ...,
+    *,
+    weights: _ArrayLikeFloat_co | None = ...,
+) -> timedelta64: ...
+@overload
+def percentile(
+    a: _ArrayLikeDT64_co,
+    q: _FloatLike_co,
+    axis: None = ...,
+    out: None = ...,
+    overwrite_input: bool = ...,
+    method: _MethodKind = ...,
+    keepdims: L[False] = ...,
+    *,
+    weights: _ArrayLikeFloat_co | None = ...,
+) -> datetime64: ...
+@overload
+def percentile(
+    a: _ArrayLikeObject_co,
+    q: _FloatLike_co,
+    axis: None = ...,
+    out: None = ...,
+    overwrite_input: bool = ...,
+    method: _MethodKind = ...,
+    keepdims: L[False] = ...,
+    *,
+    weights: _ArrayLikeFloat_co | None = ...,
+) -> Any: ...
+@overload
+def percentile(
+    a: _ArrayLikeFloat_co,
+    q: _ArrayLikeFloat_co,
+    axis: None = ...,
+    out: None = ...,
+    overwrite_input: bool = ...,
+    method: _MethodKind = ...,
+    keepdims: L[False] = ...,
+    *,
+    weights: _ArrayLikeFloat_co | None = ...,
+) -> NDArray[floating]: ...
+@overload
+def percentile(
+    a: _ArrayLikeComplex_co,
+    q: _ArrayLikeFloat_co,
+    axis: None = ...,
+    out: None = ...,
+    overwrite_input: bool = ...,
+    method: _MethodKind = ...,
+    keepdims: L[False] = ...,
+    *,
+    weights: _ArrayLikeFloat_co | None = ...,
+) -> NDArray[complexfloating]: ...
+@overload
+def percentile(
+    a: _ArrayLikeTD64_co,
+    q: _ArrayLikeFloat_co,
+    axis: None = ...,
+    out: None = ...,
+    overwrite_input: bool = ...,
+    method: _MethodKind = ...,
+    keepdims: L[False] = ...,
+    *,
+    weights: _ArrayLikeFloat_co | None = ...,
+) -> NDArray[timedelta64]: ...
+@overload
+def percentile(
+    a: _ArrayLikeDT64_co,
+    q: _ArrayLikeFloat_co,
+    axis: None = ...,
+    out: None = ...,
+    overwrite_input: bool = ...,
+    method: _MethodKind = ...,
+    keepdims: L[False] = ...,
+    *,
+    weights: _ArrayLikeFloat_co | None = ...,
+) -> NDArray[datetime64]: ...
+@overload
+def percentile(
+    a: _ArrayLikeObject_co,
+    q: _ArrayLikeFloat_co,
+    axis: None = ...,
+    out: None = ...,
+    overwrite_input: bool = ...,
+    method: _MethodKind = ...,
+    keepdims: L[False] = ...,
+    *,
+    weights: _ArrayLikeFloat_co | None = ...,
+) -> NDArray[object_]: ...
+@overload
+def percentile(
+    a: _ArrayLikeComplex_co | _ArrayLikeTD64_co | _ArrayLikeDT64_co | _ArrayLikeObject_co,
+    q: _ArrayLikeFloat_co,
+    axis: _ShapeLike | None = ...,
+    out: None = ...,
+    overwrite_input: bool = ...,
+    method: _MethodKind = ...,
+    keepdims: bool = ...,
+    *,
+    weights: _ArrayLikeFloat_co | None = ...,
+) -> Any: ...
+@overload
+def percentile(
+    a: _ArrayLikeComplex_co | _ArrayLikeTD64_co | _ArrayLikeDT64_co | _ArrayLikeObject_co,
+    q: _ArrayLikeFloat_co,
+    axis: _ShapeLike | None,
+    out: _ArrayT,
+    overwrite_input: bool = ...,
+    method: _MethodKind = ...,
+    keepdims: bool = ...,
+    *,
+    weights: _ArrayLikeFloat_co | None = ...,
+) -> _ArrayT: ...
+@overload
+def percentile(
+    a: _ArrayLikeComplex_co | _ArrayLikeTD64_co | _ArrayLikeDT64_co | _ArrayLikeObject_co,
+    q: _ArrayLikeFloat_co,
+    axis: _ShapeLike | None = ...,
+    *,
+    out: _ArrayT,
+    overwrite_input: bool = ...,
+    method: _MethodKind = ...,
+    keepdims: bool = ...,
+    weights: _ArrayLikeFloat_co | None = ...,
+) -> _ArrayT: ...
+
+# NOTE: Not an alias, but they do have identical signatures
+# (that we can reuse)
+quantile = percentile
+
+_ScalarT_fm = TypeVar(
+    "_ScalarT_fm",
+    bound=floating | complexfloating | timedelta64,
+)
+
+class _SupportsRMulFloat(Protocol[_T_co]):
+    def __rmul__(self, other: float, /) -> _T_co: ...
+
+@overload
+def trapezoid(  # type: ignore[overload-overlap]
+    y: Sequence[_FloatLike_co],
+    x: Sequence[_FloatLike_co] | None = ...,
+    dx: float = ...,
+    axis: SupportsIndex = ...,
+) -> float64: ...
+@overload
+def trapezoid(
+    y: Sequence[_ComplexLike_co],
+    x: Sequence[_ComplexLike_co] | None = ...,
+    dx: float = ...,
+    axis: SupportsIndex = ...,
+) -> complex128: ...
+@overload
+def trapezoid(
+    y: _ArrayLike[bool_ | integer],
+    x: _ArrayLike[bool_ | integer] | None = ...,
+    dx: float = ...,
+    axis: SupportsIndex = ...,
+) -> float64 | NDArray[float64]: ...
+@overload
+def trapezoid(  # type: ignore[overload-overlap]
+    y: _ArrayLikeObject_co,
+    x: _ArrayLikeFloat_co | _ArrayLikeObject_co | None = ...,
+    dx: float = ...,
+    axis: SupportsIndex = ...,
+) -> float | NDArray[object_]: ...
+@overload
+def trapezoid(
+    y: _ArrayLike[_ScalarT_fm],
+    x: _ArrayLike[_ScalarT_fm] | _ArrayLikeInt_co | None = ...,
+    dx: float = ...,
+    axis: SupportsIndex = ...,
+) -> _ScalarT_fm | NDArray[_ScalarT_fm]: ...
+@overload
+def trapezoid(
+    y: Sequence[_SupportsRMulFloat[_T]],
+    x: Sequence[_SupportsRMulFloat[_T] | _T] | None = ...,
+    dx: float = ...,
+    axis: SupportsIndex = ...,
+) -> _T: ...
+@overload
+def trapezoid(
+    y: _ArrayLikeComplex_co | _ArrayLikeTD64_co | _ArrayLikeObject_co,
+    x: _ArrayLikeComplex_co | _ArrayLikeTD64_co | _ArrayLikeObject_co | None = ...,
+    dx: float = ...,
+    axis: SupportsIndex = ...,
+) -> (
+    floating | complexfloating | timedelta64
+    | NDArray[floating | complexfloating | timedelta64 | object_]
+): ...
+
+@deprecated("Use 'trapezoid' instead")
+def trapz(y: ArrayLike, x: ArrayLike | None = None, dx: float = 1.0, axis: int = -1) -> generic | NDArray[generic]: ...
+
+@overload
+def meshgrid(
+    *,
+    copy: bool = ...,
+    sparse: bool = ...,
+    indexing: _MeshgridIdx = ...,
+) -> tuple[()]: ...
+@overload
+def meshgrid(
+    x1: _ArrayLike[_ScalarT],
+    /,
+    *,
+    copy: bool = ...,
+    sparse: bool = ...,
+    indexing: _MeshgridIdx = ...,
+) -> tuple[NDArray[_ScalarT]]: ...
+@overload
+def meshgrid(
+    x1: ArrayLike,
+    /,
+    *,
+    copy: bool = ...,
+    sparse: bool = ...,
+    indexing: _MeshgridIdx = ...,
+) -> tuple[NDArray[Any]]: ...
+@overload
+def meshgrid(
+    x1: _ArrayLike[_ScalarT1],
+    x2: _ArrayLike[_ScalarT2],
+    /,
+    *,
+    copy: bool = ...,
+    sparse: bool = ...,
+    indexing: _MeshgridIdx = ...,
+) -> tuple[NDArray[_ScalarT1], NDArray[_ScalarT2]]: ...
+@overload
+def meshgrid(
+    x1: ArrayLike,
+    x2: _ArrayLike[_ScalarT],
+    /,
+    *,
+    copy: bool = ...,
+    sparse: bool = ...,
+    indexing: _MeshgridIdx = ...,
+) -> tuple[NDArray[Any], NDArray[_ScalarT]]: ...
+@overload
+def meshgrid(
+    x1: _ArrayLike[_ScalarT],
+    x2: ArrayLike,
+    /,
+    *,
+    copy: bool = ...,
+    sparse: bool = ...,
+    indexing: _MeshgridIdx = ...,
+) -> tuple[NDArray[_ScalarT], NDArray[Any]]: ...
+@overload
+def meshgrid(
+    x1: ArrayLike,
+    x2: ArrayLike,
+    /,
+    *,
+    copy: bool = ...,
+    sparse: bool = ...,
+    indexing: _MeshgridIdx = ...,
+) -> tuple[NDArray[Any], NDArray[Any]]: ...
+@overload
+def meshgrid(
+    x1: ArrayLike,
+    x2: ArrayLike,
+    x3: ArrayLike,
+    /,
+    *,
+    copy: bool = ...,
+    sparse: bool = ...,
+    indexing: _MeshgridIdx = ...,
+) -> tuple[NDArray[Any], NDArray[Any], NDArray[Any]]: ...
+@overload
+def meshgrid(
+    x1: ArrayLike,
+    x2: ArrayLike,
+    x3: ArrayLike,
+    x4: ArrayLike,
+    /,
+    *,
+    copy: bool = ...,
+    sparse: bool = ...,
+    indexing: _MeshgridIdx = ...,
+) -> tuple[NDArray[Any], NDArray[Any], NDArray[Any], NDArray[Any]]: ...
+@overload
+def meshgrid(
+    *xi: ArrayLike,
+    copy: bool = ...,
+    sparse: bool = ...,
+    indexing: _MeshgridIdx = ...,
+) -> tuple[NDArray[Any], ...]: ...
+
+@overload
+def delete(
+    arr: _ArrayLike[_ScalarT],
+    obj: slice | _ArrayLikeInt_co,
+    axis: SupportsIndex | None = ...,
+) -> NDArray[_ScalarT]: ...
+@overload
+def delete(
+    arr: ArrayLike,
+    obj: slice | _ArrayLikeInt_co,
+    axis: SupportsIndex | None = ...,
+) -> NDArray[Any]: ...
+
+@overload
+def insert(
+    arr: _ArrayLike[_ScalarT],
+    obj: slice | _ArrayLikeInt_co,
+    values: ArrayLike,
+    axis: SupportsIndex | None = ...,
+) -> NDArray[_ScalarT]: ...
+@overload
+def insert(
+    arr: ArrayLike,
+    obj: slice | _ArrayLikeInt_co,
+    values: ArrayLike,
+    axis: SupportsIndex | None = ...,
+) -> NDArray[Any]: ...
+
+def append(
+    arr: ArrayLike,
+    values: ArrayLike,
+    axis: SupportsIndex | None = ...,
+) -> NDArray[Any]: ...
+
+@overload
+def digitize(
+    x: _FloatLike_co,
+    bins: _ArrayLikeFloat_co,
+    right: bool = ...,
+) -> intp: ...
+@overload
+def digitize(
+    x: _ArrayLikeFloat_co,
+    bins: _ArrayLikeFloat_co,
+    right: bool = ...,
+) -> NDArray[intp]: ...

lib/python3.11/site-packages/numpy/lib/_histograms_impl.pyi

@@ -0,0 +1,50 @@
+from collections.abc import Sequence
+from typing import (
+    Any,
+    SupportsIndex,
+    TypeAlias,
+)
+from typing import (
+    Literal as L,
+)
+
+from numpy._typing import (
+    ArrayLike,
+    NDArray,
+)
+
+__all__ = ["histogram", "histogramdd", "histogram_bin_edges"]
+
+_BinKind: TypeAlias = L[
+    "stone",
+    "auto",
+    "doane",
+    "fd",
+    "rice",
+    "scott",
+    "sqrt",
+    "sturges",
+]
+
+def histogram_bin_edges(
+    a: ArrayLike,
+    bins: _BinKind | SupportsIndex | ArrayLike = ...,
+    range: tuple[float, float] | None = ...,
+    weights: ArrayLike | None = ...,
+) -> NDArray[Any]: ...
+
+def histogram(
+    a: ArrayLike,
+    bins: _BinKind | SupportsIndex | ArrayLike = ...,
+    range: tuple[float, float] | None = ...,
+    density: bool = ...,
+    weights: ArrayLike | None = ...,
+) -> tuple[NDArray[Any], NDArray[Any]]: ...
+
+def histogramdd(
+    sample: ArrayLike,
+    bins: SupportsIndex | ArrayLike = ...,
+    range: Sequence[tuple[float, float]] = ...,
+    density: bool | None = ...,
+    weights: ArrayLike | None = ...,
+) -> tuple[NDArray[Any], tuple[NDArray[Any], ...]]: ...

lib/python3.11/site-packages/numpy/lib/_index_tricks_impl.pyi

@@ -0,0 +1,196 @@
+from collections.abc import Sequence
+from typing import Any, ClassVar, Final, Generic, Self, SupportsIndex, final, overload
+from typing import Literal as L
+
+from _typeshed import Incomplete
+from typing_extensions import TypeVar, deprecated
+
+import numpy as np
+from numpy._core.multiarray import ravel_multi_index, unravel_index
+from numpy._typing import (
+    ArrayLike,
+    NDArray,
+    _AnyShape,
+    _FiniteNestedSequence,
+    _NestedSequence,
+    _SupportsArray,
+    _SupportsDType,
+)
+
+__all__ = [  # noqa: RUF022
+    "ravel_multi_index",
+    "unravel_index",
+    "mgrid",
+    "ogrid",
+    "r_",
+    "c_",
+    "s_",
+    "index_exp",
+    "ix_",
+    "ndenumerate",
+    "ndindex",
+    "fill_diagonal",
+    "diag_indices",
+    "diag_indices_from",
+]
+
+###
+
+_T = TypeVar("_T")
+_TupleT = TypeVar("_TupleT", bound=tuple[Any, ...])
+_ArrayT = TypeVar("_ArrayT", bound=NDArray[Any])
+_DTypeT = TypeVar("_DTypeT", bound=np.dtype)
+_ScalarT = TypeVar("_ScalarT", bound=np.generic)
+_ScalarT_co = TypeVar("_ScalarT_co", bound=np.generic, covariant=True)
+_BoolT_co = TypeVar("_BoolT_co", bound=bool, default=bool, covariant=True)
+
+_AxisT_co = TypeVar("_AxisT_co", bound=int, default=L[0], covariant=True)
+_MatrixT_co = TypeVar("_MatrixT_co", bound=bool, default=L[False], covariant=True)
+_NDMinT_co = TypeVar("_NDMinT_co", bound=int, default=L[1], covariant=True)
+_Trans1DT_co = TypeVar("_Trans1DT_co", bound=int, default=L[-1], covariant=True)
+
+###
+
+class ndenumerate(Generic[_ScalarT_co]):
+    @overload
+    def __new__(cls, arr: _FiniteNestedSequence[_SupportsArray[np.dtype[_ScalarT]]]) -> ndenumerate[_ScalarT]: ...
+    @overload
+    def __new__(cls, arr: str | _NestedSequence[str]) -> ndenumerate[np.str_]: ...
+    @overload
+    def __new__(cls, arr: bytes | _NestedSequence[bytes]) -> ndenumerate[np.bytes_]: ...
+    @overload
+    def __new__(cls, arr: bool | _NestedSequence[bool]) -> ndenumerate[np.bool]: ...
+    @overload
+    def __new__(cls, arr: int | _NestedSequence[int]) -> ndenumerate[np.intp]: ...
+    @overload
+    def __new__(cls, arr: float | _NestedSequence[float]) -> ndenumerate[np.float64]: ...
+    @overload
+    def __new__(cls, arr: complex | _NestedSequence[complex]) -> ndenumerate[np.complex128]: ...
+    @overload
+    def __new__(cls, arr: object) -> ndenumerate[Any]: ...
+
+    # The first overload is a (semi-)workaround for a mypy bug (tested with v1.10 and v1.11)
+    @overload
+    def __next__(
+        self: ndenumerate[np.bool | np.number | np.flexible | np.datetime64 | np.timedelta64],
+        /,
+    ) -> tuple[_AnyShape, _ScalarT_co]: ...
+    @overload
+    def __next__(self: ndenumerate[np.object_], /) -> tuple[_AnyShape, Incomplete]: ...
+    @overload
+    def __next__(self, /) -> tuple[_AnyShape, _ScalarT_co]: ...
+
+    #
+    def __iter__(self) -> Self: ...
+
+class ndindex:
+    @overload
+    def __init__(self, shape: tuple[SupportsIndex, ...], /) -> None: ...
+    @overload
+    def __init__(self, /, *shape: SupportsIndex) -> None: ...
+
+    #
+    def __iter__(self) -> Self: ...
+    def __next__(self) -> _AnyShape: ...
+
+    #
+    @deprecated("Deprecated since 1.20.0.")
+    def ndincr(self, /) -> None: ...
+
+class nd_grid(Generic[_BoolT_co]):
+    sparse: _BoolT_co
+    def __init__(self, sparse: _BoolT_co = ...) -> None: ...
+    @overload
+    def __getitem__(self: nd_grid[L[False]], key: slice | Sequence[slice]) -> NDArray[Incomplete]: ...
+    @overload
+    def __getitem__(self: nd_grid[L[True]], key: slice | Sequence[slice]) -> tuple[NDArray[Incomplete], ...]: ...
+
+@final
+class MGridClass(nd_grid[L[False]]):
+    def __init__(self) -> None: ...
+
+@final
+class OGridClass(nd_grid[L[True]]):
+    def __init__(self) -> None: ...
+
+class AxisConcatenator(Generic[_AxisT_co, _MatrixT_co, _NDMinT_co, _Trans1DT_co]):
+    __slots__ = "axis", "matrix", "ndmin", "trans1d"
+
+    makemat: ClassVar[type[np.matrix[tuple[int, int], np.dtype]]]
+
+    axis: _AxisT_co
+    matrix: _MatrixT_co
+    ndmin: _NDMinT_co
+    trans1d: _Trans1DT_co
+
+    #
+    def __init__(
+        self,
+        /,
+        axis: _AxisT_co = ...,
+        matrix: _MatrixT_co = ...,
+        ndmin: _NDMinT_co = ...,
+        trans1d: _Trans1DT_co = ...,
+    ) -> None: ...
+
+    # TODO(jorenham): annotate this
+    def __getitem__(self, key: Incomplete, /) -> Incomplete: ...
+    def __len__(self, /) -> L[0]: ...
+
+    #
+    @staticmethod
+    @overload
+    def concatenate(*a: ArrayLike, axis: SupportsIndex | None = 0, out: _ArrayT) -> _ArrayT: ...
+    @staticmethod
+    @overload
+    def concatenate(*a: ArrayLike, axis: SupportsIndex | None = 0, out: None = None) -> NDArray[Incomplete]: ...
+
+@final
+class RClass(AxisConcatenator[L[0], L[False], L[1], L[-1]]):
+    def __init__(self, /) -> None: ...
+
+@final
+class CClass(AxisConcatenator[L[-1], L[False], L[2], L[0]]):
+    def __init__(self, /) -> None: ...
+
+class IndexExpression(Generic[_BoolT_co]):
+    maketuple: _BoolT_co
+    def __init__(self, maketuple: _BoolT_co) -> None: ...
+    @overload
+    def __getitem__(self, item: _TupleT) -> _TupleT: ...
+    @overload
+    def __getitem__(self: IndexExpression[L[True]], item: _T) -> tuple[_T]: ...
+    @overload
+    def __getitem__(self: IndexExpression[L[False]], item: _T) -> _T: ...
+
+@overload
+def ix_(*args: _FiniteNestedSequence[_SupportsDType[_DTypeT]]) -> tuple[np.ndarray[_AnyShape, _DTypeT], ...]: ...
+@overload
+def ix_(*args: str | _NestedSequence[str]) -> tuple[NDArray[np.str_], ...]: ...
+@overload
+def ix_(*args: bytes | _NestedSequence[bytes]) -> tuple[NDArray[np.bytes_], ...]: ...
+@overload
+def ix_(*args: bool | _NestedSequence[bool]) -> tuple[NDArray[np.bool], ...]: ...
+@overload
+def ix_(*args: int | _NestedSequence[int]) -> tuple[NDArray[np.intp], ...]: ...
+@overload
+def ix_(*args: float | _NestedSequence[float]) -> tuple[NDArray[np.float64], ...]: ...
+@overload
+def ix_(*args: complex | _NestedSequence[complex]) -> tuple[NDArray[np.complex128], ...]: ...
+
+#
+def fill_diagonal(a: NDArray[Any], val: object, wrap: bool = ...) -> None: ...
+
+#
+def diag_indices(n: int, ndim: int = ...) -> tuple[NDArray[np.intp], ...]: ...
+def diag_indices_from(arr: ArrayLike) -> tuple[NDArray[np.intp], ...]: ...
+
+#
+mgrid: Final[MGridClass] = ...
+ogrid: Final[OGridClass] = ...
+
+r_: Final[RClass] = ...
+c_: Final[CClass] = ...
+
+index_exp: Final[IndexExpression[L[True]]] = ...
+s_: Final[IndexExpression[L[False]]] = ...

lib/python3.11/site-packages/numpy/lib/_iotools.py

@@ -0,0 +1,900 @@
+"""A collection of functions designed to help I/O with ascii files.
+
+"""
+__docformat__ = "restructuredtext en"
+
+import itertools
+
+import numpy as np
+import numpy._core.numeric as nx
+from numpy._utils import asbytes, asunicode
+
+
+def _decode_line(line, encoding=None):
+    """Decode bytes from binary input streams.
+
+    Defaults to decoding from 'latin1'.
+
+    Parameters
+    ----------
+    line : str or bytes
+         Line to be decoded.
+    encoding : str
+         Encoding used to decode `line`.
+
+    Returns
+    -------
+    decoded_line : str
+
+    """
+    if type(line) is bytes:
+        if encoding is None:
+            encoding = "latin1"
+        line = line.decode(encoding)
+
+    return line
+
+
+def _is_string_like(obj):
+    """
+    Check whether obj behaves like a string.
+    """
+    try:
+        obj + ''
+    except (TypeError, ValueError):
+        return False
+    return True
+
+
+def _is_bytes_like(obj):
+    """
+    Check whether obj behaves like a bytes object.
+    """
+    try:
+        obj + b''
+    except (TypeError, ValueError):
+        return False
+    return True
+
+
+def has_nested_fields(ndtype):
+    """
+    Returns whether one or several fields of a dtype are nested.
+
+    Parameters
+    ----------
+    ndtype : dtype
+        Data-type of a structured array.
+
+    Raises
+    ------
+    AttributeError
+        If `ndtype` does not have a `names` attribute.
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> dt = np.dtype([('name', 'S4'), ('x', float), ('y', float)])
+    >>> np.lib._iotools.has_nested_fields(dt)
+    False
+
+    """
+    return any(ndtype[name].names is not None for name in ndtype.names or ())
+
+
+def flatten_dtype(ndtype, flatten_base=False):
+    """
+    Unpack a structured data-type by collapsing nested fields and/or fields
+    with a shape.
+
+    Note that the field names are lost.
+
+    Parameters
+    ----------
+    ndtype : dtype
+        The datatype to collapse
+    flatten_base : bool, optional
+       If True, transform a field with a shape into several fields. Default is
+       False.
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> dt = np.dtype([('name', 'S4'), ('x', float), ('y', float),
+    ...                ('block', int, (2, 3))])
+    >>> np.lib._iotools.flatten_dtype(dt)
+    [dtype('S4'), dtype('float64'), dtype('float64'), dtype('int64')]
+    >>> np.lib._iotools.flatten_dtype(dt, flatten_base=True)
+    [dtype('S4'),
+     dtype('float64'),
+     dtype('float64'),
+     dtype('int64'),
+     dtype('int64'),
+     dtype('int64'),
+     dtype('int64'),
+     dtype('int64'),
+     dtype('int64')]
+
+    """
+    names = ndtype.names
+    if names is None:
+        if flatten_base:
+            return [ndtype.base] * int(np.prod(ndtype.shape))
+        return [ndtype.base]
+    else:
+        types = []
+        for field in names:
+            info = ndtype.fields[field]
+            flat_dt = flatten_dtype(info[0], flatten_base)
+            types.extend(flat_dt)
+        return types
+
+
+class LineSplitter:
+    """
+    Object to split a string at a given delimiter or at given places.
+
+    Parameters
+    ----------
+    delimiter : str, int, or sequence of ints, optional
+        If a string, character used to delimit consecutive fields.
+        If an integer or a sequence of integers, width(s) of each field.
+    comments : str, optional
+        Character used to mark the beginning of a comment. Default is '#'.
+    autostrip : bool, optional
+        Whether to strip each individual field. Default is True.
+
+    """
+
+    def autostrip(self, method):
+        """
+        Wrapper to strip each member of the output of `method`.
+
+        Parameters
+        ----------
+        method : function
+            Function that takes a single argument and returns a sequence of
+            strings.
+
+        Returns
+        -------
+        wrapped : function
+            The result of wrapping `method`. `wrapped` takes a single input
+            argument and returns a list of strings that are stripped of
+            white-space.
+
+        """
+        return lambda input: [_.strip() for _ in method(input)]
+
+    def __init__(self, delimiter=None, comments='#', autostrip=True,
+                 encoding=None):
+        delimiter = _decode_line(delimiter)
+        comments = _decode_line(comments)
+
+        self.comments = comments
+
+        # Delimiter is a character
+        if (delimiter is None) or isinstance(delimiter, str):
+            delimiter = delimiter or None
+            _handyman = self._delimited_splitter
+        # Delimiter is a list of field widths
+        elif hasattr(delimiter, '__iter__'):
+            _handyman = self._variablewidth_splitter
+            idx = np.cumsum([0] + list(delimiter))
+            delimiter = [slice(i, j) for (i, j) in itertools.pairwise(idx)]
+        # Delimiter is a single integer
+        elif int(delimiter):
+            (_handyman, delimiter) = (
+                    self._fixedwidth_splitter, int(delimiter))
+        else:
+            (_handyman, delimiter) = (self._delimited_splitter, None)
+        self.delimiter = delimiter
+        if autostrip:
+            self._handyman = self.autostrip(_handyman)
+        else:
+            self._handyman = _handyman
+        self.encoding = encoding
+
+    def _delimited_splitter(self, line):
+        """Chop off comments, strip, and split at delimiter. """
+        if self.comments is not None:
+            line = line.split(self.comments)[0]
+        line = line.strip(" \r\n")
+        if not line:
+            return []
+        return line.split(self.delimiter)
+
+    def _fixedwidth_splitter(self, line):
+        if self.comments is not None:
+            line = line.split(self.comments)[0]
+        line = line.strip("\r\n")
+        if not line:
+            return []
+        fixed = self.delimiter
+        slices = [slice(i, i + fixed) for i in range(0, len(line), fixed)]
+        return [line[s] for s in slices]
+
+    def _variablewidth_splitter(self, line):
+        if self.comments is not None:
+            line = line.split(self.comments)[0]
+        if not line:
+            return []
+        slices = self.delimiter
+        return [line[s] for s in slices]
+
+    def __call__(self, line):
+        return self._handyman(_decode_line(line, self.encoding))
+
+
+class NameValidator:
+    """
+    Object to validate a list of strings to use as field names.
+
+    The strings are stripped of any non alphanumeric character, and spaces
+    are replaced by '_'. During instantiation, the user can define a list
+    of names to exclude, as well as a list of invalid characters. Names in
+    the exclusion list are appended a '_' character.
+
+    Once an instance has been created, it can be called with a list of
+    names, and a list of valid names will be created.  The `__call__`
+    method accepts an optional keyword "default" that sets the default name
+    in case of ambiguity. By default this is 'f', so that names will
+    default to `f0`, `f1`, etc.
+
+    Parameters
+    ----------
+    excludelist : sequence, optional
+        A list of names to exclude. This list is appended to the default
+        list ['return', 'file', 'print']. Excluded names are appended an
+        underscore: for example, `file` becomes `file_` if supplied.
+    deletechars : str, optional
+        A string combining invalid characters that must be deleted from the
+        names.
+    case_sensitive : {True, False, 'upper', 'lower'}, optional
+        * If True, field names are case-sensitive.
+        * If False or 'upper', field names are converted to upper case.
+        * If 'lower', field names are converted to lower case.
+
+        The default value is True.
+    replace_space : '_', optional
+        Character(s) used in replacement of white spaces.
+
+    Notes
+    -----
+    Calling an instance of `NameValidator` is the same as calling its
+    method `validate`.
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> validator = np.lib._iotools.NameValidator()
+    >>> validator(['file', 'field2', 'with space', 'CaSe'])
+    ('file_', 'field2', 'with_space', 'CaSe')
+
+    >>> validator = np.lib._iotools.NameValidator(excludelist=['excl'],
+    ...                                           deletechars='q',
+    ...                                           case_sensitive=False)
+    >>> validator(['excl', 'field2', 'no_q', 'with space', 'CaSe'])
+    ('EXCL', 'FIELD2', 'NO_Q', 'WITH_SPACE', 'CASE')
+
+    """
+
+    defaultexcludelist = 'return', 'file', 'print'
+    defaultdeletechars = frozenset(r"""~!@#$%^&*()-=+~\|]}[{';: /?.>,<""")
+
+    def __init__(self, excludelist=None, deletechars=None,
+                 case_sensitive=None, replace_space='_'):
+        # Process the exclusion list ..
+        if excludelist is None:
+            excludelist = []
+        excludelist.extend(self.defaultexcludelist)
+        self.excludelist = excludelist
+        # Process the list of characters to delete
+        if deletechars is None:
+            delete = set(self.defaultdeletechars)
+        else:
+            delete = set(deletechars)
+        delete.add('"')
+        self.deletechars = delete
+        # Process the case option .....
+        if (case_sensitive is None) or (case_sensitive is True):
+            self.case_converter = lambda x: x
+        elif (case_sensitive is False) or case_sensitive.startswith('u'):
+            self.case_converter = lambda x: x.upper()
+        elif case_sensitive.startswith('l'):
+            self.case_converter = lambda x: x.lower()
+        else:
+            msg = f'unrecognized case_sensitive value {case_sensitive}.'
+            raise ValueError(msg)
+
+        self.replace_space = replace_space
+
+    def validate(self, names, defaultfmt="f%i", nbfields=None):
+        """
+        Validate a list of strings as field names for a structured array.
+
+        Parameters
+        ----------
+        names : sequence of str
+            Strings to be validated.
+        defaultfmt : str, optional
+            Default format string, used if validating a given string
+            reduces its length to zero.
+        nbfields : integer, optional
+            Final number of validated names, used to expand or shrink the
+            initial list of names.
+
+        Returns
+        -------
+        validatednames : list of str
+            The list of validated field names.
+
+        Notes
+        -----
+        A `NameValidator` instance can be called directly, which is the
+        same as calling `validate`. For examples, see `NameValidator`.
+
+        """
+        # Initial checks ..............
+        if (names is None):
+            if (nbfields is None):
+                return None
+            names = []
+        if isinstance(names, str):
+            names = [names, ]
+        if nbfields is not None:
+            nbnames = len(names)
+            if (nbnames < nbfields):
+                names = list(names) + [''] * (nbfields - nbnames)
+            elif (nbnames > nbfields):
+                names = names[:nbfields]
+        # Set some shortcuts ...........
+        deletechars = self.deletechars
+        excludelist = self.excludelist
+        case_converter = self.case_converter
+        replace_space = self.replace_space
+        # Initializes some variables ...
+        validatednames = []
+        seen = {}
+        nbempty = 0
+
+        for item in names:
+            item = case_converter(item).strip()
+            if replace_space:
+                item = item.replace(' ', replace_space)
+            item = ''.join([c for c in item if c not in deletechars])
+            if item == '':
+                item = defaultfmt % nbempty
+                while item in names:
+                    nbempty += 1
+                    item = defaultfmt % nbempty
+                nbempty += 1
+            elif item in excludelist:
+                item += '_'
+            cnt = seen.get(item, 0)
+            if cnt > 0:
+                validatednames.append(item + '_%d' % cnt)
+            else:
+                validatednames.append(item)
+            seen[item] = cnt + 1
+        return tuple(validatednames)
+
+    def __call__(self, names, defaultfmt="f%i", nbfields=None):
+        return self.validate(names, defaultfmt=defaultfmt, nbfields=nbfields)
+
+
+def str2bool(value):
+    """
+    Tries to transform a string supposed to represent a boolean to a boolean.
+
+    Parameters
+    ----------
+    value : str
+        The string that is transformed to a boolean.
+
+    Returns
+    -------
+    boolval : bool
+        The boolean representation of `value`.
+
+    Raises
+    ------
+    ValueError
+        If the string is not 'True' or 'False' (case independent)
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> np.lib._iotools.str2bool('TRUE')
+    True
+    >>> np.lib._iotools.str2bool('false')
+    False
+
+    """
+    value = value.upper()
+    if value == 'TRUE':
+        return True
+    elif value == 'FALSE':
+        return False
+    else:
+        raise ValueError("Invalid boolean")
+
+
+class ConverterError(Exception):
+    """
+    Exception raised when an error occurs in a converter for string values.
+
+    """
+    pass
+
+
+class ConverterLockError(ConverterError):
+    """
+    Exception raised when an attempt is made to upgrade a locked converter.
+
+    """
+    pass
+
+
+class ConversionWarning(UserWarning):
+    """
+    Warning issued when a string converter has a problem.
+
+    Notes
+    -----
+    In `genfromtxt` a `ConversionWarning` is issued if raising exceptions
+    is explicitly suppressed with the "invalid_raise" keyword.
+
+    """
+    pass
+
+
+class StringConverter:
+    """
+    Factory class for function transforming a string into another object
+    (int, float).
+
+    After initialization, an instance can be called to transform a string
+    into another object. If the string is recognized as representing a
+    missing value, a default value is returned.
+
+    Attributes
+    ----------
+    func : function
+        Function used for the conversion.
+    default : any
+        Default value to return when the input corresponds to a missing
+        value.
+    type : type
+        Type of the output.
+    _status : int
+        Integer representing the order of the conversion.
+    _mapper : sequence of tuples
+        Sequence of tuples (dtype, function, default value) to evaluate in
+        order.
+    _locked : bool
+        Holds `locked` parameter.
+
+    Parameters
+    ----------
+    dtype_or_func : {None, dtype, function}, optional
+        If a `dtype`, specifies the input data type, used to define a basic
+        function and a default value for missing data. For example, when
+        `dtype` is float, the `func` attribute is set to `float` and the
+        default value to `np.nan`.  If a function, this function is used to
+        convert a string to another object. In this case, it is recommended
+        to give an associated default value as input.
+    default : any, optional
+        Value to return by default, that is, when the string to be
+        converted is flagged as missing. If not given, `StringConverter`
+        tries to supply a reasonable default value.
+    missing_values : {None, sequence of str}, optional
+        ``None`` or sequence of strings indicating a missing value. If ``None``
+        then missing values are indicated by empty entries. The default is
+        ``None``.
+    locked : bool, optional
+        Whether the StringConverter should be locked to prevent automatic
+        upgrade or not. Default is False.
+
+    """
+    _mapper = [(nx.bool, str2bool, False),
+               (nx.int_, int, -1),]
+
+    # On 32-bit systems, we need to make sure that we explicitly include
+    # nx.int64 since ns.int_ is nx.int32.
+    if nx.dtype(nx.int_).itemsize < nx.dtype(nx.int64).itemsize:
+        _mapper.append((nx.int64, int, -1))
+
+    _mapper.extend([(nx.float64, float, nx.nan),
+                    (nx.complex128, complex, nx.nan + 0j),
+                    (nx.longdouble, nx.longdouble, nx.nan),
+                    # If a non-default dtype is passed, fall back to generic
+                    # ones (should only be used for the converter)
+                    (nx.integer, int, -1),
+                    (nx.floating, float, nx.nan),
+                    (nx.complexfloating, complex, nx.nan + 0j),
+                    # Last, try with the string types (must be last, because
+                    # `_mapper[-1]` is used as default in some cases)
+                    (nx.str_, asunicode, '???'),
+                    (nx.bytes_, asbytes, '???'),
+                    ])
+
+    @classmethod
+    def _getdtype(cls, val):
+        """Returns the dtype of the input variable."""
+        return np.array(val).dtype
+
+    @classmethod
+    def _getsubdtype(cls, val):
+        """Returns the type of the dtype of the input variable."""
+        return np.array(val).dtype.type
+
+    @classmethod
+    def _dtypeortype(cls, dtype):
+        """Returns dtype for datetime64 and type of dtype otherwise."""
+
+        # This is a bit annoying. We want to return the "general" type in most
+        # cases (ie. "string" rather than "S10"), but we want to return the
+        # specific type for datetime64 (ie. "datetime64[us]" rather than
+        # "datetime64").
+        if dtype.type == np.datetime64:
+            return dtype
+        return dtype.type
+
+    @classmethod
+    def upgrade_mapper(cls, func, default=None):
+        """
+        Upgrade the mapper of a StringConverter by adding a new function and
+        its corresponding default.
+
+        The input function (or sequence of functions) and its associated
+        default value (if any) is inserted in penultimate position of the
+        mapper.  The corresponding type is estimated from the dtype of the
+        default value.
+
+        Parameters
+        ----------
+        func : var
+            Function, or sequence of functions
+
+        Examples
+        --------
+        >>> import dateutil.parser
+        >>> import datetime
+        >>> dateparser = dateutil.parser.parse
+        >>> defaultdate = datetime.date(2000, 1, 1)
+        >>> StringConverter.upgrade_mapper(dateparser, default=defaultdate)
+        """
+        # Func is a single functions
+        if callable(func):
+            cls._mapper.insert(-1, (cls._getsubdtype(default), func, default))
+            return
+        elif hasattr(func, '__iter__'):
+            if isinstance(func[0], (tuple, list)):
+                for _ in func:
+                    cls._mapper.insert(-1, _)
+                return
+            if default is None:
+                default = [None] * len(func)
+            else:
+                default = list(default)
+                default.append([None] * (len(func) - len(default)))
+            for fct, dft in zip(func, default):
+                cls._mapper.insert(-1, (cls._getsubdtype(dft), fct, dft))
+
+    @classmethod
+    def _find_map_entry(cls, dtype):
+        # if a converter for the specific dtype is available use that
+        for i, (deftype, func, default_def) in enumerate(cls._mapper):
+            if dtype.type == deftype:
+                return i, (deftype, func, default_def)
+
+        # otherwise find an inexact match
+        for i, (deftype, func, default_def) in enumerate(cls._mapper):
+            if np.issubdtype(dtype.type, deftype):
+                return i, (deftype, func, default_def)
+
+        raise LookupError
+
+    def __init__(self, dtype_or_func=None, default=None, missing_values=None,
+                 locked=False):
+        # Defines a lock for upgrade
+        self._locked = bool(locked)
+        # No input dtype: minimal initialization
+        if dtype_or_func is None:
+            self.func = str2bool
+            self._status = 0
+            self.default = default or False
+            dtype = np.dtype('bool')
+        else:
+            # Is the input a np.dtype ?
+            try:
+                self.func = None
+                dtype = np.dtype(dtype_or_func)
+            except TypeError:
+                # dtype_or_func must be a function, then
+                if not callable(dtype_or_func):
+                    errmsg = ("The input argument `dtype` is neither a"
+                              " function nor a dtype (got '%s' instead)")
+                    raise TypeError(errmsg % type(dtype_or_func))
+                # Set the function
+                self.func = dtype_or_func
+                # If we don't have a default, try to guess it or set it to
+                # None
+                if default is None:
+                    try:
+                        default = self.func('0')
+                    except ValueError:
+                        default = None
+                dtype = self._getdtype(default)
+
+            # find the best match in our mapper
+            try:
+                self._status, (_, func, default_def) = self._find_map_entry(dtype)
+            except LookupError:
+                # no match
+                self.default = default
+                _, func, _ = self._mapper[-1]
+                self._status = 0
+            else:
+                # use the found default only if we did not already have one
+                if default is None:
+                    self.default = default_def
+                else:
+                    self.default = default
+
+            # If the input was a dtype, set the function to the last we saw
+            if self.func is None:
+                self.func = func
+
+            # If the status is 1 (int), change the function to
+            # something more robust.
+            if self.func == self._mapper[1][1]:
+                if issubclass(dtype.type, np.uint64):
+                    self.func = np.uint64
+                elif issubclass(dtype.type, np.int64):
+                    self.func = np.int64
+                else:
+                    self.func = lambda x: int(float(x))
+        # Store the list of strings corresponding to missing values.
+        if missing_values is None:
+            self.missing_values = {''}
+        else:
+            if isinstance(missing_values, str):
+                missing_values = missing_values.split(",")
+            self.missing_values = set(list(missing_values) + [''])
+
+        self._callingfunction = self._strict_call
+        self.type = self._dtypeortype(dtype)
+        self._checked = False
+        self._initial_default = default
+
+    def _loose_call(self, value):
+        try:
+            return self.func(value)
+        except ValueError:
+            return self.default
+
+    def _strict_call(self, value):
+        try:
+
+            # We check if we can convert the value using the current function
+            new_value = self.func(value)
+
+            # In addition to having to check whether func can convert the
+            # value, we also have to make sure that we don't get overflow
+            # errors for integers.
+            if self.func is int:
+                try:
+                    np.array(value, dtype=self.type)
+                except OverflowError:
+                    raise ValueError
+
+            # We're still here so we can now return the new value
+            return new_value
+
+        except ValueError:
+            if value.strip() in self.missing_values:
+                if not self._status:
+                    self._checked = False
+                return self.default
+            raise ValueError(f"Cannot convert string '{value}'")
+
+    def __call__(self, value):
+        return self._callingfunction(value)
+
+    def _do_upgrade(self):
+        # Raise an exception if we locked the converter...
+        if self._locked:
+            errmsg = "Converter is locked and cannot be upgraded"
+            raise ConverterLockError(errmsg)
+        _statusmax = len(self._mapper)
+        # Complains if we try to upgrade by the maximum
+        _status = self._status
+        if _status == _statusmax:
+            errmsg = "Could not find a valid conversion function"
+            raise ConverterError(errmsg)
+        elif _status < _statusmax - 1:
+            _status += 1
+        self.type, self.func, default = self._mapper[_status]
+        self._status = _status
+        if self._initial_default is not None:
+            self.default = self._initial_default
+        else:
+            self.default = default
+
+    def upgrade(self, value):
+        """
+        Find the best converter for a given string, and return the result.
+
+        The supplied string `value` is converted by testing different
+        converters in order. First the `func` method of the
+        `StringConverter` instance is tried, if this fails other available
+        converters are tried.  The order in which these other converters
+        are tried is determined by the `_status` attribute of the instance.
+
+        Parameters
+        ----------
+        value : str
+            The string to convert.
+
+        Returns
+        -------
+        out : any
+            The result of converting `value` with the appropriate converter.
+
+        """
+        self._checked = True
+        try:
+            return self._strict_call(value)
+        except ValueError:
+            self._do_upgrade()
+            return self.upgrade(value)
+
+    def iterupgrade(self, value):
+        self._checked = True
+        if not hasattr(value, '__iter__'):
+            value = (value,)
+        _strict_call = self._strict_call
+        try:
+            for _m in value:
+                _strict_call(_m)
+        except ValueError:
+            self._do_upgrade()
+            self.iterupgrade(value)
+
+    def update(self, func, default=None, testing_value=None,
+               missing_values='', locked=False):
+        """
+        Set StringConverter attributes directly.
+
+        Parameters
+        ----------
+        func : function
+            Conversion function.
+        default : any, optional
+            Value to return by default, that is, when the string to be
+            converted is flagged as missing. If not given,
+            `StringConverter` tries to supply a reasonable default value.
+        testing_value : str, optional
+            A string representing a standard input value of the converter.
+            This string is used to help defining a reasonable default
+            value.
+        missing_values : {sequence of str, None}, optional
+            Sequence of strings indicating a missing value. If ``None``, then
+            the existing `missing_values` are cleared. The default is ``''``.
+        locked : bool, optional
+            Whether the StringConverter should be locked to prevent
+            automatic upgrade or not. Default is False.
+
+        Notes
+        -----
+        `update` takes the same parameters as the constructor of
+        `StringConverter`, except that `func` does not accept a `dtype`
+        whereas `dtype_or_func` in the constructor does.
+
+        """
+        self.func = func
+        self._locked = locked
+
+        # Don't reset the default to None if we can avoid it
+        if default is not None:
+            self.default = default
+            self.type = self._dtypeortype(self._getdtype(default))
+        else:
+            try:
+                tester = func(testing_value or '1')
+            except (TypeError, ValueError):
+                tester = None
+            self.type = self._dtypeortype(self._getdtype(tester))
+
+        # Add the missing values to the existing set or clear it.
+        if missing_values is None:
+            # Clear all missing values even though the ctor initializes it to
+            # set(['']) when the argument is None.
+            self.missing_values = set()
+        else:
+            if not np.iterable(missing_values):
+                missing_values = [missing_values]
+            if not all(isinstance(v, str) for v in missing_values):
+                raise TypeError("missing_values must be strings or unicode")
+            self.missing_values.update(missing_values)
+
+
+def easy_dtype(ndtype, names=None, defaultfmt="f%i", **validationargs):
+    """
+    Convenience function to create a `np.dtype` object.
+
+    The function processes the input `dtype` and matches it with the given
+    names.
+
+    Parameters
+    ----------
+    ndtype : var
+        Definition of the dtype. Can be any string or dictionary recognized
+        by the `np.dtype` function, or a sequence of types.
+    names : str or sequence, optional
+        Sequence of strings to use as field names for a structured dtype.
+        For convenience, `names` can be a string of a comma-separated list
+        of names.
+    defaultfmt : str, optional
+        Format string used to define missing names, such as ``"f%i"``
+        (default) or ``"fields_%02i"``.
+    validationargs : optional
+        A series of optional arguments used to initialize a
+        `NameValidator`.
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> np.lib._iotools.easy_dtype(float)
+    dtype('float64')
+    >>> np.lib._iotools.easy_dtype("i4, f8")
+    dtype([('f0', '<i4'), ('f1', '<f8')])
+    >>> np.lib._iotools.easy_dtype("i4, f8", defaultfmt="field_%03i")
+    dtype([('field_000', '<i4'), ('field_001', '<f8')])
+
+    >>> np.lib._iotools.easy_dtype((int, float, float), names="a,b,c")
+    dtype([('a', '<i8'), ('b', '<f8'), ('c', '<f8')])
+    >>> np.lib._iotools.easy_dtype(float, names="a,b,c")
+    dtype([('a', '<f8'), ('b', '<f8'), ('c', '<f8')])
+
+    """
+    try:
+        ndtype = np.dtype(ndtype)
+    except TypeError:
+        validate = NameValidator(**validationargs)
+        nbfields = len(ndtype)
+        if names is None:
+            names = [''] * len(ndtype)
+        elif isinstance(names, str):
+            names = names.split(",")
+        names = validate(names, nbfields=nbfields, defaultfmt=defaultfmt)
+        ndtype = np.dtype({"formats": ndtype, "names": names})
+    else:
+        # Explicit names
+        if names is not None:
+            validate = NameValidator(**validationargs)
+            if isinstance(names, str):
+                names = names.split(",")
+            # Simple dtype: repeat to match the nb of names
+            if ndtype.names is None:
+                formats = tuple([ndtype.type] * len(names))
+                names = validate(names, defaultfmt=defaultfmt)
+                ndtype = np.dtype(list(zip(names, formats)))
+            # Structured dtype: just validate the names as needed
+            else:
+                ndtype.names = validate(names, nbfields=len(ndtype.names),
+                                        defaultfmt=defaultfmt)
+        # No implicit names
+        elif ndtype.names is not None:
+            validate = NameValidator(**validationargs)
+            # Default initial names : should we change the format ?
+            numbered_names = tuple(f"f{i}" for i in range(len(ndtype.names)))
+            if ((ndtype.names == numbered_names) and (defaultfmt != "f%i")):
+                ndtype.names = validate([''] * len(ndtype.names),
+                                        defaultfmt=defaultfmt)
+            # Explicit initial names : just validate
+            else:
+                ndtype.names = validate(ndtype.names, defaultfmt=defaultfmt)
+    return ndtype

lib/python3.11/site-packages/numpy/lib/_iotools.pyi

@@ -0,0 +1,114 @@
+from collections.abc import Callable, Iterable, Sequence
+from typing import (
+    Any,
+    ClassVar,
+    Final,
+    Literal,
+    TypedDict,
+    TypeVar,
+    Unpack,
+    overload,
+    type_check_only,
+)
+
+import numpy as np
+import numpy.typing as npt
+
+_T = TypeVar("_T")
+
+@type_check_only
+class _ValidationKwargs(TypedDict, total=False):
+    excludelist: Iterable[str] | None
+    deletechars: Iterable[str] | None
+    case_sensitive: Literal["upper", "lower"] | bool | None
+    replace_space: str
+
+###
+
+__docformat__: Final[str] = "restructuredtext en"
+
+class ConverterError(Exception): ...
+class ConverterLockError(ConverterError): ...
+class ConversionWarning(UserWarning): ...
+
+class LineSplitter:
+    delimiter: str | int | Iterable[int] | None
+    comments: str
+    encoding: str | None
+
+    def __init__(
+        self,
+        /,
+        delimiter: str | bytes | int | Iterable[int] | None = None,
+        comments: str | bytes = "#",
+        autostrip: bool = True,
+        encoding: str | None = None,
+    ) -> None: ...
+    def __call__(self, /, line: str | bytes) -> list[str]: ...
+    def autostrip(self, /, method: Callable[[_T], Iterable[str]]) -> Callable[[_T], list[str]]: ...
+
+class NameValidator:
+    defaultexcludelist: ClassVar[Sequence[str]]
+    defaultdeletechars: ClassVar[Sequence[str]]
+    excludelist: list[str]
+    deletechars: set[str]
+    case_converter: Callable[[str], str]
+    replace_space: str
+
+    def __init__(
+        self,
+        /,
+        excludelist: Iterable[str] | None = None,
+        deletechars: Iterable[str] | None = None,
+        case_sensitive: Literal["upper", "lower"] | bool | None = None,
+        replace_space: str = "_",
+    ) -> None: ...
+    def __call__(self, /, names: Iterable[str], defaultfmt: str = "f%i", nbfields: int | None = None) -> tuple[str, ...]: ...
+    def validate(self, /, names: Iterable[str], defaultfmt: str = "f%i", nbfields: int | None = None) -> tuple[str, ...]: ...
+
+class StringConverter:
+    func: Callable[[str], Any] | None
+    default: Any
+    missing_values: set[str]
+    type: np.dtype[np.datetime64] | np.generic
+
+    def __init__(
+        self,
+        /,
+        dtype_or_func: npt.DTypeLike | None = None,
+        default: None = None,
+        missing_values: Iterable[str] | None = None,
+        locked: bool = False,
+    ) -> None: ...
+    def update(
+        self,
+        /,
+        func: Callable[[str], Any],
+        default: object | None = None,
+        testing_value: str | None = None,
+        missing_values: str = "",
+        locked: bool = False,
+    ) -> None: ...
+    #
+    def __call__(self, /, value: str) -> Any: ...
+    def upgrade(self, /, value: str) -> Any: ...
+    def iterupgrade(self, /, value: Iterable[str] | str) -> None: ...
+
+    #
+    @classmethod
+    def upgrade_mapper(cls, func: Callable[[str], Any], default: object | None = None) -> None: ...
+
+@overload
+def str2bool(value: Literal["false", "False", "FALSE"]) -> Literal[False]: ...
+@overload
+def str2bool(value: Literal["true", "True", "TRUE"]) -> Literal[True]: ...
+
+#
+def has_nested_fields(ndtype: np.dtype[np.void]) -> bool: ...
+def flatten_dtype(ndtype: np.dtype[np.void], flatten_base: bool = False) -> type[np.dtype]: ...
+def easy_dtype(
+    ndtype: npt.DTypeLike,
+    names: Iterable[str] | None = None,
+    defaultfmt: str = "f%i",
+    **validationargs: Unpack[_ValidationKwargs],
+) -> np.dtype[np.void]: ...

lib/python3.11/site-packages/numpy/lib/_nanfunctions_impl.pyi

@@ -0,0 +1,52 @@
+from numpy._core.fromnumeric import (
+    amax,
+    amin,
+    argmax,
+    argmin,
+    cumprod,
+    cumsum,
+    mean,
+    prod,
+    std,
+    sum,
+    var,
+)
+from numpy.lib._function_base_impl import (
+    median,
+    percentile,
+    quantile,
+)
+
+__all__ = [
+    "nansum",
+    "nanmax",
+    "nanmin",
+    "nanargmax",
+    "nanargmin",
+    "nanmean",
+    "nanmedian",
+    "nanpercentile",
+    "nanvar",
+    "nanstd",
+    "nanprod",
+    "nancumsum",
+    "nancumprod",
+    "nanquantile",
+]
+
+# NOTE: In reality these functions are not aliases but distinct functions
+# with identical signatures.
+nanmin = amin
+nanmax = amax
+nanargmin = argmin
+nanargmax = argmax
+nansum = sum
+nanprod = prod
+nancumsum = cumsum
+nancumprod = cumprod
+nanmean = mean
+nanvar = var
+nanstd = std
+nanmedian = median
+nanpercentile = percentile
+nanquantile = quantile

lib/python3.11/site-packages/numpy/lib/_npyio_impl.pyi

@@ -0,0 +1,301 @@
+import types
+import zipfile
+from collections.abc import Callable, Collection, Iterable, Iterator, Mapping, Sequence
+from re import Pattern
+from typing import (
+    IO,
+    Any,
+    ClassVar,
+    Generic,
+    Protocol,
+    Self,
+    TypeAlias,
+    overload,
+    type_check_only,
+)
+from typing import Literal as L
+
+from _typeshed import (
+    StrOrBytesPath,
+    StrPath,
+    SupportsKeysAndGetItem,
+    SupportsRead,
+    SupportsWrite,
+)
+from typing_extensions import TypeVar, deprecated, override
+
+import numpy as np
+from numpy._core.multiarray import packbits, unpackbits
+from numpy._typing import ArrayLike, DTypeLike, NDArray, _DTypeLike, _SupportsArrayFunc
+from numpy.ma.mrecords import MaskedRecords
+
+from ._datasource import DataSource as DataSource
+
+__all__ = [
+    "fromregex",
+    "genfromtxt",
+    "load",
+    "loadtxt",
+    "packbits",
+    "save",
+    "savetxt",
+    "savez",
+    "savez_compressed",
+    "unpackbits",
+]
+
+_T_co = TypeVar("_T_co", covariant=True)
+_ScalarT = TypeVar("_ScalarT", bound=np.generic)
+_ScalarT_co = TypeVar("_ScalarT_co", bound=np.generic, default=Any, covariant=True)
+
+_FName: TypeAlias = StrPath | Iterable[str] | Iterable[bytes]
+_FNameRead: TypeAlias = StrPath | SupportsRead[str] | SupportsRead[bytes]
+_FNameWriteBytes: TypeAlias = StrPath | SupportsWrite[bytes]
+_FNameWrite: TypeAlias = _FNameWriteBytes | SupportsWrite[str]
+
+@type_check_only
+class _SupportsReadSeek(SupportsRead[_T_co], Protocol[_T_co]):
+    def seek(self, offset: int, whence: int, /) -> object: ...
+
+class BagObj(Generic[_T_co]):
+    def __init__(self, /, obj: SupportsKeysAndGetItem[str, _T_co]) -> None: ...
+    def __getattribute__(self, key: str, /) -> _T_co: ...
+    def __dir__(self) -> list[str]: ...
+
+class NpzFile(Mapping[str, NDArray[_ScalarT_co]]):
+    _MAX_REPR_ARRAY_COUNT: ClassVar[int] = 5
+
+    zip: zipfile.ZipFile
+    fid: IO[str] | None
+    files: list[str]
+    allow_pickle: bool
+    pickle_kwargs: Mapping[str, Any] | None
+    f: BagObj[NpzFile[_ScalarT_co]]
+
+    #
+    def __init__(
+        self,
+        /,
+        fid: IO[Any],
+        own_fid: bool = False,
+        allow_pickle: bool = False,
+        pickle_kwargs: Mapping[str, object] | None = None,
+        *,
+        max_header_size: int = 10_000,
+    ) -> None: ...
+    def __del__(self) -> None: ...
+    def __enter__(self) -> Self: ...
+    def __exit__(self, cls: type[BaseException] | None, e: BaseException | None, tb: types.TracebackType | None, /) -> None: ...
+    @override
+    def __len__(self) -> int: ...
+    @override
+    def __iter__(self) -> Iterator[str]: ...
+    @override
+    def __getitem__(self, key: str, /) -> NDArray[_ScalarT_co]: ...
+    def close(self) -> None: ...
+
+# NOTE: Returns a `NpzFile` if file is a zip file;
+# returns an `ndarray`/`memmap` otherwise
+def load(
+    file: StrOrBytesPath | _SupportsReadSeek[bytes],
+    mmap_mode: L["r+", "r", "w+", "c"] | None = None,
+    allow_pickle: bool = False,
+    fix_imports: bool = True,
+    encoding: L["ASCII", "latin1", "bytes"] = "ASCII",
+    *,
+    max_header_size: int = 10_000,
+) -> Any: ...
+
+@overload
+def save(file: _FNameWriteBytes, arr: ArrayLike, allow_pickle: bool = True) -> None: ...
+@overload
+@deprecated("The 'fix_imports' flag is deprecated in NumPy 2.1.")
+def save(file: _FNameWriteBytes, arr: ArrayLike, allow_pickle: bool, fix_imports: bool) -> None: ...
+@overload
+@deprecated("The 'fix_imports' flag is deprecated in NumPy 2.1.")
+def save(file: _FNameWriteBytes, arr: ArrayLike, allow_pickle: bool = True, *, fix_imports: bool) -> None: ...
+
+#
+def savez(file: _FNameWriteBytes, *args: ArrayLike, allow_pickle: bool = True, **kwds: ArrayLike) -> None: ...
+
+#
+def savez_compressed(file: _FNameWriteBytes, *args: ArrayLike, allow_pickle: bool = True, **kwds: ArrayLike) -> None: ...
+
+# File-like objects only have to implement `__iter__` and,
+# optionally, `encoding`
+@overload
+def loadtxt(
+    fname: _FName,
+    dtype: None = None,
+    comments: str | Sequence[str] | None = "#",
+    delimiter: str | None = None,
+    converters: Mapping[int | str, Callable[[str], Any]] | Callable[[str], Any] | None = None,
+    skiprows: int = 0,
+    usecols: int | Sequence[int] | None = None,
+    unpack: bool = False,
+    ndmin: L[0, 1, 2] = 0,
+    encoding: str | None = None,
+    max_rows: int | None = None,
+    *,
+    quotechar: str | None = None,
+    like: _SupportsArrayFunc | None = None,
+) -> NDArray[np.float64]: ...
+@overload
+def loadtxt(
+    fname: _FName,
+    dtype: _DTypeLike[_ScalarT],
+    comments: str | Sequence[str] | None = "#",
+    delimiter: str | None = None,
+    converters: Mapping[int | str, Callable[[str], Any]] | Callable[[str], Any] | None = None,
+    skiprows: int = 0,
+    usecols: int | Sequence[int] | None = None,
+    unpack: bool = False,
+    ndmin: L[0, 1, 2] = 0,
+    encoding: str | None = None,
+    max_rows: int | None = None,
+    *,
+    quotechar: str | None = None,
+    like: _SupportsArrayFunc | None = None,
+) -> NDArray[_ScalarT]: ...
+@overload
+def loadtxt(
+    fname: _FName,
+    dtype: DTypeLike,
+    comments: str | Sequence[str] | None = "#",
+    delimiter: str | None = None,
+    converters: Mapping[int | str, Callable[[str], Any]] | Callable[[str], Any] | None = None,
+    skiprows: int = 0,
+    usecols: int | Sequence[int] | None = None,
+    unpack: bool = False,
+    ndmin: L[0, 1, 2] = 0,
+    encoding: str | None = None,
+    max_rows: int | None = None,
+    *,
+    quotechar: str | None = None,
+    like: _SupportsArrayFunc | None = None,
+) -> NDArray[Any]: ...
+
+def savetxt(
+    fname: _FNameWrite,
+    X: ArrayLike,
+    fmt: str | Sequence[str] = "%.18e",
+    delimiter: str = " ",
+    newline: str = "\n",
+    header: str = "",
+    footer: str = "",
+    comments: str = "# ",
+    encoding: str | None = None,
+) -> None: ...
+
+@overload
+def fromregex(
+    file: _FNameRead,
+    regexp: str | bytes | Pattern[Any],
+    dtype: _DTypeLike[_ScalarT],
+    encoding: str | None = None,
+) -> NDArray[_ScalarT]: ...
+@overload
+def fromregex(
+    file: _FNameRead,
+    regexp: str | bytes | Pattern[Any],
+    dtype: DTypeLike,
+    encoding: str | None = None,
+) -> NDArray[Any]: ...
+
+@overload
+def genfromtxt(
+    fname: _FName,
+    dtype: None = None,
+    comments: str = ...,
+    delimiter: str | int | Iterable[int] | None = ...,
+    skip_header: int = ...,
+    skip_footer: int = ...,
+    converters: Mapping[int | str, Callable[[str], Any]] | None = ...,
+    missing_values: Any = ...,
+    filling_values: Any = ...,
+    usecols: Sequence[int] | None = ...,
+    names: L[True] | str | Collection[str] | None = ...,
+    excludelist: Sequence[str] | None = ...,
+    deletechars: str = ...,
+    replace_space: str = ...,
+    autostrip: bool = ...,
+    case_sensitive: bool | L["upper", "lower"] = ...,
+    defaultfmt: str = ...,
+    unpack: bool | None = ...,
+    usemask: bool = ...,
+    loose: bool = ...,
+    invalid_raise: bool = ...,
+    max_rows: int | None = ...,
+    encoding: str = ...,
+    *,
+    ndmin: L[0, 1, 2] = ...,
+    like: _SupportsArrayFunc | None = ...,
+) -> NDArray[Any]: ...
+@overload
+def genfromtxt(
+    fname: _FName,
+    dtype: _DTypeLike[_ScalarT],
+    comments: str = ...,
+    delimiter: str | int | Iterable[int] | None = ...,
+    skip_header: int = ...,
+    skip_footer: int = ...,
+    converters: Mapping[int | str, Callable[[str], Any]] | None = ...,
+    missing_values: Any = ...,
+    filling_values: Any = ...,
+    usecols: Sequence[int] | None = ...,
+    names: L[True] | str | Collection[str] | None = ...,
+    excludelist: Sequence[str] | None = ...,
+    deletechars: str = ...,
+    replace_space: str = ...,
+    autostrip: bool = ...,
+    case_sensitive: bool | L["upper", "lower"] = ...,
+    defaultfmt: str = ...,
+    unpack: bool | None = ...,
+    usemask: bool = ...,
+    loose: bool = ...,
+    invalid_raise: bool = ...,
+    max_rows: int | None = ...,
+    encoding: str = ...,
+    *,
+    ndmin: L[0, 1, 2] = ...,
+    like: _SupportsArrayFunc | None = ...,
+) -> NDArray[_ScalarT]: ...
+@overload
+def genfromtxt(
+    fname: _FName,
+    dtype: DTypeLike,
+    comments: str = ...,
+    delimiter: str | int | Iterable[int] | None = ...,
+    skip_header: int = ...,
+    skip_footer: int = ...,
+    converters: Mapping[int | str, Callable[[str], Any]] | None = ...,
+    missing_values: Any = ...,
+    filling_values: Any = ...,
+    usecols: Sequence[int] | None = ...,
+    names: L[True] | str | Collection[str] | None = ...,
+    excludelist: Sequence[str] | None = ...,
+    deletechars: str = ...,
+    replace_space: str = ...,
+    autostrip: bool = ...,
+    case_sensitive: bool | L["upper", "lower"] = ...,
+    defaultfmt: str = ...,
+    unpack: bool | None = ...,
+    usemask: bool = ...,
+    loose: bool = ...,
+    invalid_raise: bool = ...,
+    max_rows: int | None = ...,
+    encoding: str = ...,
+    *,
+    ndmin: L[0, 1, 2] = ...,
+    like: _SupportsArrayFunc | None = ...,
+) -> NDArray[Any]: ...
+
+@overload
+def recfromtxt(fname: _FName, *, usemask: L[False] = False, **kwargs: object) -> np.recarray[Any, np.dtype[np.record]]: ...
+@overload
+def recfromtxt(fname: _FName, *, usemask: L[True], **kwargs: object) -> MaskedRecords[Any, np.dtype[np.void]]: ...
+
+@overload
+def recfromcsv(fname: _FName, *, usemask: L[False] = False, **kwargs: object) -> np.recarray[Any, np.dtype[np.record]]: ...
+@overload
+def recfromcsv(fname: _FName, *, usemask: L[True], **kwargs: object) -> MaskedRecords[Any, np.dtype[np.void]]: ...

lib/python3.11/site-packages/numpy/lib/_polynomial_impl.pyi

@@ -0,0 +1,316 @@
+from typing import (
+    Any,
+    NoReturn,
+    SupportsIndex,
+    SupportsInt,
+    TypeAlias,
+    TypeVar,
+    overload,
+)
+from typing import (
+    Literal as L,
+)
+
+import numpy as np
+from numpy import (
+    complex128,
+    complexfloating,
+    float64,
+    floating,
+    int32,
+    int64,
+    object_,
+    poly1d,
+    signedinteger,
+    unsignedinteger,
+)
+from numpy._typing import (
+    ArrayLike,
+    NDArray,
+    _ArrayLikeBool_co,
+    _ArrayLikeComplex_co,
+    _ArrayLikeFloat_co,
+    _ArrayLikeInt_co,
+    _ArrayLikeObject_co,
+    _ArrayLikeUInt_co,
+)
+
+_T = TypeVar("_T")
+
+_2Tup: TypeAlias = tuple[_T, _T]
+_5Tup: TypeAlias = tuple[
+    _T,
+    NDArray[float64],
+    NDArray[int32],
+    NDArray[float64],
+    NDArray[float64],
+]
+
+__all__ = [
+    "poly",
+    "roots",
+    "polyint",
+    "polyder",
+    "polyadd",
+    "polysub",
+    "polymul",
+    "polydiv",
+    "polyval",
+    "poly1d",
+    "polyfit",
+]
+
+def poly(seq_of_zeros: ArrayLike) -> NDArray[floating]: ...
+
+# Returns either a float or complex array depending on the input values.
+# See `np.linalg.eigvals`.
+def roots(p: ArrayLike) -> NDArray[complexfloating] | NDArray[floating]: ...
+
+@overload
+def polyint(
+    p: poly1d,
+    m: SupportsInt | SupportsIndex = ...,
+    k: _ArrayLikeComplex_co | _ArrayLikeObject_co | None = ...,
+) -> poly1d: ...
+@overload
+def polyint(
+    p: _ArrayLikeFloat_co,
+    m: SupportsInt | SupportsIndex = ...,
+    k: _ArrayLikeFloat_co | None = ...,
+) -> NDArray[floating]: ...
+@overload
+def polyint(
+    p: _ArrayLikeComplex_co,
+    m: SupportsInt | SupportsIndex = ...,
+    k: _ArrayLikeComplex_co | None = ...,
+) -> NDArray[complexfloating]: ...
+@overload
+def polyint(
+    p: _ArrayLikeObject_co,
+    m: SupportsInt | SupportsIndex = ...,
+    k: _ArrayLikeObject_co | None = ...,
+) -> NDArray[object_]: ...
+
+@overload
+def polyder(
+    p: poly1d,
+    m: SupportsInt | SupportsIndex = ...,
+) -> poly1d: ...
+@overload
+def polyder(
+    p: _ArrayLikeFloat_co,
+    m: SupportsInt | SupportsIndex = ...,
+) -> NDArray[floating]: ...
+@overload
+def polyder(
+    p: _ArrayLikeComplex_co,
+    m: SupportsInt | SupportsIndex = ...,
+) -> NDArray[complexfloating]: ...
+@overload
+def polyder(
+    p: _ArrayLikeObject_co,
+    m: SupportsInt | SupportsIndex = ...,
+) -> NDArray[object_]: ...
+
+@overload
+def polyfit(
+    x: _ArrayLikeFloat_co,
+    y: _ArrayLikeFloat_co,
+    deg: SupportsIndex | SupportsInt,
+    rcond: float | None = ...,
+    full: L[False] = ...,
+    w: _ArrayLikeFloat_co | None = ...,
+    cov: L[False] = ...,
+) -> NDArray[float64]: ...
+@overload
+def polyfit(
+    x: _ArrayLikeComplex_co,
+    y: _ArrayLikeComplex_co,
+    deg: SupportsIndex | SupportsInt,
+    rcond: float | None = ...,
+    full: L[False] = ...,
+    w: _ArrayLikeFloat_co | None = ...,
+    cov: L[False] = ...,
+) -> NDArray[complex128]: ...
+@overload
+def polyfit(
+    x: _ArrayLikeFloat_co,
+    y: _ArrayLikeFloat_co,
+    deg: SupportsIndex | SupportsInt,
+    rcond: float | None = ...,
+    full: L[False] = ...,
+    w: _ArrayLikeFloat_co | None = ...,
+    cov: L[True, "unscaled"] = ...,
+) -> _2Tup[NDArray[float64]]: ...
+@overload
+def polyfit(
+    x: _ArrayLikeComplex_co,
+    y: _ArrayLikeComplex_co,
+    deg: SupportsIndex | SupportsInt,
+    rcond: float | None = ...,
+    full: L[False] = ...,
+    w: _ArrayLikeFloat_co | None = ...,
+    cov: L[True, "unscaled"] = ...,
+) -> _2Tup[NDArray[complex128]]: ...
+@overload
+def polyfit(
+    x: _ArrayLikeFloat_co,
+    y: _ArrayLikeFloat_co,
+    deg: SupportsIndex | SupportsInt,
+    rcond: float | None = ...,
+    full: L[True] = ...,
+    w: _ArrayLikeFloat_co | None = ...,
+    cov: bool | L["unscaled"] = ...,
+) -> _5Tup[NDArray[float64]]: ...
+@overload
+def polyfit(
+    x: _ArrayLikeComplex_co,
+    y: _ArrayLikeComplex_co,
+    deg: SupportsIndex | SupportsInt,
+    rcond: float | None = ...,
+    full: L[True] = ...,
+    w: _ArrayLikeFloat_co | None = ...,
+    cov: bool | L["unscaled"] = ...,
+) -> _5Tup[NDArray[complex128]]: ...
+
+@overload
+def polyval(
+    p: _ArrayLikeBool_co,
+    x: _ArrayLikeBool_co,
+) -> NDArray[int64]: ...
+@overload
+def polyval(
+    p: _ArrayLikeUInt_co,
+    x: _ArrayLikeUInt_co,
+) -> NDArray[unsignedinteger]: ...
+@overload
+def polyval(
+    p: _ArrayLikeInt_co,
+    x: _ArrayLikeInt_co,
+) -> NDArray[signedinteger]: ...
+@overload
+def polyval(
+    p: _ArrayLikeFloat_co,
+    x: _ArrayLikeFloat_co,
+) -> NDArray[floating]: ...
+@overload
+def polyval(
+    p: _ArrayLikeComplex_co,
+    x: _ArrayLikeComplex_co,
+) -> NDArray[complexfloating]: ...
+@overload
+def polyval(
+    p: _ArrayLikeObject_co,
+    x: _ArrayLikeObject_co,
+) -> NDArray[object_]: ...
+
+@overload
+def polyadd(
+    a1: poly1d,
+    a2: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+) -> poly1d: ...
+@overload
+def polyadd(
+    a1: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    a2: poly1d,
+) -> poly1d: ...
+@overload
+def polyadd(
+    a1: _ArrayLikeBool_co,
+    a2: _ArrayLikeBool_co,
+) -> NDArray[np.bool]: ...
+@overload
+def polyadd(
+    a1: _ArrayLikeUInt_co,
+    a2: _ArrayLikeUInt_co,
+) -> NDArray[unsignedinteger]: ...
+@overload
+def polyadd(
+    a1: _ArrayLikeInt_co,
+    a2: _ArrayLikeInt_co,
+) -> NDArray[signedinteger]: ...
+@overload
+def polyadd(
+    a1: _ArrayLikeFloat_co,
+    a2: _ArrayLikeFloat_co,
+) -> NDArray[floating]: ...
+@overload
+def polyadd(
+    a1: _ArrayLikeComplex_co,
+    a2: _ArrayLikeComplex_co,
+) -> NDArray[complexfloating]: ...
+@overload
+def polyadd(
+    a1: _ArrayLikeObject_co,
+    a2: _ArrayLikeObject_co,
+) -> NDArray[object_]: ...
+
+@overload
+def polysub(
+    a1: poly1d,
+    a2: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+) -> poly1d: ...
+@overload
+def polysub(
+    a1: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    a2: poly1d,
+) -> poly1d: ...
+@overload
+def polysub(
+    a1: _ArrayLikeBool_co,
+    a2: _ArrayLikeBool_co,
+) -> NoReturn: ...
+@overload
+def polysub(
+    a1: _ArrayLikeUInt_co,
+    a2: _ArrayLikeUInt_co,
+) -> NDArray[unsignedinteger]: ...
+@overload
+def polysub(
+    a1: _ArrayLikeInt_co,
+    a2: _ArrayLikeInt_co,
+) -> NDArray[signedinteger]: ...
+@overload
+def polysub(
+    a1: _ArrayLikeFloat_co,
+    a2: _ArrayLikeFloat_co,
+) -> NDArray[floating]: ...
+@overload
+def polysub(
+    a1: _ArrayLikeComplex_co,
+    a2: _ArrayLikeComplex_co,
+) -> NDArray[complexfloating]: ...
+@overload
+def polysub(
+    a1: _ArrayLikeObject_co,
+    a2: _ArrayLikeObject_co,
+) -> NDArray[object_]: ...
+
+# NOTE: Not an alias, but they do have the same signature (that we can reuse)
+polymul = polyadd
+
+@overload
+def polydiv(
+    u: poly1d,
+    v: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+) -> _2Tup[poly1d]: ...
+@overload
+def polydiv(
+    u: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    v: poly1d,
+) -> _2Tup[poly1d]: ...
+@overload
+def polydiv(
+    u: _ArrayLikeFloat_co,
+    v: _ArrayLikeFloat_co,
+) -> _2Tup[NDArray[floating]]: ...
+@overload
+def polydiv(
+    u: _ArrayLikeComplex_co,
+    v: _ArrayLikeComplex_co,
+) -> _2Tup[NDArray[complexfloating]]: ...
+@overload
+def polydiv(
+    u: _ArrayLikeObject_co,
+    v: _ArrayLikeObject_co,
+) -> _2Tup[NDArray[Any]]: ...

lib/python3.11/site-packages/numpy/lib/_scimath_impl.py

@@ -0,0 +1,642 @@
+"""
+Wrapper functions to more user-friendly calling of certain math functions
+whose output data-type is different than the input data-type in certain
+domains of the input.
+
+For example, for functions like `log` with branch cuts, the versions in this
+module provide the mathematically valid answers in the complex plane::
+
+  >>> import math
+  >>> np.emath.log(-math.exp(1)) == (1+1j*math.pi)
+  True
+
+Similarly, `sqrt`, other base logarithms, `power` and trig functions are
+correctly handled.  See their respective docstrings for specific examples.
+
+"""
+import numpy._core.numeric as nx
+import numpy._core.numerictypes as nt
+from numpy._core.numeric import any, asarray
+from numpy._core.overrides import array_function_dispatch, set_module
+from numpy.lib._type_check_impl import isreal
+
+__all__ = [
+    'sqrt', 'log', 'log2', 'logn', 'log10', 'power', 'arccos', 'arcsin',
+    'arctanh'
+    ]
+
+
+_ln2 = nx.log(2.0)
+
+
+def _tocomplex(arr):
+    """Convert its input `arr` to a complex array.
+
+    The input is returned as a complex array of the smallest type that will fit
+    the original data: types like single, byte, short, etc. become csingle,
+    while others become cdouble.
+
+    A copy of the input is always made.
+
+    Parameters
+    ----------
+    arr : array
+
+    Returns
+    -------
+    array
+        An array with the same input data as the input but in complex form.
+
+    Examples
+    --------
+    >>> import numpy as np
+
+    First, consider an input of type short:
+
+    >>> a = np.array([1,2,3],np.short)
+
+    >>> ac = np.lib.scimath._tocomplex(a); ac
+    array([1.+0.j, 2.+0.j, 3.+0.j], dtype=complex64)
+
+    >>> ac.dtype
+    dtype('complex64')
+
+    If the input is of type double, the output is correspondingly of the
+    complex double type as well:
+
+    >>> b = np.array([1,2,3],np.double)
+
+    >>> bc = np.lib.scimath._tocomplex(b); bc
+    array([1.+0.j, 2.+0.j, 3.+0.j])
+
+    >>> bc.dtype
+    dtype('complex128')
+
+    Note that even if the input was complex to begin with, a copy is still
+    made, since the astype() method always copies:
+
+    >>> c = np.array([1,2,3],np.csingle)
+
+    >>> cc = np.lib.scimath._tocomplex(c); cc
+    array([1.+0.j,  2.+0.j,  3.+0.j], dtype=complex64)
+
+    >>> c *= 2; c
+    array([2.+0.j,  4.+0.j,  6.+0.j], dtype=complex64)
+
+    >>> cc
+    array([1.+0.j,  2.+0.j,  3.+0.j], dtype=complex64)
+    """
+    if issubclass(arr.dtype.type, (nt.single, nt.byte, nt.short, nt.ubyte,
+                                   nt.ushort, nt.csingle)):
+        return arr.astype(nt.csingle)
+    else:
+        return arr.astype(nt.cdouble)
+
+
+def _fix_real_lt_zero(x):
+    """Convert `x` to complex if it has real, negative components.
+
+    Otherwise, output is just the array version of the input (via asarray).
+
+    Parameters
+    ----------
+    x : array_like
+
+    Returns
+    -------
+    array
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> np.lib.scimath._fix_real_lt_zero([1,2])
+    array([1, 2])
+
+    >>> np.lib.scimath._fix_real_lt_zero([-1,2])
+    array([-1.+0.j,  2.+0.j])
+
+    """
+    x = asarray(x)
+    if any(isreal(x) & (x < 0)):
+        x = _tocomplex(x)
+    return x
+
+
+def _fix_int_lt_zero(x):
+    """Convert `x` to double if it has real, negative components.
+
+    Otherwise, output is just the array version of the input (via asarray).
+
+    Parameters
+    ----------
+    x : array_like
+
+    Returns
+    -------
+    array
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> np.lib.scimath._fix_int_lt_zero([1,2])
+    array([1, 2])
+
+    >>> np.lib.scimath._fix_int_lt_zero([-1,2])
+    array([-1.,  2.])
+    """
+    x = asarray(x)
+    if any(isreal(x) & (x < 0)):
+        x = x * 1.0
+    return x
+
+
+def _fix_real_abs_gt_1(x):
+    """Convert `x` to complex if it has real components x_i with abs(x_i)>1.
+
+    Otherwise, output is just the array version of the input (via asarray).
+
+    Parameters
+    ----------
+    x : array_like
+
+    Returns
+    -------
+    array
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> np.lib.scimath._fix_real_abs_gt_1([0,1])
+    array([0, 1])
+
+    >>> np.lib.scimath._fix_real_abs_gt_1([0,2])
+    array([0.+0.j, 2.+0.j])
+    """
+    x = asarray(x)
+    if any(isreal(x) & (abs(x) > 1)):
+        x = _tocomplex(x)
+    return x
+
+
+def _unary_dispatcher(x):
+    return (x,)
+
+
+@set_module('numpy.lib.scimath')
+@array_function_dispatch(_unary_dispatcher)
+def sqrt(x):
+    """
+    Compute the square root of x.
+
+    For negative input elements, a complex value is returned
+    (unlike `numpy.sqrt` which returns NaN).
+
+    Parameters
+    ----------
+    x : array_like
+       The input value(s).
+
+    Returns
+    -------
+    out : ndarray or scalar
+       The square root of `x`. If `x` was a scalar, so is `out`,
+       otherwise an array is returned.
+
+    See Also
+    --------
+    numpy.sqrt
+
+    Examples
+    --------
+    For real, non-negative inputs this works just like `numpy.sqrt`:
+
+    >>> import numpy as np
+
+    >>> np.emath.sqrt(1)
+    1.0
+    >>> np.emath.sqrt([1, 4])
+    array([1.,  2.])
+
+    But it automatically handles negative inputs:
+
+    >>> np.emath.sqrt(-1)
+    1j
+    >>> np.emath.sqrt([-1,4])
+    array([0.+1.j, 2.+0.j])
+
+    Different results are expected because:
+    floating point 0.0 and -0.0 are distinct.
+
+    For more control, explicitly use complex() as follows:
+
+    >>> np.emath.sqrt(complex(-4.0, 0.0))
+    2j
+    >>> np.emath.sqrt(complex(-4.0, -0.0))
+    -2j
+    """
+    x = _fix_real_lt_zero(x)
+    return nx.sqrt(x)
+
+
+@set_module('numpy.lib.scimath')
+@array_function_dispatch(_unary_dispatcher)
+def log(x):
+    """
+    Compute the natural logarithm of `x`.
+
+    Return the "principal value" (for a description of this, see `numpy.log`)
+    of :math:`log_e(x)`. For real `x > 0`, this is a real number (``log(0)``
+    returns ``-inf`` and ``log(np.inf)`` returns ``inf``). Otherwise, the
+    complex principle value is returned.
+
+    Parameters
+    ----------
+    x : array_like
+       The value(s) whose log is (are) required.
+
+    Returns
+    -------
+    out : ndarray or scalar
+       The log of the `x` value(s). If `x` was a scalar, so is `out`,
+       otherwise an array is returned.
+
+    See Also
+    --------
+    numpy.log
+
+    Notes
+    -----
+    For a log() that returns ``NAN`` when real `x < 0`, use `numpy.log`
+    (note, however, that otherwise `numpy.log` and this `log` are identical,
+    i.e., both return ``-inf`` for `x = 0`, ``inf`` for `x = inf`, and,
+    notably, the complex principle value if ``x.imag != 0``).
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> np.emath.log(np.exp(1))
+    1.0
+
+    Negative arguments are handled "correctly" (recall that
+    ``exp(log(x)) == x`` does *not* hold for real ``x < 0``):
+
+    >>> np.emath.log(-np.exp(1)) == (1 + np.pi * 1j)
+    True
+
+    """
+    x = _fix_real_lt_zero(x)
+    return nx.log(x)
+
+
+@set_module('numpy.lib.scimath')
+@array_function_dispatch(_unary_dispatcher)
+def log10(x):
+    """
+    Compute the logarithm base 10 of `x`.
+
+    Return the "principal value" (for a description of this, see
+    `numpy.log10`) of :math:`log_{10}(x)`. For real `x > 0`, this
+    is a real number (``log10(0)`` returns ``-inf`` and ``log10(np.inf)``
+    returns ``inf``). Otherwise, the complex principle value is returned.
+
+    Parameters
+    ----------
+    x : array_like or scalar
+       The value(s) whose log base 10 is (are) required.
+
+    Returns
+    -------
+    out : ndarray or scalar
+       The log base 10 of the `x` value(s). If `x` was a scalar, so is `out`,
+       otherwise an array object is returned.
+
+    See Also
+    --------
+    numpy.log10
+
+    Notes
+    -----
+    For a log10() that returns ``NAN`` when real `x < 0`, use `numpy.log10`
+    (note, however, that otherwise `numpy.log10` and this `log10` are
+    identical, i.e., both return ``-inf`` for `x = 0`, ``inf`` for `x = inf`,
+    and, notably, the complex principle value if ``x.imag != 0``).
+
+    Examples
+    --------
+    >>> import numpy as np
+
+    (We set the printing precision so the example can be auto-tested)
+
+    >>> np.set_printoptions(precision=4)
+
+    >>> np.emath.log10(10**1)
+    1.0
+
+    >>> np.emath.log10([-10**1, -10**2, 10**2])
+    array([1.+1.3644j, 2.+1.3644j, 2.+0.j    ])
+
+    """
+    x = _fix_real_lt_zero(x)
+    return nx.log10(x)
+
+
+def _logn_dispatcher(n, x):
+    return (n, x,)
+
+
+@set_module('numpy.lib.scimath')
+@array_function_dispatch(_logn_dispatcher)
+def logn(n, x):
+    """
+    Take log base n of x.
+
+    If `x` contains negative inputs, the answer is computed and returned in the
+    complex domain.
+
+    Parameters
+    ----------
+    n : array_like
+       The integer base(s) in which the log is taken.
+    x : array_like
+       The value(s) whose log base `n` is (are) required.
+
+    Returns
+    -------
+    out : ndarray or scalar
+       The log base `n` of the `x` value(s). If `x` was a scalar, so is
+       `out`, otherwise an array is returned.
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> np.set_printoptions(precision=4)
+
+    >>> np.emath.logn(2, [4, 8])
+    array([2., 3.])
+    >>> np.emath.logn(2, [-4, -8, 8])
+    array([2.+4.5324j, 3.+4.5324j, 3.+0.j    ])
+
+    """
+    x = _fix_real_lt_zero(x)
+    n = _fix_real_lt_zero(n)
+    return nx.log(x) / nx.log(n)
+
+
+@set_module('numpy.lib.scimath')
+@array_function_dispatch(_unary_dispatcher)
+def log2(x):
+    """
+    Compute the logarithm base 2 of `x`.
+
+    Return the "principal value" (for a description of this, see
+    `numpy.log2`) of :math:`log_2(x)`. For real `x > 0`, this is
+    a real number (``log2(0)`` returns ``-inf`` and ``log2(np.inf)`` returns
+    ``inf``). Otherwise, the complex principle value is returned.
+
+    Parameters
+    ----------
+    x : array_like
+       The value(s) whose log base 2 is (are) required.
+
+    Returns
+    -------
+    out : ndarray or scalar
+       The log base 2 of the `x` value(s). If `x` was a scalar, so is `out`,
+       otherwise an array is returned.
+
+    See Also
+    --------
+    numpy.log2
+
+    Notes
+    -----
+    For a log2() that returns ``NAN`` when real `x < 0`, use `numpy.log2`
+    (note, however, that otherwise `numpy.log2` and this `log2` are
+    identical, i.e., both return ``-inf`` for `x = 0`, ``inf`` for `x = inf`,
+    and, notably, the complex principle value if ``x.imag != 0``).
+
+    Examples
+    --------
+
+    We set the printing precision so the example can be auto-tested:
+
+    >>> np.set_printoptions(precision=4)
+
+    >>> np.emath.log2(8)
+    3.0
+    >>> np.emath.log2([-4, -8, 8])
+    array([2.+4.5324j, 3.+4.5324j, 3.+0.j    ])
+
+    """
+    x = _fix_real_lt_zero(x)
+    return nx.log2(x)
+
+
+def _power_dispatcher(x, p):
+    return (x, p)
+
+
+@set_module('numpy.lib.scimath')
+@array_function_dispatch(_power_dispatcher)
+def power(x, p):
+    """
+    Return x to the power p, (x**p).
+
+    If `x` contains negative values, the output is converted to the
+    complex domain.
+
+    Parameters
+    ----------
+    x : array_like
+        The input value(s).
+    p : array_like of ints
+        The power(s) to which `x` is raised. If `x` contains multiple values,
+        `p` has to either be a scalar, or contain the same number of values
+        as `x`. In the latter case, the result is
+        ``x[0]**p[0], x[1]**p[1], ...``.
+
+    Returns
+    -------
+    out : ndarray or scalar
+        The result of ``x**p``. If `x` and `p` are scalars, so is `out`,
+        otherwise an array is returned.
+
+    See Also
+    --------
+    numpy.power
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> np.set_printoptions(precision=4)
+
+    >>> np.emath.power(2, 2)
+    4
+
+    >>> np.emath.power([2, 4], 2)
+    array([ 4, 16])
+
+    >>> np.emath.power([2, 4], -2)
+    array([0.25  ,  0.0625])
+
+    >>> np.emath.power([-2, 4], 2)
+    array([ 4.-0.j, 16.+0.j])
+
+    >>> np.emath.power([2, 4], [2, 4])
+    array([ 4, 256])
+
+    """
+    x = _fix_real_lt_zero(x)
+    p = _fix_int_lt_zero(p)
+    return nx.power(x, p)
+
+
+@set_module('numpy.lib.scimath')
+@array_function_dispatch(_unary_dispatcher)
+def arccos(x):
+    """
+    Compute the inverse cosine of x.
+
+    Return the "principal value" (for a description of this, see
+    `numpy.arccos`) of the inverse cosine of `x`. For real `x` such that
+    `abs(x) <= 1`, this is a real number in the closed interval
+    :math:`[0, \\pi]`.  Otherwise, the complex principle value is returned.
+
+    Parameters
+    ----------
+    x : array_like or scalar
+       The value(s) whose arccos is (are) required.
+
+    Returns
+    -------
+    out : ndarray or scalar
+       The inverse cosine(s) of the `x` value(s). If `x` was a scalar, so
+       is `out`, otherwise an array object is returned.
+
+    See Also
+    --------
+    numpy.arccos
+
+    Notes
+    -----
+    For an arccos() that returns ``NAN`` when real `x` is not in the
+    interval ``[-1,1]``, use `numpy.arccos`.
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> np.set_printoptions(precision=4)
+
+    >>> np.emath.arccos(1) # a scalar is returned
+    0.0
+
+    >>> np.emath.arccos([1,2])
+    array([0.-0.j   , 0.-1.317j])
+
+    """
+    x = _fix_real_abs_gt_1(x)
+    return nx.arccos(x)
+
+
+@set_module('numpy.lib.scimath')
+@array_function_dispatch(_unary_dispatcher)
+def arcsin(x):
+    """
+    Compute the inverse sine of x.
+
+    Return the "principal value" (for a description of this, see
+    `numpy.arcsin`) of the inverse sine of `x`. For real `x` such that
+    `abs(x) <= 1`, this is a real number in the closed interval
+    :math:`[-\\pi/2, \\pi/2]`.  Otherwise, the complex principle value is
+    returned.
+
+    Parameters
+    ----------
+    x : array_like or scalar
+       The value(s) whose arcsin is (are) required.
+
+    Returns
+    -------
+    out : ndarray or scalar
+       The inverse sine(s) of the `x` value(s). If `x` was a scalar, so
+       is `out`, otherwise an array object is returned.
+
+    See Also
+    --------
+    numpy.arcsin
+
+    Notes
+    -----
+    For an arcsin() that returns ``NAN`` when real `x` is not in the
+    interval ``[-1,1]``, use `numpy.arcsin`.
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> np.set_printoptions(precision=4)
+
+    >>> np.emath.arcsin(0)
+    0.0
+
+    >>> np.emath.arcsin([0,1])
+    array([0.    , 1.5708])
+
+    """
+    x = _fix_real_abs_gt_1(x)
+    return nx.arcsin(x)
+
+
+@set_module('numpy.lib.scimath')
+@array_function_dispatch(_unary_dispatcher)
+def arctanh(x):
+    """
+    Compute the inverse hyperbolic tangent of `x`.
+
+    Return the "principal value" (for a description of this, see
+    `numpy.arctanh`) of ``arctanh(x)``. For real `x` such that
+    ``abs(x) < 1``, this is a real number.  If `abs(x) > 1`, or if `x` is
+    complex, the result is complex. Finally, `x = 1` returns``inf`` and
+    ``x=-1`` returns ``-inf``.
+
+    Parameters
+    ----------
+    x : array_like
+       The value(s) whose arctanh is (are) required.
+
+    Returns
+    -------
+    out : ndarray or scalar
+       The inverse hyperbolic tangent(s) of the `x` value(s). If `x` was
+       a scalar so is `out`, otherwise an array is returned.
+
+
+    See Also
+    --------
+    numpy.arctanh
+
+    Notes
+    -----
+    For an arctanh() that returns ``NAN`` when real `x` is not in the
+    interval ``(-1,1)``, use `numpy.arctanh` (this latter, however, does
+    return +/-inf for ``x = +/-1``).
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> np.set_printoptions(precision=4)
+
+    >>> np.emath.arctanh(0.5)
+    0.5493061443340549
+
+    >>> from numpy.testing import suppress_warnings
+    >>> with suppress_warnings() as sup:
+    ...     sup.filter(RuntimeWarning)
+    ...     np.emath.arctanh(np.eye(2))
+    array([[inf,  0.],
+           [ 0., inf]])
+    >>> np.emath.arctanh([1j])
+    array([0.+0.7854j])
+
+    """
+    x = _fix_real_abs_gt_1(x)
+    return nx.arctanh(x)

lib/python3.11/site-packages/numpy/lib/_scimath_impl.pyi

@@ -0,0 +1,93 @@
+from typing import Any, overload
+
+from numpy import complexfloating
+from numpy._typing import (
+    NDArray,
+    _ArrayLikeComplex_co,
+    _ArrayLikeFloat_co,
+    _ComplexLike_co,
+    _FloatLike_co,
+)
+
+__all__ = ["sqrt", "log", "log2", "logn", "log10", "power", "arccos", "arcsin", "arctanh"]
+
+@overload
+def sqrt(x: _FloatLike_co) -> Any: ...
+@overload
+def sqrt(x: _ComplexLike_co) -> complexfloating: ...
+@overload
+def sqrt(x: _ArrayLikeFloat_co) -> NDArray[Any]: ...
+@overload
+def sqrt(x: _ArrayLikeComplex_co) -> NDArray[complexfloating]: ...
+
+@overload
+def log(x: _FloatLike_co) -> Any: ...
+@overload
+def log(x: _ComplexLike_co) -> complexfloating: ...
+@overload
+def log(x: _ArrayLikeFloat_co) -> NDArray[Any]: ...
+@overload
+def log(x: _ArrayLikeComplex_co) -> NDArray[complexfloating]: ...
+
+@overload
+def log10(x: _FloatLike_co) -> Any: ...
+@overload
+def log10(x: _ComplexLike_co) -> complexfloating: ...
+@overload
+def log10(x: _ArrayLikeFloat_co) -> NDArray[Any]: ...
+@overload
+def log10(x: _ArrayLikeComplex_co) -> NDArray[complexfloating]: ...
+
+@overload
+def log2(x: _FloatLike_co) -> Any: ...
+@overload
+def log2(x: _ComplexLike_co) -> complexfloating: ...
+@overload
+def log2(x: _ArrayLikeFloat_co) -> NDArray[Any]: ...
+@overload
+def log2(x: _ArrayLikeComplex_co) -> NDArray[complexfloating]: ...
+
+@overload
+def logn(n: _FloatLike_co, x: _FloatLike_co) -> Any: ...
+@overload
+def logn(n: _ComplexLike_co, x: _ComplexLike_co) -> complexfloating: ...
+@overload
+def logn(n: _ArrayLikeFloat_co, x: _ArrayLikeFloat_co) -> NDArray[Any]: ...
+@overload
+def logn(n: _ArrayLikeComplex_co, x: _ArrayLikeComplex_co) -> NDArray[complexfloating]: ...
+
+@overload
+def power(x: _FloatLike_co, p: _FloatLike_co) -> Any: ...
+@overload
+def power(x: _ComplexLike_co, p: _ComplexLike_co) -> complexfloating: ...
+@overload
+def power(x: _ArrayLikeFloat_co, p: _ArrayLikeFloat_co) -> NDArray[Any]: ...
+@overload
+def power(x: _ArrayLikeComplex_co, p: _ArrayLikeComplex_co) -> NDArray[complexfloating]: ...
+
+@overload
+def arccos(x: _FloatLike_co) -> Any: ...
+@overload
+def arccos(x: _ComplexLike_co) -> complexfloating: ...
+@overload
+def arccos(x: _ArrayLikeFloat_co) -> NDArray[Any]: ...
+@overload
+def arccos(x: _ArrayLikeComplex_co) -> NDArray[complexfloating]: ...
+
+@overload
+def arcsin(x: _FloatLike_co) -> Any: ...
+@overload
+def arcsin(x: _ComplexLike_co) -> complexfloating: ...
+@overload
+def arcsin(x: _ArrayLikeFloat_co) -> NDArray[Any]: ...
+@overload
+def arcsin(x: _ArrayLikeComplex_co) -> NDArray[complexfloating]: ...
+
+@overload
+def arctanh(x: _FloatLike_co) -> Any: ...
+@overload
+def arctanh(x: _ComplexLike_co) -> complexfloating: ...
+@overload
+def arctanh(x: _ArrayLikeFloat_co) -> NDArray[Any]: ...
+@overload
+def arctanh(x: _ArrayLikeComplex_co) -> NDArray[complexfloating]: ...

lib/python3.11/site-packages/numpy/lib/_shape_base_impl.pyi

@@ -0,0 +1,235 @@
+from collections.abc import Callable, Sequence
+from typing import (
+    Any,
+    Concatenate,
+    ParamSpec,
+    Protocol,
+    SupportsIndex,
+    TypeVar,
+    overload,
+    type_check_only,
+)
+
+from typing_extensions import deprecated
+
+import numpy as np
+from numpy import (
+    _CastingKind,
+    complexfloating,
+    floating,
+    generic,
+    integer,
+    object_,
+    signedinteger,
+    ufunc,
+    unsignedinteger,
+)
+from numpy._typing import (
+    ArrayLike,
+    DTypeLike,
+    NDArray,
+    _ArrayLike,
+    _ArrayLikeBool_co,
+    _ArrayLikeComplex_co,
+    _ArrayLikeFloat_co,
+    _ArrayLikeInt_co,
+    _ArrayLikeObject_co,
+    _ArrayLikeUInt_co,
+    _ShapeLike,
+)
+
+__all__ = [
+    "column_stack",
+    "row_stack",
+    "dstack",
+    "array_split",
+    "split",
+    "hsplit",
+    "vsplit",
+    "dsplit",
+    "apply_over_axes",
+    "expand_dims",
+    "apply_along_axis",
+    "kron",
+    "tile",
+    "take_along_axis",
+    "put_along_axis",
+]
+
+_P = ParamSpec("_P")
+_ScalarT = TypeVar("_ScalarT", bound=generic)
+
+# Signature of `__array_wrap__`
+@type_check_only
+class _ArrayWrap(Protocol):
+    def __call__(
+        self,
+        array: NDArray[Any],
+        context: tuple[ufunc, tuple[Any, ...], int] | None = ...,
+        return_scalar: bool = ...,
+        /,
+    ) -> Any: ...
+
+@type_check_only
+class _SupportsArrayWrap(Protocol):
+    @property
+    def __array_wrap__(self) -> _ArrayWrap: ...
+
+###
+
+def take_along_axis(
+    arr: _ScalarT | NDArray[_ScalarT],
+    indices: NDArray[integer],
+    axis: int | None = ...,
+) -> NDArray[_ScalarT]: ...
+
+def put_along_axis(
+    arr: NDArray[_ScalarT],
+    indices: NDArray[integer],
+    values: ArrayLike,
+    axis: int | None,
+) -> None: ...
+
+@overload
+def apply_along_axis(
+    func1d: Callable[Concatenate[NDArray[Any], _P], _ArrayLike[_ScalarT]],
+    axis: SupportsIndex,
+    arr: ArrayLike,
+    *args: _P.args,
+    **kwargs: _P.kwargs,
+) -> NDArray[_ScalarT]: ...
+@overload
+def apply_along_axis(
+    func1d: Callable[Concatenate[NDArray[Any], _P], Any],
+    axis: SupportsIndex,
+    arr: ArrayLike,
+    *args: _P.args,
+    **kwargs: _P.kwargs,
+) -> NDArray[Any]: ...
+
+def apply_over_axes(
+    func: Callable[[NDArray[Any], int], NDArray[_ScalarT]],
+    a: ArrayLike,
+    axes: int | Sequence[int],
+) -> NDArray[_ScalarT]: ...
+
+@overload
+def expand_dims(
+    a: _ArrayLike[_ScalarT],
+    axis: _ShapeLike,
+) -> NDArray[_ScalarT]: ...
+@overload
+def expand_dims(
+    a: ArrayLike,
+    axis: _ShapeLike,
+) -> NDArray[Any]: ...
+
+# Deprecated in NumPy 2.0, 2023-08-18
+@deprecated("`row_stack` alias is deprecated. Use `np.vstack` directly.")
+def row_stack(
+    tup: Sequence[ArrayLike],
+    *,
+    dtype: DTypeLike | None = None,
+    casting: _CastingKind = "same_kind",
+) -> NDArray[Any]: ...
+
+#
+@overload
+def column_stack(tup: Sequence[_ArrayLike[_ScalarT]]) -> NDArray[_ScalarT]: ...
+@overload
+def column_stack(tup: Sequence[ArrayLike]) -> NDArray[Any]: ...
+
+@overload
+def dstack(tup: Sequence[_ArrayLike[_ScalarT]]) -> NDArray[_ScalarT]: ...
+@overload
+def dstack(tup: Sequence[ArrayLike]) -> NDArray[Any]: ...
+
+@overload
+def array_split(
+    ary: _ArrayLike[_ScalarT],
+    indices_or_sections: _ShapeLike,
+    axis: SupportsIndex = ...,
+) -> list[NDArray[_ScalarT]]: ...
+@overload
+def array_split(
+    ary: ArrayLike,
+    indices_or_sections: _ShapeLike,
+    axis: SupportsIndex = ...,
+) -> list[NDArray[Any]]: ...
+
+@overload
+def split(
+    ary: _ArrayLike[_ScalarT],
+    indices_or_sections: _ShapeLike,
+    axis: SupportsIndex = ...,
+) -> list[NDArray[_ScalarT]]: ...
+@overload
+def split(
+    ary: ArrayLike,
+    indices_or_sections: _ShapeLike,
+    axis: SupportsIndex = ...,
+) -> list[NDArray[Any]]: ...
+
+@overload
+def hsplit(
+    ary: _ArrayLike[_ScalarT],
+    indices_or_sections: _ShapeLike,
+) -> list[NDArray[_ScalarT]]: ...
+@overload
+def hsplit(
+    ary: ArrayLike,
+    indices_or_sections: _ShapeLike,
+) -> list[NDArray[Any]]: ...
+
+@overload
+def vsplit(
+    ary: _ArrayLike[_ScalarT],
+    indices_or_sections: _ShapeLike,
+) -> list[NDArray[_ScalarT]]: ...
+@overload
+def vsplit(
+    ary: ArrayLike,
+    indices_or_sections: _ShapeLike,
+) -> list[NDArray[Any]]: ...
+
+@overload
+def dsplit(
+    ary: _ArrayLike[_ScalarT],
+    indices_or_sections: _ShapeLike,
+) -> list[NDArray[_ScalarT]]: ...
+@overload
+def dsplit(
+    ary: ArrayLike,
+    indices_or_sections: _ShapeLike,
+) -> list[NDArray[Any]]: ...
+
+@overload
+def get_array_wrap(*args: _SupportsArrayWrap) -> _ArrayWrap: ...
+@overload
+def get_array_wrap(*args: object) -> _ArrayWrap | None: ...
+
+@overload
+def kron(a: _ArrayLikeBool_co, b: _ArrayLikeBool_co) -> NDArray[np.bool]: ...  # type: ignore[misc]
+@overload
+def kron(a: _ArrayLikeUInt_co, b: _ArrayLikeUInt_co) -> NDArray[unsignedinteger]: ...  # type: ignore[misc]
+@overload
+def kron(a: _ArrayLikeInt_co, b: _ArrayLikeInt_co) -> NDArray[signedinteger]: ...  # type: ignore[misc]
+@overload
+def kron(a: _ArrayLikeFloat_co, b: _ArrayLikeFloat_co) -> NDArray[floating]: ...  # type: ignore[misc]
+@overload
+def kron(a: _ArrayLikeComplex_co, b: _ArrayLikeComplex_co) -> NDArray[complexfloating]: ...
+@overload
+def kron(a: _ArrayLikeObject_co, b: Any) -> NDArray[object_]: ...
+@overload
+def kron(a: Any, b: _ArrayLikeObject_co) -> NDArray[object_]: ...
+
+@overload
+def tile(
+    A: _ArrayLike[_ScalarT],
+    reps: int | Sequence[int],
+) -> NDArray[_ScalarT]: ...
+@overload
+def tile(
+    A: ArrayLike,
+    reps: int | Sequence[int],
+) -> NDArray[Any]: ...

lib/python3.11/site-packages/numpy/lib/_stride_tricks_impl.py

@@ -0,0 +1,549 @@
+"""
+Utilities that manipulate strides to achieve desirable effects.
+
+An explanation of strides can be found in the :ref:`arrays.ndarray`.
+
+"""
+import numpy as np
+from numpy._core.numeric import normalize_axis_tuple
+from numpy._core.overrides import array_function_dispatch, set_module
+
+__all__ = ['broadcast_to', 'broadcast_arrays', 'broadcast_shapes']
+
+
+class DummyArray:
+    """Dummy object that just exists to hang __array_interface__ dictionaries
+    and possibly keep alive a reference to a base array.
+    """
+
+    def __init__(self, interface, base=None):
+        self.__array_interface__ = interface
+        self.base = base
+
+
+def _maybe_view_as_subclass(original_array, new_array):
+    if type(original_array) is not type(new_array):
+        # if input was an ndarray subclass and subclasses were OK,
+        # then view the result as that subclass.
+        new_array = new_array.view(type=type(original_array))
+        # Since we have done something akin to a view from original_array, we
+        # should let the subclass finalize (if it has it implemented, i.e., is
+        # not None).
+        if new_array.__array_finalize__:
+            new_array.__array_finalize__(original_array)
+    return new_array
+
+
+@set_module("numpy.lib.stride_tricks")
+def as_strided(x, shape=None, strides=None, subok=False, writeable=True):
+    """
+    Create a view into the array with the given shape and strides.
+
+    .. warning:: This function has to be used with extreme care, see notes.
+
+    Parameters
+    ----------
+    x : ndarray
+        Array to create a new.
+    shape : sequence of int, optional
+        The shape of the new array. Defaults to ``x.shape``.
+    strides : sequence of int, optional
+        The strides of the new array. Defaults to ``x.strides``.
+    subok : bool, optional
+        If True, subclasses are preserved.
+    writeable : bool, optional
+        If set to False, the returned array will always be readonly.
+        Otherwise it will be writable if the original array was. It
+        is advisable to set this to False if possible (see Notes).
+
+    Returns
+    -------
+    view : ndarray
+
+    See also
+    --------
+    broadcast_to : broadcast an array to a given shape.
+    reshape : reshape an array.
+    lib.stride_tricks.sliding_window_view :
+        userfriendly and safe function for a creation of sliding window views.
+
+    Notes
+    -----
+    ``as_strided`` creates a view into the array given the exact strides
+    and shape. This means it manipulates the internal data structure of
+    ndarray and, if done incorrectly, the array elements can point to
+    invalid memory and can corrupt results or crash your program.
+    It is advisable to always use the original ``x.strides`` when
+    calculating new strides to avoid reliance on a contiguous memory
+    layout.
+
+    Furthermore, arrays created with this function often contain self
+    overlapping memory, so that two elements are identical.
+    Vectorized write operations on such arrays will typically be
+    unpredictable. They may even give different results for small, large,
+    or transposed arrays.
+
+    Since writing to these arrays has to be tested and done with great
+    care, you may want to use ``writeable=False`` to avoid accidental write
+    operations.
+
+    For these reasons it is advisable to avoid ``as_strided`` when
+    possible.
+    """
+    # first convert input to array, possibly keeping subclass
+    x = np.array(x, copy=None, subok=subok)
+    interface = dict(x.__array_interface__)
+    if shape is not None:
+        interface['shape'] = tuple(shape)
+    if strides is not None:
+        interface['strides'] = tuple(strides)
+
+    array = np.asarray(DummyArray(interface, base=x))
+    # The route via `__interface__` does not preserve structured
+    # dtypes. Since dtype should remain unchanged, we set it explicitly.
+    array.dtype = x.dtype
+
+    view = _maybe_view_as_subclass(x, array)
+
+    if view.flags.writeable and not writeable:
+        view.flags.writeable = False
+
+    return view
+
+
+def _sliding_window_view_dispatcher(x, window_shape, axis=None, *,
+                                    subok=None, writeable=None):
+    return (x,)
+
+
+@array_function_dispatch(
+    _sliding_window_view_dispatcher, module="numpy.lib.stride_tricks"
+)
+def sliding_window_view(x, window_shape, axis=None, *,
+                        subok=False, writeable=False):
+    """
+    Create a sliding window view into the array with the given window shape.
+
+    Also known as rolling or moving window, the window slides across all
+    dimensions of the array and extracts subsets of the array at all window
+    positions.
+
+    .. versionadded:: 1.20.0
+
+    Parameters
+    ----------
+    x : array_like
+        Array to create the sliding window view from.
+    window_shape : int or tuple of int
+        Size of window over each axis that takes part in the sliding window.
+        If `axis` is not present, must have same length as the number of input
+        array dimensions. Single integers `i` are treated as if they were the
+        tuple `(i,)`.
+    axis : int or tuple of int, optional
+        Axis or axes along which the sliding window is applied.
+        By default, the sliding window is applied to all axes and
+        `window_shape[i]` will refer to axis `i` of `x`.
+        If `axis` is given as a `tuple of int`, `window_shape[i]` will refer to
+        the axis `axis[i]` of `x`.
+        Single integers `i` are treated as if they were the tuple `(i,)`.
+    subok : bool, optional
+        If True, sub-classes will be passed-through, otherwise the returned
+        array will be forced to be a base-class array (default).
+    writeable : bool, optional
+        When true, allow writing to the returned view. The default is false,
+        as this should be used with caution: the returned view contains the
+        same memory location multiple times, so writing to one location will
+        cause others to change.
+
+    Returns
+    -------
+    view : ndarray
+        Sliding window view of the array. The sliding window dimensions are
+        inserted at the end, and the original dimensions are trimmed as
+        required by the size of the sliding window.
+        That is, ``view.shape = x_shape_trimmed + window_shape``, where
+        ``x_shape_trimmed`` is ``x.shape`` with every entry reduced by one less
+        than the corresponding window size.
+
+    See Also
+    --------
+    lib.stride_tricks.as_strided: A lower-level and less safe routine for
+        creating arbitrary views from custom shape and strides.
+    broadcast_to: broadcast an array to a given shape.
+
+    Notes
+    -----
+    For many applications using a sliding window view can be convenient, but
+    potentially very slow. Often specialized solutions exist, for example:
+
+    - `scipy.signal.fftconvolve`
+
+    - filtering functions in `scipy.ndimage`
+
+    - moving window functions provided by
+      `bottleneck <https://github.com/pydata/bottleneck>`_.
+
+    As a rough estimate, a sliding window approach with an input size of `N`
+    and a window size of `W` will scale as `O(N*W)` where frequently a special
+    algorithm can achieve `O(N)`. That means that the sliding window variant
+    for a window size of 100 can be a 100 times slower than a more specialized
+    version.
+
+    Nevertheless, for small window sizes, when no custom algorithm exists, or
+    as a prototyping and developing tool, this function can be a good solution.
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> from numpy.lib.stride_tricks import sliding_window_view
+    >>> x = np.arange(6)
+    >>> x.shape
+    (6,)
+    >>> v = sliding_window_view(x, 3)
+    >>> v.shape
+    (4, 3)
+    >>> v
+    array([[0, 1, 2],
+           [1, 2, 3],
+           [2, 3, 4],
+           [3, 4, 5]])
+
+    This also works in more dimensions, e.g.
+
+    >>> i, j = np.ogrid[:3, :4]
+    >>> x = 10*i + j
+    >>> x.shape
+    (3, 4)
+    >>> x
+    array([[ 0,  1,  2,  3],
+           [10, 11, 12, 13],
+           [20, 21, 22, 23]])
+    >>> shape = (2,2)
+    >>> v = sliding_window_view(x, shape)
+    >>> v.shape
+    (2, 3, 2, 2)
+    >>> v
+    array([[[[ 0,  1],
+             [10, 11]],
+            [[ 1,  2],
+             [11, 12]],
+            [[ 2,  3],
+             [12, 13]]],
+           [[[10, 11],
+             [20, 21]],
+            [[11, 12],
+             [21, 22]],
+            [[12, 13],
+             [22, 23]]]])
+
+    The axis can be specified explicitly:
+
+    >>> v = sliding_window_view(x, 3, 0)
+    >>> v.shape
+    (1, 4, 3)
+    >>> v
+    array([[[ 0, 10, 20],
+            [ 1, 11, 21],
+            [ 2, 12, 22],
+            [ 3, 13, 23]]])
+
+    The same axis can be used several times. In that case, every use reduces
+    the corresponding original dimension:
+
+    >>> v = sliding_window_view(x, (2, 3), (1, 1))
+    >>> v.shape
+    (3, 1, 2, 3)
+    >>> v
+    array([[[[ 0,  1,  2],
+             [ 1,  2,  3]]],
+           [[[10, 11, 12],
+             [11, 12, 13]]],
+           [[[20, 21, 22],
+             [21, 22, 23]]]])
+
+    Combining with stepped slicing (`::step`), this can be used to take sliding
+    views which skip elements:
+
+    >>> x = np.arange(7)
+    >>> sliding_window_view(x, 5)[:, ::2]
+    array([[0, 2, 4],
+           [1, 3, 5],
+           [2, 4, 6]])
+
+    or views which move by multiple elements
+
+    >>> x = np.arange(7)
+    >>> sliding_window_view(x, 3)[::2, :]
+    array([[0, 1, 2],
+           [2, 3, 4],
+           [4, 5, 6]])
+
+    A common application of `sliding_window_view` is the calculation of running
+    statistics. The simplest example is the
+    `moving average <https://en.wikipedia.org/wiki/Moving_average>`_:
+
+    >>> x = np.arange(6)
+    >>> x.shape
+    (6,)
+    >>> v = sliding_window_view(x, 3)
+    >>> v.shape
+    (4, 3)
+    >>> v
+    array([[0, 1, 2],
+           [1, 2, 3],
+           [2, 3, 4],
+           [3, 4, 5]])
+    >>> moving_average = v.mean(axis=-1)
+    >>> moving_average
+    array([1., 2., 3., 4.])
+
+    Note that a sliding window approach is often **not** optimal (see Notes).
+    """
+    window_shape = (tuple(window_shape)
+                    if np.iterable(window_shape)
+                    else (window_shape,))
+    # first convert input to array, possibly keeping subclass
+    x = np.array(x, copy=None, subok=subok)
+
+    window_shape_array = np.array(window_shape)
+    if np.any(window_shape_array < 0):
+        raise ValueError('`window_shape` cannot contain negative values')
+
+    if axis is None:
+        axis = tuple(range(x.ndim))
+        if len(window_shape) != len(axis):
+            raise ValueError(f'Since axis is `None`, must provide '
+                             f'window_shape for all dimensions of `x`; '
+                             f'got {len(window_shape)} window_shape elements '
+                             f'and `x.ndim` is {x.ndim}.')
+    else:
+        axis = normalize_axis_tuple(axis, x.ndim, allow_duplicate=True)
+        if len(window_shape) != len(axis):
+            raise ValueError(f'Must provide matching length window_shape and '
+                             f'axis; got {len(window_shape)} window_shape '
+                             f'elements and {len(axis)} axes elements.')
+
+    out_strides = x.strides + tuple(x.strides[ax] for ax in axis)
+
+    # note: same axis can be windowed repeatedly
+    x_shape_trimmed = list(x.shape)
+    for ax, dim in zip(axis, window_shape):
+        if x_shape_trimmed[ax] < dim:
+            raise ValueError(
+                'window shape cannot be larger than input array shape')
+        x_shape_trimmed[ax] -= dim - 1
+    out_shape = tuple(x_shape_trimmed) + window_shape
+    return as_strided(x, strides=out_strides, shape=out_shape,
+                      subok=subok, writeable=writeable)
+
+
+def _broadcast_to(array, shape, subok, readonly):
+    shape = tuple(shape) if np.iterable(shape) else (shape,)
+    array = np.array(array, copy=None, subok=subok)
+    if not shape and array.shape:
+        raise ValueError('cannot broadcast a non-scalar to a scalar array')
+    if any(size < 0 for size in shape):
+        raise ValueError('all elements of broadcast shape must be non-'
+                         'negative')
+    extras = []
+    it = np.nditer(
+        (array,), flags=['multi_index', 'refs_ok', 'zerosize_ok'] + extras,
+        op_flags=['readonly'], itershape=shape, order='C')
+    with it:
+        # never really has writebackifcopy semantics
+        broadcast = it.itviews[0]
+    result = _maybe_view_as_subclass(array, broadcast)
+    # In a future version this will go away
+    if not readonly and array.flags._writeable_no_warn:
+        result.flags.writeable = True
+        result.flags._warn_on_write = True
+    return result
+
+
+def _broadcast_to_dispatcher(array, shape, subok=None):
+    return (array,)
+
+
+@array_function_dispatch(_broadcast_to_dispatcher, module='numpy')
+def broadcast_to(array, shape, subok=False):
+    """Broadcast an array to a new shape.
+
+    Parameters
+    ----------
+    array : array_like
+        The array to broadcast.
+    shape : tuple or int
+        The shape of the desired array. A single integer ``i`` is interpreted
+        as ``(i,)``.
+    subok : bool, optional
+        If True, then sub-classes will be passed-through, otherwise
+        the returned array will be forced to be a base-class array (default).
+
+    Returns
+    -------
+    broadcast : array
+        A readonly view on the original array with the given shape. It is
+        typically not contiguous. Furthermore, more than one element of a
+        broadcasted array may refer to a single memory location.
+
+    Raises
+    ------
+    ValueError
+        If the array is not compatible with the new shape according to NumPy's
+        broadcasting rules.
+
+    See Also
+    --------
+    broadcast
+    broadcast_arrays
+    broadcast_shapes
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> x = np.array([1, 2, 3])
+    >>> np.broadcast_to(x, (3, 3))
+    array([[1, 2, 3],
+           [1, 2, 3],
+           [1, 2, 3]])
+    """
+    return _broadcast_to(array, shape, subok=subok, readonly=True)
+
+
+def _broadcast_shape(*args):
+    """Returns the shape of the arrays that would result from broadcasting the
+    supplied arrays against each other.
+    """
+    # use the old-iterator because np.nditer does not handle size 0 arrays
+    # consistently
+    b = np.broadcast(*args[:32])
+    # unfortunately, it cannot handle 32 or more arguments directly
+    for pos in range(32, len(args), 31):
+        # ironically, np.broadcast does not properly handle np.broadcast
+        # objects (it treats them as scalars)
+        # use broadcasting to avoid allocating the full array
+        b = broadcast_to(0, b.shape)
+        b = np.broadcast(b, *args[pos:(pos + 31)])
+    return b.shape
+
+
+_size0_dtype = np.dtype([])
+
+
+@set_module('numpy')
+def broadcast_shapes(*args):
+    """
+    Broadcast the input shapes into a single shape.
+
+    :ref:`Learn more about broadcasting here <basics.broadcasting>`.
+
+    .. versionadded:: 1.20.0
+
+    Parameters
+    ----------
+    *args : tuples of ints, or ints
+        The shapes to be broadcast against each other.
+
+    Returns
+    -------
+    tuple
+        Broadcasted shape.
+
+    Raises
+    ------
+    ValueError
+        If the shapes are not compatible and cannot be broadcast according
+        to NumPy's broadcasting rules.
+
+    See Also
+    --------
+    broadcast
+    broadcast_arrays
+    broadcast_to
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> np.broadcast_shapes((1, 2), (3, 1), (3, 2))
+    (3, 2)
+
+    >>> np.broadcast_shapes((6, 7), (5, 6, 1), (7,), (5, 1, 7))
+    (5, 6, 7)
+    """
+    arrays = [np.empty(x, dtype=_size0_dtype) for x in args]
+    return _broadcast_shape(*arrays)
+
+
+def _broadcast_arrays_dispatcher(*args, subok=None):
+    return args
+
+
+@array_function_dispatch(_broadcast_arrays_dispatcher, module='numpy')
+def broadcast_arrays(*args, subok=False):
+    """
+    Broadcast any number of arrays against each other.
+
+    Parameters
+    ----------
+    *args : array_likes
+        The arrays to broadcast.
+
+    subok : bool, optional
+        If True, then sub-classes will be passed-through, otherwise
+        the returned arrays will be forced to be a base-class array (default).
+
+    Returns
+    -------
+    broadcasted : tuple of arrays
+        These arrays are views on the original arrays.  They are typically
+        not contiguous.  Furthermore, more than one element of a
+        broadcasted array may refer to a single memory location. If you need
+        to write to the arrays, make copies first. While you can set the
+        ``writable`` flag True, writing to a single output value may end up
+        changing more than one location in the output array.
+
+        .. deprecated:: 1.17
+            The output is currently marked so that if written to, a deprecation
+            warning will be emitted. A future version will set the
+            ``writable`` flag False so writing to it will raise an error.
+
+    See Also
+    --------
+    broadcast
+    broadcast_to
+    broadcast_shapes
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> x = np.array([[1,2,3]])
+    >>> y = np.array([[4],[5]])
+    >>> np.broadcast_arrays(x, y)
+    (array([[1, 2, 3],
+            [1, 2, 3]]),
+     array([[4, 4, 4],
+            [5, 5, 5]]))
+
+    Here is a useful idiom for getting contiguous copies instead of
+    non-contiguous views.
+
+    >>> [np.array(a) for a in np.broadcast_arrays(x, y)]
+    [array([[1, 2, 3],
+            [1, 2, 3]]),
+     array([[4, 4, 4],
+            [5, 5, 5]])]
+
+    """
+    # nditer is not used here to avoid the limit of 32 arrays.
+    # Otherwise, something like the following one-liner would suffice:
+    # return np.nditer(args, flags=['multi_index', 'zerosize_ok'],
+    #                  order='C').itviews
+
+    args = [np.array(_m, copy=None, subok=subok) for _m in args]
+
+    shape = _broadcast_shape(*args)
+
+    result = [array if array.shape == shape
+              else _broadcast_to(array, shape, subok=subok, readonly=False)
+                              for array in args]
+    return tuple(result)

lib/python3.11/site-packages/numpy/lib/_stride_tricks_impl.pyi

@@ -0,0 +1,74 @@
+from collections.abc import Iterable
+from typing import Any, SupportsIndex, TypeVar, overload
+
+from numpy import generic
+from numpy._typing import ArrayLike, NDArray, _AnyShape, _ArrayLike, _ShapeLike
+
+__all__ = ["broadcast_to", "broadcast_arrays", "broadcast_shapes"]
+
+_ScalarT = TypeVar("_ScalarT", bound=generic)
+
+class DummyArray:
+    __array_interface__: dict[str, Any]
+    base: NDArray[Any] | None
+    def __init__(
+        self,
+        interface: dict[str, Any],
+        base: NDArray[Any] | None = ...,
+    ) -> None: ...
+
+@overload
+def as_strided(
+    x: _ArrayLike[_ScalarT],
+    shape: Iterable[int] | None = ...,
+    strides: Iterable[int] | None = ...,
+    subok: bool = ...,
+    writeable: bool = ...,
+) -> NDArray[_ScalarT]: ...
+@overload
+def as_strided(
+    x: ArrayLike,
+    shape: Iterable[int] | None = ...,
+    strides: Iterable[int] | None = ...,
+    subok: bool = ...,
+    writeable: bool = ...,
+) -> NDArray[Any]: ...
+
+@overload
+def sliding_window_view(
+    x: _ArrayLike[_ScalarT],
+    window_shape: int | Iterable[int],
+    axis: SupportsIndex | None = ...,
+    *,
+    subok: bool = ...,
+    writeable: bool = ...,
+) -> NDArray[_ScalarT]: ...
+@overload
+def sliding_window_view(
+    x: ArrayLike,
+    window_shape: int | Iterable[int],
+    axis: SupportsIndex | None = ...,
+    *,
+    subok: bool = ...,
+    writeable: bool = ...,
+) -> NDArray[Any]: ...
+
+@overload
+def broadcast_to(
+    array: _ArrayLike[_ScalarT],
+    shape: int | Iterable[int],
+    subok: bool = ...,
+) -> NDArray[_ScalarT]: ...
+@overload
+def broadcast_to(
+    array: ArrayLike,
+    shape: int | Iterable[int],
+    subok: bool = ...,
+) -> NDArray[Any]: ...
+
+def broadcast_shapes(*args: _ShapeLike) -> _AnyShape: ...
+
+def broadcast_arrays(
+    *args: ArrayLike,
+    subok: bool = ...,
+) -> tuple[NDArray[Any], ...]: ...

lib/python3.11/site-packages/numpy/lib/_twodim_base_impl.pyi

@@ -0,0 +1,438 @@
+from collections.abc import Callable, Sequence
+from typing import (
+    Any,
+    TypeAlias,
+    TypeVar,
+    overload,
+)
+from typing import (
+    Literal as L,
+)
+
+import numpy as np
+from numpy import (
+    _OrderCF,
+    complex128,
+    complexfloating,
+    datetime64,
+    float64,
+    floating,
+    generic,
+    int_,
+    intp,
+    object_,
+    signedinteger,
+    timedelta64,
+)
+from numpy._typing import (
+    ArrayLike,
+    DTypeLike,
+    NDArray,
+    _ArrayLike,
+    _ArrayLikeComplex_co,
+    _ArrayLikeFloat_co,
+    _ArrayLikeInt_co,
+    _ArrayLikeObject_co,
+    _DTypeLike,
+    _SupportsArray,
+    _SupportsArrayFunc,
+)
+
+__all__ = [
+    "diag",
+    "diagflat",
+    "eye",
+    "fliplr",
+    "flipud",
+    "tri",
+    "triu",
+    "tril",
+    "vander",
+    "histogram2d",
+    "mask_indices",
+    "tril_indices",
+    "tril_indices_from",
+    "triu_indices",
+    "triu_indices_from",
+]
+
+###
+
+_T = TypeVar("_T")
+_ScalarT = TypeVar("_ScalarT", bound=generic)
+_ComplexFloatingT = TypeVar("_ComplexFloatingT", bound=np.complexfloating)
+_InexactT = TypeVar("_InexactT", bound=np.inexact)
+_NumberCoT = TypeVar("_NumberCoT", bound=_Number_co)
+
+# The returned arrays dtype must be compatible with `np.equal`
+_MaskFunc: TypeAlias = Callable[[NDArray[int_], _T], NDArray[_Number_co | timedelta64 | datetime64 | object_]]
+
+_Int_co: TypeAlias = np.integer | np.bool
+_Float_co: TypeAlias = np.floating | _Int_co
+_Number_co: TypeAlias = np.number | np.bool
+
+_ArrayLike1D: TypeAlias = _SupportsArray[np.dtype[_ScalarT]] | Sequence[_ScalarT]
+_ArrayLike1DInt_co: TypeAlias = _SupportsArray[np.dtype[_Int_co]] | Sequence[int | _Int_co]
+_ArrayLike1DFloat_co: TypeAlias = _SupportsArray[np.dtype[_Float_co]] | Sequence[float | _Float_co]
+_ArrayLike2DFloat_co: TypeAlias = _SupportsArray[np.dtype[_Float_co]] | Sequence[_ArrayLike1DFloat_co]
+_ArrayLike1DNumber_co: TypeAlias = _SupportsArray[np.dtype[_Number_co]] | Sequence[complex | _Number_co]
+
+###
+
+@overload
+def fliplr(m: _ArrayLike[_ScalarT]) -> NDArray[_ScalarT]: ...
+@overload
+def fliplr(m: ArrayLike) -> NDArray[Any]: ...
+
+@overload
+def flipud(m: _ArrayLike[_ScalarT]) -> NDArray[_ScalarT]: ...
+@overload
+def flipud(m: ArrayLike) -> NDArray[Any]: ...
+
+@overload
+def eye(
+    N: int,
+    M: int | None = ...,
+    k: int = ...,
+    dtype: None = ...,
+    order: _OrderCF = ...,
+    *,
+    device: L["cpu"] | None = ...,
+    like: _SupportsArrayFunc | None = ...,
+) -> NDArray[float64]: ...
+@overload
+def eye(
+    N: int,
+    M: int | None,
+    k: int,
+    dtype: _DTypeLike[_ScalarT],
+    order: _OrderCF = ...,
+    *,
+    device: L["cpu"] | None = ...,
+    like: _SupportsArrayFunc | None = ...,
+) -> NDArray[_ScalarT]: ...
+@overload
+def eye(
+    N: int,
+    M: int | None = ...,
+    k: int = ...,
+    *,
+    dtype: _DTypeLike[_ScalarT],
+    order: _OrderCF = ...,
+    device: L["cpu"] | None = ...,
+    like: _SupportsArrayFunc | None = ...,
+) -> NDArray[_ScalarT]: ...
+@overload
+def eye(
+    N: int,
+    M: int | None = ...,
+    k: int = ...,
+    dtype: DTypeLike = ...,
+    order: _OrderCF = ...,
+    *,
+    device: L["cpu"] | None = ...,
+    like: _SupportsArrayFunc | None = ...,
+) -> NDArray[Any]: ...
+
+@overload
+def diag(v: _ArrayLike[_ScalarT], k: int = ...) -> NDArray[_ScalarT]: ...
+@overload
+def diag(v: ArrayLike, k: int = ...) -> NDArray[Any]: ...
+
+@overload
+def diagflat(v: _ArrayLike[_ScalarT], k: int = ...) -> NDArray[_ScalarT]: ...
+@overload
+def diagflat(v: ArrayLike, k: int = ...) -> NDArray[Any]: ...
+
+@overload
+def tri(
+    N: int,
+    M: int | None = ...,
+    k: int = ...,
+    dtype: None = ...,
+    *,
+    like: _SupportsArrayFunc | None = ...
+) -> NDArray[float64]: ...
+@overload
+def tri(
+    N: int,
+    M: int | None,
+    k: int,
+    dtype: _DTypeLike[_ScalarT],
+    *,
+    like: _SupportsArrayFunc | None = ...
+) -> NDArray[_ScalarT]: ...
+@overload
+def tri(
+    N: int,
+    M: int | None = ...,
+    k: int = ...,
+    *,
+    dtype: _DTypeLike[_ScalarT],
+    like: _SupportsArrayFunc | None = ...
+) -> NDArray[_ScalarT]: ...
+@overload
+def tri(
+    N: int,
+    M: int | None = ...,
+    k: int = ...,
+    dtype: DTypeLike = ...,
+    *,
+    like: _SupportsArrayFunc | None = ...
+) -> NDArray[Any]: ...
+
+@overload
+def tril(m: _ArrayLike[_ScalarT], k: int = 0) -> NDArray[_ScalarT]: ...
+@overload
+def tril(m: ArrayLike, k: int = 0) -> NDArray[Any]: ...
+
+@overload
+def triu(m: _ArrayLike[_ScalarT], k: int = 0) -> NDArray[_ScalarT]: ...
+@overload
+def triu(m: ArrayLike, k: int = 0) -> NDArray[Any]: ...
+
+@overload
+def vander(  # type: ignore[misc]
+    x: _ArrayLikeInt_co,
+    N: int | None = ...,
+    increasing: bool = ...,
+) -> NDArray[signedinteger]: ...
+@overload
+def vander(  # type: ignore[misc]
+    x: _ArrayLikeFloat_co,
+    N: int | None = ...,
+    increasing: bool = ...,
+) -> NDArray[floating]: ...
+@overload
+def vander(
+    x: _ArrayLikeComplex_co,
+    N: int | None = ...,
+    increasing: bool = ...,
+) -> NDArray[complexfloating]: ...
+@overload
+def vander(
+    x: _ArrayLikeObject_co,
+    N: int | None = ...,
+    increasing: bool = ...,
+) -> NDArray[object_]: ...
+
+@overload
+def histogram2d(
+    x: _ArrayLike1D[_ComplexFloatingT],
+    y: _ArrayLike1D[_ComplexFloatingT | _Float_co],
+    bins: int | Sequence[int] = ...,
+    range: _ArrayLike2DFloat_co | None = ...,
+    density: bool | None = ...,
+    weights: _ArrayLike1DFloat_co | None = ...,
+) -> tuple[
+    NDArray[float64],
+    NDArray[_ComplexFloatingT],
+    NDArray[_ComplexFloatingT],
+]: ...
+@overload
+def histogram2d(
+    x: _ArrayLike1D[_ComplexFloatingT | _Float_co],
+    y: _ArrayLike1D[_ComplexFloatingT],
+    bins: int | Sequence[int] = ...,
+    range: _ArrayLike2DFloat_co | None = ...,
+    density: bool | None = ...,
+    weights: _ArrayLike1DFloat_co | None = ...,
+) -> tuple[
+    NDArray[float64],
+    NDArray[_ComplexFloatingT],
+    NDArray[_ComplexFloatingT],
+]: ...
+@overload
+def histogram2d(
+    x: _ArrayLike1D[_InexactT],
+    y: _ArrayLike1D[_InexactT | _Int_co],
+    bins: int | Sequence[int] = ...,
+    range: _ArrayLike2DFloat_co | None = ...,
+    density: bool | None = ...,
+    weights: _ArrayLike1DFloat_co | None = ...,
+) -> tuple[
+    NDArray[float64],
+    NDArray[_InexactT],
+    NDArray[_InexactT],
+]: ...
+@overload
+def histogram2d(
+    x: _ArrayLike1D[_InexactT | _Int_co],
+    y: _ArrayLike1D[_InexactT],
+    bins: int | Sequence[int] = ...,
+    range: _ArrayLike2DFloat_co | None = ...,
+    density: bool | None = ...,
+    weights: _ArrayLike1DFloat_co | None = ...,
+) -> tuple[
+    NDArray[float64],
+    NDArray[_InexactT],
+    NDArray[_InexactT],
+]: ...
+@overload
+def histogram2d(
+    x: _ArrayLike1DInt_co | Sequence[float],
+    y: _ArrayLike1DInt_co | Sequence[float],
+    bins: int | Sequence[int] = ...,
+    range: _ArrayLike2DFloat_co | None = ...,
+    density: bool | None = ...,
+    weights: _ArrayLike1DFloat_co | None = ...,
+) -> tuple[
+    NDArray[float64],
+    NDArray[float64],
+    NDArray[float64],
+]: ...
+@overload
+def histogram2d(
+    x: Sequence[complex],
+    y: Sequence[complex],
+    bins: int | Sequence[int] = ...,
+    range: _ArrayLike2DFloat_co | None = ...,
+    density: bool | None = ...,
+    weights: _ArrayLike1DFloat_co | None = ...,
+) -> tuple[
+    NDArray[float64],
+    NDArray[complex128 | float64],
+    NDArray[complex128 | float64],
+]: ...
+@overload
+def histogram2d(
+    x: _ArrayLike1DNumber_co,
+    y: _ArrayLike1DNumber_co,
+    bins: _ArrayLike1D[_NumberCoT] | Sequence[_ArrayLike1D[_NumberCoT]],
+    range: _ArrayLike2DFloat_co | None = ...,
+    density: bool | None = ...,
+    weights: _ArrayLike1DFloat_co | None = ...,
+) -> tuple[
+    NDArray[float64],
+    NDArray[_NumberCoT],
+    NDArray[_NumberCoT],
+]: ...
+@overload
+def histogram2d(
+    x: _ArrayLike1D[_InexactT],
+    y: _ArrayLike1D[_InexactT],
+    bins: Sequence[_ArrayLike1D[_NumberCoT] | int],
+    range: _ArrayLike2DFloat_co | None = ...,
+    density: bool | None = ...,
+    weights: _ArrayLike1DFloat_co | None = ...,
+) -> tuple[
+    NDArray[float64],
+    NDArray[_NumberCoT | _InexactT],
+    NDArray[_NumberCoT | _InexactT],
+]: ...
+@overload
+def histogram2d(
+    x: _ArrayLike1DInt_co | Sequence[float],
+    y: _ArrayLike1DInt_co | Sequence[float],
+    bins: Sequence[_ArrayLike1D[_NumberCoT] | int],
+    range: _ArrayLike2DFloat_co | None = ...,
+    density: bool | None = ...,
+    weights: _ArrayLike1DFloat_co | None = ...,
+) -> tuple[
+    NDArray[float64],
+    NDArray[_NumberCoT | float64],
+    NDArray[_NumberCoT | float64],
+]: ...
+@overload
+def histogram2d(
+    x: Sequence[complex],
+    y: Sequence[complex],
+    bins: Sequence[_ArrayLike1D[_NumberCoT] | int],
+    range: _ArrayLike2DFloat_co | None = ...,
+    density: bool | None = ...,
+    weights: _ArrayLike1DFloat_co | None = ...,
+) -> tuple[
+    NDArray[float64],
+    NDArray[_NumberCoT | complex128 | float64],
+    NDArray[_NumberCoT | complex128 | float64],
+]: ...
+@overload
+def histogram2d(
+    x: _ArrayLike1DNumber_co,
+    y: _ArrayLike1DNumber_co,
+    bins: Sequence[Sequence[bool]],
+    range: _ArrayLike2DFloat_co | None = ...,
+    density: bool | None = ...,
+    weights: _ArrayLike1DFloat_co | None = ...,
+) -> tuple[
+    NDArray[float64],
+    NDArray[np.bool],
+    NDArray[np.bool],
+]: ...
+@overload
+def histogram2d(
+    x: _ArrayLike1DNumber_co,
+    y: _ArrayLike1DNumber_co,
+    bins: Sequence[Sequence[int]],
+    range: _ArrayLike2DFloat_co | None = ...,
+    density: bool | None = ...,
+    weights: _ArrayLike1DFloat_co | None = ...,
+) -> tuple[
+    NDArray[float64],
+    NDArray[np.int_ | np.bool],
+    NDArray[np.int_ | np.bool],
+]: ...
+@overload
+def histogram2d(
+    x: _ArrayLike1DNumber_co,
+    y: _ArrayLike1DNumber_co,
+    bins: Sequence[Sequence[float]],
+    range: _ArrayLike2DFloat_co | None = ...,
+    density: bool | None = ...,
+    weights: _ArrayLike1DFloat_co | None = ...,
+) -> tuple[
+    NDArray[float64],
+    NDArray[np.float64 | np.int_ | np.bool],
+    NDArray[np.float64 | np.int_ | np.bool],
+]: ...
+@overload
+def histogram2d(
+    x: _ArrayLike1DNumber_co,
+    y: _ArrayLike1DNumber_co,
+    bins: Sequence[Sequence[complex]],
+    range: _ArrayLike2DFloat_co | None = ...,
+    density: bool | None = ...,
+    weights: _ArrayLike1DFloat_co | None = ...,
+) -> tuple[
+    NDArray[float64],
+    NDArray[np.complex128 | np.float64 | np.int_ | np.bool],
+    NDArray[np.complex128 | np.float64 | np.int_ | np.bool],
+]: ...
+
+# NOTE: we're assuming/demanding here the `mask_func` returns
+# an ndarray of shape `(n, n)`; otherwise there is the possibility
+# of the output tuple having more or less than 2 elements
+@overload
+def mask_indices(
+    n: int,
+    mask_func: _MaskFunc[int],
+    k: int = ...,
+) -> tuple[NDArray[intp], NDArray[intp]]: ...
+@overload
+def mask_indices(
+    n: int,
+    mask_func: _MaskFunc[_T],
+    k: _T,
+) -> tuple[NDArray[intp], NDArray[intp]]: ...
+
+def tril_indices(
+    n: int,
+    k: int = ...,
+    m: int | None = ...,
+) -> tuple[NDArray[int_], NDArray[int_]]: ...
+
+def tril_indices_from(
+    arr: NDArray[Any],
+    k: int = ...,
+) -> tuple[NDArray[int_], NDArray[int_]]: ...
+
+def triu_indices(
+    n: int,
+    k: int = ...,
+    m: int | None = ...,
+) -> tuple[NDArray[int_], NDArray[int_]]: ...
+
+def triu_indices_from(
+    arr: NDArray[Any],
+    k: int = ...,
+) -> tuple[NDArray[int_], NDArray[int_]]: ...

lib/python3.11/site-packages/numpy/lib/_type_check_impl.py

@@ -0,0 +1,699 @@
+"""Automatically adapted for numpy Sep 19, 2005 by convertcode.py
+
+"""
+import functools
+
+__all__ = ['iscomplexobj', 'isrealobj', 'imag', 'iscomplex',
+           'isreal', 'nan_to_num', 'real', 'real_if_close',
+           'typename', 'mintypecode',
+           'common_type']
+
+import numpy._core.numeric as _nx
+from numpy._core import getlimits, overrides
+from numpy._core.numeric import asanyarray, asarray, isnan, zeros
+from numpy._utils import set_module
+
+from ._ufunclike_impl import isneginf, isposinf
+
+array_function_dispatch = functools.partial(
+    overrides.array_function_dispatch, module='numpy')
+
+
+_typecodes_by_elsize = 'GDFgdfQqLlIiHhBb?'
+
+
+@set_module('numpy')
+def mintypecode(typechars, typeset='GDFgdf', default='d'):
+    """
+    Return the character for the minimum-size type to which given types can
+    be safely cast.
+
+    The returned type character must represent the smallest size dtype such
+    that an array of the returned type can handle the data from an array of
+    all types in `typechars` (or if `typechars` is an array, then its
+    dtype.char).
+
+    Parameters
+    ----------
+    typechars : list of str or array_like
+        If a list of strings, each string should represent a dtype.
+        If array_like, the character representation of the array dtype is used.
+    typeset : str or list of str, optional
+        The set of characters that the returned character is chosen from.
+        The default set is 'GDFgdf'.
+    default : str, optional
+        The default character, this is returned if none of the characters in
+        `typechars` matches a character in `typeset`.
+
+    Returns
+    -------
+    typechar : str
+        The character representing the minimum-size type that was found.
+
+    See Also
+    --------
+    dtype
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> np.mintypecode(['d', 'f', 'S'])
+    'd'
+    >>> x = np.array([1.1, 2-3.j])
+    >>> np.mintypecode(x)
+    'D'
+
+    >>> np.mintypecode('abceh', default='G')
+    'G'
+
+    """
+    typecodes = ((isinstance(t, str) and t) or asarray(t).dtype.char
+                 for t in typechars)
+    intersection = {t for t in typecodes if t in typeset}
+    if not intersection:
+        return default
+    if 'F' in intersection and 'd' in intersection:
+        return 'D'
+    return min(intersection, key=_typecodes_by_elsize.index)
+
+
+def _real_dispatcher(val):
+    return (val,)
+
+
+@array_function_dispatch(_real_dispatcher)
+def real(val):
+    """
+    Return the real part of the complex argument.
+
+    Parameters
+    ----------
+    val : array_like
+        Input array.
+
+    Returns
+    -------
+    out : ndarray or scalar
+        The real component of the complex argument. If `val` is real, the type
+        of `val` is used for the output.  If `val` has complex elements, the
+        returned type is float.
+
+    See Also
+    --------
+    real_if_close, imag, angle
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> a = np.array([1+2j, 3+4j, 5+6j])
+    >>> a.real
+    array([1.,  3.,  5.])
+    >>> a.real = 9
+    >>> a
+    array([9.+2.j,  9.+4.j,  9.+6.j])
+    >>> a.real = np.array([9, 8, 7])
+    >>> a
+    array([9.+2.j,  8.+4.j,  7.+6.j])
+    >>> np.real(1 + 1j)
+    1.0
+
+    """
+    try:
+        return val.real
+    except AttributeError:
+        return asanyarray(val).real
+
+
+def _imag_dispatcher(val):
+    return (val,)
+
+
+@array_function_dispatch(_imag_dispatcher)
+def imag(val):
+    """
+    Return the imaginary part of the complex argument.
+
+    Parameters
+    ----------
+    val : array_like
+        Input array.
+
+    Returns
+    -------
+    out : ndarray or scalar
+        The imaginary component of the complex argument. If `val` is real,
+        the type of `val` is used for the output.  If `val` has complex
+        elements, the returned type is float.
+
+    See Also
+    --------
+    real, angle, real_if_close
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> a = np.array([1+2j, 3+4j, 5+6j])
+    >>> a.imag
+    array([2.,  4.,  6.])
+    >>> a.imag = np.array([8, 10, 12])
+    >>> a
+    array([1. +8.j,  3.+10.j,  5.+12.j])
+    >>> np.imag(1 + 1j)
+    1.0
+
+    """
+    try:
+        return val.imag
+    except AttributeError:
+        return asanyarray(val).imag
+
+
+def _is_type_dispatcher(x):
+    return (x,)
+
+
+@array_function_dispatch(_is_type_dispatcher)
+def iscomplex(x):
+    """
+    Returns a bool array, where True if input element is complex.
+
+    What is tested is whether the input has a non-zero imaginary part, not if
+    the input type is complex.
+
+    Parameters
+    ----------
+    x : array_like
+        Input array.
+
+    Returns
+    -------
+    out : ndarray of bools
+        Output array.
+
+    See Also
+    --------
+    isreal
+    iscomplexobj : Return True if x is a complex type or an array of complex
+                   numbers.
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> np.iscomplex([1+1j, 1+0j, 4.5, 3, 2, 2j])
+    array([ True, False, False, False, False,  True])
+
+    """
+    ax = asanyarray(x)
+    if issubclass(ax.dtype.type, _nx.complexfloating):
+        return ax.imag != 0
+    res = zeros(ax.shape, bool)
+    return res[()]   # convert to scalar if needed
+
+
+@array_function_dispatch(_is_type_dispatcher)
+def isreal(x):
+    """
+    Returns a bool array, where True if input element is real.
+
+    If element has complex type with zero imaginary part, the return value
+    for that element is True.
+
+    Parameters
+    ----------
+    x : array_like
+        Input array.
+
+    Returns
+    -------
+    out : ndarray, bool
+        Boolean array of same shape as `x`.
+
+    Notes
+    -----
+    `isreal` may behave unexpectedly for string or object arrays (see examples)
+
+    See Also
+    --------
+    iscomplex
+    isrealobj : Return True if x is not a complex type.
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> a = np.array([1+1j, 1+0j, 4.5, 3, 2, 2j], dtype=complex)
+    >>> np.isreal(a)
+    array([False,  True,  True,  True,  True, False])
+
+    The function does not work on string arrays.
+
+    >>> a = np.array([2j, "a"], dtype="U")
+    >>> np.isreal(a)  # Warns about non-elementwise comparison
+    False
+
+    Returns True for all elements in input array of ``dtype=object`` even if
+    any of the elements is complex.
+
+    >>> a = np.array([1, "2", 3+4j], dtype=object)
+    >>> np.isreal(a)
+    array([ True,  True,  True])
+
+    isreal should not be used with object arrays
+
+    >>> a = np.array([1+2j, 2+1j], dtype=object)
+    >>> np.isreal(a)
+    array([ True,  True])
+
+    """
+    return imag(x) == 0
+
+
+@array_function_dispatch(_is_type_dispatcher)
+def iscomplexobj(x):
+    """
+    Check for a complex type or an array of complex numbers.
+
+    The type of the input is checked, not the value. Even if the input
+    has an imaginary part equal to zero, `iscomplexobj` evaluates to True.
+
+    Parameters
+    ----------
+    x : any
+        The input can be of any type and shape.
+
+    Returns
+    -------
+    iscomplexobj : bool
+        The return value, True if `x` is of a complex type or has at least
+        one complex element.
+
+    See Also
+    --------
+    isrealobj, iscomplex
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> np.iscomplexobj(1)
+    False
+    >>> np.iscomplexobj(1+0j)
+    True
+    >>> np.iscomplexobj([3, 1+0j, True])
+    True
+
+    """
+    try:
+        dtype = x.dtype
+        type_ = dtype.type
+    except AttributeError:
+        type_ = asarray(x).dtype.type
+    return issubclass(type_, _nx.complexfloating)
+
+
+@array_function_dispatch(_is_type_dispatcher)
+def isrealobj(x):
+    """
+    Return True if x is a not complex type or an array of complex numbers.
+
+    The type of the input is checked, not the value. So even if the input
+    has an imaginary part equal to zero, `isrealobj` evaluates to False
+    if the data type is complex.
+
+    Parameters
+    ----------
+    x : any
+        The input can be of any type and shape.
+
+    Returns
+    -------
+    y : bool
+        The return value, False if `x` is of a complex type.
+
+    See Also
+    --------
+    iscomplexobj, isreal
+
+    Notes
+    -----
+    The function is only meant for arrays with numerical values but it
+    accepts all other objects. Since it assumes array input, the return
+    value of other objects may be True.
+
+    >>> np.isrealobj('A string')
+    True
+    >>> np.isrealobj(False)
+    True
+    >>> np.isrealobj(None)
+    True
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> np.isrealobj(1)
+    True
+    >>> np.isrealobj(1+0j)
+    False
+    >>> np.isrealobj([3, 1+0j, True])
+    False
+
+    """
+    return not iscomplexobj(x)
+
+#-----------------------------------------------------------------------------
+
+def _getmaxmin(t):
+    from numpy._core import getlimits
+    f = getlimits.finfo(t)
+    return f.max, f.min
+
+
+def _nan_to_num_dispatcher(x, copy=None, nan=None, posinf=None, neginf=None):
+    return (x,)
+
+
+@array_function_dispatch(_nan_to_num_dispatcher)
+def nan_to_num(x, copy=True, nan=0.0, posinf=None, neginf=None):
+    """
+    Replace NaN with zero and infinity with large finite numbers (default
+    behaviour) or with the numbers defined by the user using the `nan`,
+    `posinf` and/or `neginf` keywords.
+
+    If `x` is inexact, NaN is replaced by zero or by the user defined value in
+    `nan` keyword, infinity is replaced by the largest finite floating point
+    values representable by ``x.dtype`` or by the user defined value in
+    `posinf` keyword and -infinity is replaced by the most negative finite
+    floating point values representable by ``x.dtype`` or by the user defined
+    value in `neginf` keyword.
+
+    For complex dtypes, the above is applied to each of the real and
+    imaginary components of `x` separately.
+
+    If `x` is not inexact, then no replacements are made.
+
+    Parameters
+    ----------
+    x : scalar or array_like
+        Input data.
+    copy : bool, optional
+        Whether to create a copy of `x` (True) or to replace values
+        in-place (False). The in-place operation only occurs if
+        casting to an array does not require a copy.
+        Default is True.
+    nan : int, float, optional
+        Value to be used to fill NaN values. If no value is passed
+        then NaN values will be replaced with 0.0.
+    posinf : int, float, optional
+        Value to be used to fill positive infinity values. If no value is
+        passed then positive infinity values will be replaced with a very
+        large number.
+    neginf : int, float, optional
+        Value to be used to fill negative infinity values. If no value is
+        passed then negative infinity values will be replaced with a very
+        small (or negative) number.
+
+    Returns
+    -------
+    out : ndarray
+        `x`, with the non-finite values replaced. If `copy` is False, this may
+        be `x` itself.
+
+    See Also
+    --------
+    isinf : Shows which elements are positive or negative infinity.
+    isneginf : Shows which elements are negative infinity.
+    isposinf : Shows which elements are positive infinity.
+    isnan : Shows which elements are Not a Number (NaN).
+    isfinite : Shows which elements are finite (not NaN, not infinity)
+
+    Notes
+    -----
+    NumPy uses the IEEE Standard for Binary Floating-Point for Arithmetic
+    (IEEE 754). This means that Not a Number is not equivalent to infinity.
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> np.nan_to_num(np.inf)
+    1.7976931348623157e+308
+    >>> np.nan_to_num(-np.inf)
+    -1.7976931348623157e+308
+    >>> np.nan_to_num(np.nan)
+    0.0
+    >>> x = np.array([np.inf, -np.inf, np.nan, -128, 128])
+    >>> np.nan_to_num(x)
+    array([ 1.79769313e+308, -1.79769313e+308,  0.00000000e+000, # may vary
+           -1.28000000e+002,  1.28000000e+002])
+    >>> np.nan_to_num(x, nan=-9999, posinf=33333333, neginf=33333333)
+    array([ 3.3333333e+07,  3.3333333e+07, -9.9990000e+03,
+           -1.2800000e+02,  1.2800000e+02])
+    >>> y = np.array([complex(np.inf, np.nan), np.nan, complex(np.nan, np.inf)])
+    array([  1.79769313e+308,  -1.79769313e+308,   0.00000000e+000, # may vary
+         -1.28000000e+002,   1.28000000e+002])
+    >>> np.nan_to_num(y)
+    array([  1.79769313e+308 +0.00000000e+000j, # may vary
+             0.00000000e+000 +0.00000000e+000j,
+             0.00000000e+000 +1.79769313e+308j])
+    >>> np.nan_to_num(y, nan=111111, posinf=222222)
+    array([222222.+111111.j, 111111.     +0.j, 111111.+222222.j])
+    """
+    x = _nx.array(x, subok=True, copy=copy)
+    xtype = x.dtype.type
+
+    isscalar = (x.ndim == 0)
+
+    if not issubclass(xtype, _nx.inexact):
+        return x[()] if isscalar else x
+
+    iscomplex = issubclass(xtype, _nx.complexfloating)
+
+    dest = (x.real, x.imag) if iscomplex else (x,)
+    maxf, minf = _getmaxmin(x.real.dtype)
+    if posinf is not None:
+        maxf = posinf
+    if neginf is not None:
+        minf = neginf
+    for d in dest:
+        idx_nan = isnan(d)
+        idx_posinf = isposinf(d)
+        idx_neginf = isneginf(d)
+        _nx.copyto(d, nan, where=idx_nan)
+        _nx.copyto(d, maxf, where=idx_posinf)
+        _nx.copyto(d, minf, where=idx_neginf)
+    return x[()] if isscalar else x
+
+#-----------------------------------------------------------------------------
+
+def _real_if_close_dispatcher(a, tol=None):
+    return (a,)
+
+
+@array_function_dispatch(_real_if_close_dispatcher)
+def real_if_close(a, tol=100):
+    """
+    If input is complex with all imaginary parts close to zero, return
+    real parts.
+
+    "Close to zero" is defined as `tol` * (machine epsilon of the type for
+    `a`).
+
+    Parameters
+    ----------
+    a : array_like
+        Input array.
+    tol : float
+        Tolerance in machine epsilons for the complex part of the elements
+        in the array. If the tolerance is <=1, then the absolute tolerance
+        is used.
+
+    Returns
+    -------
+    out : ndarray
+        If `a` is real, the type of `a` is used for the output.  If `a`
+        has complex elements, the returned type is float.
+
+    See Also
+    --------
+    real, imag, angle
+
+    Notes
+    -----
+    Machine epsilon varies from machine to machine and between data types
+    but Python floats on most platforms have a machine epsilon equal to
+    2.2204460492503131e-16.  You can use 'np.finfo(float).eps' to print
+    out the machine epsilon for floats.
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> np.finfo(float).eps
+    2.2204460492503131e-16 # may vary
+
+    >>> np.real_if_close([2.1 + 4e-14j, 5.2 + 3e-15j], tol=1000)
+    array([2.1, 5.2])
+    >>> np.real_if_close([2.1 + 4e-13j, 5.2 + 3e-15j], tol=1000)
+    array([2.1+4.e-13j, 5.2 + 3e-15j])
+
+    """
+    a = asanyarray(a)
+    type_ = a.dtype.type
+    if not issubclass(type_, _nx.complexfloating):
+        return a
+    if tol > 1:
+        f = getlimits.finfo(type_)
+        tol = f.eps * tol
+    if _nx.all(_nx.absolute(a.imag) < tol):
+        a = a.real
+    return a
+
+
+#-----------------------------------------------------------------------------
+
+_namefromtype = {'S1': 'character',
+                 '?': 'bool',
+                 'b': 'signed char',
+                 'B': 'unsigned char',
+                 'h': 'short',
+                 'H': 'unsigned short',
+                 'i': 'integer',
+                 'I': 'unsigned integer',
+                 'l': 'long integer',
+                 'L': 'unsigned long integer',
+                 'q': 'long long integer',
+                 'Q': 'unsigned long long integer',
+                 'f': 'single precision',
+                 'd': 'double precision',
+                 'g': 'long precision',
+                 'F': 'complex single precision',
+                 'D': 'complex double precision',
+                 'G': 'complex long double precision',
+                 'S': 'string',
+                 'U': 'unicode',
+                 'V': 'void',
+                 'O': 'object'
+                 }
+
+@set_module('numpy')
+def typename(char):
+    """
+    Return a description for the given data type code.
+
+    Parameters
+    ----------
+    char : str
+        Data type code.
+
+    Returns
+    -------
+    out : str
+        Description of the input data type code.
+
+    See Also
+    --------
+    dtype
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> typechars = ['S1', '?', 'B', 'D', 'G', 'F', 'I', 'H', 'L', 'O', 'Q',
+    ...              'S', 'U', 'V', 'b', 'd', 'g', 'f', 'i', 'h', 'l', 'q']
+    >>> for typechar in typechars:
+    ...     print(typechar, ' : ', np.typename(typechar))
+    ...
+    S1  :  character
+    ?  :  bool
+    B  :  unsigned char
+    D  :  complex double precision
+    G  :  complex long double precision
+    F  :  complex single precision
+    I  :  unsigned integer
+    H  :  unsigned short
+    L  :  unsigned long integer
+    O  :  object
+    Q  :  unsigned long long integer
+    S  :  string
+    U  :  unicode
+    V  :  void
+    b  :  signed char
+    d  :  double precision
+    g  :  long precision
+    f  :  single precision
+    i  :  integer
+    h  :  short
+    l  :  long integer
+    q  :  long long integer
+
+    """
+    return _namefromtype[char]
+
+#-----------------------------------------------------------------------------
+
+
+#determine the "minimum common type" for a group of arrays.
+array_type = [[_nx.float16, _nx.float32, _nx.float64, _nx.longdouble],
+              [None, _nx.complex64, _nx.complex128, _nx.clongdouble]]
+array_precision = {_nx.float16: 0,
+                   _nx.float32: 1,
+                   _nx.float64: 2,
+                   _nx.longdouble: 3,
+                   _nx.complex64: 1,
+                   _nx.complex128: 2,
+                   _nx.clongdouble: 3}
+
+
+def _common_type_dispatcher(*arrays):
+    return arrays
+
+
+@array_function_dispatch(_common_type_dispatcher)
+def common_type(*arrays):
+    """
+    Return a scalar type which is common to the input arrays.
+
+    The return type will always be an inexact (i.e. floating point) scalar
+    type, even if all the arrays are integer arrays. If one of the inputs is
+    an integer array, the minimum precision type that is returned is a
+    64-bit floating point dtype.
+
+    All input arrays except int64 and uint64 can be safely cast to the
+    returned dtype without loss of information.
+
+    Parameters
+    ----------
+    array1, array2, ... : ndarrays
+        Input arrays.
+
+    Returns
+    -------
+    out : data type code
+        Data type code.
+
+    See Also
+    --------
+    dtype, mintypecode
+
+    Examples
+    --------
+    >>> np.common_type(np.arange(2, dtype=np.float32))
+    <class 'numpy.float32'>
+    >>> np.common_type(np.arange(2, dtype=np.float32), np.arange(2))
+    <class 'numpy.float64'>
+    >>> np.common_type(np.arange(4), np.array([45, 6.j]), np.array([45.0]))
+    <class 'numpy.complex128'>
+
+    """
+    is_complex = False
+    precision = 0
+    for a in arrays:
+        t = a.dtype.type
+        if iscomplexobj(a):
+            is_complex = True
+        if issubclass(t, _nx.integer):
+            p = 2  # array_precision[_nx.double]
+        else:
+            p = array_precision.get(t)
+            if p is None:
+                raise TypeError("can't get common type for non-numeric array")
+        precision = max(precision, p)
+    if is_complex:
+        return array_type[1][precision]
+    else:
+        return array_type[0][precision]

lib/python3.11/site-packages/numpy/lib/_type_check_impl.pyi

@@ -0,0 +1,350 @@
+from collections.abc import Container, Iterable
+from typing import Any, Protocol, TypeAlias, overload, type_check_only
+from typing import Literal as L
+
+from _typeshed import Incomplete
+from typing_extensions import TypeVar
+
+import numpy as np
+from numpy._typing import (
+    ArrayLike,
+    NDArray,
+    _16Bit,
+    _32Bit,
+    _64Bit,
+    _ArrayLike,
+    _NestedSequence,
+    _ScalarLike_co,
+    _SupportsArray,
+)
+
+__all__ = [
+    "common_type",
+    "imag",
+    "iscomplex",
+    "iscomplexobj",
+    "isreal",
+    "isrealobj",
+    "mintypecode",
+    "nan_to_num",
+    "real",
+    "real_if_close",
+    "typename",
+]
+
+_T = TypeVar("_T")
+_T_co = TypeVar("_T_co", covariant=True)
+_ScalarT = TypeVar("_ScalarT", bound=np.generic)
+_ScalarT_co = TypeVar("_ScalarT_co", bound=np.generic, covariant=True)
+_RealT = TypeVar("_RealT", bound=np.floating | np.integer | np.bool)
+
+_FloatMax32: TypeAlias = np.float32 | np.float16
+_ComplexMax128: TypeAlias = np.complex128 | np.complex64
+_RealMax64: TypeAlias = np.float64 | np.float32 | np.float16 | np.integer
+_Real: TypeAlias = np.floating | np.integer
+_InexactMax32: TypeAlias = np.inexact[_32Bit] | np.float16
+_NumberMax64: TypeAlias = np.number[_64Bit] | np.number[_32Bit] | np.number[_16Bit] | np.integer
+
+@type_check_only
+class _HasReal(Protocol[_T_co]):
+    @property
+    def real(self, /) -> _T_co: ...
+
+@type_check_only
+class _HasImag(Protocol[_T_co]):
+    @property
+    def imag(self, /) -> _T_co: ...
+
+@type_check_only
+class _HasDType(Protocol[_ScalarT_co]):
+    @property
+    def dtype(self, /) -> np.dtype[_ScalarT_co]: ...
+
+###
+
+def mintypecode(typechars: Iterable[str | ArrayLike], typeset: str | Container[str] = "GDFgdf", default: str = "d") -> str: ...
+
+#
+@overload
+def real(val: _HasReal[_T]) -> _T: ...  # type: ignore[overload-overlap]
+@overload
+def real(val: _ArrayLike[_RealT]) -> NDArray[_RealT]: ...
+@overload
+def real(val: ArrayLike) -> NDArray[Any]: ...
+
+#
+@overload
+def imag(val: _HasImag[_T]) -> _T: ...  # type: ignore[overload-overlap]
+@overload
+def imag(val: _ArrayLike[_RealT]) -> NDArray[_RealT]: ...
+@overload
+def imag(val: ArrayLike) -> NDArray[Any]: ...
+
+#
+@overload
+def iscomplex(x: _ScalarLike_co) -> np.bool: ...
+@overload
+def iscomplex(x: NDArray[Any] | _NestedSequence[ArrayLike]) -> NDArray[np.bool]: ...
+@overload
+def iscomplex(x: ArrayLike) -> np.bool | NDArray[np.bool]: ...
+
+#
+@overload
+def isreal(x: _ScalarLike_co) -> np.bool: ...
+@overload
+def isreal(x: NDArray[Any] | _NestedSequence[ArrayLike]) -> NDArray[np.bool]: ...
+@overload
+def isreal(x: ArrayLike) -> np.bool | NDArray[np.bool]: ...
+
+#
+def iscomplexobj(x: _HasDType[Any] | ArrayLike) -> bool: ...
+def isrealobj(x: _HasDType[Any] | ArrayLike) -> bool: ...
+
+#
+@overload
+def nan_to_num(
+    x: _ScalarT,
+    copy: bool = True,
+    nan: float = 0.0,
+    posinf: float | None = None,
+    neginf: float | None = None,
+) -> _ScalarT: ...
+@overload
+def nan_to_num(
+    x: NDArray[_ScalarT] | _NestedSequence[_ArrayLike[_ScalarT]],
+    copy: bool = True,
+    nan: float = 0.0,
+    posinf: float | None = None,
+    neginf: float | None = None,
+) -> NDArray[_ScalarT]: ...
+@overload
+def nan_to_num(
+    x: _SupportsArray[np.dtype[_ScalarT]],
+    copy: bool = True,
+    nan: float = 0.0,
+    posinf: float | None = None,
+    neginf: float | None = None,
+) -> _ScalarT | NDArray[_ScalarT]: ...
+@overload
+def nan_to_num(
+    x: _NestedSequence[ArrayLike],
+    copy: bool = True,
+    nan: float = 0.0,
+    posinf: float | None = None,
+    neginf: float | None = None,
+) -> NDArray[Incomplete]: ...
+@overload
+def nan_to_num(
+    x: ArrayLike,
+    copy: bool = True,
+    nan: float = 0.0,
+    posinf: float | None = None,
+    neginf: float | None = None,
+) -> Incomplete: ...
+
+# NOTE: The [overload-overlap] mypy error is a false positive
+@overload
+def real_if_close(a: _ArrayLike[np.complex64], tol: float = 100) -> NDArray[np.float32 | np.complex64]: ...  # type: ignore[overload-overlap]
+@overload
+def real_if_close(a: _ArrayLike[np.complex128], tol: float = 100) -> NDArray[np.float64 | np.complex128]: ...
+@overload
+def real_if_close(a: _ArrayLike[np.clongdouble], tol: float = 100) -> NDArray[np.longdouble | np.clongdouble]: ...
+@overload
+def real_if_close(a: _ArrayLike[_RealT], tol: float = 100) -> NDArray[_RealT]: ...
+@overload
+def real_if_close(a: ArrayLike, tol: float = 100) -> NDArray[Any]: ...
+
+#
+@overload
+def typename(char: L['S1']) -> L['character']: ...
+@overload
+def typename(char: L['?']) -> L['bool']: ...
+@overload
+def typename(char: L['b']) -> L['signed char']: ...
+@overload
+def typename(char: L['B']) -> L['unsigned char']: ...
+@overload
+def typename(char: L['h']) -> L['short']: ...
+@overload
+def typename(char: L['H']) -> L['unsigned short']: ...
+@overload
+def typename(char: L['i']) -> L['integer']: ...
+@overload
+def typename(char: L['I']) -> L['unsigned integer']: ...
+@overload
+def typename(char: L['l']) -> L['long integer']: ...
+@overload
+def typename(char: L['L']) -> L['unsigned long integer']: ...
+@overload
+def typename(char: L['q']) -> L['long long integer']: ...
+@overload
+def typename(char: L['Q']) -> L['unsigned long long integer']: ...
+@overload
+def typename(char: L['f']) -> L['single precision']: ...
+@overload
+def typename(char: L['d']) -> L['double precision']: ...
+@overload
+def typename(char: L['g']) -> L['long precision']: ...
+@overload
+def typename(char: L['F']) -> L['complex single precision']: ...
+@overload
+def typename(char: L['D']) -> L['complex double precision']: ...
+@overload
+def typename(char: L['G']) -> L['complex long double precision']: ...
+@overload
+def typename(char: L['S']) -> L['string']: ...
+@overload
+def typename(char: L['U']) -> L['unicode']: ...
+@overload
+def typename(char: L['V']) -> L['void']: ...
+@overload
+def typename(char: L['O']) -> L['object']: ...
+
+# NOTE: The [overload-overlap] mypy errors are false positives
+@overload
+def common_type() -> type[np.float16]: ...
+@overload
+def common_type(a0: _HasDType[np.float16], /, *ai: _HasDType[np.float16]) -> type[np.float16]: ...  # type: ignore[overload-overlap]
+@overload
+def common_type(a0: _HasDType[np.float32], /, *ai: _HasDType[_FloatMax32]) -> type[np.float32]: ...  # type: ignore[overload-overlap]
+@overload
+def common_type(  # type: ignore[overload-overlap]
+    a0: _HasDType[np.float64 | np.integer],
+    /,
+    *ai: _HasDType[_RealMax64],
+) -> type[np.float64]: ...
+@overload
+def common_type(  # type: ignore[overload-overlap]
+    a0: _HasDType[np.longdouble],
+    /,
+    *ai: _HasDType[_Real],
+) -> type[np.longdouble]: ...
+@overload
+def common_type(  # type: ignore[overload-overlap]
+    a0: _HasDType[np.complex64],
+    /,
+    *ai: _HasDType[_InexactMax32],
+) -> type[np.complex64]: ...
+@overload
+def common_type(  # type: ignore[overload-overlap]
+    a0: _HasDType[np.complex128],
+    /,
+    *ai: _HasDType[_NumberMax64],
+) -> type[np.complex128]: ...
+@overload
+def common_type(  # type: ignore[overload-overlap]
+    a0: _HasDType[np.clongdouble],
+    /,
+    *ai: _HasDType[np.number],
+) -> type[np.clongdouble]: ...
+@overload
+def common_type(  # type: ignore[overload-overlap]
+    a0: _HasDType[_FloatMax32],
+    array1: _HasDType[np.float32],
+    /,
+    *ai: _HasDType[_FloatMax32],
+) -> type[np.float32]: ...
+@overload
+def common_type(
+    a0: _HasDType[_RealMax64],
+    array1: _HasDType[np.float64 | np.integer],
+    /,
+    *ai: _HasDType[_RealMax64],
+) -> type[np.float64]: ...
+@overload
+def common_type(
+    a0: _HasDType[_Real],
+    array1: _HasDType[np.longdouble],
+    /,
+    *ai: _HasDType[_Real],
+) -> type[np.longdouble]: ...
+@overload
+def common_type(  # type: ignore[overload-overlap]
+    a0: _HasDType[_InexactMax32],
+    array1: _HasDType[np.complex64],
+    /,
+    *ai: _HasDType[_InexactMax32],
+) -> type[np.complex64]: ...
+@overload
+def common_type(
+    a0: _HasDType[np.float64],
+    array1: _HasDType[_ComplexMax128],
+    /,
+    *ai: _HasDType[_NumberMax64],
+) -> type[np.complex128]: ...
+@overload
+def common_type(
+    a0: _HasDType[_ComplexMax128],
+    array1: _HasDType[np.float64],
+    /,
+    *ai: _HasDType[_NumberMax64],
+) -> type[np.complex128]: ...
+@overload
+def common_type(
+    a0: _HasDType[_NumberMax64],
+    array1: _HasDType[np.complex128],
+    /,
+    *ai: _HasDType[_NumberMax64],
+) -> type[np.complex128]: ...
+@overload
+def common_type(
+    a0: _HasDType[_ComplexMax128],
+    array1: _HasDType[np.complex128 | np.integer],
+    /,
+    *ai: _HasDType[_NumberMax64],
+) -> type[np.complex128]: ...
+@overload
+def common_type(
+    a0: _HasDType[np.complex128 | np.integer],
+    array1: _HasDType[_ComplexMax128],
+    /,
+    *ai: _HasDType[_NumberMax64],
+) -> type[np.complex128]: ...
+@overload
+def common_type(
+    a0: _HasDType[_Real],
+    /,
+    *ai: _HasDType[_Real],
+) -> type[np.floating]: ...
+@overload
+def common_type(
+    a0: _HasDType[np.number],
+    array1: _HasDType[np.clongdouble],
+    /,
+    *ai: _HasDType[np.number],
+) -> type[np.clongdouble]: ...
+@overload
+def common_type(
+    a0: _HasDType[np.longdouble],
+    array1: _HasDType[np.complexfloating],
+    /,
+    *ai: _HasDType[np.number],
+) -> type[np.clongdouble]: ...
+@overload
+def common_type(
+    a0: _HasDType[np.complexfloating],
+    array1: _HasDType[np.longdouble],
+    /,
+    *ai: _HasDType[np.number],
+) -> type[np.clongdouble]: ...
+@overload
+def common_type(
+    a0: _HasDType[np.complexfloating],
+    array1: _HasDType[np.number],
+    /,
+    *ai: _HasDType[np.number],
+) -> type[np.complexfloating]: ...
+@overload
+def common_type(
+    a0: _HasDType[np.number],
+    array1: _HasDType[np.complexfloating],
+    /,
+    *ai: _HasDType[np.number],
+) -> type[np.complexfloating]: ...
+@overload
+def common_type(
+    a0: _HasDType[np.number],
+    array1: _HasDType[np.number],
+    /,
+    *ai: _HasDType[np.number],
+) -> type[Any]: ...

lib/python3.11/site-packages/numpy/lib/_ufunclike_impl.py

@@ -0,0 +1,207 @@
+"""
+Module of functions that are like ufuncs in acting on arrays and optionally
+storing results in an output array.
+
+"""
+__all__ = ['fix', 'isneginf', 'isposinf']
+
+import numpy._core.numeric as nx
+from numpy._core.overrides import array_function_dispatch
+
+
+def _dispatcher(x, out=None):
+    return (x, out)
+
+
+@array_function_dispatch(_dispatcher, verify=False, module='numpy')
+def fix(x, out=None):
+    """
+    Round to nearest integer towards zero.
+
+    Round an array of floats element-wise to nearest integer towards zero.
+    The rounded values have the same data-type as the input.
+
+    Parameters
+    ----------
+    x : array_like
+        An array to be rounded
+    out : ndarray, optional
+        A location into which the result is stored. If provided, it must have
+        a shape that the input broadcasts to. If not provided or None, a
+        freshly-allocated array is returned.
+
+    Returns
+    -------
+    out : ndarray of floats
+        An array with the same dimensions and data-type as the input.
+        If second argument is not supplied then a new array is returned
+        with the rounded values.
+
+        If a second argument is supplied the result is stored there.
+        The return value ``out`` is then a reference to that array.
+
+    See Also
+    --------
+    rint, trunc, floor, ceil
+    around : Round to given number of decimals
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> np.fix(3.14)
+    3.0
+    >>> np.fix(3)
+    3
+    >>> np.fix([2.1, 2.9, -2.1, -2.9])
+    array([ 2.,  2., -2., -2.])
+
+    """
+    # promote back to an array if flattened
+    res = nx.asanyarray(nx.ceil(x, out=out))
+    res = nx.floor(x, out=res, where=nx.greater_equal(x, 0))
+
+    # when no out argument is passed and no subclasses are involved, flatten
+    # scalars
+    if out is None and type(res) is nx.ndarray:
+        res = res[()]
+    return res
+
+
+@array_function_dispatch(_dispatcher, verify=False, module='numpy')
+def isposinf(x, out=None):
+    """
+    Test element-wise for positive infinity, return result as bool array.
+
+    Parameters
+    ----------
+    x : array_like
+        The input array.
+    out : array_like, optional
+        A location into which the result is stored. If provided, it must have a
+        shape that the input broadcasts to. If not provided or None, a
+        freshly-allocated boolean array is returned.
+
+    Returns
+    -------
+    out : ndarray
+        A boolean array with the same dimensions as the input.
+        If second argument is not supplied then a boolean array is returned
+        with values True where the corresponding element of the input is
+        positive infinity and values False where the element of the input is
+        not positive infinity.
+
+        If a second argument is supplied the result is stored there. If the
+        type of that array is a numeric type the result is represented as zeros
+        and ones, if the type is boolean then as False and True.
+        The return value `out` is then a reference to that array.
+
+    See Also
+    --------
+    isinf, isneginf, isfinite, isnan
+
+    Notes
+    -----
+    NumPy uses the IEEE Standard for Binary Floating-Point for Arithmetic
+    (IEEE 754).
+
+    Errors result if the second argument is also supplied when x is a scalar
+    input, if first and second arguments have different shapes, or if the
+    first argument has complex values
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> np.isposinf(np.inf)
+    True
+    >>> np.isposinf(-np.inf)
+    False
+    >>> np.isposinf([-np.inf, 0., np.inf])
+    array([False, False,  True])
+
+    >>> x = np.array([-np.inf, 0., np.inf])
+    >>> y = np.array([2, 2, 2])
+    >>> np.isposinf(x, y)
+    array([0, 0, 1])
+    >>> y
+    array([0, 0, 1])
+
+    """
+    is_inf = nx.isinf(x)
+    try:
+        signbit = ~nx.signbit(x)
+    except TypeError as e:
+        dtype = nx.asanyarray(x).dtype
+        raise TypeError(f'This operation is not supported for {dtype} values '
+                        'because it would be ambiguous.') from e
+    else:
+        return nx.logical_and(is_inf, signbit, out)
+
+
+@array_function_dispatch(_dispatcher, verify=False, module='numpy')
+def isneginf(x, out=None):
+    """
+    Test element-wise for negative infinity, return result as bool array.
+
+    Parameters
+    ----------
+    x : array_like
+        The input array.
+    out : array_like, optional
+        A location into which the result is stored. If provided, it must have a
+        shape that the input broadcasts to. If not provided or None, a
+        freshly-allocated boolean array is returned.
+
+    Returns
+    -------
+    out : ndarray
+        A boolean array with the same dimensions as the input.
+        If second argument is not supplied then a numpy boolean array is
+        returned with values True where the corresponding element of the
+        input is negative infinity and values False where the element of
+        the input is not negative infinity.
+
+        If a second argument is supplied the result is stored there. If the
+        type of that array is a numeric type the result is represented as
+        zeros and ones, if the type is boolean then as False and True. The
+        return value `out` is then a reference to that array.
+
+    See Also
+    --------
+    isinf, isposinf, isnan, isfinite
+
+    Notes
+    -----
+    NumPy uses the IEEE Standard for Binary Floating-Point for Arithmetic
+    (IEEE 754).
+
+    Errors result if the second argument is also supplied when x is a scalar
+    input, if first and second arguments have different shapes, or if the
+    first argument has complex values.
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> np.isneginf(-np.inf)
+    True
+    >>> np.isneginf(np.inf)
+    False
+    >>> np.isneginf([-np.inf, 0., np.inf])
+    array([ True, False, False])
+
+    >>> x = np.array([-np.inf, 0., np.inf])
+    >>> y = np.array([2, 2, 2])
+    >>> np.isneginf(x, y)
+    array([1, 0, 0])
+    >>> y
+    array([1, 0, 0])
+
+    """
+    is_inf = nx.isinf(x)
+    try:
+        signbit = nx.signbit(x)
+    except TypeError as e:
+        dtype = nx.asanyarray(x).dtype
+        raise TypeError(f'This operation is not supported for {dtype} values '
+                        'because it would be ambiguous.') from e
+    else:
+        return nx.logical_and(is_inf, signbit, out)

lib/python3.11/site-packages/numpy/lib/_ufunclike_impl.pyi

@@ -0,0 +1,67 @@
+from typing import Any, TypeVar, overload
+
+import numpy as np
+from numpy import floating, object_
+from numpy._typing import (
+    NDArray,
+    _ArrayLikeFloat_co,
+    _ArrayLikeObject_co,
+    _FloatLike_co,
+)
+
+__all__ = ["fix", "isneginf", "isposinf"]
+
+_ArrayT = TypeVar("_ArrayT", bound=NDArray[Any])
+
+@overload
+def fix(  # type: ignore[misc]
+    x: _FloatLike_co,
+    out: None = ...,
+) -> floating: ...
+@overload
+def fix(
+    x: _ArrayLikeFloat_co,
+    out: None = ...,
+) -> NDArray[floating]: ...
+@overload
+def fix(
+    x: _ArrayLikeObject_co,
+    out: None = ...,
+) -> NDArray[object_]: ...
+@overload
+def fix(
+    x: _ArrayLikeFloat_co | _ArrayLikeObject_co,
+    out: _ArrayT,
+) -> _ArrayT: ...
+
+@overload
+def isposinf(  # type: ignore[misc]
+    x: _FloatLike_co,
+    out: None = ...,
+) -> np.bool: ...
+@overload
+def isposinf(
+    x: _ArrayLikeFloat_co,
+    out: None = ...,
+) -> NDArray[np.bool]: ...
+@overload
+def isposinf(
+    x: _ArrayLikeFloat_co,
+    out: _ArrayT,
+) -> _ArrayT: ...
+
+@overload
+def isneginf(  # type: ignore[misc]
+    x: _FloatLike_co,
+    out: None = ...,
+) -> np.bool: ...
+@overload
+def isneginf(
+    x: _ArrayLikeFloat_co,
+    out: None = ...,
+) -> NDArray[np.bool]: ...
+@overload
+def isneginf(
+    x: _ArrayLikeFloat_co,
+    out: _ArrayT,
+) -> _ArrayT: ...

lib/python3.11/site-packages/numpy/lib/_user_array_impl.py

@@ -0,0 +1,299 @@
+"""
+Container class for backward compatibility with NumArray.
+
+The user_array.container class exists for backward compatibility with NumArray
+and is not meant to be used in new code. If you need to create an array
+container class, we recommend either creating a class that wraps an ndarray
+or subclasses ndarray.
+
+"""
+from numpy._core import (
+    absolute,
+    add,
+    arange,
+    array,
+    asarray,
+    bitwise_and,
+    bitwise_or,
+    bitwise_xor,
+    divide,
+    equal,
+    greater,
+    greater_equal,
+    invert,
+    left_shift,
+    less,
+    less_equal,
+    multiply,
+    not_equal,
+    power,
+    remainder,
+    reshape,
+    right_shift,
+    shape,
+    sin,
+    sqrt,
+    subtract,
+    transpose,
+)
+from numpy._core.overrides import set_module
+
+
+@set_module("numpy.lib.user_array")
+class container:
+    """
+    container(data, dtype=None, copy=True)
+
+    Standard container-class for easy multiple-inheritance.
+
+    Methods
+    -------
+    copy
+    byteswap
+    astype
+
+    """
+    def __init__(self, data, dtype=None, copy=True):
+        self.array = array(data, dtype, copy=copy)
+
+    def __repr__(self):
+        if self.ndim > 0:
+            return self.__class__.__name__ + repr(self.array)[len("array"):]
+        else:
+            return self.__class__.__name__ + "(" + repr(self.array) + ")"
+
+    def __array__(self, t=None):
+        if t:
+            return self.array.astype(t)
+        return self.array
+
+    # Array as sequence
+    def __len__(self):
+        return len(self.array)
+
+    def __getitem__(self, index):
+        return self._rc(self.array[index])
+
+    def __setitem__(self, index, value):
+        self.array[index] = asarray(value, self.dtype)
+
+    def __abs__(self):
+        return self._rc(absolute(self.array))
+
+    def __neg__(self):
+        return self._rc(-self.array)
+
+    def __add__(self, other):
+        return self._rc(self.array + asarray(other))
+
+    __radd__ = __add__
+
+    def __iadd__(self, other):
+        add(self.array, other, self.array)
+        return self
+
+    def __sub__(self, other):
+        return self._rc(self.array - asarray(other))
+
+    def __rsub__(self, other):
+        return self._rc(asarray(other) - self.array)
+
+    def __isub__(self, other):
+        subtract(self.array, other, self.array)
+        return self
+
+    def __mul__(self, other):
+        return self._rc(multiply(self.array, asarray(other)))
+
+    __rmul__ = __mul__
+
+    def __imul__(self, other):
+        multiply(self.array, other, self.array)
+        return self
+
+    def __mod__(self, other):
+        return self._rc(remainder(self.array, other))
+
+    def __rmod__(self, other):
+        return self._rc(remainder(other, self.array))
+
+    def __imod__(self, other):
+        remainder(self.array, other, self.array)
+        return self
+
+    def __divmod__(self, other):
+        return (self._rc(divide(self.array, other)),
+                self._rc(remainder(self.array, other)))
+
+    def __rdivmod__(self, other):
+        return (self._rc(divide(other, self.array)),
+                self._rc(remainder(other, self.array)))
+
+    def __pow__(self, other):
+        return self._rc(power(self.array, asarray(other)))
+
+    def __rpow__(self, other):
+        return self._rc(power(asarray(other), self.array))
+
+    def __ipow__(self, other):
+        power(self.array, other, self.array)
+        return self
+
+    def __lshift__(self, other):
+        return self._rc(left_shift(self.array, other))
+
+    def __rshift__(self, other):
+        return self._rc(right_shift(self.array, other))
+
+    def __rlshift__(self, other):
+        return self._rc(left_shift(other, self.array))
+
+    def __rrshift__(self, other):
+        return self._rc(right_shift(other, self.array))
+
+    def __ilshift__(self, other):
+        left_shift(self.array, other, self.array)
+        return self
+
+    def __irshift__(self, other):
+        right_shift(self.array, other, self.array)
+        return self
+
+    def __and__(self, other):
+        return self._rc(bitwise_and(self.array, other))
+
+    def __rand__(self, other):
+        return self._rc(bitwise_and(other, self.array))
+
+    def __iand__(self, other):
+        bitwise_and(self.array, other, self.array)
+        return self
+
+    def __xor__(self, other):
+        return self._rc(bitwise_xor(self.array, other))
+
+    def __rxor__(self, other):
+        return self._rc(bitwise_xor(other, self.array))
+
+    def __ixor__(self, other):
+        bitwise_xor(self.array, other, self.array)
+        return self
+
+    def __or__(self, other):
+        return self._rc(bitwise_or(self.array, other))
+
+    def __ror__(self, other):
+        return self._rc(bitwise_or(other, self.array))
+
+    def __ior__(self, other):
+        bitwise_or(self.array, other, self.array)
+        return self
+
+    def __pos__(self):
+        return self._rc(self.array)
+
+    def __invert__(self):
+        return self._rc(invert(self.array))
+
+    def _scalarfunc(self, func):
+        if self.ndim == 0:
+            return func(self[0])
+        else:
+            raise TypeError(
+                "only rank-0 arrays can be converted to Python scalars.")
+
+    def __complex__(self):
+        return self._scalarfunc(complex)
+
+    def __float__(self):
+        return self._scalarfunc(float)
+
+    def __int__(self):
+        return self._scalarfunc(int)
+
+    def __hex__(self):
+        return self._scalarfunc(hex)
+
+    def __oct__(self):
+        return self._scalarfunc(oct)
+
+    def __lt__(self, other):
+        return self._rc(less(self.array, other))
+
+    def __le__(self, other):
+        return self._rc(less_equal(self.array, other))
+
+    def __eq__(self, other):
+        return self._rc(equal(self.array, other))
+
+    def __ne__(self, other):
+        return self._rc(not_equal(self.array, other))
+
+    def __gt__(self, other):
+        return self._rc(greater(self.array, other))
+
+    def __ge__(self, other):
+        return self._rc(greater_equal(self.array, other))
+
+    def copy(self):
+        ""
+        return self._rc(self.array.copy())
+
+    def tobytes(self):
+        ""
+        return self.array.tobytes()
+
+    def byteswap(self):
+        ""
+        return self._rc(self.array.byteswap())
+
+    def astype(self, typecode):
+        ""
+        return self._rc(self.array.astype(typecode))
+
+    def _rc(self, a):
+        if len(shape(a)) == 0:
+            return a
+        else:
+            return self.__class__(a)
+
+    def __array_wrap__(self, *args):
+        return self.__class__(args[0])
+
+    def __setattr__(self, attr, value):
+        if attr == 'array':
+            object.__setattr__(self, attr, value)
+            return
+        try:
+            self.array.__setattr__(attr, value)
+        except AttributeError:
+            object.__setattr__(self, attr, value)
+
+    # Only called after other approaches fail.
+    def __getattr__(self, attr):
+        if (attr == 'array'):
+            return object.__getattribute__(self, attr)
+        return self.array.__getattribute__(attr)
+
+
+#############################################################
+# Test of class container
+#############################################################
+if __name__ == '__main__':
+    temp = reshape(arange(10000), (100, 100))
+
+    ua = container(temp)
+    # new object created begin test
+    print(dir(ua))
+    print(shape(ua), ua.shape)  # I have changed Numeric.py
+
+    ua_small = ua[:3, :5]
+    print(ua_small)
+    # this did not change ua[0,0], which is not normal behavior
+    ua_small[0, 0] = 10
+    print(ua_small[0, 0], ua[0, 0])
+    print(sin(ua_small) / 3. * 6. + sqrt(ua_small ** 2))
+    print(less(ua_small, 103), type(less(ua_small, 103)))
+    print(type(ua_small * reshape(arange(15), shape(ua_small))))
+    print(reshape(ua_small, (5, 3)))
+    print(transpose(ua_small))

lib/python3.11/site-packages/numpy/lib/_user_array_impl.pyi

@@ -0,0 +1,225 @@
+from types import EllipsisType
+from typing import Any, Generic, Self, SupportsIndex, TypeAlias, overload
+
+from _typeshed import Incomplete
+from typing_extensions import TypeVar, override
+
+import numpy as np
+import numpy.typing as npt
+from numpy._typing import (
+    _AnyShape,
+    _ArrayLike,
+    _ArrayLikeBool_co,
+    _ArrayLikeInt_co,
+    _DTypeLike,
+)
+
+###
+
+_ScalarT = TypeVar("_ScalarT", bound=np.generic)
+_ShapeT = TypeVar("_ShapeT", bound=tuple[int, ...])
+_ShapeT_co = TypeVar("_ShapeT_co", bound=tuple[int, ...], default=_AnyShape, covariant=True)
+_DTypeT = TypeVar("_DTypeT", bound=np.dtype)
+_DTypeT_co = TypeVar("_DTypeT_co", bound=np.dtype, default=np.dtype, covariant=True)
+
+_BoolArrayT = TypeVar("_BoolArrayT", bound=container[Any, np.dtype[np.bool]])
+_IntegralArrayT = TypeVar("_IntegralArrayT", bound=container[Any, np.dtype[np.bool | np.integer | np.object_]])
+_RealContainerT = TypeVar(
+    "_RealContainerT",
+    bound=container[Any, np.dtype[np.bool | np.integer | np.floating | np.timedelta64 | np.object_]],
+)
+_NumericContainerT = TypeVar("_NumericContainerT", bound=container[Any, np.dtype[np.number | np.timedelta64 | np.object_]])
+
+_ArrayInt_co: TypeAlias = npt.NDArray[np.integer | np.bool]
+
+_ToIndexSlice: TypeAlias = slice | EllipsisType | _ArrayInt_co | None
+_ToIndexSlices: TypeAlias = _ToIndexSlice | tuple[_ToIndexSlice, ...]
+_ToIndex: TypeAlias = SupportsIndex | _ToIndexSlice
+_ToIndices: TypeAlias = _ToIndex | tuple[_ToIndex, ...]
+
+###
+
+class container(Generic[_ShapeT_co, _DTypeT_co]):
+    array: np.ndarray[_ShapeT_co, _DTypeT_co]
+
+    @overload
+    def __init__(
+        self,
+        /,
+        data: container[_ShapeT_co, _DTypeT_co] | np.ndarray[_ShapeT_co, _DTypeT_co],
+        dtype: None = None,
+        copy: bool = True,
+    ) -> None: ...
+    @overload
+    def __init__(
+        self: container[Any, np.dtype[_ScalarT]],
+        /,
+        data: _ArrayLike[_ScalarT],
+        dtype: None = None,
+        copy: bool = True,
+    ) -> None: ...
+    @overload
+    def __init__(
+        self: container[Any, np.dtype[_ScalarT]],
+        /,
+        data: npt.ArrayLike,
+        dtype: _DTypeLike[_ScalarT],
+        copy: bool = True,
+    ) -> None: ...
+    @overload
+    def __init__(self, /, data: npt.ArrayLike, dtype: npt.DTypeLike | None = None, copy: bool = True) -> None: ...
+
+    #
+    def __complex__(self, /) -> complex: ...
+    def __float__(self, /) -> float: ...
+    def __int__(self, /) -> int: ...
+    def __hex__(self, /) -> str: ...
+    def __oct__(self, /) -> str: ...
+
+    #
+    @override
+    def __eq__(self, other: object, /) -> container[_ShapeT_co, np.dtype[np.bool]]: ...  # type: ignore[override]  # pyright: ignore[reportIncompatibleMethodOverride]
+    @override
+    def __ne__(self, other: object, /) -> container[_ShapeT_co, np.dtype[np.bool]]: ...  # type: ignore[override]  # pyright: ignore[reportIncompatibleMethodOverride]
+
+    #
+    def __lt__(self, other: npt.ArrayLike, /) -> container[_ShapeT_co, np.dtype[np.bool]]: ...
+    def __le__(self, other: npt.ArrayLike, /) -> container[_ShapeT_co, np.dtype[np.bool]]: ...
+    def __gt__(self, other: npt.ArrayLike, /) -> container[_ShapeT_co, np.dtype[np.bool]]: ...
+    def __ge__(self, other: npt.ArrayLike, /) -> container[_ShapeT_co, np.dtype[np.bool]]: ...
+
+    #
+    def __len__(self, /) -> int: ...
+
+    # keep in sync with np.ndarray
+    @overload
+    def __getitem__(self, key: _ArrayInt_co | tuple[_ArrayInt_co, ...], /) -> container[_ShapeT_co, _DTypeT_co]: ...
+    @overload
+    def __getitem__(self, key: _ToIndexSlices, /) -> container[_AnyShape, _DTypeT_co]: ...
+    @overload
+    def __getitem__(self, key: _ToIndices, /) -> Any: ...
+    @overload
+    def __getitem__(self: container[Any, np.dtype[np.void]], key: list[str], /) -> container[_ShapeT_co, np.dtype[np.void]]: ...
+    @overload
+    def __getitem__(self: container[Any, np.dtype[np.void]], key: str, /) -> container[_ShapeT_co, np.dtype]: ...
+
+    # keep in sync with np.ndarray
+    @overload
+    def __setitem__(self, index: _ToIndices, value: object, /) -> None: ...
+    @overload
+    def __setitem__(self: container[Any, np.dtype[np.void]], key: str | list[str], value: object, /) -> None: ...
+
+    # keep in sync with np.ndarray
+    @overload
+    def __abs__(self: container[_ShapeT, np.dtype[np.complex64]], /) -> container[_ShapeT, np.dtype[np.float32]]: ...  # type: ignore[overload-overlap]
+    @overload
+    def __abs__(self: container[_ShapeT, np.dtype[np.complex128]], /) -> container[_ShapeT, np.dtype[np.float64]]: ...
+    @overload
+    def __abs__(self: container[_ShapeT, np.dtype[np.complex192]], /) -> container[_ShapeT, np.dtype[np.float96]]: ...
+    @overload
+    def __abs__(self: container[_ShapeT, np.dtype[np.complex256]], /) -> container[_ShapeT, np.dtype[np.float128]]: ...
+    @overload
+    def __abs__(self: _RealContainerT, /) -> _RealContainerT: ...
+
+    #
+    def __neg__(self: _NumericContainerT, /) -> _NumericContainerT: ...  # noqa: PYI019
+    def __pos__(self: _NumericContainerT, /) -> _NumericContainerT: ...  # noqa: PYI019
+    def __invert__(self: _IntegralArrayT, /) -> _IntegralArrayT: ...  # noqa: PYI019
+
+    # TODO(jorenham): complete these binary ops
+
+    #
+    def __add__(self, other: npt.ArrayLike, /) -> Incomplete: ...
+    def __radd__(self, other: npt.ArrayLike, /) -> Incomplete: ...
+    def __iadd__(self, other: npt.ArrayLike, /) -> Self: ...
+
+    #
+    def __sub__(self, other: npt.ArrayLike, /) -> Incomplete: ...
+    def __rsub__(self, other: npt.ArrayLike, /) -> Incomplete: ...
+    def __isub__(self, other: npt.ArrayLike, /) -> Self: ...
+
+    #
+    def __mul__(self, other: npt.ArrayLike, /) -> Incomplete: ...
+    def __rmul__(self, other: npt.ArrayLike, /) -> Incomplete: ...
+    def __imul__(self, other: npt.ArrayLike, /) -> Self: ...
+
+    #
+    def __mod__(self, other: npt.ArrayLike, /) -> Incomplete: ...
+    def __rmod__(self, other: npt.ArrayLike, /) -> Incomplete: ...
+    def __imod__(self, other: npt.ArrayLike, /) -> Self: ...
+
+    #
+    def __divmod__(self, other: npt.ArrayLike, /) -> tuple[Incomplete, Incomplete]: ...
+    def __rdivmod__(self, other: npt.ArrayLike, /) -> tuple[Incomplete, Incomplete]: ...
+
+    #
+    def __pow__(self, other: npt.ArrayLike, /) -> Incomplete: ...
+    def __rpow__(self, other: npt.ArrayLike, /) -> Incomplete: ...
+    def __ipow__(self, other: npt.ArrayLike, /) -> Self: ...
+
+    #
+    def __lshift__(self, other: _ArrayLikeInt_co, /) -> container[_AnyShape, np.dtype[np.integer]]: ...
+    def __rlshift__(self, other: _ArrayLikeInt_co, /) -> container[_AnyShape, np.dtype[np.integer]]: ...
+    def __ilshift__(self, other: _ArrayLikeInt_co, /) -> Self: ...
+
+    #
+    def __rshift__(self, other: _ArrayLikeInt_co, /) -> container[_AnyShape, np.dtype[np.integer]]: ...
+    def __rrshift__(self, other: _ArrayLikeInt_co, /) -> container[_AnyShape, np.dtype[np.integer]]: ...
+    def __irshift__(self, other: _ArrayLikeInt_co, /) -> Self: ...
+
+    #
+    @overload
+    def __and__(
+        self: container[Any, np.dtype[np.bool]], other: _ArrayLikeBool_co, /
+    ) -> container[_AnyShape, np.dtype[np.bool]]: ...
+    @overload
+    def __and__(self, other: _ArrayLikeInt_co, /) -> container[_AnyShape, np.dtype[np.bool | np.integer]]: ...
+    __rand__ = __and__
+    @overload
+    def __iand__(self: _BoolArrayT, other: _ArrayLikeBool_co, /) -> _BoolArrayT: ...
+    @overload
+    def __iand__(self, other: _ArrayLikeInt_co, /) -> Self: ...
+
+    #
+    @overload
+    def __xor__(
+        self: container[Any, np.dtype[np.bool]], other: _ArrayLikeBool_co, /
+    ) -> container[_AnyShape, np.dtype[np.bool]]: ...
+    @overload
+    def __xor__(self, other: _ArrayLikeInt_co, /) -> container[_AnyShape, np.dtype[np.bool | np.integer]]: ...
+    __rxor__ = __xor__
+    @overload
+    def __ixor__(self: _BoolArrayT, other: _ArrayLikeBool_co, /) -> _BoolArrayT: ...
+    @overload
+    def __ixor__(self, other: _ArrayLikeInt_co, /) -> Self: ...
+
+    #
+    @overload
+    def __or__(
+        self: container[Any, np.dtype[np.bool]], other: _ArrayLikeBool_co, /
+    ) -> container[_AnyShape, np.dtype[np.bool]]: ...
+    @overload
+    def __or__(self, other: _ArrayLikeInt_co, /) -> container[_AnyShape, np.dtype[np.bool | np.integer]]: ...
+    __ror__ = __or__
+    @overload
+    def __ior__(self: _BoolArrayT, other: _ArrayLikeBool_co, /) -> _BoolArrayT: ...
+    @overload
+    def __ior__(self, other: _ArrayLikeInt_co, /) -> Self: ...
+
+    #
+    @overload
+    def __array__(self, /, t: None = None) -> np.ndarray[_ShapeT_co, _DTypeT_co]: ...
+    @overload
+    def __array__(self, /, t: _DTypeT) -> np.ndarray[_ShapeT_co, _DTypeT]: ...
+
+    #
+    @overload
+    def __array_wrap__(self, arg0: npt.ArrayLike, /) -> container[_ShapeT_co, _DTypeT_co]: ...
+    @overload
+    def __array_wrap__(self, a: np.ndarray[_ShapeT, _DTypeT], c: Any = ..., s: Any = ..., /) -> container[_ShapeT, _DTypeT]: ...
+
+    #
+    def copy(self, /) -> Self: ...
+    def tobytes(self, /) -> bytes: ...
+    def byteswap(self, /) -> Self: ...
+    def astype(self, /, typecode: _DTypeLike[_ScalarT]) -> container[_ShapeT_co, np.dtype[_ScalarT]]: ...

lib/python3.11/site-packages/numpy/lib/_utils_impl.py

@@ -0,0 +1,779 @@
+import functools
+import os
+import platform
+import sys
+import textwrap
+import types
+import warnings
+
+import numpy as np
+from numpy._core import ndarray
+from numpy._utils import set_module
+
+__all__ = [
+    'get_include', 'info', 'show_runtime'
+]
+
+
+@set_module('numpy')
+def show_runtime():
+    """
+    Print information about various resources in the system
+    including available intrinsic support and BLAS/LAPACK library
+    in use
+
+    .. versionadded:: 1.24.0
+
+    See Also
+    --------
+    show_config : Show libraries in the system on which NumPy was built.
+
+    Notes
+    -----
+    1. Information is derived with the help of `threadpoolctl <https://pypi.org/project/threadpoolctl/>`_
+       library if available.
+    2. SIMD related information is derived from ``__cpu_features__``,
+       ``__cpu_baseline__`` and ``__cpu_dispatch__``
+
+    """
+    from pprint import pprint
+
+    from numpy._core._multiarray_umath import (
+        __cpu_baseline__,
+        __cpu_dispatch__,
+        __cpu_features__,
+    )
+    config_found = [{
+        "numpy_version": np.__version__,
+        "python": sys.version,
+        "uname": platform.uname(),
+        }]
+    features_found, features_not_found = [], []
+    for feature in __cpu_dispatch__:
+        if __cpu_features__[feature]:
+            features_found.append(feature)
+        else:
+            features_not_found.append(feature)
+    config_found.append({
+        "simd_extensions": {
+            "baseline": __cpu_baseline__,
+            "found": features_found,
+            "not_found": features_not_found
+        }
+    })
+    try:
+        from threadpoolctl import threadpool_info
+        config_found.extend(threadpool_info())
+    except ImportError:
+        print("WARNING: `threadpoolctl` not found in system!"
+              " Install it by `pip install threadpoolctl`."
+              " Once installed, try `np.show_runtime` again"
+              " for more detailed build information")
+    pprint(config_found)
+
+
+@set_module('numpy')
+def get_include():
+    """
+    Return the directory that contains the NumPy \\*.h header files.
+
+    Extension modules that need to compile against NumPy may need to use this
+    function to locate the appropriate include directory.
+
+    Notes
+    -----
+    When using ``setuptools``, for example in ``setup.py``::
+
+        import numpy as np
+        ...
+        Extension('extension_name', ...
+                  include_dirs=[np.get_include()])
+        ...
+
+    Note that a CLI tool ``numpy-config`` was introduced in NumPy 2.0, using
+    that is likely preferred for build systems other than ``setuptools``::
+
+        $ numpy-config --cflags
+        -I/path/to/site-packages/numpy/_core/include
+
+        # Or rely on pkg-config:
+        $ export PKG_CONFIG_PATH=$(numpy-config --pkgconfigdir)
+        $ pkg-config --cflags
+        -I/path/to/site-packages/numpy/_core/include
+
+    Examples
+    --------
+    >>> np.get_include()
+    '.../site-packages/numpy/core/include'  # may vary
+
+    """
+    import numpy
+    if numpy.show_config is None:
+        # running from numpy source directory
+        d = os.path.join(os.path.dirname(numpy.__file__), '_core', 'include')
+    else:
+        # using installed numpy core headers
+        import numpy._core as _core
+        d = os.path.join(os.path.dirname(_core.__file__), 'include')
+    return d
+
+
+class _Deprecate:
+    """
+    Decorator class to deprecate old functions.
+
+    Refer to `deprecate` for details.
+
+    See Also
+    --------
+    deprecate
+
+    """
+
+    def __init__(self, old_name=None, new_name=None, message=None):
+        self.old_name = old_name
+        self.new_name = new_name
+        self.message = message
+
+    def __call__(self, func, *args, **kwargs):
+        """
+        Decorator call.  Refer to ``decorate``.
+
+        """
+        old_name = self.old_name
+        new_name = self.new_name
+        message = self.message
+
+        if old_name is None:
+            old_name = func.__name__
+        if new_name is None:
+            depdoc = f"`{old_name}` is deprecated!"
+        else:
+            depdoc = f"`{old_name}` is deprecated, use `{new_name}` instead!"
+
+        if message is not None:
+            depdoc += "\n" + message
+
+        @functools.wraps(func)
+        def newfunc(*args, **kwds):
+            warnings.warn(depdoc, DeprecationWarning, stacklevel=2)
+            return func(*args, **kwds)
+
+        newfunc.__name__ = old_name
+        doc = func.__doc__
+        if doc is None:
+            doc = depdoc
+        else:
+            lines = doc.expandtabs().split('\n')
+            indent = _get_indent(lines[1:])
+            if lines[0].lstrip():
+                # Indent the original first line to let inspect.cleandoc()
+                # dedent the docstring despite the deprecation notice.
+                doc = indent * ' ' + doc
+            else:
+                # Remove the same leading blank lines as cleandoc() would.
+                skip = len(lines[0]) + 1
+                for line in lines[1:]:
+                    if len(line) > indent:
+                        break
+                    skip += len(line) + 1
+                doc = doc[skip:]
+            depdoc = textwrap.indent(depdoc, ' ' * indent)
+            doc = f'{depdoc}\n\n{doc}'
+        newfunc.__doc__ = doc
+
+        return newfunc
+
+
+def _get_indent(lines):
+    """
+    Determines the leading whitespace that could be removed from all the lines.
+    """
+    indent = sys.maxsize
+    for line in lines:
+        content = len(line.lstrip())
+        if content:
+            indent = min(indent, len(line) - content)
+    if indent == sys.maxsize:
+        indent = 0
+    return indent
+
+
+def deprecate(*args, **kwargs):
+    """
+    Issues a DeprecationWarning, adds warning to `old_name`'s
+    docstring, rebinds ``old_name.__name__`` and returns the new
+    function object.
+
+    This function may also be used as a decorator.
+
+    .. deprecated:: 2.0
+        Use `~warnings.warn` with :exc:`DeprecationWarning` instead.
+
+    Parameters
+    ----------
+    func : function
+        The function to be deprecated.
+    old_name : str, optional
+        The name of the function to be deprecated. Default is None, in
+        which case the name of `func` is used.
+    new_name : str, optional
+        The new name for the function. Default is None, in which case the
+        deprecation message is that `old_name` is deprecated. If given, the
+        deprecation message is that `old_name` is deprecated and `new_name`
+        should be used instead.
+    message : str, optional
+        Additional explanation of the deprecation.  Displayed in the
+        docstring after the warning.
+
+    Returns
+    -------
+    old_func : function
+        The deprecated function.
+
+    Examples
+    --------
+    Note that ``olduint`` returns a value after printing Deprecation
+    Warning:
+
+    >>> olduint = np.lib.utils.deprecate(np.uint)
+    DeprecationWarning: `uint64` is deprecated! # may vary
+    >>> olduint(6)
+    6
+
+    """
+    # Deprecate may be run as a function or as a decorator
+    # If run as a function, we initialise the decorator class
+    # and execute its __call__ method.
+
+    # Deprecated in NumPy 2.0, 2023-07-11
+    warnings.warn(
+        "`deprecate` is deprecated, "
+        "use `warn` with `DeprecationWarning` instead. "
+        "(deprecated in NumPy 2.0)",
+        DeprecationWarning,
+        stacklevel=2
+    )
+
+    if args:
+        fn = args[0]
+        args = args[1:]
+
+        return _Deprecate(*args, **kwargs)(fn)
+    else:
+        return _Deprecate(*args, **kwargs)
+
+
+def deprecate_with_doc(msg):
+    """
+    Deprecates a function and includes the deprecation in its docstring.
+
+    .. deprecated:: 2.0
+        Use `~warnings.warn` with :exc:`DeprecationWarning` instead.
+
+    This function is used as a decorator. It returns an object that can be
+    used to issue a DeprecationWarning, by passing the to-be decorated
+    function as argument, this adds warning to the to-be decorated function's
+    docstring and returns the new function object.
+
+    See Also
+    --------
+    deprecate : Decorate a function such that it issues a
+                :exc:`DeprecationWarning`
+
+    Parameters
+    ----------
+    msg : str
+        Additional explanation of the deprecation. Displayed in the
+        docstring after the warning.
+
+    Returns
+    -------
+    obj : object
+
+    """
+
+    # Deprecated in NumPy 2.0, 2023-07-11
+    warnings.warn(
+        "`deprecate` is deprecated, "
+        "use `warn` with `DeprecationWarning` instead. "
+        "(deprecated in NumPy 2.0)",
+        DeprecationWarning,
+        stacklevel=2
+    )
+
+    return _Deprecate(message=msg)
+
+
+#-----------------------------------------------------------------------------
+
+
+# NOTE:  pydoc defines a help function which works similarly to this
+#  except it uses a pager to take over the screen.
+
+# combine name and arguments and split to multiple lines of width
+# characters.  End lines on a comma and begin argument list indented with
+# the rest of the arguments.
+def _split_line(name, arguments, width):
+    firstwidth = len(name)
+    k = firstwidth
+    newstr = name
+    sepstr = ", "
+    arglist = arguments.split(sepstr)
+    for argument in arglist:
+        if k == firstwidth:
+            addstr = ""
+        else:
+            addstr = sepstr
+        k = k + len(argument) + len(addstr)
+        if k > width:
+            k = firstwidth + 1 + len(argument)
+            newstr = newstr + ",\n" + " " * (firstwidth + 2) + argument
+        else:
+            newstr = newstr + addstr + argument
+    return newstr
+
+
+_namedict = None
+_dictlist = None
+
+# Traverse all module directories underneath globals
+# to see if something is defined
+def _makenamedict(module='numpy'):
+    module = __import__(module, globals(), locals(), [])
+    thedict = {module.__name__: module.__dict__}
+    dictlist = [module.__name__]
+    totraverse = [module.__dict__]
+    while True:
+        if len(totraverse) == 0:
+            break
+        thisdict = totraverse.pop(0)
+        for x in thisdict.keys():
+            if isinstance(thisdict[x], types.ModuleType):
+                modname = thisdict[x].__name__
+                if modname not in dictlist:
+                    moddict = thisdict[x].__dict__
+                    dictlist.append(modname)
+                    totraverse.append(moddict)
+                    thedict[modname] = moddict
+    return thedict, dictlist
+
+
+def _info(obj, output=None):
+    """Provide information about ndarray obj.
+
+    Parameters
+    ----------
+    obj : ndarray
+        Must be ndarray, not checked.
+    output
+        Where printed output goes.
+
+    Notes
+    -----
+    Copied over from the numarray module prior to its removal.
+    Adapted somewhat as only numpy is an option now.
+
+    Called by info.
+
+    """
+    extra = ""
+    tic = ""
+    bp = lambda x: x
+    cls = getattr(obj, '__class__', type(obj))
+    nm = getattr(cls, '__name__', cls)
+    strides = obj.strides
+    endian = obj.dtype.byteorder
+
+    if output is None:
+        output = sys.stdout
+
+    print("class: ", nm, file=output)
+    print("shape: ", obj.shape, file=output)
+    print("strides: ", strides, file=output)
+    print("itemsize: ", obj.itemsize, file=output)
+    print("aligned: ", bp(obj.flags.aligned), file=output)
+    print("contiguous: ", bp(obj.flags.contiguous), file=output)
+    print("fortran: ", obj.flags.fortran, file=output)
+    print(
+        f"data pointer: {hex(obj.ctypes._as_parameter_.value)}{extra}",
+        file=output
+        )
+    print("byteorder: ", end=' ', file=output)
+    if endian in ['|', '=']:
+        print(f"{tic}{sys.byteorder}{tic}", file=output)
+        byteswap = False
+    elif endian == '>':
+        print(f"{tic}big{tic}", file=output)
+        byteswap = sys.byteorder != "big"
+    else:
+        print(f"{tic}little{tic}", file=output)
+        byteswap = sys.byteorder != "little"
+    print("byteswap: ", bp(byteswap), file=output)
+    print(f"type: {obj.dtype}", file=output)
+
+
+@set_module('numpy')
+def info(object=None, maxwidth=76, output=None, toplevel='numpy'):
+    """
+    Get help information for an array, function, class, or module.
+
+    Parameters
+    ----------
+    object : object or str, optional
+        Input object or name to get information about. If `object` is
+        an `ndarray` instance, information about the array is printed.
+        If `object` is a numpy object, its docstring is given. If it is
+        a string, available modules are searched for matching objects.
+        If None, information about `info` itself is returned.
+    maxwidth : int, optional
+        Printing width.
+    output : file like object, optional
+        File like object that the output is written to, default is
+        ``None``, in which case ``sys.stdout`` will be used.
+        The object has to be opened in 'w' or 'a' mode.
+    toplevel : str, optional
+        Start search at this level.
+
+    Notes
+    -----
+    When used interactively with an object, ``np.info(obj)`` is equivalent
+    to ``help(obj)`` on the Python prompt or ``obj?`` on the IPython
+    prompt.
+
+    Examples
+    --------
+    >>> np.info(np.polyval) # doctest: +SKIP
+       polyval(p, x)
+         Evaluate the polynomial p at x.
+         ...
+
+    When using a string for `object` it is possible to get multiple results.
+
+    >>> np.info('fft') # doctest: +SKIP
+         *** Found in numpy ***
+    Core FFT routines
+    ...
+         *** Found in numpy.fft ***
+     fft(a, n=None, axis=-1)
+    ...
+         *** Repeat reference found in numpy.fft.fftpack ***
+         *** Total of 3 references found. ***
+
+    When the argument is an array, information about the array is printed.
+
+    >>> a = np.array([[1 + 2j, 3, -4], [-5j, 6, 0]], dtype=np.complex64)
+    >>> np.info(a)
+    class:  ndarray
+    shape:  (2, 3)
+    strides:  (24, 8)
+    itemsize:  8
+    aligned:  True
+    contiguous:  True
+    fortran:  False
+    data pointer: 0x562b6e0d2860  # may vary
+    byteorder:  little
+    byteswap:  False
+    type: complex64
+
+    """
+    global _namedict, _dictlist
+    # Local import to speed up numpy's import time.
+    import inspect
+    import pydoc
+
+    if (hasattr(object, '_ppimport_importer') or
+           hasattr(object, '_ppimport_module')):
+        object = object._ppimport_module
+    elif hasattr(object, '_ppimport_attr'):
+        object = object._ppimport_attr
+
+    if output is None:
+        output = sys.stdout
+
+    if object is None:
+        info(info)
+    elif isinstance(object, ndarray):
+        _info(object, output=output)
+    elif isinstance(object, str):
+        if _namedict is None:
+            _namedict, _dictlist = _makenamedict(toplevel)
+        numfound = 0
+        objlist = []
+        for namestr in _dictlist:
+            try:
+                obj = _namedict[namestr][object]
+                if id(obj) in objlist:
+                    print(f"\n     *** Repeat reference found in {namestr} *** ",
+                          file=output
+                          )
+                else:
+                    objlist.append(id(obj))
+                    print(f"     *** Found in {namestr} ***", file=output)
+                    info(obj)
+                    print("-" * maxwidth, file=output)
+                numfound += 1
+            except KeyError:
+                pass
+        if numfound == 0:
+            print(f"Help for {object} not found.", file=output)
+        else:
+            print("\n     "
+                  "*** Total of %d references found. ***" % numfound,
+                  file=output
+                  )
+
+    elif inspect.isfunction(object) or inspect.ismethod(object):
+        name = object.__name__
+        try:
+            arguments = str(inspect.signature(object))
+        except Exception:
+            arguments = "()"
+
+        if len(name + arguments) > maxwidth:
+            argstr = _split_line(name, arguments, maxwidth)
+        else:
+            argstr = name + arguments
+
+        print(" " + argstr + "\n", file=output)
+        print(inspect.getdoc(object), file=output)
+
+    elif inspect.isclass(object):
+        name = object.__name__
+        try:
+            arguments = str(inspect.signature(object))
+        except Exception:
+            arguments = "()"
+
+        if len(name + arguments) > maxwidth:
+            argstr = _split_line(name, arguments, maxwidth)
+        else:
+            argstr = name + arguments
+
+        print(" " + argstr + "\n", file=output)
+        doc1 = inspect.getdoc(object)
+        if doc1 is None:
+            if hasattr(object, '__init__'):
+                print(inspect.getdoc(object.__init__), file=output)
+        else:
+            print(inspect.getdoc(object), file=output)
+
+        methods = pydoc.allmethods(object)
+
+        public_methods = [meth for meth in methods if meth[0] != '_']
+        if public_methods:
+            print("\n\nMethods:\n", file=output)
+            for meth in public_methods:
+                thisobj = getattr(object, meth, None)
+                if thisobj is not None:
+                    methstr, other = pydoc.splitdoc(
+                            inspect.getdoc(thisobj) or "None"
+                            )
+                print(f"  {meth}  --  {methstr}", file=output)
+
+    elif hasattr(object, '__doc__'):
+        print(inspect.getdoc(object), file=output)
+
+
+def safe_eval(source):
+    """
+    Protected string evaluation.
+
+    .. deprecated:: 2.0
+        Use `ast.literal_eval` instead.
+
+    Evaluate a string containing a Python literal expression without
+    allowing the execution of arbitrary non-literal code.
+
+    .. warning::
+
+        This function is identical to :py:meth:`ast.literal_eval` and
+        has the same security implications.  It may not always be safe
+        to evaluate large input strings.
+
+    Parameters
+    ----------
+    source : str
+        The string to evaluate.
+
+    Returns
+    -------
+    obj : object
+       The result of evaluating `source`.
+
+    Raises
+    ------
+    SyntaxError
+        If the code has invalid Python syntax, or if it contains
+        non-literal code.
+
+    Examples
+    --------
+    >>> np.safe_eval('1')
+    1
+    >>> np.safe_eval('[1, 2, 3]')
+    [1, 2, 3]
+    >>> np.safe_eval('{"foo": ("bar", 10.0)}')
+    {'foo': ('bar', 10.0)}
+
+    >>> np.safe_eval('import os')
+    Traceback (most recent call last):
+      ...
+    SyntaxError: invalid syntax
+
+    >>> np.safe_eval('open("/home/user/.ssh/id_dsa").read()')
+    Traceback (most recent call last):
+      ...
+    ValueError: malformed node or string: <_ast.Call object at 0x...>
+
+    """
+
+    # Deprecated in NumPy 2.0, 2023-07-11
+    warnings.warn(
+        "`safe_eval` is deprecated. Use `ast.literal_eval` instead. "
+        "Be aware of security implications, such as memory exhaustion "
+        "based attacks (deprecated in NumPy 2.0)",
+        DeprecationWarning,
+        stacklevel=2
+    )
+
+    # Local import to speed up numpy's import time.
+    import ast
+    return ast.literal_eval(source)
+
+
+def _median_nancheck(data, result, axis):
+    """
+    Utility function to check median result from data for NaN values at the end
+    and return NaN in that case. Input result can also be a MaskedArray.
+
+    Parameters
+    ----------
+    data : array
+        Sorted input data to median function
+    result : Array or MaskedArray
+        Result of median function.
+    axis : int
+        Axis along which the median was computed.
+
+    Returns
+    -------
+    result : scalar or ndarray
+        Median or NaN in axes which contained NaN in the input.  If the input
+        was an array, NaN will be inserted in-place.  If a scalar, either the
+        input itself or a scalar NaN.
+    """
+    if data.size == 0:
+        return result
+    potential_nans = data.take(-1, axis=axis)
+    n = np.isnan(potential_nans)
+    # masked NaN values are ok, although for masked the copyto may fail for
+    # unmasked ones (this was always broken) when the result is a scalar.
+    if np.ma.isMaskedArray(n):
+        n = n.filled(False)
+
+    if not n.any():
+        return result
+
+    # Without given output, it is possible that the current result is a
+    # numpy scalar, which is not writeable.  If so, just return nan.
+    if isinstance(result, np.generic):
+        return potential_nans
+
+    # Otherwise copy NaNs (if there are any)
+    np.copyto(result, potential_nans, where=n)
+    return result
+
+def _opt_info():
+    """
+    Returns a string containing the CPU features supported
+    by the current build.
+
+    The format of the string can be explained as follows:
+        - Dispatched features supported by the running machine end with `*`.
+        - Dispatched features not supported by the running machine
+          end with `?`.
+        - Remaining features represent the baseline.
+
+    Returns:
+        str: A formatted string indicating the supported CPU features.
+    """
+    from numpy._core._multiarray_umath import (
+        __cpu_baseline__,
+        __cpu_dispatch__,
+        __cpu_features__,
+    )
+
+    if len(__cpu_baseline__) == 0 and len(__cpu_dispatch__) == 0:
+        return ''
+
+    enabled_features = ' '.join(__cpu_baseline__)
+    for feature in __cpu_dispatch__:
+        if __cpu_features__[feature]:
+            enabled_features += f" {feature}*"
+        else:
+            enabled_features += f" {feature}?"
+
+    return enabled_features
+
+def drop_metadata(dtype, /):
+    """
+    Returns the dtype unchanged if it contained no metadata or a copy of the
+    dtype if it (or any of its structure dtypes) contained metadata.
+
+    This utility is used by `np.save` and `np.savez` to drop metadata before
+    saving.
+
+    .. note::
+
+        Due to its limitation this function may move to a more appropriate
+        home or change in the future and is considered semi-public API only.
+
+    .. warning::
+
+        This function does not preserve more strange things like record dtypes
+        and user dtypes may simply return the wrong thing.  If you need to be
+        sure about the latter, check the result with:
+        ``np.can_cast(new_dtype, dtype, casting="no")``.
+
+    """
+    if dtype.fields is not None:
+        found_metadata = dtype.metadata is not None
+
+        names = []
+        formats = []
+        offsets = []
+        titles = []
+        for name, field in dtype.fields.items():
+            field_dt = drop_metadata(field[0])
+            if field_dt is not field[0]:
+                found_metadata = True
+
+            names.append(name)
+            formats.append(field_dt)
+            offsets.append(field[1])
+            titles.append(None if len(field) < 3 else field[2])
+
+        if not found_metadata:
+            return dtype
+
+        structure = {
+            'names': names, 'formats': formats, 'offsets': offsets, 'titles': titles,
+            'itemsize': dtype.itemsize}
+
+        # NOTE: Could pass (dtype.type, structure) to preserve record dtypes...
+        return np.dtype(structure, align=dtype.isalignedstruct)
+    elif dtype.subdtype is not None:
+        # subarray dtype
+        subdtype, shape = dtype.subdtype
+        new_subdtype = drop_metadata(subdtype)
+        if dtype.metadata is None and new_subdtype is subdtype:
+            return dtype
+
+        return np.dtype((new_subdtype, shape))
+    else:
+        # Normal unstructured dtype
+        if dtype.metadata is None:
+            return dtype
+        # Note that `dt.str` doesn't round-trip e.g. for user-dtypes.
+        return np.dtype(dtype.str)

lib/python3.11/site-packages/numpy/lib/_utils_impl.pyi

@@ -0,0 +1,10 @@
+from _typeshed import SupportsWrite
+
+from numpy._typing import DTypeLike
+
+__all__ = ["get_include", "info", "show_runtime"]
+
+def get_include() -> str: ...
+def show_runtime() -> None: ...
+def info(object: object = ..., maxwidth: int = ..., output: SupportsWrite[str] | None = ..., toplevel: str = ...) -> None: ...
+def drop_metadata(dtype: DTypeLike, /) -> DTypeLike: ...

lib/python3.11/site-packages/numpy/lib/_version.py

@@ -0,0 +1,154 @@
+"""Utility to compare (NumPy) version strings.
+
+The NumpyVersion class allows properly comparing numpy version strings.
+The LooseVersion and StrictVersion classes that distutils provides don't
+work; they don't recognize anything like alpha/beta/rc/dev versions.
+
+"""
+import re
+
+__all__ = ['NumpyVersion']
+
+
+class NumpyVersion:
+    """Parse and compare numpy version strings.
+
+    NumPy has the following versioning scheme (numbers given are examples; they
+    can be > 9 in principle):
+
+    - Released version: '1.8.0', '1.8.1', etc.
+    - Alpha: '1.8.0a1', '1.8.0a2', etc.
+    - Beta: '1.8.0b1', '1.8.0b2', etc.
+    - Release candidates: '1.8.0rc1', '1.8.0rc2', etc.
+    - Development versions: '1.8.0.dev-f1234afa' (git commit hash appended)
+    - Development versions after a1: '1.8.0a1.dev-f1234afa',
+                                     '1.8.0b2.dev-f1234afa',
+                                     '1.8.1rc1.dev-f1234afa', etc.
+    - Development versions (no git hash available): '1.8.0.dev-Unknown'
+
+    Comparing needs to be done against a valid version string or other
+    `NumpyVersion` instance. Note that all development versions of the same
+    (pre-)release compare equal.
+
+    Parameters
+    ----------
+    vstring : str
+        NumPy version string (``np.__version__``).
+
+    Examples
+    --------
+    >>> from numpy.lib import NumpyVersion
+    >>> if NumpyVersion(np.__version__) < '1.7.0':
+    ...     print('skip')
+    >>> # skip
+
+    >>> NumpyVersion('1.7')  # raises ValueError, add ".0"
+    Traceback (most recent call last):
+        ...
+    ValueError: Not a valid numpy version string
+
+    """
+
+    __module__ = "numpy.lib"
+
+    def __init__(self, vstring):
+        self.vstring = vstring
+        ver_main = re.match(r'\d+\.\d+\.\d+', vstring)
+        if not ver_main:
+            raise ValueError("Not a valid numpy version string")
+
+        self.version = ver_main.group()
+        self.major, self.minor, self.bugfix = [int(x) for x in
+            self.version.split('.')]
+        if len(vstring) == ver_main.end():
+            self.pre_release = 'final'
+        else:
+            alpha = re.match(r'a\d', vstring[ver_main.end():])
+            beta = re.match(r'b\d', vstring[ver_main.end():])
+            rc = re.match(r'rc\d', vstring[ver_main.end():])
+            pre_rel = [m for m in [alpha, beta, rc] if m is not None]
+            if pre_rel:
+                self.pre_release = pre_rel[0].group()
+            else:
+                self.pre_release = ''
+
+        self.is_devversion = bool(re.search(r'.dev', vstring))
+
+    def _compare_version(self, other):
+        """Compare major.minor.bugfix"""
+        if self.major == other.major:
+            if self.minor == other.minor:
+                if self.bugfix == other.bugfix:
+                    vercmp = 0
+                elif self.bugfix > other.bugfix:
+                    vercmp = 1
+                else:
+                    vercmp = -1
+            elif self.minor > other.minor:
+                vercmp = 1
+            else:
+                vercmp = -1
+        elif self.major > other.major:
+            vercmp = 1
+        else:
+            vercmp = -1
+
+        return vercmp
+
+    def _compare_pre_release(self, other):
+        """Compare alpha/beta/rc/final."""
+        if self.pre_release == other.pre_release:
+            vercmp = 0
+        elif self.pre_release == 'final':
+            vercmp = 1
+        elif other.pre_release == 'final':
+            vercmp = -1
+        elif self.pre_release > other.pre_release:
+            vercmp = 1
+        else:
+            vercmp = -1
+
+        return vercmp
+
+    def _compare(self, other):
+        if not isinstance(other, (str, NumpyVersion)):
+            raise ValueError("Invalid object to compare with NumpyVersion.")
+
+        if isinstance(other, str):
+            other = NumpyVersion(other)
+
+        vercmp = self._compare_version(other)
+        if vercmp == 0:
+            # Same x.y.z version, check for alpha/beta/rc
+            vercmp = self._compare_pre_release(other)
+            if vercmp == 0:
+                # Same version and same pre-release, check if dev version
+                if self.is_devversion is other.is_devversion:
+                    vercmp = 0
+                elif self.is_devversion:
+                    vercmp = -1
+                else:
+                    vercmp = 1
+
+        return vercmp
+
+    def __lt__(self, other):
+        return self._compare(other) < 0
+
+    def __le__(self, other):
+        return self._compare(other) <= 0
+
+    def __eq__(self, other):
+        return self._compare(other) == 0
+
+    def __ne__(self, other):
+        return self._compare(other) != 0
+
+    def __gt__(self, other):
+        return self._compare(other) > 0
+
+    def __ge__(self, other):
+        return self._compare(other) >= 0
+
+    def __repr__(self):
+        return f"NumpyVersion({self.vstring})"

lib/python3.11/site-packages/numpy/lib/_version.pyi

@@ -0,0 +1,17 @@
+__all__ = ["NumpyVersion"]
+
+class NumpyVersion:
+    vstring: str
+    version: str
+    major: int
+    minor: int
+    bugfix: int
+    pre_release: str
+    is_devversion: bool
+    def __init__(self, vstring: str) -> None: ...
+    def __lt__(self, other: str | NumpyVersion) -> bool: ...
+    def __le__(self, other: str | NumpyVersion) -> bool: ...
+    def __eq__(self, other: str | NumpyVersion) -> bool: ...  # type: ignore[override]
+    def __ne__(self, other: str | NumpyVersion) -> bool: ...  # type: ignore[override]
+    def __gt__(self, other: str | NumpyVersion) -> bool: ...
+    def __ge__(self, other: str | NumpyVersion) -> bool: ...

lib/python3.11/site-packages/numpy/lib/array_utils.py

@@ -0,0 +1,7 @@
+from ._array_utils_impl import (  # noqa: F401
+    __all__,
+    __doc__,
+    byte_bounds,
+    normalize_axis_index,
+    normalize_axis_tuple,
+)

lib/python3.11/site-packages/numpy/lib/array_utils.pyi

@@ -0,0 +1,12 @@
+from ._array_utils_impl import (
+    __all__ as __all__,
+)
+from ._array_utils_impl import (
+    byte_bounds as byte_bounds,
+)
+from ._array_utils_impl import (
+    normalize_axis_index as normalize_axis_index,
+)
+from ._array_utils_impl import (
+    normalize_axis_tuple as normalize_axis_tuple,
+)

lib/python3.11/site-packages/numpy/lib/format.py

@@ -0,0 +1,24 @@
+from ._format_impl import (  # noqa: F401
+    ARRAY_ALIGN,
+    BUFFER_SIZE,
+    EXPECTED_KEYS,
+    GROWTH_AXIS_MAX_DIGITS,
+    MAGIC_LEN,
+    MAGIC_PREFIX,
+    __all__,
+    __doc__,
+    descr_to_dtype,
+    drop_metadata,
+    dtype_to_descr,
+    header_data_from_array_1_0,
+    isfileobj,
+    magic,
+    open_memmap,
+    read_array,
+    read_array_header_1_0,
+    read_array_header_2_0,
+    read_magic,
+    write_array,
+    write_array_header_1_0,
+    write_array_header_2_0,
+)

lib/python3.11/site-packages/numpy/lib/format.pyi

@@ -0,0 +1,66 @@
+from ._format_impl import (
+    ARRAY_ALIGN as ARRAY_ALIGN,
+)
+from ._format_impl import (
+    BUFFER_SIZE as BUFFER_SIZE,
+)
+from ._format_impl import (
+    EXPECTED_KEYS as EXPECTED_KEYS,
+)
+from ._format_impl import (
+    GROWTH_AXIS_MAX_DIGITS as GROWTH_AXIS_MAX_DIGITS,
+)
+from ._format_impl import (
+    MAGIC_LEN as MAGIC_LEN,
+)
+from ._format_impl import (
+    MAGIC_PREFIX as MAGIC_PREFIX,
+)
+from ._format_impl import (
+    __all__ as __all__,
+)
+from ._format_impl import (
+    __doc__ as __doc__,
+)
+from ._format_impl import (
+    descr_to_dtype as descr_to_dtype,
+)
+from ._format_impl import (
+    drop_metadata as drop_metadata,
+)
+from ._format_impl import (
+    dtype_to_descr as dtype_to_descr,
+)
+from ._format_impl import (
+    header_data_from_array_1_0 as header_data_from_array_1_0,
+)
+from ._format_impl import (
+    isfileobj as isfileobj,
+)
+from ._format_impl import (
+    magic as magic,
+)
+from ._format_impl import (
+    open_memmap as open_memmap,
+)
+from ._format_impl import (
+    read_array as read_array,
+)
+from ._format_impl import (
+    read_array_header_1_0 as read_array_header_1_0,
+)
+from ._format_impl import (
+    read_array_header_2_0 as read_array_header_2_0,
+)
+from ._format_impl import (
+    read_magic as read_magic,
+)
+from ._format_impl import (
+    write_array as write_array,
+)
+from ._format_impl import (
+    write_array_header_1_0 as write_array_header_1_0,
+)
+from ._format_impl import (
+    write_array_header_2_0 as write_array_header_2_0,
+)

lib/python3.11/site-packages/numpy/lib/introspect.py

@@ -0,0 +1,95 @@
+"""
+Introspection helper functions.
+"""
+
+__all__ = ['opt_func_info']
+
+
+def opt_func_info(func_name=None, signature=None):
+    """
+    Returns a dictionary containing the currently supported CPU dispatched
+    features for all optimized functions.
+
+    Parameters
+    ----------
+    func_name : str (optional)
+        Regular expression to filter by function name.
+
+    signature : str (optional)
+        Regular expression to filter by data type.
+
+    Returns
+    -------
+    dict
+        A dictionary where keys are optimized function names and values are
+        nested dictionaries indicating supported targets based on data types.
+
+    Examples
+    --------
+    Retrieve dispatch information for functions named 'add' or 'sub' and
+    data types 'float64' or 'float32':
+
+    >>> import numpy as np
+    >>> dict = np.lib.introspect.opt_func_info(
+    ...     func_name="add|abs", signature="float64|complex64"
+    ... )
+    >>> import json
+    >>> print(json.dumps(dict, indent=2))
+        {
+          "absolute": {
+            "dd": {
+              "current": "SSE41",
+              "available": "SSE41 baseline(SSE SSE2 SSE3)"
+            },
+            "Ff": {
+              "current": "FMA3__AVX2",
+              "available": "AVX512F FMA3__AVX2 baseline(SSE SSE2 SSE3)"
+            },
+            "Dd": {
+              "current": "FMA3__AVX2",
+              "available": "AVX512F FMA3__AVX2 baseline(SSE SSE2 SSE3)"
+            }
+          },
+          "add": {
+            "ddd": {
+              "current": "FMA3__AVX2",
+              "available": "FMA3__AVX2 baseline(SSE SSE2 SSE3)"
+            },
+            "FFF": {
+              "current": "FMA3__AVX2",
+              "available": "FMA3__AVX2 baseline(SSE SSE2 SSE3)"
+            }
+          }
+        }
+
+    """
+    import re
+
+    from numpy._core._multiarray_umath import __cpu_targets_info__ as targets
+    from numpy._core._multiarray_umath import dtype
+
+    if func_name is not None:
+        func_pattern = re.compile(func_name)
+        matching_funcs = {
+            k: v for k, v in targets.items()
+            if func_pattern.search(k)
+        }
+    else:
+        matching_funcs = targets
+
+    if signature is not None:
+        sig_pattern = re.compile(signature)
+        matching_sigs = {}
+        for k, v in matching_funcs.items():
+            matching_chars = {}
+            for chars, targets in v.items():
+                if any(
+                    sig_pattern.search(c) or sig_pattern.search(dtype(c).name)
+                    for c in chars
+                ):
+                    matching_chars[chars] = targets
+            if matching_chars:
+                matching_sigs[k] = matching_chars
+    else:
+        matching_sigs = matching_funcs
+    return matching_sigs

lib/python3.11/site-packages/numpy/lib/introspect.pyi

@@ -0,0 +1,3 @@
+__all__ = ["opt_func_info"]
+
+def opt_func_info(func_name: str | None = None, signature: str | None = None) -> dict[str, dict[str, dict[str, str]]]: ...

lib/python3.11/site-packages/numpy/lib/mixins.py

@@ -0,0 +1,180 @@
+"""
+Mixin classes for custom array types that don't inherit from ndarray.
+"""
+
+__all__ = ['NDArrayOperatorsMixin']
+
+
+def _disables_array_ufunc(obj):
+    """True when __array_ufunc__ is set to None."""
+    try:
+        return obj.__array_ufunc__ is None
+    except AttributeError:
+        return False
+
+
+def _binary_method(ufunc, name):
+    """Implement a forward binary method with a ufunc, e.g., __add__."""
+    def func(self, other):
+        if _disables_array_ufunc(other):
+            return NotImplemented
+        return ufunc(self, other)
+    func.__name__ = f'__{name}__'
+    return func
+
+
+def _reflected_binary_method(ufunc, name):
+    """Implement a reflected binary method with a ufunc, e.g., __radd__."""
+    def func(self, other):
+        if _disables_array_ufunc(other):
+            return NotImplemented
+        return ufunc(other, self)
+    func.__name__ = f'__r{name}__'
+    return func
+
+
+def _inplace_binary_method(ufunc, name):
+    """Implement an in-place binary method with a ufunc, e.g., __iadd__."""
+    def func(self, other):
+        return ufunc(self, other, out=(self,))
+    func.__name__ = f'__i{name}__'
+    return func
+
+
+def _numeric_methods(ufunc, name):
+    """Implement forward, reflected and inplace binary methods with a ufunc."""
+    return (_binary_method(ufunc, name),
+            _reflected_binary_method(ufunc, name),
+            _inplace_binary_method(ufunc, name))
+
+
+def _unary_method(ufunc, name):
+    """Implement a unary special method with a ufunc."""
+    def func(self):
+        return ufunc(self)
+    func.__name__ = f'__{name}__'
+    return func
+
+
+class NDArrayOperatorsMixin:
+    """Mixin defining all operator special methods using __array_ufunc__.
+
+    This class implements the special methods for almost all of Python's
+    builtin operators defined in the `operator` module, including comparisons
+    (``==``, ``>``, etc.) and arithmetic (``+``, ``*``, ``-``, etc.), by
+    deferring to the ``__array_ufunc__`` method, which subclasses must
+    implement.
+
+    It is useful for writing classes that do not inherit from `numpy.ndarray`,
+    but that should support arithmetic and numpy universal functions like
+    arrays as described in :external+neps:doc:`nep-0013-ufunc-overrides`.
+
+    As an trivial example, consider this implementation of an ``ArrayLike``
+    class that simply wraps a NumPy array and ensures that the result of any
+    arithmetic operation is also an ``ArrayLike`` object:
+
+        >>> import numbers
+        >>> class ArrayLike(np.lib.mixins.NDArrayOperatorsMixin):
+        ...     def __init__(self, value):
+        ...         self.value = np.asarray(value)
+        ...
+        ...     # One might also consider adding the built-in list type to this
+        ...     # list, to support operations like np.add(array_like, list)
+        ...     _HANDLED_TYPES = (np.ndarray, numbers.Number)
+        ...
+        ...     def __array_ufunc__(self, ufunc, method, *inputs, **kwargs):
+        ...         out = kwargs.get('out', ())
+        ...         for x in inputs + out:
+        ...             # Only support operations with instances of
+        ...             # _HANDLED_TYPES. Use ArrayLike instead of type(self)
+        ...             # for isinstance to allow subclasses that don't
+        ...             # override __array_ufunc__ to handle ArrayLike objects.
+        ...             if not isinstance(
+        ...                 x, self._HANDLED_TYPES + (ArrayLike,)
+        ...             ):
+        ...                 return NotImplemented
+        ...
+        ...         # Defer to the implementation of the ufunc
+        ...         # on unwrapped values.
+        ...         inputs = tuple(x.value if isinstance(x, ArrayLike) else x
+        ...                     for x in inputs)
+        ...         if out:
+        ...             kwargs['out'] = tuple(
+        ...                 x.value if isinstance(x, ArrayLike) else x
+        ...                 for x in out)
+        ...         result = getattr(ufunc, method)(*inputs, **kwargs)
+        ...
+        ...         if type(result) is tuple:
+        ...             # multiple return values
+        ...             return tuple(type(self)(x) for x in result)
+        ...         elif method == 'at':
+        ...             # no return value
+        ...             return None
+        ...         else:
+        ...             # one return value
+        ...             return type(self)(result)
+        ...
+        ...     def __repr__(self):
+        ...         return '%s(%r)' % (type(self).__name__, self.value)
+
+    In interactions between ``ArrayLike`` objects and numbers or numpy arrays,
+    the result is always another ``ArrayLike``:
+
+        >>> x = ArrayLike([1, 2, 3])
+        >>> x - 1
+        ArrayLike(array([0, 1, 2]))
+        >>> 1 - x
+        ArrayLike(array([ 0, -1, -2]))
+        >>> np.arange(3) - x
+        ArrayLike(array([-1, -1, -1]))
+        >>> x - np.arange(3)
+        ArrayLike(array([1, 1, 1]))
+
+    Note that unlike ``numpy.ndarray``, ``ArrayLike`` does not allow operations
+    with arbitrary, unrecognized types. This ensures that interactions with
+    ArrayLike preserve a well-defined casting hierarchy.
+
+    """
+    from numpy._core import umath as um
+
+    __slots__ = ()
+    # Like np.ndarray, this mixin class implements "Option 1" from the ufunc
+    # overrides NEP.
+
+    # comparisons don't have reflected and in-place versions
+    __lt__ = _binary_method(um.less, 'lt')
+    __le__ = _binary_method(um.less_equal, 'le')
+    __eq__ = _binary_method(um.equal, 'eq')
+    __ne__ = _binary_method(um.not_equal, 'ne')
+    __gt__ = _binary_method(um.greater, 'gt')
+    __ge__ = _binary_method(um.greater_equal, 'ge')
+
+    # numeric methods
+    __add__, __radd__, __iadd__ = _numeric_methods(um.add, 'add')
+    __sub__, __rsub__, __isub__ = _numeric_methods(um.subtract, 'sub')
+    __mul__, __rmul__, __imul__ = _numeric_methods(um.multiply, 'mul')
+    __matmul__, __rmatmul__, __imatmul__ = _numeric_methods(
+        um.matmul, 'matmul')
+    __truediv__, __rtruediv__, __itruediv__ = _numeric_methods(
+        um.true_divide, 'truediv')
+    __floordiv__, __rfloordiv__, __ifloordiv__ = _numeric_methods(
+        um.floor_divide, 'floordiv')
+    __mod__, __rmod__, __imod__ = _numeric_methods(um.remainder, 'mod')
+    __divmod__ = _binary_method(um.divmod, 'divmod')
+    __rdivmod__ = _reflected_binary_method(um.divmod, 'divmod')
+    # __idivmod__ does not exist
+    # TODO: handle the optional third argument for __pow__?
+    __pow__, __rpow__, __ipow__ = _numeric_methods(um.power, 'pow')
+    __lshift__, __rlshift__, __ilshift__ = _numeric_methods(
+        um.left_shift, 'lshift')
+    __rshift__, __rrshift__, __irshift__ = _numeric_methods(
+        um.right_shift, 'rshift')
+    __and__, __rand__, __iand__ = _numeric_methods(um.bitwise_and, 'and')
+    __xor__, __rxor__, __ixor__ = _numeric_methods(um.bitwise_xor, 'xor')
+    __or__, __ror__, __ior__ = _numeric_methods(um.bitwise_or, 'or')
+
+    # unary methods
+    __neg__ = _unary_method(um.negative, 'neg')
+    __pos__ = _unary_method(um.positive, 'pos')
+    __abs__ = _unary_method(um.absolute, 'abs')
+    __invert__ = _unary_method(um.invert, 'invert')

lib/python3.11/site-packages/numpy/lib/mixins.pyi

@@ -0,0 +1,75 @@
+from abc import ABC, abstractmethod
+from typing import Any
+from typing import Literal as L
+
+from numpy import ufunc
+
+__all__ = ["NDArrayOperatorsMixin"]
+
+# NOTE: `NDArrayOperatorsMixin` is not formally an abstract baseclass,
+# even though it's reliant on subclasses implementing `__array_ufunc__`
+
+# NOTE: The accepted input- and output-types of the various dunders are
+# completely dependent on how `__array_ufunc__` is implemented.
+# As such, only little type safety can be provided here.
+
+class NDArrayOperatorsMixin(ABC):
+    @abstractmethod
+    def __array_ufunc__(
+        self,
+        ufunc: ufunc,
+        method: L["__call__", "reduce", "reduceat", "accumulate", "outer", "at"],
+        *inputs: Any,
+        **kwargs: Any,
+    ) -> Any: ...
+    def __lt__(self, other: Any) -> Any: ...
+    def __le__(self, other: Any) -> Any: ...
+    def __eq__(self, other: Any) -> Any: ...
+    def __ne__(self, other: Any) -> Any: ...
+    def __gt__(self, other: Any) -> Any: ...
+    def __ge__(self, other: Any) -> Any: ...
+    def __add__(self, other: Any) -> Any: ...
+    def __radd__(self, other: Any) -> Any: ...
+    def __iadd__(self, other: Any) -> Any: ...
+    def __sub__(self, other: Any) -> Any: ...
+    def __rsub__(self, other: Any) -> Any: ...
+    def __isub__(self, other: Any) -> Any: ...
+    def __mul__(self, other: Any) -> Any: ...
+    def __rmul__(self, other: Any) -> Any: ...
+    def __imul__(self, other: Any) -> Any: ...
+    def __matmul__(self, other: Any) -> Any: ...
+    def __rmatmul__(self, other: Any) -> Any: ...
+    def __imatmul__(self, other: Any) -> Any: ...
+    def __truediv__(self, other: Any) -> Any: ...
+    def __rtruediv__(self, other: Any) -> Any: ...
+    def __itruediv__(self, other: Any) -> Any: ...
+    def __floordiv__(self, other: Any) -> Any: ...
+    def __rfloordiv__(self, other: Any) -> Any: ...
+    def __ifloordiv__(self, other: Any) -> Any: ...
+    def __mod__(self, other: Any) -> Any: ...
+    def __rmod__(self, other: Any) -> Any: ...
+    def __imod__(self, other: Any) -> Any: ...
+    def __divmod__(self, other: Any) -> Any: ...
+    def __rdivmod__(self, other: Any) -> Any: ...
+    def __pow__(self, other: Any) -> Any: ...
+    def __rpow__(self, other: Any) -> Any: ...
+    def __ipow__(self, other: Any) -> Any: ...
+    def __lshift__(self, other: Any) -> Any: ...
+    def __rlshift__(self, other: Any) -> Any: ...
+    def __ilshift__(self, other: Any) -> Any: ...
+    def __rshift__(self, other: Any) -> Any: ...
+    def __rrshift__(self, other: Any) -> Any: ...
+    def __irshift__(self, other: Any) -> Any: ...
+    def __and__(self, other: Any) -> Any: ...
+    def __rand__(self, other: Any) -> Any: ...
+    def __iand__(self, other: Any) -> Any: ...
+    def __xor__(self, other: Any) -> Any: ...
+    def __rxor__(self, other: Any) -> Any: ...
+    def __ixor__(self, other: Any) -> Any: ...
+    def __or__(self, other: Any) -> Any: ...
+    def __ror__(self, other: Any) -> Any: ...
+    def __ior__(self, other: Any) -> Any: ...
+    def __neg__(self) -> Any: ...
+    def __pos__(self) -> Any: ...
+    def __abs__(self) -> Any: ...
+    def __invert__(self) -> Any: ...

lib/python3.11/site-packages/numpy/lib/npyio.py

@@ -0,0 +1 @@
+from ._npyio_impl import DataSource, NpzFile, __doc__  # noqa: F401

lib/python3.11/site-packages/numpy/lib/npyio.pyi

@@ -0,0 +1,9 @@
+from numpy.lib._npyio_impl import (
+    DataSource as DataSource,
+)
+from numpy.lib._npyio_impl import (
+    NpzFile as NpzFile,
+)
+from numpy.lib._npyio_impl import (
+    __doc__ as __doc__,
+)

lib/python3.11/site-packages/numpy/lib/recfunctions.pyi

@@ -0,0 +1,435 @@
+from collections.abc import Callable, Iterable, Mapping, Sequence
+from typing import Any, Literal, TypeAlias, overload
+
+from _typeshed import Incomplete
+from typing_extensions import TypeVar
+
+import numpy as np
+import numpy.typing as npt
+from numpy._typing import _AnyShape, _DTypeLike, _DTypeLikeVoid
+from numpy.ma.mrecords import MaskedRecords
+
+__all__ = [
+    "append_fields",
+    "apply_along_fields",
+    "assign_fields_by_name",
+    "drop_fields",
+    "find_duplicates",
+    "flatten_descr",
+    "get_fieldstructure",
+    "get_names",
+    "get_names_flat",
+    "join_by",
+    "merge_arrays",
+    "rec_append_fields",
+    "rec_drop_fields",
+    "rec_join",
+    "recursive_fill_fields",
+    "rename_fields",
+    "repack_fields",
+    "require_fields",
+    "stack_arrays",
+    "structured_to_unstructured",
+    "unstructured_to_structured",
+]
+
+_T = TypeVar("_T")
+_ShapeT = TypeVar("_ShapeT", bound=tuple[int, ...])
+_ScalarT = TypeVar("_ScalarT", bound=np.generic)
+_DTypeT = TypeVar("_DTypeT", bound=np.dtype)
+_ArrayT = TypeVar("_ArrayT", bound=npt.NDArray[Any])
+_VoidArrayT = TypeVar("_VoidArrayT", bound=npt.NDArray[np.void])
+_NonVoidDTypeT = TypeVar("_NonVoidDTypeT", bound=_NonVoidDType)
+
+_OneOrMany: TypeAlias = _T | Iterable[_T]
+_BuiltinSequence: TypeAlias = tuple[_T, ...] | list[_T]
+
+_NestedNames: TypeAlias = tuple[str | _NestedNames, ...]
+_NonVoid: TypeAlias = np.bool | np.number | np.character | np.datetime64 | np.timedelta64 | np.object_
+_NonVoidDType: TypeAlias = np.dtype[_NonVoid] | np.dtypes.StringDType
+
+_JoinType: TypeAlias = Literal["inner", "outer", "leftouter"]
+
+###
+
+def recursive_fill_fields(input: npt.NDArray[np.void], output: _VoidArrayT) -> _VoidArrayT: ...
+
+#
+def get_names(adtype: np.dtype[np.void]) -> _NestedNames: ...
+def get_names_flat(adtype: np.dtype[np.void]) -> tuple[str, ...]: ...
+
+#
+@overload
+def flatten_descr(ndtype: _NonVoidDTypeT) -> tuple[tuple[Literal[""], _NonVoidDTypeT]]: ...
+@overload
+def flatten_descr(ndtype: np.dtype[np.void]) -> tuple[tuple[str, np.dtype]]: ...
+
+#
+def get_fieldstructure(
+    adtype: np.dtype[np.void],
+    lastname: str | None = None,
+    parents: dict[str, list[str]] | None = None,
+) -> dict[str, list[str]]: ...
+
+#
+@overload
+def merge_arrays(
+    seqarrays: Sequence[np.ndarray[_ShapeT, np.dtype]] | np.ndarray[_ShapeT, np.dtype],
+    fill_value: float = -1,
+    flatten: bool = False,
+    usemask: bool = False,
+    asrecarray: bool = False,
+) -> np.recarray[_ShapeT, np.dtype[np.void]]: ...
+@overload
+def merge_arrays(
+    seqarrays: Sequence[npt.ArrayLike] | np.void,
+    fill_value: float = -1,
+    flatten: bool = False,
+    usemask: bool = False,
+    asrecarray: bool = False,
+) -> np.recarray[_AnyShape, np.dtype[np.void]]: ...
+
+#
+@overload
+def drop_fields(
+    base: np.ndarray[_ShapeT, np.dtype[np.void]],
+    drop_names: str | Iterable[str],
+    usemask: bool = True,
+    asrecarray: Literal[False] = False,
+) -> np.ndarray[_ShapeT, np.dtype[np.void]]: ...
+@overload
+def drop_fields(
+    base: np.ndarray[_ShapeT, np.dtype[np.void]],
+    drop_names: str | Iterable[str],
+    usemask: bool,
+    asrecarray: Literal[True],
+) -> np.recarray[_ShapeT, np.dtype[np.void]]: ...
+@overload
+def drop_fields(
+    base: np.ndarray[_ShapeT, np.dtype[np.void]],
+    drop_names: str | Iterable[str],
+    usemask: bool = True,
+    *,
+    asrecarray: Literal[True],
+) -> np.recarray[_ShapeT, np.dtype[np.void]]: ...
+
+#
+@overload
+def rename_fields(
+    base: MaskedRecords[_ShapeT, np.dtype[np.void]],
+    namemapper: Mapping[str, str],
+) -> MaskedRecords[_ShapeT, np.dtype[np.void]]: ...
+@overload
+def rename_fields(
+    base: np.ma.MaskedArray[_ShapeT, np.dtype[np.void]],
+    namemapper: Mapping[str, str],
+) -> np.ma.MaskedArray[_ShapeT, np.dtype[np.void]]: ...
+@overload
+def rename_fields(
+    base: np.recarray[_ShapeT, np.dtype[np.void]],
+    namemapper: Mapping[str, str],
+) -> np.recarray[_ShapeT, np.dtype[np.void]]: ...
+@overload
+def rename_fields(
+    base: np.ndarray[_ShapeT, np.dtype[np.void]],
+    namemapper: Mapping[str, str],
+) -> np.ndarray[_ShapeT, np.dtype[np.void]]: ...
+
+#
+@overload
+def append_fields(
+    base: np.ndarray[_ShapeT, np.dtype[np.void]],
+    names: _OneOrMany[str],
+    data: _OneOrMany[npt.NDArray[Any]],
+    dtypes: _BuiltinSequence[np.dtype] | None,
+    fill_value: int,
+    usemask: Literal[False],
+    asrecarray: Literal[False] = False,
+) -> np.ndarray[_ShapeT, np.dtype[np.void]]: ...
+@overload
+def append_fields(
+    base: np.ndarray[_ShapeT, np.dtype[np.void]],
+    names: _OneOrMany[str],
+    data: _OneOrMany[npt.NDArray[Any]],
+    dtypes: _BuiltinSequence[np.dtype] | None = None,
+    fill_value: int = -1,
+    *,
+    usemask: Literal[False],
+    asrecarray: Literal[False] = False,
+) -> np.ndarray[_ShapeT, np.dtype[np.void]]: ...
+@overload
+def append_fields(
+    base: np.ndarray[_ShapeT, np.dtype[np.void]],
+    names: _OneOrMany[str],
+    data: _OneOrMany[npt.NDArray[Any]],
+    dtypes: _BuiltinSequence[np.dtype] | None,
+    fill_value: int,
+    usemask: Literal[False],
+    asrecarray: Literal[True],
+) -> np.recarray[_ShapeT, np.dtype[np.void]]: ...
+@overload
+def append_fields(
+    base: np.ndarray[_ShapeT, np.dtype[np.void]],
+    names: _OneOrMany[str],
+    data: _OneOrMany[npt.NDArray[Any]],
+    dtypes: _BuiltinSequence[np.dtype] | None = None,
+    fill_value: int = -1,
+    *,
+    usemask: Literal[False],
+    asrecarray: Literal[True],
+) -> np.recarray[_ShapeT, np.dtype[np.void]]: ...
+@overload
+def append_fields(
+    base: np.ndarray[_ShapeT, np.dtype[np.void]],
+    names: _OneOrMany[str],
+    data: _OneOrMany[npt.NDArray[Any]],
+    dtypes: _BuiltinSequence[np.dtype] | None = None,
+    fill_value: int = -1,
+    usemask: Literal[True] = True,
+    asrecarray: Literal[False] = False,
+) -> np.ma.MaskedArray[_ShapeT, np.dtype[np.void]]: ...
+@overload
+def append_fields(
+    base: np.ndarray[_ShapeT, np.dtype[np.void]],
+    names: _OneOrMany[str],
+    data: _OneOrMany[npt.NDArray[Any]],
+    dtypes: _BuiltinSequence[np.dtype] | None,
+    fill_value: int,
+    usemask: Literal[True],
+    asrecarray: Literal[True],
+) -> MaskedRecords[_ShapeT, np.dtype[np.void]]: ...
+@overload
+def append_fields(
+    base: np.ndarray[_ShapeT, np.dtype[np.void]],
+    names: _OneOrMany[str],
+    data: _OneOrMany[npt.NDArray[Any]],
+    dtypes: _BuiltinSequence[np.dtype] | None = None,
+    fill_value: int = -1,
+    usemask: Literal[True] = True,
+    *,
+    asrecarray: Literal[True],
+) -> MaskedRecords[_ShapeT, np.dtype[np.void]]: ...
+
+#
+def rec_drop_fields(
+    base: np.ndarray[_ShapeT, np.dtype[np.void]],
+    drop_names: str | Iterable[str],
+) -> np.recarray[_ShapeT, np.dtype[np.void]]: ...
+
+#
+def rec_append_fields(
+    base: np.ndarray[_ShapeT, np.dtype[np.void]],
+    names: _OneOrMany[str],
+    data: _OneOrMany[npt.NDArray[Any]],
+    dtypes: _BuiltinSequence[np.dtype] | None = None,
+) -> np.ma.MaskedArray[_ShapeT, np.dtype[np.void]]: ...
+
+# TODO(jorenham): Stop passing `void` directly once structured dtypes are implemented,
+# e.g. using a `TypeVar` with constraints.
+# https://github.com/numpy/numtype/issues/92
+@overload
+def repack_fields(a: _DTypeT, align: bool = False, recurse: bool = False) -> _DTypeT: ...
+@overload
+def repack_fields(a: _ScalarT, align: bool = False, recurse: bool = False) -> _ScalarT: ...
+@overload
+def repack_fields(a: _ArrayT, align: bool = False, recurse: bool = False) -> _ArrayT: ...
+
+# TODO(jorenham): Attempt shape-typing (return type has ndim == arr.ndim + 1)
+@overload
+def structured_to_unstructured(
+    arr: npt.NDArray[np.void],
+    dtype: _DTypeLike[_ScalarT],
+    copy: bool = False,
+    casting: np._CastingKind = "unsafe",
+) -> npt.NDArray[_ScalarT]: ...
+@overload
+def structured_to_unstructured(
+    arr: npt.NDArray[np.void],
+    dtype: npt.DTypeLike | None = None,
+    copy: bool = False,
+    casting: np._CastingKind = "unsafe",
+) -> npt.NDArray[Any]: ...
+
+#
+@overload
+def unstructured_to_structured(
+    arr: npt.NDArray[Any],
+    dtype: npt.DTypeLike,
+    names: None = None,
+    align: bool = False,
+    copy: bool = False,
+    casting: str = "unsafe",
+) -> npt.NDArray[np.void]: ...
+@overload
+def unstructured_to_structured(
+    arr: npt.NDArray[Any],
+    dtype: None,
+    names: _OneOrMany[str],
+    align: bool = False,
+    copy: bool = False,
+    casting: str = "unsafe",
+) -> npt.NDArray[np.void]: ...
+
+#
+def apply_along_fields(
+    func: Callable[[np.ndarray[_ShapeT, Any]], npt.NDArray[Any]],
+    arr: np.ndarray[_ShapeT, np.dtype[np.void]],
+) -> np.ndarray[_ShapeT, np.dtype[np.void]]: ...
+
+#
+def assign_fields_by_name(dst: npt.NDArray[np.void], src: npt.NDArray[np.void], zero_unassigned: bool = True) -> None: ...
+
+#
+def require_fields(
+    array: np.ndarray[_ShapeT, np.dtype[np.void]],
+    required_dtype: _DTypeLikeVoid,
+) -> np.ndarray[_ShapeT, np.dtype[np.void]]: ...
+
+# TODO(jorenham): Attempt shape-typing
+@overload
+def stack_arrays(
+    arrays: _ArrayT,
+    defaults: Mapping[str, object] | None = None,
+    usemask: bool = True,
+    asrecarray: bool = False,
+    autoconvert: bool = False,
+) -> _ArrayT: ...
+@overload
+def stack_arrays(
+    arrays: Sequence[npt.NDArray[Any]],
+    defaults: Mapping[str, Incomplete] | None,
+    usemask: Literal[False],
+    asrecarray: Literal[False] = False,
+    autoconvert: bool = False,
+) -> npt.NDArray[np.void]: ...
+@overload
+def stack_arrays(
+    arrays: Sequence[npt.NDArray[Any]],
+    defaults: Mapping[str, Incomplete] | None = None,
+    *,
+    usemask: Literal[False],
+    asrecarray: Literal[False] = False,
+    autoconvert: bool = False,
+) -> npt.NDArray[np.void]: ...
+@overload
+def stack_arrays(
+    arrays: Sequence[npt.NDArray[Any]],
+    defaults: Mapping[str, Incomplete] | None = None,
+    *,
+    usemask: Literal[False],
+    asrecarray: Literal[True],
+    autoconvert: bool = False,
+) -> np.recarray[_AnyShape, np.dtype[np.void]]: ...
+@overload
+def stack_arrays(
+    arrays: Sequence[npt.NDArray[Any]],
+    defaults: Mapping[str, Incomplete] | None = None,
+    usemask: Literal[True] = True,
+    asrecarray: Literal[False] = False,
+    autoconvert: bool = False,
+) -> np.ma.MaskedArray[_AnyShape, np.dtype[np.void]]: ...
+@overload
+def stack_arrays(
+    arrays: Sequence[npt.NDArray[Any]],
+    defaults: Mapping[str, Incomplete] | None,
+    usemask: Literal[True],
+    asrecarray: Literal[True],
+    autoconvert: bool = False,
+) -> MaskedRecords[_AnyShape, np.dtype[np.void]]: ...
+@overload
+def stack_arrays(
+    arrays: Sequence[npt.NDArray[Any]],
+    defaults: Mapping[str, Incomplete] | None = None,
+    usemask: Literal[True] = True,
+    *,
+    asrecarray: Literal[True],
+    autoconvert: bool = False,
+) -> MaskedRecords[_AnyShape, np.dtype[np.void]]: ...
+
+#
+@overload
+def find_duplicates(
+    a: np.ma.MaskedArray[_ShapeT, np.dtype[np.void]],
+    key: str | None = None,
+    ignoremask: bool = True,
+    return_index: Literal[False] = False,
+) -> np.ma.MaskedArray[_ShapeT, np.dtype[np.void]]: ...
+@overload
+def find_duplicates(
+    a: np.ma.MaskedArray[_ShapeT, np.dtype[np.void]],
+    key: str | None,
+    ignoremask: bool,
+    return_index: Literal[True],
+) -> tuple[np.ma.MaskedArray[_ShapeT, np.dtype[np.void]], np.ndarray[_ShapeT, np.dtype[np.int_]]]: ...
+@overload
+def find_duplicates(
+    a: np.ma.MaskedArray[_ShapeT, np.dtype[np.void]],
+    key: str | None = None,
+    ignoremask: bool = True,
+    *,
+    return_index: Literal[True],
+) -> tuple[np.ma.MaskedArray[_ShapeT, np.dtype[np.void]], np.ndarray[_ShapeT, np.dtype[np.int_]]]: ...
+
+#
+@overload
+def join_by(
+    key: str | Sequence[str],
+    r1: npt.NDArray[np.void],
+    r2: npt.NDArray[np.void],
+    jointype: _JoinType = "inner",
+    r1postfix: str = "1",
+    r2postfix: str = "2",
+    defaults: Mapping[str, object] | None = None,
+    *,
+    usemask: Literal[False],
+    asrecarray: Literal[False] = False,
+) -> np.ndarray[tuple[int], np.dtype[np.void]]: ...
+@overload
+def join_by(
+    key: str | Sequence[str],
+    r1: npt.NDArray[np.void],
+    r2: npt.NDArray[np.void],
+    jointype: _JoinType = "inner",
+    r1postfix: str = "1",
+    r2postfix: str = "2",
+    defaults: Mapping[str, object] | None = None,
+    *,
+    usemask: Literal[False],
+    asrecarray: Literal[True],
+) -> np.recarray[tuple[int], np.dtype[np.void]]: ...
+@overload
+def join_by(
+    key: str | Sequence[str],
+    r1: npt.NDArray[np.void],
+    r2: npt.NDArray[np.void],
+    jointype: _JoinType = "inner",
+    r1postfix: str = "1",
+    r2postfix: str = "2",
+    defaults: Mapping[str, object] | None = None,
+    usemask: Literal[True] = True,
+    asrecarray: Literal[False] = False,
+) -> np.ma.MaskedArray[tuple[int], np.dtype[np.void]]: ...
+@overload
+def join_by(
+    key: str | Sequence[str],
+    r1: npt.NDArray[np.void],
+    r2: npt.NDArray[np.void],
+    jointype: _JoinType = "inner",
+    r1postfix: str = "1",
+    r2postfix: str = "2",
+    defaults: Mapping[str, object] | None = None,
+    usemask: Literal[True] = True,
+    *,
+    asrecarray: Literal[True],
+) -> MaskedRecords[tuple[int], np.dtype[np.void]]: ...
+
+#
+def rec_join(
+    key: str | Sequence[str],
+    r1: npt.NDArray[np.void],
+    r2: npt.NDArray[np.void],
+    jointype: _JoinType = "inner",
+    r1postfix: str = "1",
+    r2postfix: str = "2",
+    defaults: Mapping[str, object] | None = None,
+) -> np.recarray[tuple[int], np.dtype[np.void]]: ...

lib/python3.11/site-packages/numpy/lib/scimath.py

@@ -0,0 +1,13 @@
+from ._scimath_impl import (  # noqa: F401
+    __all__,
+    __doc__,
+    arccos,
+    arcsin,
+    arctanh,
+    log,
+    log2,
+    log10,
+    logn,
+    power,
+    sqrt,
+)

lib/python3.11/site-packages/numpy/lib/scimath.pyi

@@ -0,0 +1,30 @@
+from ._scimath_impl import (
+    __all__ as __all__,
+)
+from ._scimath_impl import (
+    arccos as arccos,
+)
+from ._scimath_impl import (
+    arcsin as arcsin,
+)
+from ._scimath_impl import (
+    arctanh as arctanh,
+)
+from ._scimath_impl import (
+    log as log,
+)
+from ._scimath_impl import (
+    log2 as log2,
+)
+from ._scimath_impl import (
+    log10 as log10,
+)
+from ._scimath_impl import (
+    logn as logn,
+)
+from ._scimath_impl import (
+    power as power,
+)
+from ._scimath_impl import (
+    sqrt as sqrt,
+)

lib/python3.11/site-packages/numpy/lib/stride_tricks.py

@@ -0,0 +1 @@
+from ._stride_tricks_impl import __doc__, as_strided, sliding_window_view  # noqa: F401

lib/python3.11/site-packages/numpy/lib/stride_tricks.pyi

@@ -0,0 +1,6 @@
+from numpy.lib._stride_tricks_impl import (
+    as_strided as as_strided,
+)
+from numpy.lib._stride_tricks_impl import (
+    sliding_window_view as sliding_window_view,
+)

lib/python3.11/site-packages/numpy/lib/tests/test__datasource.py

@@ -0,0 +1,352 @@
+import os
+import urllib.request as urllib_request
+from shutil import rmtree
+from tempfile import NamedTemporaryFile, mkdtemp, mkstemp
+from urllib.error import URLError
+from urllib.parse import urlparse
+
+import pytest
+
+import numpy.lib._datasource as datasource
+from numpy.testing import assert_, assert_equal, assert_raises
+
+
+def urlopen_stub(url, data=None):
+    '''Stub to replace urlopen for testing.'''
+    if url == valid_httpurl():
+        tmpfile = NamedTemporaryFile(prefix='urltmp_')
+        return tmpfile
+    else:
+        raise URLError('Name or service not known')
+
+
+# setup and teardown
+old_urlopen = None
+
+
+def setup_module():
+    global old_urlopen
+
+    old_urlopen = urllib_request.urlopen
+    urllib_request.urlopen = urlopen_stub
+
+
+def teardown_module():
+    urllib_request.urlopen = old_urlopen
+
+
+# A valid website for more robust testing
+http_path = 'http://www.google.com/'
+http_file = 'index.html'
+
+http_fakepath = 'http://fake.abc.web/site/'
+http_fakefile = 'fake.txt'
+
+malicious_files = ['/etc/shadow', '../../shadow',
+                   '..\\system.dat', 'c:\\windows\\system.dat']
+
+magic_line = b'three is the magic number'
+
+
+# Utility functions used by many tests
+def valid_textfile(filedir):
+    # Generate and return a valid temporary file.
+    fd, path = mkstemp(suffix='.txt', prefix='dstmp_', dir=filedir, text=True)
+    os.close(fd)
+    return path
+
+
+def invalid_textfile(filedir):
+    # Generate and return an invalid filename.
+    fd, path = mkstemp(suffix='.txt', prefix='dstmp_', dir=filedir)
+    os.close(fd)
+    os.remove(path)
+    return path
+
+
+def valid_httpurl():
+    return http_path + http_file
+
+
+def invalid_httpurl():
+    return http_fakepath + http_fakefile
+
+
+def valid_baseurl():
+    return http_path
+
+
+def invalid_baseurl():
+    return http_fakepath
+
+
+def valid_httpfile():
+    return http_file
+
+
+def invalid_httpfile():
+    return http_fakefile
+
+
+class TestDataSourceOpen:
+    def setup_method(self):
+        self.tmpdir = mkdtemp()
+        self.ds = datasource.DataSource(self.tmpdir)
+
+    def teardown_method(self):
+        rmtree(self.tmpdir)
+        del self.ds
+
+    def test_ValidHTTP(self):
+        fh = self.ds.open(valid_httpurl())
+        assert_(fh)
+        fh.close()
+
+    def test_InvalidHTTP(self):
+        url = invalid_httpurl()
+        assert_raises(OSError, self.ds.open, url)
+        try:
+            self.ds.open(url)
+        except OSError as e:
+            # Regression test for bug fixed in r4342.
+            assert_(e.errno is None)
+
+    def test_InvalidHTTPCacheURLError(self):
+        assert_raises(URLError, self.ds._cache, invalid_httpurl())
+
+    def test_ValidFile(self):
+        local_file = valid_textfile(self.tmpdir)
+        fh = self.ds.open(local_file)
+        assert_(fh)
+        fh.close()
+
+    def test_InvalidFile(self):
+        invalid_file = invalid_textfile(self.tmpdir)
+        assert_raises(OSError, self.ds.open, invalid_file)
+
+    def test_ValidGzipFile(self):
+        try:
+            import gzip
+        except ImportError:
+            # We don't have the gzip capabilities to test.
+            pytest.skip()
+        # Test datasource's internal file_opener for Gzip files.
+        filepath = os.path.join(self.tmpdir, 'foobar.txt.gz')
+        fp = gzip.open(filepath, 'w')
+        fp.write(magic_line)
+        fp.close()
+        fp = self.ds.open(filepath)
+        result = fp.readline()
+        fp.close()
+        assert_equal(magic_line, result)
+
+    def test_ValidBz2File(self):
+        try:
+            import bz2
+        except ImportError:
+            # We don't have the bz2 capabilities to test.
+            pytest.skip()
+        # Test datasource's internal file_opener for BZip2 files.
+        filepath = os.path.join(self.tmpdir, 'foobar.txt.bz2')
+        fp = bz2.BZ2File(filepath, 'w')
+        fp.write(magic_line)
+        fp.close()
+        fp = self.ds.open(filepath)
+        result = fp.readline()
+        fp.close()
+        assert_equal(magic_line, result)
+
+
+class TestDataSourceExists:
+    def setup_method(self):
+        self.tmpdir = mkdtemp()
+        self.ds = datasource.DataSource(self.tmpdir)
+
+    def teardown_method(self):
+        rmtree(self.tmpdir)
+        del self.ds
+
+    def test_ValidHTTP(self):
+        assert_(self.ds.exists(valid_httpurl()))
+
+    def test_InvalidHTTP(self):
+        assert_equal(self.ds.exists(invalid_httpurl()), False)
+
+    def test_ValidFile(self):
+        # Test valid file in destpath
+        tmpfile = valid_textfile(self.tmpdir)
+        assert_(self.ds.exists(tmpfile))
+        # Test valid local file not in destpath
+        localdir = mkdtemp()
+        tmpfile = valid_textfile(localdir)
+        assert_(self.ds.exists(tmpfile))
+        rmtree(localdir)
+
+    def test_InvalidFile(self):
+        tmpfile = invalid_textfile(self.tmpdir)
+        assert_equal(self.ds.exists(tmpfile), False)
+
+
+class TestDataSourceAbspath:
+    def setup_method(self):
+        self.tmpdir = os.path.abspath(mkdtemp())
+        self.ds = datasource.DataSource(self.tmpdir)
+
+    def teardown_method(self):
+        rmtree(self.tmpdir)
+        del self.ds
+
+    def test_ValidHTTP(self):
+        scheme, netloc, upath, pms, qry, frg = urlparse(valid_httpurl())
+        local_path = os.path.join(self.tmpdir, netloc,
+                                  upath.strip(os.sep).strip('/'))
+        assert_equal(local_path, self.ds.abspath(valid_httpurl()))
+
+    def test_ValidFile(self):
+        tmpfile = valid_textfile(self.tmpdir)
+        tmpfilename = os.path.split(tmpfile)[-1]
+        # Test with filename only
+        assert_equal(tmpfile, self.ds.abspath(tmpfilename))
+        # Test filename with complete path
+        assert_equal(tmpfile, self.ds.abspath(tmpfile))
+
+    def test_InvalidHTTP(self):
+        scheme, netloc, upath, pms, qry, frg = urlparse(invalid_httpurl())
+        invalidhttp = os.path.join(self.tmpdir, netloc,
+                                   upath.strip(os.sep).strip('/'))
+        assert_(invalidhttp != self.ds.abspath(valid_httpurl()))
+
+    def test_InvalidFile(self):
+        invalidfile = valid_textfile(self.tmpdir)
+        tmpfile = valid_textfile(self.tmpdir)
+        tmpfilename = os.path.split(tmpfile)[-1]
+        # Test with filename only
+        assert_(invalidfile != self.ds.abspath(tmpfilename))
+        # Test filename with complete path
+        assert_(invalidfile != self.ds.abspath(tmpfile))
+
+    def test_sandboxing(self):
+        tmpfile = valid_textfile(self.tmpdir)
+        tmpfilename = os.path.split(tmpfile)[-1]
+
+        tmp_path = lambda x: os.path.abspath(self.ds.abspath(x))
+
+        assert_(tmp_path(valid_httpurl()).startswith(self.tmpdir))
+        assert_(tmp_path(invalid_httpurl()).startswith(self.tmpdir))
+        assert_(tmp_path(tmpfile).startswith(self.tmpdir))
+        assert_(tmp_path(tmpfilename).startswith(self.tmpdir))
+        for fn in malicious_files:
+            assert_(tmp_path(http_path + fn).startswith(self.tmpdir))
+            assert_(tmp_path(fn).startswith(self.tmpdir))
+
+    def test_windows_os_sep(self):
+        orig_os_sep = os.sep
+        try:
+            os.sep = '\\'
+            self.test_ValidHTTP()
+            self.test_ValidFile()
+            self.test_InvalidHTTP()
+            self.test_InvalidFile()
+            self.test_sandboxing()
+        finally:
+            os.sep = orig_os_sep
+
+
+class TestRepositoryAbspath:
+    def setup_method(self):
+        self.tmpdir = os.path.abspath(mkdtemp())
+        self.repos = datasource.Repository(valid_baseurl(), self.tmpdir)
+
+    def teardown_method(self):
+        rmtree(self.tmpdir)
+        del self.repos
+
+    def test_ValidHTTP(self):
+        scheme, netloc, upath, pms, qry, frg = urlparse(valid_httpurl())
+        local_path = os.path.join(self.repos._destpath, netloc,
+                                  upath.strip(os.sep).strip('/'))
+        filepath = self.repos.abspath(valid_httpfile())
+        assert_equal(local_path, filepath)
+
+    def test_sandboxing(self):
+        tmp_path = lambda x: os.path.abspath(self.repos.abspath(x))
+        assert_(tmp_path(valid_httpfile()).startswith(self.tmpdir))
+        for fn in malicious_files:
+            assert_(tmp_path(http_path + fn).startswith(self.tmpdir))
+            assert_(tmp_path(fn).startswith(self.tmpdir))
+
+    def test_windows_os_sep(self):
+        orig_os_sep = os.sep
+        try:
+            os.sep = '\\'
+            self.test_ValidHTTP()
+            self.test_sandboxing()
+        finally:
+            os.sep = orig_os_sep
+
+
+class TestRepositoryExists:
+    def setup_method(self):
+        self.tmpdir = mkdtemp()
+        self.repos = datasource.Repository(valid_baseurl(), self.tmpdir)
+
+    def teardown_method(self):
+        rmtree(self.tmpdir)
+        del self.repos
+
+    def test_ValidFile(self):
+        # Create local temp file
+        tmpfile = valid_textfile(self.tmpdir)
+        assert_(self.repos.exists(tmpfile))
+
+    def test_InvalidFile(self):
+        tmpfile = invalid_textfile(self.tmpdir)
+        assert_equal(self.repos.exists(tmpfile), False)
+
+    def test_RemoveHTTPFile(self):
+        assert_(self.repos.exists(valid_httpurl()))
+
+    def test_CachedHTTPFile(self):
+        localfile = valid_httpurl()
+        # Create a locally cached temp file with an URL based
+        # directory structure.  This is similar to what Repository.open
+        # would do.
+        scheme, netloc, upath, pms, qry, frg = urlparse(localfile)
+        local_path = os.path.join(self.repos._destpath, netloc)
+        os.mkdir(local_path, 0o0700)
+        tmpfile = valid_textfile(local_path)
+        assert_(self.repos.exists(tmpfile))
+
+
+class TestOpenFunc:
+    def setup_method(self):
+        self.tmpdir = mkdtemp()
+
+    def teardown_method(self):
+        rmtree(self.tmpdir)
+
+    def test_DataSourceOpen(self):
+        local_file = valid_textfile(self.tmpdir)
+        # Test case where destpath is passed in
+        fp = datasource.open(local_file, destpath=self.tmpdir)
+        assert_(fp)
+        fp.close()
+        # Test case where default destpath is used
+        fp = datasource.open(local_file)
+        assert_(fp)
+        fp.close()
+
+def test_del_attr_handling():
+    # DataSource __del__ can be called
+    # even if __init__ fails when the
+    # Exception object is caught by the
+    # caller as happens in refguide_check
+    # is_deprecated() function
+
+    ds = datasource.DataSource()
+    # simulate failed __init__ by removing key attribute
+    # produced within __init__ and expected by __del__
+    del ds._istmpdest
+    # should not raise an AttributeError if __del__
+    # gracefully handles failed __init__:
+    ds.__del__()

lib/python3.11/site-packages/numpy/lib/tests/test__iotools.py

@@ -0,0 +1,360 @@
+import time
+from datetime import date
+
+import numpy as np
+from numpy.lib._iotools import (
+    LineSplitter,
+    NameValidator,
+    StringConverter,
+    easy_dtype,
+    flatten_dtype,
+    has_nested_fields,
+)
+from numpy.testing import (
+    assert_,
+    assert_allclose,
+    assert_equal,
+    assert_raises,
+)
+
+
+class TestLineSplitter:
+    "Tests the LineSplitter class."
+
+    def test_no_delimiter(self):
+        "Test LineSplitter w/o delimiter"
+        strg = " 1 2 3 4  5 # test"
+        test = LineSplitter()(strg)
+        assert_equal(test, ['1', '2', '3', '4', '5'])
+        test = LineSplitter('')(strg)
+        assert_equal(test, ['1', '2', '3', '4', '5'])
+
+    def test_space_delimiter(self):
+        "Test space delimiter"
+        strg = " 1 2 3 4  5 # test"
+        test = LineSplitter(' ')(strg)
+        assert_equal(test, ['1', '2', '3', '4', '', '5'])
+        test = LineSplitter('  ')(strg)
+        assert_equal(test, ['1 2 3 4', '5'])
+
+    def test_tab_delimiter(self):
+        "Test tab delimiter"
+        strg = " 1\t 2\t 3\t 4\t 5  6"
+        test = LineSplitter('\t')(strg)
+        assert_equal(test, ['1', '2', '3', '4', '5  6'])
+        strg = " 1  2\t 3  4\t 5  6"
+        test = LineSplitter('\t')(strg)
+        assert_equal(test, ['1  2', '3  4', '5  6'])
+
+    def test_other_delimiter(self):
+        "Test LineSplitter on delimiter"
+        strg = "1,2,3,4,,5"
+        test = LineSplitter(',')(strg)
+        assert_equal(test, ['1', '2', '3', '4', '', '5'])
+        #
+        strg = " 1,2,3,4,,5 # test"
+        test = LineSplitter(',')(strg)
+        assert_equal(test, ['1', '2', '3', '4', '', '5'])
+
+        # gh-11028 bytes comment/delimiters should get encoded
+        strg = b" 1,2,3,4,,5 % test"
+        test = LineSplitter(delimiter=b',', comments=b'%')(strg)
+        assert_equal(test, ['1', '2', '3', '4', '', '5'])
+
+    def test_constant_fixed_width(self):
+        "Test LineSplitter w/ fixed-width fields"
+        strg = "  1  2  3  4     5   # test"
+        test = LineSplitter(3)(strg)
+        assert_equal(test, ['1', '2', '3', '4', '', '5', ''])
+        #
+        strg = "  1     3  4  5  6# test"
+        test = LineSplitter(20)(strg)
+        assert_equal(test, ['1     3  4  5  6'])
+        #
+        strg = "  1     3  4  5  6# test"
+        test = LineSplitter(30)(strg)
+        assert_equal(test, ['1     3  4  5  6'])
+
+    def test_variable_fixed_width(self):
+        strg = "  1     3  4  5  6# test"
+        test = LineSplitter((3, 6, 6, 3))(strg)
+        assert_equal(test, ['1', '3', '4  5', '6'])
+        #
+        strg = "  1     3  4  5  6# test"
+        test = LineSplitter((6, 6, 9))(strg)
+        assert_equal(test, ['1', '3  4', '5  6'])
+
+# -----------------------------------------------------------------------------
+
+
+class TestNameValidator:
+
+    def test_case_sensitivity(self):
+        "Test case sensitivity"
+        names = ['A', 'a', 'b', 'c']
+        test = NameValidator().validate(names)
+        assert_equal(test, ['A', 'a', 'b', 'c'])
+        test = NameValidator(case_sensitive=False).validate(names)
+        assert_equal(test, ['A', 'A_1', 'B', 'C'])
+        test = NameValidator(case_sensitive='upper').validate(names)
+        assert_equal(test, ['A', 'A_1', 'B', 'C'])
+        test = NameValidator(case_sensitive='lower').validate(names)
+        assert_equal(test, ['a', 'a_1', 'b', 'c'])
+
+        # check exceptions
+        assert_raises(ValueError, NameValidator, case_sensitive='foobar')
+
+    def test_excludelist(self):
+        "Test excludelist"
+        names = ['dates', 'data', 'Other Data', 'mask']
+        validator = NameValidator(excludelist=['dates', 'data', 'mask'])
+        test = validator.validate(names)
+        assert_equal(test, ['dates_', 'data_', 'Other_Data', 'mask_'])
+
+    def test_missing_names(self):
+        "Test validate missing names"
+        namelist = ('a', 'b', 'c')
+        validator = NameValidator()
+        assert_equal(validator(namelist), ['a', 'b', 'c'])
+        namelist = ('', 'b', 'c')
+        assert_equal(validator(namelist), ['f0', 'b', 'c'])
+        namelist = ('a', 'b', '')
+        assert_equal(validator(namelist), ['a', 'b', 'f0'])
+        namelist = ('', 'f0', '')
+        assert_equal(validator(namelist), ['f1', 'f0', 'f2'])
+
+    def test_validate_nb_names(self):
+        "Test validate nb names"
+        namelist = ('a', 'b', 'c')
+        validator = NameValidator()
+        assert_equal(validator(namelist, nbfields=1), ('a',))
+        assert_equal(validator(namelist, nbfields=5, defaultfmt="g%i"),
+                     ['a', 'b', 'c', 'g0', 'g1'])
+
+    def test_validate_wo_names(self):
+        "Test validate no names"
+        namelist = None
+        validator = NameValidator()
+        assert_(validator(namelist) is None)
+        assert_equal(validator(namelist, nbfields=3), ['f0', 'f1', 'f2'])
+
+# -----------------------------------------------------------------------------
+
+
+def _bytes_to_date(s):
+    return date(*time.strptime(s, "%Y-%m-%d")[:3])
+
+
+class TestStringConverter:
+    "Test StringConverter"
+
+    def test_creation(self):
+        "Test creation of a StringConverter"
+        converter = StringConverter(int, -99999)
+        assert_equal(converter._status, 1)
+        assert_equal(converter.default, -99999)
+
+    def test_upgrade(self):
+        "Tests the upgrade method."
+
+        converter = StringConverter()
+        assert_equal(converter._status, 0)
+
+        # test int
+        assert_equal(converter.upgrade('0'), 0)
+        assert_equal(converter._status, 1)
+
+        # On systems where long defaults to 32-bit, the statuses will be
+        # offset by one, so we check for this here.
+        import numpy._core.numeric as nx
+        status_offset = int(nx.dtype(nx.int_).itemsize < nx.dtype(nx.int64).itemsize)
+
+        # test int > 2**32
+        assert_equal(converter.upgrade('17179869184'), 17179869184)
+        assert_equal(converter._status, 1 + status_offset)
+
+        # test float
+        assert_allclose(converter.upgrade('0.'), 0.0)
+        assert_equal(converter._status, 2 + status_offset)
+
+        # test complex
+        assert_equal(converter.upgrade('0j'), complex('0j'))
+        assert_equal(converter._status, 3 + status_offset)
+
+        # test str
+        # note that the longdouble type has been skipped, so the
+        # _status increases by 2. Everything should succeed with
+        # unicode conversion (8).
+        for s in ['a', b'a']:
+            res = converter.upgrade(s)
+            assert_(type(res) is str)
+            assert_equal(res, 'a')
+            assert_equal(converter._status, 8 + status_offset)
+
+    def test_missing(self):
+        "Tests the use of missing values."
+        converter = StringConverter(missing_values=('missing',
+                                                    'missed'))
+        converter.upgrade('0')
+        assert_equal(converter('0'), 0)
+        assert_equal(converter(''), converter.default)
+        assert_equal(converter('missing'), converter.default)
+        assert_equal(converter('missed'), converter.default)
+        try:
+            converter('miss')
+        except ValueError:
+            pass
+
+    def test_upgrademapper(self):
+        "Tests updatemapper"
+        dateparser = _bytes_to_date
+        _original_mapper = StringConverter._mapper[:]
+        try:
+            StringConverter.upgrade_mapper(dateparser, date(2000, 1, 1))
+            convert = StringConverter(dateparser, date(2000, 1, 1))
+            test = convert('2001-01-01')
+            assert_equal(test, date(2001, 1, 1))
+            test = convert('2009-01-01')
+            assert_equal(test, date(2009, 1, 1))
+            test = convert('')
+            assert_equal(test, date(2000, 1, 1))
+        finally:
+            StringConverter._mapper = _original_mapper
+
+    def test_string_to_object(self):
+        "Make sure that string-to-object functions are properly recognized"
+        old_mapper = StringConverter._mapper[:]  # copy of list
+        conv = StringConverter(_bytes_to_date)
+        assert_equal(conv._mapper, old_mapper)
+        assert_(hasattr(conv, 'default'))
+
+    def test_keep_default(self):
+        "Make sure we don't lose an explicit default"
+        converter = StringConverter(None, missing_values='',
+                                    default=-999)
+        converter.upgrade('3.14159265')
+        assert_equal(converter.default, -999)
+        assert_equal(converter.type, np.dtype(float))
+        #
+        converter = StringConverter(
+            None, missing_values='', default=0)
+        converter.upgrade('3.14159265')
+        assert_equal(converter.default, 0)
+        assert_equal(converter.type, np.dtype(float))
+
+    def test_keep_default_zero(self):
+        "Check that we don't lose a default of 0"
+        converter = StringConverter(int, default=0,
+                                    missing_values="N/A")
+        assert_equal(converter.default, 0)
+
+    def test_keep_missing_values(self):
+        "Check that we're not losing missing values"
+        converter = StringConverter(int, default=0,
+                                    missing_values="N/A")
+        assert_equal(
+            converter.missing_values, {'', 'N/A'})
+
+    def test_int64_dtype(self):
+        "Check that int64 integer types can be specified"
+        converter = StringConverter(np.int64, default=0)
+        val = "-9223372036854775807"
+        assert_(converter(val) == -9223372036854775807)
+        val = "9223372036854775807"
+        assert_(converter(val) == 9223372036854775807)
+
+    def test_uint64_dtype(self):
+        "Check that uint64 integer types can be specified"
+        converter = StringConverter(np.uint64, default=0)
+        val = "9223372043271415339"
+        assert_(converter(val) == 9223372043271415339)
+
+
+class TestMiscFunctions:
+
+    def test_has_nested_dtype(self):
+        "Test has_nested_dtype"
+        ndtype = np.dtype(float)
+        assert_equal(has_nested_fields(ndtype), False)
+        ndtype = np.dtype([('A', '|S3'), ('B', float)])
+        assert_equal(has_nested_fields(ndtype), False)
+        ndtype = np.dtype([('A', int), ('B', [('BA', float), ('BB', '|S1')])])
+        assert_equal(has_nested_fields(ndtype), True)
+
+    def test_easy_dtype(self):
+        "Test ndtype on dtypes"
+        # Simple case
+        ndtype = float
+        assert_equal(easy_dtype(ndtype), np.dtype(float))
+        # As string w/o names
+        ndtype = "i4, f8"
+        assert_equal(easy_dtype(ndtype),
+                     np.dtype([('f0', "i4"), ('f1', "f8")]))
+        # As string w/o names but different default format
+        assert_equal(easy_dtype(ndtype, defaultfmt="field_%03i"),
+                     np.dtype([('field_000', "i4"), ('field_001', "f8")]))
+        # As string w/ names
+        ndtype = "i4, f8"
+        assert_equal(easy_dtype(ndtype, names="a, b"),
+                     np.dtype([('a', "i4"), ('b', "f8")]))
+        # As string w/ names (too many)
+        ndtype = "i4, f8"
+        assert_equal(easy_dtype(ndtype, names="a, b, c"),
+                     np.dtype([('a', "i4"), ('b', "f8")]))
+        # As string w/ names (not enough)
+        ndtype = "i4, f8"
+        assert_equal(easy_dtype(ndtype, names=", b"),
+                     np.dtype([('f0', "i4"), ('b', "f8")]))
+        # ... (with different default format)
+        assert_equal(easy_dtype(ndtype, names="a", defaultfmt="f%02i"),
+                     np.dtype([('a', "i4"), ('f00', "f8")]))
+        # As list of tuples w/o names
+        ndtype = [('A', int), ('B', float)]
+        assert_equal(easy_dtype(ndtype), np.dtype([('A', int), ('B', float)]))
+        # As list of tuples w/ names
+        assert_equal(easy_dtype(ndtype, names="a,b"),
+                     np.dtype([('a', int), ('b', float)]))
+        # As list of tuples w/ not enough names
+        assert_equal(easy_dtype(ndtype, names="a"),
+                     np.dtype([('a', int), ('f0', float)]))
+        # As list of tuples w/ too many names
+        assert_equal(easy_dtype(ndtype, names="a,b,c"),
+                     np.dtype([('a', int), ('b', float)]))
+        # As list of types w/o names
+        ndtype = (int, float, float)
+        assert_equal(easy_dtype(ndtype),
+                     np.dtype([('f0', int), ('f1', float), ('f2', float)]))
+        # As list of types w names
+        ndtype = (int, float, float)
+        assert_equal(easy_dtype(ndtype, names="a, b, c"),
+                     np.dtype([('a', int), ('b', float), ('c', float)]))
+        # As simple dtype w/ names
+        ndtype = np.dtype(float)
+        assert_equal(easy_dtype(ndtype, names="a, b, c"),
+                     np.dtype([(_, float) for _ in ('a', 'b', 'c')]))
+        # As simple dtype w/o names (but multiple fields)
+        ndtype = np.dtype(float)
+        assert_equal(
+            easy_dtype(ndtype, names=['', '', ''], defaultfmt="f%02i"),
+            np.dtype([(_, float) for _ in ('f00', 'f01', 'f02')]))
+
+    def test_flatten_dtype(self):
+        "Testing flatten_dtype"
+        # Standard dtype
+        dt = np.dtype([("a", "f8"), ("b", "f8")])
+        dt_flat = flatten_dtype(dt)
+        assert_equal(dt_flat, [float, float])
+        # Recursive dtype
+        dt = np.dtype([("a", [("aa", '|S1'), ("ab", '|S2')]), ("b", int)])
+        dt_flat = flatten_dtype(dt)
+        assert_equal(dt_flat, [np.dtype('|S1'), np.dtype('|S2'), int])
+        # dtype with shaped fields
+        dt = np.dtype([("a", (float, 2)), ("b", (int, 3))])
+        dt_flat = flatten_dtype(dt)
+        assert_equal(dt_flat, [float, int])
+        dt_flat = flatten_dtype(dt, True)
+        assert_equal(dt_flat, [float] * 2 + [int] * 3)
+        # dtype w/ titles
+        dt = np.dtype([(("a", "A"), "f8"), (("b", "B"), "f8")])
+        dt_flat = flatten_dtype(dt)
+        assert_equal(dt_flat, [float, float])

lib/python3.11/site-packages/numpy/lib/tests/test__version.py

@@ -0,0 +1,64 @@
+"""Tests for the NumpyVersion class.
+
+"""
+from numpy.lib import NumpyVersion
+from numpy.testing import assert_, assert_raises
+
+
+def test_main_versions():
+    assert_(NumpyVersion('1.8.0') == '1.8.0')
+    for ver in ['1.9.0', '2.0.0', '1.8.1', '10.0.1']:
+        assert_(NumpyVersion('1.8.0') < ver)
+
+    for ver in ['1.7.0', '1.7.1', '0.9.9']:
+        assert_(NumpyVersion('1.8.0') > ver)
+
+
+def test_version_1_point_10():
+    # regression test for gh-2998.
+    assert_(NumpyVersion('1.9.0') < '1.10.0')
+    assert_(NumpyVersion('1.11.0') < '1.11.1')
+    assert_(NumpyVersion('1.11.0') == '1.11.0')
+    assert_(NumpyVersion('1.99.11') < '1.99.12')
+
+
+def test_alpha_beta_rc():
+    assert_(NumpyVersion('1.8.0rc1') == '1.8.0rc1')
+    for ver in ['1.8.0', '1.8.0rc2']:
+        assert_(NumpyVersion('1.8.0rc1') < ver)
+
+    for ver in ['1.8.0a2', '1.8.0b3', '1.7.2rc4']:
+        assert_(NumpyVersion('1.8.0rc1') > ver)
+
+    assert_(NumpyVersion('1.8.0b1') > '1.8.0a2')
+
+
+def test_dev_version():
+    assert_(NumpyVersion('1.9.0.dev-Unknown') < '1.9.0')
+    for ver in ['1.9.0', '1.9.0a1', '1.9.0b2', '1.9.0b2.dev-ffffffff']:
+        assert_(NumpyVersion('1.9.0.dev-f16acvda') < ver)
+
+    assert_(NumpyVersion('1.9.0.dev-f16acvda') == '1.9.0.dev-11111111')
+
+
+def test_dev_a_b_rc_mixed():
+    assert_(NumpyVersion('1.9.0a2.dev-f16acvda') == '1.9.0a2.dev-11111111')
+    assert_(NumpyVersion('1.9.0a2.dev-6acvda54') < '1.9.0a2')
+
+
+def test_dev0_version():
+    assert_(NumpyVersion('1.9.0.dev0+Unknown') < '1.9.0')
+    for ver in ['1.9.0', '1.9.0a1', '1.9.0b2', '1.9.0b2.dev0+ffffffff']:
+        assert_(NumpyVersion('1.9.0.dev0+f16acvda') < ver)
+
+    assert_(NumpyVersion('1.9.0.dev0+f16acvda') == '1.9.0.dev0+11111111')
+
+
+def test_dev0_a_b_rc_mixed():
+    assert_(NumpyVersion('1.9.0a2.dev0+f16acvda') == '1.9.0a2.dev0+11111111')
+    assert_(NumpyVersion('1.9.0a2.dev0+6acvda54') < '1.9.0a2')
+
+
+def test_raises():
+    for ver in ['1.9', '1,9.0', '1.7.x']:
+        assert_raises(ValueError, NumpyVersion, ver)

lib/python3.11/site-packages/numpy/lib/tests/test_array_utils.py

@@ -0,0 +1,32 @@
+import numpy as np
+from numpy.lib import array_utils
+from numpy.testing import assert_equal
+
+
+class TestByteBounds:
+    def test_byte_bounds(self):
+        # pointer difference matches size * itemsize
+        # due to contiguity
+        a = np.arange(12).reshape(3, 4)
+        low, high = array_utils.byte_bounds(a)
+        assert_equal(high - low, a.size * a.itemsize)
+
+    def test_unusual_order_positive_stride(self):
+        a = np.arange(12).reshape(3, 4)
+        b = a.T
+        low, high = array_utils.byte_bounds(b)
+        assert_equal(high - low, b.size * b.itemsize)
+
+    def test_unusual_order_negative_stride(self):
+        a = np.arange(12).reshape(3, 4)
+        b = a.T[::-1]
+        low, high = array_utils.byte_bounds(b)
+        assert_equal(high - low, b.size * b.itemsize)
+
+    def test_strided(self):
+        a = np.arange(12)
+        b = a[::2]
+        low, high = array_utils.byte_bounds(b)
+        # the largest pointer address is lost (even numbers only in the
+        # stride), and compensate addresses for striding by 2
+        assert_equal(high - low, b.size * 2 * b.itemsize - b.itemsize)

lib/python3.11/site-packages/numpy/lib/tests/test_arrayterator.py

@@ -0,0 +1,46 @@
+from functools import reduce
+from operator import mul
+
+import numpy as np
+from numpy.lib import Arrayterator
+from numpy.random import randint
+from numpy.testing import assert_
+
+
+def test():
+    np.random.seed(np.arange(10))
+
+    # Create a random array
+    ndims = randint(5) + 1
+    shape = tuple(randint(10) + 1 for dim in range(ndims))
+    els = reduce(mul, shape)
+    a = np.arange(els)
+    a.shape = shape
+
+    buf_size = randint(2 * els)
+    b = Arrayterator(a, buf_size)
+
+    # Check that each block has at most ``buf_size`` elements
+    for block in b:
+        assert_(len(block.flat) <= (buf_size or els))
+
+    # Check that all elements are iterated correctly
+    assert_(list(b.flat) == list(a.flat))
+
+    # Slice arrayterator
+    start = [randint(dim) for dim in shape]
+    stop = [randint(dim) + 1 for dim in shape]
+    step = [randint(dim) + 1 for dim in shape]
+    slice_ = tuple(slice(*t) for t in zip(start, stop, step))
+    c = b[slice_]
+    d = a[slice_]
+
+    # Check that each block has at most ``buf_size`` elements
+    for block in c:
+        assert_(len(block.flat) <= (buf_size or els))
+
+    # Check that the arrayterator is sliced correctly
+    assert_(np.all(c.__array__() == d))
+
+    # Check that all elements are iterated correctly
+    assert_(list(c.flat) == list(d.flat))

lib/python3.11/site-packages/numpy/lib/tests/test_histograms.py

@@ -0,0 +1,855 @@
+import pytest
+
+import numpy as np
+from numpy import histogram, histogram_bin_edges, histogramdd
+from numpy.testing import (
+    assert_,
+    assert_allclose,
+    assert_almost_equal,
+    assert_array_almost_equal,
+    assert_array_equal,
+    assert_array_max_ulp,
+    assert_equal,
+    assert_raises,
+    assert_raises_regex,
+    suppress_warnings,
+)
+
+
+class TestHistogram:
+
+    def setup_method(self):
+        pass
+
+    def teardown_method(self):
+        pass
+
+    def test_simple(self):
+        n = 100
+        v = np.random.rand(n)
+        (a, b) = histogram(v)
+        # check if the sum of the bins equals the number of samples
+        assert_equal(np.sum(a, axis=0), n)
+        # check that the bin counts are evenly spaced when the data is from
+        # a linear function
+        (a, b) = histogram(np.linspace(0, 10, 100))
+        assert_array_equal(a, 10)
+
+    def test_one_bin(self):
+        # Ticket 632
+        hist, edges = histogram([1, 2, 3, 4], [1, 2])
+        assert_array_equal(hist, [2, ])
+        assert_array_equal(edges, [1, 2])
+        assert_raises(ValueError, histogram, [1, 2], bins=0)
+        h, e = histogram([1, 2], bins=1)
+        assert_equal(h, np.array([2]))
+        assert_allclose(e, np.array([1., 2.]))
+
+    def test_density(self):
+        # Check that the integral of the density equals 1.
+        n = 100
+        v = np.random.rand(n)
+        a, b = histogram(v, density=True)
+        area = np.sum(a * np.diff(b))
+        assert_almost_equal(area, 1)
+
+        # Check with non-constant bin widths
+        v = np.arange(10)
+        bins = [0, 1, 3, 6, 10]
+        a, b = histogram(v, bins, density=True)
+        assert_array_equal(a, .1)
+        assert_equal(np.sum(a * np.diff(b)), 1)
+
+        # Test that passing False works too
+        a, b = histogram(v, bins, density=False)
+        assert_array_equal(a, [1, 2, 3, 4])
+
+        # Variable bin widths are especially useful to deal with
+        # infinities.
+        v = np.arange(10)
+        bins = [0, 1, 3, 6, np.inf]
+        a, b = histogram(v, bins, density=True)
+        assert_array_equal(a, [.1, .1, .1, 0.])
+
+        # Taken from a bug report from N. Becker on the numpy-discussion
+        # mailing list Aug. 6, 2010.
+        counts, dmy = np.histogram(
+            [1, 2, 3, 4], [0.5, 1.5, np.inf], density=True)
+        assert_equal(counts, [.25, 0])
+
+    def test_outliers(self):
+        # Check that outliers are not tallied
+        a = np.arange(10) + .5
+
+        # Lower outliers
+        h, b = histogram(a, range=[0, 9])
+        assert_equal(h.sum(), 9)
+
+        # Upper outliers
+        h, b = histogram(a, range=[1, 10])
+        assert_equal(h.sum(), 9)
+
+        # Normalization
+        h, b = histogram(a, range=[1, 9], density=True)
+        assert_almost_equal((h * np.diff(b)).sum(), 1, decimal=15)
+
+        # Weights
+        w = np.arange(10) + .5
+        h, b = histogram(a, range=[1, 9], weights=w, density=True)
+        assert_equal((h * np.diff(b)).sum(), 1)
+
+        h, b = histogram(a, bins=8, range=[1, 9], weights=w)
+        assert_equal(h, w[1:-1])
+
+    def test_arr_weights_mismatch(self):
+        a = np.arange(10) + .5
+        w = np.arange(11) + .5
+        with assert_raises_regex(ValueError, "same shape as"):
+            h, b = histogram(a, range=[1, 9], weights=w, density=True)
+
+    def test_type(self):
+        # Check the type of the returned histogram
+        a = np.arange(10) + .5
+        h, b = histogram(a)
+        assert_(np.issubdtype(h.dtype, np.integer))
+
+        h, b = histogram(a, density=True)
+        assert_(np.issubdtype(h.dtype, np.floating))
+
+        h, b = histogram(a, weights=np.ones(10, int))
+        assert_(np.issubdtype(h.dtype, np.integer))
+
+        h, b = histogram(a, weights=np.ones(10, float))
+        assert_(np.issubdtype(h.dtype, np.floating))
+
+    def test_f32_rounding(self):
+        # gh-4799, check that the rounding of the edges works with float32
+        x = np.array([276.318359, -69.593948, 21.329449], dtype=np.float32)
+        y = np.array([5005.689453, 4481.327637, 6010.369629], dtype=np.float32)
+        counts_hist, xedges, yedges = np.histogram2d(x, y, bins=100)
+        assert_equal(counts_hist.sum(), 3.)
+
+    def test_bool_conversion(self):
+        # gh-12107
+        # Reference integer histogram
+        a = np.array([1, 1, 0], dtype=np.uint8)
+        int_hist, int_edges = np.histogram(a)
+
+        # Should raise an warning on booleans
+        # Ensure that the histograms are equivalent, need to suppress
+        # the warnings to get the actual outputs
+        with suppress_warnings() as sup:
+            rec = sup.record(RuntimeWarning, 'Converting input from .*')
+            hist, edges = np.histogram([True, True, False])
+            # A warning should be issued
+            assert_equal(len(rec), 1)
+            assert_array_equal(hist, int_hist)
+            assert_array_equal(edges, int_edges)
+
+    def test_weights(self):
+        v = np.random.rand(100)
+        w = np.ones(100) * 5
+        a, b = histogram(v)
+        na, nb = histogram(v, density=True)
+        wa, wb = histogram(v, weights=w)
+        nwa, nwb = histogram(v, weights=w, density=True)
+        assert_array_almost_equal(a * 5, wa)
+        assert_array_almost_equal(na, nwa)
+
+        # Check weights are properly applied.
+        v = np.linspace(0, 10, 10)
+        w = np.concatenate((np.zeros(5), np.ones(5)))
+        wa, wb = histogram(v, bins=np.arange(11), weights=w)
+        assert_array_almost_equal(wa, w)
+
+        # Check with integer weights
+        wa, wb = histogram([1, 2, 2, 4], bins=4, weights=[4, 3, 2, 1])
+        assert_array_equal(wa, [4, 5, 0, 1])
+        wa, wb = histogram(
+            [1, 2, 2, 4], bins=4, weights=[4, 3, 2, 1], density=True)
+        assert_array_almost_equal(wa, np.array([4, 5, 0, 1]) / 10. / 3. * 4)
+
+        # Check weights with non-uniform bin widths
+        a, b = histogram(
+            np.arange(9), [0, 1, 3, 6, 10],
+            weights=[2, 1, 1, 1, 1, 1, 1, 1, 1], density=True)
+        assert_almost_equal(a, [.2, .1, .1, .075])
+
+    def test_exotic_weights(self):
+
+        # Test the use of weights that are not integer or floats, but e.g.
+        # complex numbers or object types.
+
+        # Complex weights
+        values = np.array([1.3, 2.5, 2.3])
+        weights = np.array([1, -1, 2]) + 1j * np.array([2, 1, 2])
+
+        # Check with custom bins
+        wa, wb = histogram(values, bins=[0, 2, 3], weights=weights)
+        assert_array_almost_equal(wa, np.array([1, 1]) + 1j * np.array([2, 3]))
+
+        # Check with even bins
+        wa, wb = histogram(values, bins=2, range=[1, 3], weights=weights)
+        assert_array_almost_equal(wa, np.array([1, 1]) + 1j * np.array([2, 3]))
+
+        # Decimal weights
+        from decimal import Decimal
+        values = np.array([1.3, 2.5, 2.3])
+        weights = np.array([Decimal(1), Decimal(2), Decimal(3)])
+
+        # Check with custom bins
+        wa, wb = histogram(values, bins=[0, 2, 3], weights=weights)
+        assert_array_almost_equal(wa, [Decimal(1), Decimal(5)])
+
+        # Check with even bins
+        wa, wb = histogram(values, bins=2, range=[1, 3], weights=weights)
+        assert_array_almost_equal(wa, [Decimal(1), Decimal(5)])
+
+    def test_no_side_effects(self):
+        # This is a regression test that ensures that values passed to
+        # ``histogram`` are unchanged.
+        values = np.array([1.3, 2.5, 2.3])
+        np.histogram(values, range=[-10, 10], bins=100)
+        assert_array_almost_equal(values, [1.3, 2.5, 2.3])
+
+    def test_empty(self):
+        a, b = histogram([], bins=([0, 1]))
+        assert_array_equal(a, np.array([0]))
+        assert_array_equal(b, np.array([0, 1]))
+
+    def test_error_binnum_type(self):
+        # Tests if right Error is raised if bins argument is float
+        vals = np.linspace(0.0, 1.0, num=100)
+        histogram(vals, 5)
+        assert_raises(TypeError, histogram, vals, 2.4)
+
+    def test_finite_range(self):
+        # Normal ranges should be fine
+        vals = np.linspace(0.0, 1.0, num=100)
+        histogram(vals, range=[0.25, 0.75])
+        assert_raises(ValueError, histogram, vals, range=[np.nan, 0.75])
+        assert_raises(ValueError, histogram, vals, range=[0.25, np.inf])
+
+    def test_invalid_range(self):
+        # start of range must be < end of range
+        vals = np.linspace(0.0, 1.0, num=100)
+        with assert_raises_regex(ValueError, "max must be larger than"):
+            np.histogram(vals, range=[0.1, 0.01])
+
+    def test_bin_edge_cases(self):
+        # Ensure that floating-point computations correctly place edge cases.
+        arr = np.array([337, 404, 739, 806, 1007, 1811, 2012])
+        hist, edges = np.histogram(arr, bins=8296, range=(2, 2280))
+        mask = hist > 0
+        left_edges = edges[:-1][mask]
+        right_edges = edges[1:][mask]
+        for x, left, right in zip(arr, left_edges, right_edges):
+            assert_(x >= left)
+            assert_(x < right)
+
+    def test_last_bin_inclusive_range(self):
+        arr = np.array([0.,  0.,  0.,  1.,  2.,  3.,  3.,  4.,  5.])
+        hist, edges = np.histogram(arr, bins=30, range=(-0.5, 5))
+        assert_equal(hist[-1], 1)
+
+    def test_bin_array_dims(self):
+        # gracefully handle bins object > 1 dimension
+        vals = np.linspace(0.0, 1.0, num=100)
+        bins = np.array([[0, 0.5], [0.6, 1.0]])
+        with assert_raises_regex(ValueError, "must be 1d"):
+            np.histogram(vals, bins=bins)
+
+    def test_unsigned_monotonicity_check(self):
+        # Ensures ValueError is raised if bins not increasing monotonically
+        # when bins contain unsigned values (see #9222)
+        arr = np.array([2])
+        bins = np.array([1, 3, 1], dtype='uint64')
+        with assert_raises(ValueError):
+            hist, edges = np.histogram(arr, bins=bins)
+
+    def test_object_array_of_0d(self):
+        # gh-7864
+        assert_raises(ValueError,
+            histogram, [np.array(0.4) for i in range(10)] + [-np.inf])
+        assert_raises(ValueError,
+            histogram, [np.array(0.4) for i in range(10)] + [np.inf])
+
+        # these should not crash
+        np.histogram([np.array(0.5) for i in range(10)] + [.500000000000002])
+        np.histogram([np.array(0.5) for i in range(10)] + [.5])
+
+    def test_some_nan_values(self):
+        # gh-7503
+        one_nan = np.array([0, 1, np.nan])
+        all_nan = np.array([np.nan, np.nan])
+
+        # the internal comparisons with NaN give warnings
+        sup = suppress_warnings()
+        sup.filter(RuntimeWarning)
+        with sup:
+            # can't infer range with nan
+            assert_raises(ValueError, histogram, one_nan, bins='auto')
+            assert_raises(ValueError, histogram, all_nan, bins='auto')
+
+            # explicit range solves the problem
+            h, b = histogram(one_nan, bins='auto', range=(0, 1))
+            assert_equal(h.sum(), 2)  # nan is not counted
+            h, b = histogram(all_nan, bins='auto', range=(0, 1))
+            assert_equal(h.sum(), 0)  # nan is not counted
+
+            # as does an explicit set of bins
+            h, b = histogram(one_nan, bins=[0, 1])
+            assert_equal(h.sum(), 2)  # nan is not counted
+            h, b = histogram(all_nan, bins=[0, 1])
+            assert_equal(h.sum(), 0)  # nan is not counted
+
+    def test_datetime(self):
+        begin = np.datetime64('2000-01-01', 'D')
+        offsets = np.array([0, 0, 1, 1, 2, 3, 5, 10, 20])
+        bins = np.array([0, 2, 7, 20])
+        dates = begin + offsets
+        date_bins = begin + bins
+
+        td = np.dtype('timedelta64[D]')
+
+        # Results should be the same for integer offsets or datetime values.
+        # For now, only explicit bins are supported, since linspace does not
+        # work on datetimes or timedeltas
+        d_count, d_edge = histogram(dates, bins=date_bins)
+        t_count, t_edge = histogram(offsets.astype(td), bins=bins.astype(td))
+        i_count, i_edge = histogram(offsets, bins=bins)
+
+        assert_equal(d_count, i_count)
+        assert_equal(t_count, i_count)
+
+        assert_equal((d_edge - begin).astype(int), i_edge)
+        assert_equal(t_edge.astype(int), i_edge)
+
+        assert_equal(d_edge.dtype, dates.dtype)
+        assert_equal(t_edge.dtype, td)
+
+    def do_signed_overflow_bounds(self, dtype):
+        exponent = 8 * np.dtype(dtype).itemsize - 1
+        arr = np.array([-2**exponent + 4, 2**exponent - 4], dtype=dtype)
+        hist, e = histogram(arr, bins=2)
+        assert_equal(e, [-2**exponent + 4, 0, 2**exponent - 4])
+        assert_equal(hist, [1, 1])
+
+    def test_signed_overflow_bounds(self):
+        self.do_signed_overflow_bounds(np.byte)
+        self.do_signed_overflow_bounds(np.short)
+        self.do_signed_overflow_bounds(np.intc)
+        self.do_signed_overflow_bounds(np.int_)
+        self.do_signed_overflow_bounds(np.longlong)
+
+    def do_precision_lower_bound(self, float_small, float_large):
+        eps = np.finfo(float_large).eps
+
+        arr = np.array([1.0], float_small)
+        range = np.array([1.0 + eps, 2.0], float_large)
+
+        # test is looking for behavior when the bounds change between dtypes
+        if range.astype(float_small)[0] != 1:
+            return
+
+        # previously crashed
+        count, x_loc = np.histogram(arr, bins=1, range=range)
+        assert_equal(count, [0])
+        assert_equal(x_loc.dtype, float_large)
+
+    def do_precision_upper_bound(self, float_small, float_large):
+        eps = np.finfo(float_large).eps
+
+        arr = np.array([1.0], float_small)
+        range = np.array([0.0, 1.0 - eps], float_large)
+
+        # test is looking for behavior when the bounds change between dtypes
+        if range.astype(float_small)[-1] != 1:
+            return
+
+        # previously crashed
+        count, x_loc = np.histogram(arr, bins=1, range=range)
+        assert_equal(count, [0])
+
+        assert_equal(x_loc.dtype, float_large)
+
+    def do_precision(self, float_small, float_large):
+        self.do_precision_lower_bound(float_small, float_large)
+        self.do_precision_upper_bound(float_small, float_large)
+
+    def test_precision(self):
+        # not looping results in a useful stack trace upon failure
+        self.do_precision(np.half, np.single)
+        self.do_precision(np.half, np.double)
+        self.do_precision(np.half, np.longdouble)
+        self.do_precision(np.single, np.double)
+        self.do_precision(np.single, np.longdouble)
+        self.do_precision(np.double, np.longdouble)
+
+    def test_histogram_bin_edges(self):
+        hist, e = histogram([1, 2, 3, 4], [1, 2])
+        edges = histogram_bin_edges([1, 2, 3, 4], [1, 2])
+        assert_array_equal(edges, e)
+
+        arr = np.array([0.,  0.,  0.,  1.,  2.,  3.,  3.,  4.,  5.])
+        hist, e = histogram(arr, bins=30, range=(-0.5, 5))
+        edges = histogram_bin_edges(arr, bins=30, range=(-0.5, 5))
+        assert_array_equal(edges, e)
+
+        hist, e = histogram(arr, bins='auto', range=(0, 1))
+        edges = histogram_bin_edges(arr, bins='auto', range=(0, 1))
+        assert_array_equal(edges, e)
+
+    def test_small_value_range(self):
+        arr = np.array([1, 1 + 2e-16] * 10)
+        with pytest.raises(ValueError, match="Too many bins for data range"):
+            histogram(arr, bins=10)
+
+    # @requires_memory(free_bytes=1e10)
+    # @pytest.mark.slow
+    @pytest.mark.skip(reason="Bad memory reports lead to OOM in ci testing")
+    def test_big_arrays(self):
+        sample = np.zeros([100000000, 3])
+        xbins = 400
+        ybins = 400
+        zbins = np.arange(16000)
+        hist = np.histogramdd(sample=sample, bins=(xbins, ybins, zbins))
+        assert_equal(type(hist), type((1, 2)))
+
+    def test_gh_23110(self):
+        hist, e = np.histogram(np.array([-0.9e-308], dtype='>f8'),
+                               bins=2,
+                               range=(-1e-308, -2e-313))
+        expected_hist = np.array([1, 0])
+        assert_array_equal(hist, expected_hist)
+
+    def test_gh_28400(self):
+        e = 1 + 1e-12
+        Z = [0, 1, 1, 1, 1, 1, e, e, e, e, e, e, 2]
+        counts, edges = np.histogram(Z, bins="auto")
+        assert len(counts) < 10
+        assert edges[0] == Z[0]
+        assert edges[-1] == Z[-1]
+
+class TestHistogramOptimBinNums:
+    """
+    Provide test coverage when using provided estimators for optimal number of
+    bins
+    """
+
+    def test_empty(self):
+        estimator_list = ['fd', 'scott', 'rice', 'sturges',
+                          'doane', 'sqrt', 'auto', 'stone']
+        # check it can deal with empty data
+        for estimator in estimator_list:
+            a, b = histogram([], bins=estimator)
+            assert_array_equal(a, np.array([0]))
+            assert_array_equal(b, np.array([0, 1]))
+
+    def test_simple(self):
+        """
+        Straightforward testing with a mixture of linspace data (for
+        consistency). All test values have been precomputed and the values
+        shouldn't change
+        """
+        # Some basic sanity checking, with some fixed data.
+        # Checking for the correct number of bins
+        basic_test = {50:   {'fd': 4,  'scott': 4,  'rice': 8,  'sturges': 7,
+                             'doane': 8, 'sqrt': 8, 'auto': 7, 'stone': 2},
+                      500:  {'fd': 8,  'scott': 8,  'rice': 16, 'sturges': 10,
+                             'doane': 12, 'sqrt': 23, 'auto': 10, 'stone': 9},
+                      5000: {'fd': 17, 'scott': 17, 'rice': 35, 'sturges': 14,
+                             'doane': 17, 'sqrt': 71, 'auto': 17, 'stone': 20}}
+
+        for testlen, expectedResults in basic_test.items():
+            # Create some sort of non uniform data to test with
+            # (2 peak uniform mixture)
+            x1 = np.linspace(-10, -1, testlen // 5 * 2)
+            x2 = np.linspace(1, 10, testlen // 5 * 3)
+            x = np.concatenate((x1, x2))
+            for estimator, numbins in expectedResults.items():
+                a, b = np.histogram(x, estimator)
+                assert_equal(len(a), numbins, err_msg=f"For the {estimator} estimator "
+                             f"with datasize of {testlen}")
+
+    def test_small(self):
+        """
+        Smaller datasets have the potential to cause issues with the data
+        adaptive methods, especially the FD method. All bin numbers have been
+        precalculated.
+        """
+        small_dat = {1: {'fd': 1, 'scott': 1, 'rice': 1, 'sturges': 1,
+                         'doane': 1, 'sqrt': 1, 'stone': 1},
+                     2: {'fd': 2, 'scott': 1, 'rice': 3, 'sturges': 2,
+                         'doane': 1, 'sqrt': 2, 'stone': 1},
+                     3: {'fd': 2, 'scott': 2, 'rice': 3, 'sturges': 3,
+                         'doane': 3, 'sqrt': 2, 'stone': 1}}
+
+        for testlen, expectedResults in small_dat.items():
+            testdat = np.arange(testlen).astype(float)
+            for estimator, expbins in expectedResults.items():
+                a, b = np.histogram(testdat, estimator)
+                assert_equal(len(a), expbins, err_msg=f"For the {estimator} estimator "
+                             f"with datasize of {testlen}")
+
+    def test_incorrect_methods(self):
+        """
+        Check a Value Error is thrown when an unknown string is passed in
+        """
+        check_list = ['mad', 'freeman', 'histograms', 'IQR']
+        for estimator in check_list:
+            assert_raises(ValueError, histogram, [1, 2, 3], estimator)
+
+    def test_novariance(self):
+        """
+        Check that methods handle no variance in data
+        Primarily for Scott and FD as the SD and IQR are both 0 in this case
+        """
+        novar_dataset = np.ones(100)
+        novar_resultdict = {'fd': 1, 'scott': 1, 'rice': 1, 'sturges': 1,
+                            'doane': 1, 'sqrt': 1, 'auto': 1, 'stone': 1}
+
+        for estimator, numbins in novar_resultdict.items():
+            a, b = np.histogram(novar_dataset, estimator)
+            assert_equal(len(a), numbins,
+                         err_msg=f"{estimator} estimator, No Variance test")
+
+    def test_limited_variance(self):
+        """
+        Check when IQR is 0, but variance exists, we return a reasonable value.
+        """
+        lim_var_data = np.ones(1000)
+        lim_var_data[:3] = 0
+        lim_var_data[-4:] = 100
+
+        edges_auto = histogram_bin_edges(lim_var_data, 'auto')
+        assert_equal(edges_auto[0], 0)
+        assert_equal(edges_auto[-1], 100.)
+        assert len(edges_auto) < 100
+
+        edges_fd = histogram_bin_edges(lim_var_data, 'fd')
+        assert_equal(edges_fd, np.array([0, 100]))
+
+        edges_sturges = histogram_bin_edges(lim_var_data, 'sturges')
+        assert_equal(edges_sturges, np.linspace(0, 100, 12))
+
+    def test_outlier(self):
+        """
+        Check the FD, Scott and Doane with outliers.
+
+        The FD estimates a smaller binwidth since it's less affected by
+        outliers. Since the range is so (artificially) large, this means more
+        bins, most of which will be empty, but the data of interest usually is
+        unaffected. The Scott estimator is more affected and returns fewer bins,
+        despite most of the variance being in one area of the data. The Doane
+        estimator lies somewhere between the other two.
+        """
+        xcenter = np.linspace(-10, 10, 50)
+        outlier_dataset = np.hstack((np.linspace(-110, -100, 5), xcenter))
+
+        outlier_resultdict = {'fd': 21, 'scott': 5, 'doane': 11, 'stone': 6}
+
+        for estimator, numbins in outlier_resultdict.items():
+            a, b = np.histogram(outlier_dataset, estimator)
+            assert_equal(len(a), numbins)
+
+    def test_scott_vs_stone(self):
+        """Verify that Scott's rule and Stone's rule converges for normally distributed data"""
+
+        def nbins_ratio(seed, size):
+            rng = np.random.RandomState(seed)
+            x = rng.normal(loc=0, scale=2, size=size)
+            a, b = len(np.histogram(x, 'stone')[0]), len(np.histogram(x, 'scott')[0])
+            return a / (a + b)
+
+        ll = [[nbins_ratio(seed, size) for size in np.geomspace(start=10, stop=100, num=4).round().astype(int)]
+              for seed in range(10)]
+
+        # the average difference between the two methods decreases as the dataset size increases.
+        avg = abs(np.mean(ll, axis=0) - 0.5)
+        assert_almost_equal(avg, [0.15, 0.09, 0.08, 0.03], decimal=2)
+
+    def test_simple_range(self):
+        """
+        Straightforward testing with a mixture of linspace data (for
+        consistency). Adding in a 3rd mixture that will then be
+        completely ignored. All test values have been precomputed and
+        the shouldn't change.
+        """
+        # some basic sanity checking, with some fixed data.
+        # Checking for the correct number of bins
+        basic_test = {
+                      50:   {'fd': 8,  'scott': 8,  'rice': 15,
+                             'sturges': 14, 'auto': 14, 'stone': 8},
+                      500:  {'fd': 15, 'scott': 16, 'rice': 32,
+                             'sturges': 20, 'auto': 20, 'stone': 80},
+                      5000: {'fd': 33, 'scott': 33, 'rice': 69,
+                             'sturges': 27, 'auto': 33, 'stone': 80}
+                     }
+
+        for testlen, expectedResults in basic_test.items():
+            # create some sort of non uniform data to test with
+            # (3 peak uniform mixture)
+            x1 = np.linspace(-10, -1, testlen // 5 * 2)
+            x2 = np.linspace(1, 10, testlen // 5 * 3)
+            x3 = np.linspace(-100, -50, testlen)
+            x = np.hstack((x1, x2, x3))
+            for estimator, numbins in expectedResults.items():
+                a, b = np.histogram(x, estimator, range=(-20, 20))
+                msg = f"For the {estimator} estimator"
+                msg += f" with datasize of {testlen}"
+                assert_equal(len(a), numbins, err_msg=msg)
+
+    @pytest.mark.parametrize("bins", ['auto', 'fd', 'doane', 'scott',
+                                      'stone', 'rice', 'sturges'])
+    def test_signed_integer_data(self, bins):
+        # Regression test for gh-14379.
+        a = np.array([-2, 0, 127], dtype=np.int8)
+        hist, edges = np.histogram(a, bins=bins)
+        hist32, edges32 = np.histogram(a.astype(np.int32), bins=bins)
+        assert_array_equal(hist, hist32)
+        assert_array_equal(edges, edges32)
+
+    @pytest.mark.parametrize("bins", ['auto', 'fd', 'doane', 'scott',
+                                      'stone', 'rice', 'sturges'])
+    def test_integer(self, bins):
+        """
+        Test that bin width for integer data is at least 1.
+        """
+        with suppress_warnings() as sup:
+            if bins == 'stone':
+                sup.filter(RuntimeWarning)
+            assert_equal(
+                np.histogram_bin_edges(np.tile(np.arange(9), 1000), bins),
+                np.arange(9))
+
+    def test_integer_non_auto(self):
+        """
+        Test that the bin-width>=1 requirement *only* applies to auto binning.
+        """
+        assert_equal(
+            np.histogram_bin_edges(np.tile(np.arange(9), 1000), 16),
+            np.arange(17) / 2)
+        assert_equal(
+            np.histogram_bin_edges(np.tile(np.arange(9), 1000), [.1, .2]),
+            [.1, .2])
+
+    def test_simple_weighted(self):
+        """
+        Check that weighted data raises a TypeError
+        """
+        estimator_list = ['fd', 'scott', 'rice', 'sturges', 'auto']
+        for estimator in estimator_list:
+            assert_raises(TypeError, histogram, [1, 2, 3],
+                          estimator, weights=[1, 2, 3])
+
+
+class TestHistogramdd:
+
+    def test_simple(self):
+        x = np.array([[-.5, .5, 1.5], [-.5, 1.5, 2.5], [-.5, 2.5, .5],
+                      [.5,  .5, 1.5], [.5,  1.5, 2.5], [.5,  2.5, 2.5]])
+        H, edges = histogramdd(x, (2, 3, 3),
+                               range=[[-1, 1], [0, 3], [0, 3]])
+        answer = np.array([[[0, 1, 0], [0, 0, 1], [1, 0, 0]],
+                           [[0, 1, 0], [0, 0, 1], [0, 0, 1]]])
+        assert_array_equal(H, answer)
+
+        # Check normalization
+        ed = [[-2, 0, 2], [0, 1, 2, 3], [0, 1, 2, 3]]
+        H, edges = histogramdd(x, bins=ed, density=True)
+        assert_(np.all(H == answer / 12.))
+
+        # Check that H has the correct shape.
+        H, edges = histogramdd(x, (2, 3, 4),
+                               range=[[-1, 1], [0, 3], [0, 4]],
+                               density=True)
+        answer = np.array([[[0, 1, 0, 0], [0, 0, 1, 0], [1, 0, 0, 0]],
+                           [[0, 1, 0, 0], [0, 0, 1, 0], [0, 0, 1, 0]]])
+        assert_array_almost_equal(H, answer / 6., 4)
+        # Check that a sequence of arrays is accepted and H has the correct
+        # shape.
+        z = [np.squeeze(y) for y in np.split(x, 3, axis=1)]
+        H, edges = histogramdd(
+            z, bins=(4, 3, 2), range=[[-2, 2], [0, 3], [0, 2]])
+        answer = np.array([[[0, 0], [0, 0], [0, 0]],
+                           [[0, 1], [0, 0], [1, 0]],
+                           [[0, 1], [0, 0], [0, 0]],
+                           [[0, 0], [0, 0], [0, 0]]])
+        assert_array_equal(H, answer)
+
+        Z = np.zeros((5, 5, 5))
+        Z[list(range(5)), list(range(5)), list(range(5))] = 1.
+        H, edges = histogramdd([np.arange(5), np.arange(5), np.arange(5)], 5)
+        assert_array_equal(H, Z)
+
+    def test_shape_3d(self):
+        # All possible permutations for bins of different lengths in 3D.
+        bins = ((5, 4, 6), (6, 4, 5), (5, 6, 4), (4, 6, 5), (6, 5, 4),
+                (4, 5, 6))
+        r = np.random.rand(10, 3)
+        for b in bins:
+            H, edges = histogramdd(r, b)
+            assert_(H.shape == b)
+
+    def test_shape_4d(self):
+        # All possible permutations for bins of different lengths in 4D.
+        bins = ((7, 4, 5, 6), (4, 5, 7, 6), (5, 6, 4, 7), (7, 6, 5, 4),
+                (5, 7, 6, 4), (4, 6, 7, 5), (6, 5, 7, 4), (7, 5, 4, 6),
+                (7, 4, 6, 5), (6, 4, 7, 5), (6, 7, 5, 4), (4, 6, 5, 7),
+                (4, 7, 5, 6), (5, 4, 6, 7), (5, 7, 4, 6), (6, 7, 4, 5),
+                (6, 5, 4, 7), (4, 7, 6, 5), (4, 5, 6, 7), (7, 6, 4, 5),
+                (5, 4, 7, 6), (5, 6, 7, 4), (6, 4, 5, 7), (7, 5, 6, 4))
+
+        r = np.random.rand(10, 4)
+        for b in bins:
+            H, edges = histogramdd(r, b)
+            assert_(H.shape == b)
+
+    def test_weights(self):
+        v = np.random.rand(100, 2)
+        hist, edges = histogramdd(v)
+        n_hist, edges = histogramdd(v, density=True)
+        w_hist, edges = histogramdd(v, weights=np.ones(100))
+        assert_array_equal(w_hist, hist)
+        w_hist, edges = histogramdd(v, weights=np.ones(100) * 2, density=True)
+        assert_array_equal(w_hist, n_hist)
+        w_hist, edges = histogramdd(v, weights=np.ones(100, int) * 2)
+        assert_array_equal(w_hist, 2 * hist)
+
+    def test_identical_samples(self):
+        x = np.zeros((10, 2), int)
+        hist, edges = histogramdd(x, bins=2)
+        assert_array_equal(edges[0], np.array([-0.5, 0., 0.5]))
+
+    def test_empty(self):
+        a, b = histogramdd([[], []], bins=([0, 1], [0, 1]))
+        assert_array_max_ulp(a, np.array([[0.]]))
+        a, b = np.histogramdd([[], [], []], bins=2)
+        assert_array_max_ulp(a, np.zeros((2, 2, 2)))
+
+    def test_bins_errors(self):
+        # There are two ways to specify bins. Check for the right errors
+        # when mixing those.
+        x = np.arange(8).reshape(2, 4)
+        assert_raises(ValueError, np.histogramdd, x, bins=[-1, 2, 4, 5])
+        assert_raises(ValueError, np.histogramdd, x, bins=[1, 0.99, 1, 1])
+        assert_raises(
+            ValueError, np.histogramdd, x, bins=[1, 1, 1, [1, 2, 3, -3]])
+        assert_(np.histogramdd(x, bins=[1, 1, 1, [1, 2, 3, 4]]))
+
+    def test_inf_edges(self):
+        # Test using +/-inf bin edges works. See #1788.
+        with np.errstate(invalid='ignore'):
+            x = np.arange(6).reshape(3, 2)
+            expected = np.array([[1, 0], [0, 1], [0, 1]])
+            h, e = np.histogramdd(x, bins=[3, [-np.inf, 2, 10]])
+            assert_allclose(h, expected)
+            h, e = np.histogramdd(x, bins=[3, np.array([-1, 2, np.inf])])
+            assert_allclose(h, expected)
+            h, e = np.histogramdd(x, bins=[3, [-np.inf, 3, np.inf]])
+            assert_allclose(h, expected)
+
+    def test_rightmost_binedge(self):
+        # Test event very close to rightmost binedge. See Github issue #4266
+        x = [0.9999999995]
+        bins = [[0., 0.5, 1.0]]
+        hist, _ = histogramdd(x, bins=bins)
+        assert_(hist[0] == 0.0)
+        assert_(hist[1] == 1.)
+        x = [1.0]
+        bins = [[0., 0.5, 1.0]]
+        hist, _ = histogramdd(x, bins=bins)
+        assert_(hist[0] == 0.0)
+        assert_(hist[1] == 1.)
+        x = [1.0000000001]
+        bins = [[0., 0.5, 1.0]]
+        hist, _ = histogramdd(x, bins=bins)
+        assert_(hist[0] == 0.0)
+        assert_(hist[1] == 0.0)
+        x = [1.0001]
+        bins = [[0., 0.5, 1.0]]
+        hist, _ = histogramdd(x, bins=bins)
+        assert_(hist[0] == 0.0)
+        assert_(hist[1] == 0.0)
+
+    def test_finite_range(self):
+        vals = np.random.random((100, 3))
+        histogramdd(vals, range=[[0.0, 1.0], [0.25, 0.75], [0.25, 0.5]])
+        assert_raises(ValueError, histogramdd, vals,
+                      range=[[0.0, 1.0], [0.25, 0.75], [0.25, np.inf]])
+        assert_raises(ValueError, histogramdd, vals,
+                      range=[[0.0, 1.0], [np.nan, 0.75], [0.25, 0.5]])
+
+    def test_equal_edges(self):
+        """ Test that adjacent entries in an edge array can be equal """
+        x = np.array([0, 1, 2])
+        y = np.array([0, 1, 2])
+        x_edges = np.array([0, 2, 2])
+        y_edges = 1
+        hist, edges = histogramdd((x, y), bins=(x_edges, y_edges))
+
+        hist_expected = np.array([
+            [2.],
+            [1.],  # x == 2 falls in the final bin
+        ])
+        assert_equal(hist, hist_expected)
+
+    def test_edge_dtype(self):
+        """ Test that if an edge array is input, its type is preserved """
+        x = np.array([0, 10, 20])
+        y = x / 10
+        x_edges = np.array([0, 5, 15, 20])
+        y_edges = x_edges / 10
+        hist, edges = histogramdd((x, y), bins=(x_edges, y_edges))
+
+        assert_equal(edges[0].dtype, x_edges.dtype)
+        assert_equal(edges[1].dtype, y_edges.dtype)
+
+    def test_large_integers(self):
+        big = 2**60  # Too large to represent with a full precision float
+
+        x = np.array([0], np.int64)
+        x_edges = np.array([-1, +1], np.int64)
+        y = big + x
+        y_edges = big + x_edges
+
+        hist, edges = histogramdd((x, y), bins=(x_edges, y_edges))
+
+        assert_equal(hist[0, 0], 1)
+
+    def test_density_non_uniform_2d(self):
+        # Defines the following grid:
+        #
+        #    0 2     8
+        #   0+-+-----+
+        #    + |     +
+        #    + |     +
+        #   6+-+-----+
+        #   8+-+-----+
+        x_edges = np.array([0, 2, 8])
+        y_edges = np.array([0, 6, 8])
+        relative_areas = np.array([
+            [3, 9],
+            [1, 3]])
+
+        # ensure the number of points in each region is proportional to its area
+        x = np.array([1] + [1] * 3 + [7] * 3 + [7] * 9)
+        y = np.array([7] + [1] * 3 + [7] * 3 + [1] * 9)
+
+        # sanity check that the above worked as intended
+        hist, edges = histogramdd((y, x), bins=(y_edges, x_edges))
+        assert_equal(hist, relative_areas)
+
+        # resulting histogram should be uniform, since counts and areas are proportional
+        hist, edges = histogramdd((y, x), bins=(y_edges, x_edges), density=True)
+        assert_equal(hist, 1 / (8 * 8))
+
+    def test_density_non_uniform_1d(self):
+        # compare to histogram to show the results are the same
+        v = np.arange(10)
+        bins = np.array([0, 1, 3, 6, 10])
+        hist, edges = histogram(v, bins, density=True)
+        hist_dd, edges_dd = histogramdd((v,), (bins,), density=True)
+        assert_equal(hist, hist_dd)
+        assert_equal(edges, edges_dd[0])

lib/python3.11/site-packages/numpy/lib/tests/test_index_tricks.py

@@ -0,0 +1,568 @@
+import pytest
+
+import numpy as np
+from numpy.lib._index_tricks_impl import (
+    c_,
+    diag_indices,
+    diag_indices_from,
+    fill_diagonal,
+    index_exp,
+    ix_,
+    mgrid,
+    ndenumerate,
+    ndindex,
+    ogrid,
+    r_,
+    s_,
+)
+from numpy.testing import (
+    assert_,
+    assert_almost_equal,
+    assert_array_almost_equal,
+    assert_array_equal,
+    assert_equal,
+    assert_raises,
+    assert_raises_regex,
+)
+
+
+class TestRavelUnravelIndex:
+    def test_basic(self):
+        assert_equal(np.unravel_index(2, (2, 2)), (1, 0))
+
+        # test that new shape argument works properly
+        assert_equal(np.unravel_index(indices=2,
+                                      shape=(2, 2)),
+                                      (1, 0))
+
+        # test that an invalid second keyword argument
+        # is properly handled, including the old name `dims`.
+        with assert_raises(TypeError):
+            np.unravel_index(indices=2, hape=(2, 2))
+
+        with assert_raises(TypeError):
+            np.unravel_index(2, hape=(2, 2))
+
+        with assert_raises(TypeError):
+            np.unravel_index(254, ims=(17, 94))
+
+        with assert_raises(TypeError):
+            np.unravel_index(254, dims=(17, 94))
+
+        assert_equal(np.ravel_multi_index((1, 0), (2, 2)), 2)
+        assert_equal(np.unravel_index(254, (17, 94)), (2, 66))
+        assert_equal(np.ravel_multi_index((2, 66), (17, 94)), 254)
+        assert_raises(ValueError, np.unravel_index, -1, (2, 2))
+        assert_raises(TypeError, np.unravel_index, 0.5, (2, 2))
+        assert_raises(ValueError, np.unravel_index, 4, (2, 2))
+        assert_raises(ValueError, np.ravel_multi_index, (-3, 1), (2, 2))
+        assert_raises(ValueError, np.ravel_multi_index, (2, 1), (2, 2))
+        assert_raises(ValueError, np.ravel_multi_index, (0, -3), (2, 2))
+        assert_raises(ValueError, np.ravel_multi_index, (0, 2), (2, 2))
+        assert_raises(TypeError, np.ravel_multi_index, (0.1, 0.), (2, 2))
+
+        assert_equal(np.unravel_index((2 * 3 + 1) * 6 + 4, (4, 3, 6)), [2, 1, 4])
+        assert_equal(
+            np.ravel_multi_index([2, 1, 4], (4, 3, 6)), (2 * 3 + 1) * 6 + 4)
+
+        arr = np.array([[3, 6, 6], [4, 5, 1]])
+        assert_equal(np.ravel_multi_index(arr, (7, 6)), [22, 41, 37])
+        assert_equal(
+            np.ravel_multi_index(arr, (7, 6), order='F'), [31, 41, 13])
+        assert_equal(
+            np.ravel_multi_index(arr, (4, 6), mode='clip'), [22, 23, 19])
+        assert_equal(np.ravel_multi_index(arr, (4, 4), mode=('clip', 'wrap')),
+                     [12, 13, 13])
+        assert_equal(np.ravel_multi_index((3, 1, 4, 1), (6, 7, 8, 9)), 1621)
+
+        assert_equal(np.unravel_index(np.array([22, 41, 37]), (7, 6)),
+                     [[3, 6, 6], [4, 5, 1]])
+        assert_equal(
+            np.unravel_index(np.array([31, 41, 13]), (7, 6), order='F'),
+            [[3, 6, 6], [4, 5, 1]])
+        assert_equal(np.unravel_index(1621, (6, 7, 8, 9)), [3, 1, 4, 1])
+
+    def test_empty_indices(self):
+        msg1 = 'indices must be integral: the provided empty sequence was'
+        msg2 = 'only int indices permitted'
+        assert_raises_regex(TypeError, msg1, np.unravel_index, [], (10, 3, 5))
+        assert_raises_regex(TypeError, msg1, np.unravel_index, (), (10, 3, 5))
+        assert_raises_regex(TypeError, msg2, np.unravel_index, np.array([]),
+                            (10, 3, 5))
+        assert_equal(np.unravel_index(np.array([], dtype=int), (10, 3, 5)),
+                     [[], [], []])
+        assert_raises_regex(TypeError, msg1, np.ravel_multi_index, ([], []),
+                            (10, 3))
+        assert_raises_regex(TypeError, msg1, np.ravel_multi_index, ([], ['abc']),
+                            (10, 3))
+        assert_raises_regex(TypeError, msg2, np.ravel_multi_index,
+                    (np.array([]), np.array([])), (5, 3))
+        assert_equal(np.ravel_multi_index(
+                (np.array([], dtype=int), np.array([], dtype=int)), (5, 3)), [])
+        assert_equal(np.ravel_multi_index(np.array([[], []], dtype=int),
+                     (5, 3)), [])
+
+    def test_big_indices(self):
+        # ravel_multi_index for big indices (issue #7546)
+        if np.intp == np.int64:
+            arr = ([1, 29], [3, 5], [3, 117], [19, 2],
+                   [2379, 1284], [2, 2], [0, 1])
+            assert_equal(
+                np.ravel_multi_index(arr, (41, 7, 120, 36, 2706, 8, 6)),
+                [5627771580, 117259570957])
+
+        # test unravel_index for big indices (issue #9538)
+        assert_raises(ValueError, np.unravel_index, 1, (2**32 - 1, 2**31 + 1))
+
+        # test overflow checking for too big array (issue #7546)
+        dummy_arr = ([0], [0])
+        half_max = np.iinfo(np.intp).max // 2
+        assert_equal(
+            np.ravel_multi_index(dummy_arr, (half_max, 2)), [0])
+        assert_raises(ValueError,
+            np.ravel_multi_index, dummy_arr, (half_max + 1, 2))
+        assert_equal(
+            np.ravel_multi_index(dummy_arr, (half_max, 2), order='F'), [0])
+        assert_raises(ValueError,
+            np.ravel_multi_index, dummy_arr, (half_max + 1, 2), order='F')
+
+    def test_dtypes(self):
+        # Test with different data types
+        for dtype in [np.int16, np.uint16, np.int32,
+                      np.uint32, np.int64, np.uint64]:
+            coords = np.array(
+                [[1, 0, 1, 2, 3, 4], [1, 6, 1, 3, 2, 0]], dtype=dtype)
+            shape = (5, 8)
+            uncoords = 8 * coords[0] + coords[1]
+            assert_equal(np.ravel_multi_index(coords, shape), uncoords)
+            assert_equal(coords, np.unravel_index(uncoords, shape))
+            uncoords = coords[0] + 5 * coords[1]
+            assert_equal(
+                np.ravel_multi_index(coords, shape, order='F'), uncoords)
+            assert_equal(coords, np.unravel_index(uncoords, shape, order='F'))
+
+            coords = np.array(
+                [[1, 0, 1, 2, 3, 4], [1, 6, 1, 3, 2, 0], [1, 3, 1, 0, 9, 5]],
+                dtype=dtype)
+            shape = (5, 8, 10)
+            uncoords = 10 * (8 * coords[0] + coords[1]) + coords[2]
+            assert_equal(np.ravel_multi_index(coords, shape), uncoords)
+            assert_equal(coords, np.unravel_index(uncoords, shape))
+            uncoords = coords[0] + 5 * (coords[1] + 8 * coords[2])
+            assert_equal(
+                np.ravel_multi_index(coords, shape, order='F'), uncoords)
+            assert_equal(coords, np.unravel_index(uncoords, shape, order='F'))
+
+    def test_clipmodes(self):
+        # Test clipmodes
+        assert_equal(
+            np.ravel_multi_index([5, 1, -1, 2], (4, 3, 7, 12), mode='wrap'),
+            np.ravel_multi_index([1, 1, 6, 2], (4, 3, 7, 12)))
+        assert_equal(np.ravel_multi_index([5, 1, -1, 2], (4, 3, 7, 12),
+                                          mode=(
+                                              'wrap', 'raise', 'clip', 'raise')),
+                     np.ravel_multi_index([1, 1, 0, 2], (4, 3, 7, 12)))
+        assert_raises(
+            ValueError, np.ravel_multi_index, [5, 1, -1, 2], (4, 3, 7, 12))
+
+    def test_writeability(self):
+        # gh-7269
+        x, y = np.unravel_index([1, 2, 3], (4, 5))
+        assert_(x.flags.writeable)
+        assert_(y.flags.writeable)
+
+    def test_0d(self):
+        # gh-580
+        x = np.unravel_index(0, ())
+        assert_equal(x, ())
+
+        assert_raises_regex(ValueError, "0d array", np.unravel_index, [0], ())
+        assert_raises_regex(
+            ValueError, "out of bounds", np.unravel_index, [1], ())
+
+    @pytest.mark.parametrize("mode", ["clip", "wrap", "raise"])
+    def test_empty_array_ravel(self, mode):
+        res = np.ravel_multi_index(
+                    np.zeros((3, 0), dtype=np.intp), (2, 1, 0), mode=mode)
+        assert res.shape == (0,)
+
+        with assert_raises(ValueError):
+            np.ravel_multi_index(
+                    np.zeros((3, 1), dtype=np.intp), (2, 1, 0), mode=mode)
+
+    def test_empty_array_unravel(self):
+        res = np.unravel_index(np.zeros(0, dtype=np.intp), (2, 1, 0))
+        # res is a tuple of three empty arrays
+        assert len(res) == 3
+        assert all(a.shape == (0,) for a in res)
+
+        with assert_raises(ValueError):
+            np.unravel_index([1], (2, 1, 0))
+
+class TestGrid:
+    def test_basic(self):
+        a = mgrid[-1:1:10j]
+        b = mgrid[-1:1:0.1]
+        assert_(a.shape == (10,))
+        assert_(b.shape == (20,))
+        assert_(a[0] == -1)
+        assert_almost_equal(a[-1], 1)
+        assert_(b[0] == -1)
+        assert_almost_equal(b[1] - b[0], 0.1, 11)
+        assert_almost_equal(b[-1], b[0] + 19 * 0.1, 11)
+        assert_almost_equal(a[1] - a[0], 2.0 / 9.0, 11)
+
+    def test_linspace_equivalence(self):
+        y, st = np.linspace(2, 10, retstep=True)
+        assert_almost_equal(st, 8 / 49.0)
+        assert_array_almost_equal(y, mgrid[2:10:50j], 13)
+
+    def test_nd(self):
+        c = mgrid[-1:1:10j, -2:2:10j]
+        d = mgrid[-1:1:0.1, -2:2:0.2]
+        assert_(c.shape == (2, 10, 10))
+        assert_(d.shape == (2, 20, 20))
+        assert_array_equal(c[0][0, :], -np.ones(10, 'd'))
+        assert_array_equal(c[1][:, 0], -2 * np.ones(10, 'd'))
+        assert_array_almost_equal(c[0][-1, :], np.ones(10, 'd'), 11)
+        assert_array_almost_equal(c[1][:, -1], 2 * np.ones(10, 'd'), 11)
+        assert_array_almost_equal(d[0, 1, :] - d[0, 0, :],
+                                  0.1 * np.ones(20, 'd'), 11)
+        assert_array_almost_equal(d[1, :, 1] - d[1, :, 0],
+                                  0.2 * np.ones(20, 'd'), 11)
+
+    def test_sparse(self):
+        grid_full = mgrid[-1:1:10j, -2:2:10j]
+        grid_sparse = ogrid[-1:1:10j, -2:2:10j]
+
+        # sparse grids can be made dense by broadcasting
+        grid_broadcast = np.broadcast_arrays(*grid_sparse)
+        for f, b in zip(grid_full, grid_broadcast):
+            assert_equal(f, b)
+
+    @pytest.mark.parametrize("start, stop, step, expected", [
+        (None, 10, 10j, (200, 10)),
+        (-10, 20, None, (1800, 30)),
+        ])
+    def test_mgrid_size_none_handling(self, start, stop, step, expected):
+        # regression test None value handling for
+        # start and step values used by mgrid;
+        # internally, this aims to cover previously
+        # unexplored code paths in nd_grid()
+        grid = mgrid[start:stop:step, start:stop:step]
+        # need a smaller grid to explore one of the
+        # untested code paths
+        grid_small = mgrid[start:stop:step]
+        assert_equal(grid.size, expected[0])
+        assert_equal(grid_small.size, expected[1])
+
+    def test_accepts_npfloating(self):
+        # regression test for #16466
+        grid64 = mgrid[0.1:0.33:0.1, ]
+        grid32 = mgrid[np.float32(0.1):np.float32(0.33):np.float32(0.1), ]
+        assert_array_almost_equal(grid64, grid32)
+        # At some point this was float64, but NEP 50 changed it:
+        assert grid32.dtype == np.float32
+        assert grid64.dtype == np.float64
+
+        # different code path for single slice
+        grid64 = mgrid[0.1:0.33:0.1]
+        grid32 = mgrid[np.float32(0.1):np.float32(0.33):np.float32(0.1)]
+        assert_(grid32.dtype == np.float64)
+        assert_array_almost_equal(grid64, grid32)
+
+    def test_accepts_longdouble(self):
+        # regression tests for #16945
+        grid64 = mgrid[0.1:0.33:0.1, ]
+        grid128 = mgrid[
+            np.longdouble(0.1):np.longdouble(0.33):np.longdouble(0.1),
+        ]
+        assert_(grid128.dtype == np.longdouble)
+        assert_array_almost_equal(grid64, grid128)
+
+        grid128c_a = mgrid[0:np.longdouble(1):3.4j]
+        grid128c_b = mgrid[0:np.longdouble(1):3.4j, ]
+        assert_(grid128c_a.dtype == grid128c_b.dtype == np.longdouble)
+        assert_array_equal(grid128c_a, grid128c_b[0])
+
+        # different code path for single slice
+        grid64 = mgrid[0.1:0.33:0.1]
+        grid128 = mgrid[
+            np.longdouble(0.1):np.longdouble(0.33):np.longdouble(0.1)
+        ]
+        assert_(grid128.dtype == np.longdouble)
+        assert_array_almost_equal(grid64, grid128)
+
+    def test_accepts_npcomplexfloating(self):
+        # Related to #16466
+        assert_array_almost_equal(
+            mgrid[0.1:0.3:3j, ], mgrid[0.1:0.3:np.complex64(3j), ]
+        )
+
+        # different code path for single slice
+        assert_array_almost_equal(
+            mgrid[0.1:0.3:3j], mgrid[0.1:0.3:np.complex64(3j)]
+        )
+
+        # Related to #16945
+        grid64_a = mgrid[0.1:0.3:3.3j]
+        grid64_b = mgrid[0.1:0.3:3.3j, ][0]
+        assert_(grid64_a.dtype == grid64_b.dtype == np.float64)
+        assert_array_equal(grid64_a, grid64_b)
+
+        grid128_a = mgrid[0.1:0.3:np.clongdouble(3.3j)]
+        grid128_b = mgrid[0.1:0.3:np.clongdouble(3.3j), ][0]
+        assert_(grid128_a.dtype == grid128_b.dtype == np.longdouble)
+        assert_array_equal(grid64_a, grid64_b)
+
+
+class TestConcatenator:
+    def test_1d(self):
+        assert_array_equal(r_[1, 2, 3, 4, 5, 6], np.array([1, 2, 3, 4, 5, 6]))
+        b = np.ones(5)
+        c = r_[b, 0, 0, b]
+        assert_array_equal(c, [1, 1, 1, 1, 1, 0, 0, 1, 1, 1, 1, 1])
+
+    def test_mixed_type(self):
+        g = r_[10.1, 1:10]
+        assert_(g.dtype == 'f8')
+
+    def test_more_mixed_type(self):
+        g = r_[-10.1, np.array([1]), np.array([2, 3, 4]), 10.0]
+        assert_(g.dtype == 'f8')
+
+    def test_complex_step(self):
+        # Regression test for #12262
+        g = r_[0:36:100j]
+        assert_(g.shape == (100,))
+
+        # Related to #16466
+        g = r_[0:36:np.complex64(100j)]
+        assert_(g.shape == (100,))
+
+    def test_2d(self):
+        b = np.random.rand(5, 5)
+        c = np.random.rand(5, 5)
+        d = r_['1', b, c]  # append columns
+        assert_(d.shape == (5, 10))
+        assert_array_equal(d[:, :5], b)
+        assert_array_equal(d[:, 5:], c)
+        d = r_[b, c]
+        assert_(d.shape == (10, 5))
+        assert_array_equal(d[:5, :], b)
+        assert_array_equal(d[5:, :], c)
+
+    def test_0d(self):
+        assert_equal(r_[0, np.array(1), 2], [0, 1, 2])
+        assert_equal(r_[[0, 1, 2], np.array(3)], [0, 1, 2, 3])
+        assert_equal(r_[np.array(0), [1, 2, 3]], [0, 1, 2, 3])
+
+
+class TestNdenumerate:
+    def test_basic(self):
+        a = np.array([[1, 2], [3, 4]])
+        assert_equal(list(ndenumerate(a)),
+                     [((0, 0), 1), ((0, 1), 2), ((1, 0), 3), ((1, 1), 4)])
+
+
+class TestIndexExpression:
+    def test_regression_1(self):
+        # ticket #1196
+        a = np.arange(2)
+        assert_equal(a[:-1], a[s_[:-1]])
+        assert_equal(a[:-1], a[index_exp[:-1]])
+
+    def test_simple_1(self):
+        a = np.random.rand(4, 5, 6)
+
+        assert_equal(a[:, :3, [1, 2]], a[index_exp[:, :3, [1, 2]]])
+        assert_equal(a[:, :3, [1, 2]], a[s_[:, :3, [1, 2]]])
+
+
+class TestIx_:
+    def test_regression_1(self):
+        # Test empty untyped inputs create outputs of indexing type, gh-5804
+        a, = np.ix_(range(0))
+        assert_equal(a.dtype, np.intp)
+
+        a, = np.ix_([])
+        assert_equal(a.dtype, np.intp)
+
+        # but if the type is specified, don't change it
+        a, = np.ix_(np.array([], dtype=np.float32))
+        assert_equal(a.dtype, np.float32)
+
+    def test_shape_and_dtype(self):
+        sizes = (4, 5, 3, 2)
+        # Test both lists and arrays
+        for func in (range, np.arange):
+            arrays = np.ix_(*[func(sz) for sz in sizes])
+            for k, (a, sz) in enumerate(zip(arrays, sizes)):
+                assert_equal(a.shape[k], sz)
+                assert_(all(sh == 1 for j, sh in enumerate(a.shape) if j != k))
+                assert_(np.issubdtype(a.dtype, np.integer))
+
+    def test_bool(self):
+        bool_a = [True, False, True, True]
+        int_a, = np.nonzero(bool_a)
+        assert_equal(np.ix_(bool_a)[0], int_a)
+
+    def test_1d_only(self):
+        idx2d = [[1, 2, 3], [4, 5, 6]]
+        assert_raises(ValueError, np.ix_, idx2d)
+
+    def test_repeated_input(self):
+        length_of_vector = 5
+        x = np.arange(length_of_vector)
+        out = ix_(x, x)
+        assert_equal(out[0].shape, (length_of_vector, 1))
+        assert_equal(out[1].shape, (1, length_of_vector))
+        # check that input shape is not modified
+        assert_equal(x.shape, (length_of_vector,))
+
+
+def test_c_():
+    a = c_[np.array([[1, 2, 3]]), 0, 0, np.array([[4, 5, 6]])]
+    assert_equal(a, [[1, 2, 3, 0, 0, 4, 5, 6]])
+
+
+class TestFillDiagonal:
+    def test_basic(self):
+        a = np.zeros((3, 3), int)
+        fill_diagonal(a, 5)
+        assert_array_equal(
+            a, np.array([[5, 0, 0],
+                         [0, 5, 0],
+                         [0, 0, 5]])
+            )
+
+    def test_tall_matrix(self):
+        a = np.zeros((10, 3), int)
+        fill_diagonal(a, 5)
+        assert_array_equal(
+            a, np.array([[5, 0, 0],
+                         [0, 5, 0],
+                         [0, 0, 5],
+                         [0, 0, 0],
+                         [0, 0, 0],
+                         [0, 0, 0],
+                         [0, 0, 0],
+                         [0, 0, 0],
+                         [0, 0, 0],
+                         [0, 0, 0]])
+            )
+
+    def test_tall_matrix_wrap(self):
+        a = np.zeros((10, 3), int)
+        fill_diagonal(a, 5, True)
+        assert_array_equal(
+            a, np.array([[5, 0, 0],
+                         [0, 5, 0],
+                         [0, 0, 5],
+                         [0, 0, 0],
+                         [5, 0, 0],
+                         [0, 5, 0],
+                         [0, 0, 5],
+                         [0, 0, 0],
+                         [5, 0, 0],
+                         [0, 5, 0]])
+            )
+
+    def test_wide_matrix(self):
+        a = np.zeros((3, 10), int)
+        fill_diagonal(a, 5)
+        assert_array_equal(
+            a, np.array([[5, 0, 0, 0, 0, 0, 0, 0, 0, 0],
+                         [0, 5, 0, 0, 0, 0, 0, 0, 0, 0],
+                         [0, 0, 5, 0, 0, 0, 0, 0, 0, 0]])
+            )
+
+    def test_operate_4d_array(self):
+        a = np.zeros((3, 3, 3, 3), int)
+        fill_diagonal(a, 4)
+        i = np.array([0, 1, 2])
+        assert_equal(np.where(a != 0), (i, i, i, i))
+
+    def test_low_dim_handling(self):
+        # raise error with low dimensionality
+        a = np.zeros(3, int)
+        with assert_raises_regex(ValueError, "at least 2-d"):
+            fill_diagonal(a, 5)
+
+    def test_hetero_shape_handling(self):
+        # raise error with high dimensionality and
+        # shape mismatch
+        a = np.zeros((3, 3, 7, 3), int)
+        with assert_raises_regex(ValueError, "equal length"):
+            fill_diagonal(a, 2)
+
+
+def test_diag_indices():
+    di = diag_indices(4)
+    a = np.array([[1, 2, 3, 4],
+                  [5, 6, 7, 8],
+                  [9, 10, 11, 12],
+                  [13, 14, 15, 16]])
+    a[di] = 100
+    assert_array_equal(
+        a, np.array([[100, 2, 3, 4],
+                     [5, 100, 7, 8],
+                     [9, 10, 100, 12],
+                     [13, 14, 15, 100]])
+        )
+
+    # Now, we create indices to manipulate a 3-d array:
+    d3 = diag_indices(2, 3)
+
+    # And use it to set the diagonal of a zeros array to 1:
+    a = np.zeros((2, 2, 2), int)
+    a[d3] = 1
+    assert_array_equal(
+        a, np.array([[[1, 0],
+                      [0, 0]],
+                     [[0, 0],
+                      [0, 1]]])
+        )
+
+
+class TestDiagIndicesFrom:
+
+    def test_diag_indices_from(self):
+        x = np.random.random((4, 4))
+        r, c = diag_indices_from(x)
+        assert_array_equal(r, np.arange(4))
+        assert_array_equal(c, np.arange(4))
+
+    def test_error_small_input(self):
+        x = np.ones(7)
+        with assert_raises_regex(ValueError, "at least 2-d"):
+            diag_indices_from(x)
+
+    def test_error_shape_mismatch(self):
+        x = np.zeros((3, 3, 2, 3), int)
+        with assert_raises_regex(ValueError, "equal length"):
+            diag_indices_from(x)
+
+
+def test_ndindex():
+    x = list(ndindex(1, 2, 3))
+    expected = [ix for ix, e in ndenumerate(np.zeros((1, 2, 3)))]
+    assert_array_equal(x, expected)
+
+    x = list(ndindex((1, 2, 3)))
+    assert_array_equal(x, expected)
+
+    # Test use of scalars and tuples
+    x = list(ndindex((3,)))
+    assert_array_equal(x, list(ndindex(3)))
+
+    # Make sure size argument is optional
+    x = list(ndindex())
+    assert_equal(x, [()])
+
+    x = list(ndindex(()))
+    assert_equal(x, [()])
+
+    # Make sure 0-sized ndindex works correctly
+    x = list(ndindex(*[0]))
+    assert_equal(x, [])

lib/python3.11/site-packages/numpy/lib/tests/test_mixins.py

@@ -0,0 +1,215 @@
+import numbers
+import operator
+
+import numpy as np
+from numpy.testing import assert_, assert_equal, assert_raises
+
+# NOTE: This class should be kept as an exact copy of the example from the
+# docstring for NDArrayOperatorsMixin.
+
+class ArrayLike(np.lib.mixins.NDArrayOperatorsMixin):
+    def __init__(self, value):
+        self.value = np.asarray(value)
+
+    # One might also consider adding the built-in list type to this
+    # list, to support operations like np.add(array_like, list)
+    _HANDLED_TYPES = (np.ndarray, numbers.Number)
+
+    def __array_ufunc__(self, ufunc, method, *inputs, **kwargs):
+        out = kwargs.get('out', ())
+        for x in inputs + out:
+            # Only support operations with instances of _HANDLED_TYPES.
+            # Use ArrayLike instead of type(self) for isinstance to
+            # allow subclasses that don't override __array_ufunc__ to
+            # handle ArrayLike objects.
+            if not isinstance(x, self._HANDLED_TYPES + (ArrayLike,)):
+                return NotImplemented
+
+        # Defer to the implementation of the ufunc on unwrapped values.
+        inputs = tuple(x.value if isinstance(x, ArrayLike) else x
+                       for x in inputs)
+        if out:
+            kwargs['out'] = tuple(
+                x.value if isinstance(x, ArrayLike) else x
+                for x in out)
+        result = getattr(ufunc, method)(*inputs, **kwargs)
+
+        if type(result) is tuple:
+            # multiple return values
+            return tuple(type(self)(x) for x in result)
+        elif method == 'at':
+            # no return value
+            return None
+        else:
+            # one return value
+            return type(self)(result)
+
+    def __repr__(self):
+        return f'{type(self).__name__}({self.value!r})'
+
+
+def wrap_array_like(result):
+    if type(result) is tuple:
+        return tuple(ArrayLike(r) for r in result)
+    else:
+        return ArrayLike(result)
+
+
+def _assert_equal_type_and_value(result, expected, err_msg=None):
+    assert_equal(type(result), type(expected), err_msg=err_msg)
+    if isinstance(result, tuple):
+        assert_equal(len(result), len(expected), err_msg=err_msg)
+        for result_item, expected_item in zip(result, expected):
+            _assert_equal_type_and_value(result_item, expected_item, err_msg)
+    else:
+        assert_equal(result.value, expected.value, err_msg=err_msg)
+        assert_equal(getattr(result.value, 'dtype', None),
+                     getattr(expected.value, 'dtype', None), err_msg=err_msg)
+
+
+_ALL_BINARY_OPERATORS = [
+    operator.lt,
+    operator.le,
+    operator.eq,
+    operator.ne,
+    operator.gt,
+    operator.ge,
+    operator.add,
+    operator.sub,
+    operator.mul,
+    operator.truediv,
+    operator.floordiv,
+    operator.mod,
+    divmod,
+    pow,
+    operator.lshift,
+    operator.rshift,
+    operator.and_,
+    operator.xor,
+    operator.or_,
+]
+
+
+class TestNDArrayOperatorsMixin:
+
+    def test_array_like_add(self):
+
+        def check(result):
+            _assert_equal_type_and_value(result, ArrayLike(0))
+
+        check(ArrayLike(0) + 0)
+        check(0 + ArrayLike(0))
+
+        check(ArrayLike(0) + np.array(0))
+        check(np.array(0) + ArrayLike(0))
+
+        check(ArrayLike(np.array(0)) + 0)
+        check(0 + ArrayLike(np.array(0)))
+
+        check(ArrayLike(np.array(0)) + np.array(0))
+        check(np.array(0) + ArrayLike(np.array(0)))
+
+    def test_inplace(self):
+        array_like = ArrayLike(np.array([0]))
+        array_like += 1
+        _assert_equal_type_and_value(array_like, ArrayLike(np.array([1])))
+
+        array = np.array([0])
+        array += ArrayLike(1)
+        _assert_equal_type_and_value(array, ArrayLike(np.array([1])))
+
+    def test_opt_out(self):
+
+        class OptOut:
+            """Object that opts out of __array_ufunc__."""
+            __array_ufunc__ = None
+
+            def __add__(self, other):
+                return self
+
+            def __radd__(self, other):
+                return self
+
+        array_like = ArrayLike(1)
+        opt_out = OptOut()
+
+        # supported operations
+        assert_(array_like + opt_out is opt_out)
+        assert_(opt_out + array_like is opt_out)
+
+        # not supported
+        with assert_raises(TypeError):
+            # don't use the Python default, array_like = array_like + opt_out
+            array_like += opt_out
+        with assert_raises(TypeError):
+            array_like - opt_out
+        with assert_raises(TypeError):
+            opt_out - array_like
+
+    def test_subclass(self):
+
+        class SubArrayLike(ArrayLike):
+            """Should take precedence over ArrayLike."""
+
+        x = ArrayLike(0)
+        y = SubArrayLike(1)
+        _assert_equal_type_and_value(x + y, y)
+        _assert_equal_type_and_value(y + x, y)
+
+    def test_object(self):
+        x = ArrayLike(0)
+        obj = object()
+        with assert_raises(TypeError):
+            x + obj
+        with assert_raises(TypeError):
+            obj + x
+        with assert_raises(TypeError):
+            x += obj
+
+    def test_unary_methods(self):
+        array = np.array([-1, 0, 1, 2])
+        array_like = ArrayLike(array)
+        for op in [operator.neg,
+                   operator.pos,
+                   abs,
+                   operator.invert]:
+            _assert_equal_type_and_value(op(array_like), ArrayLike(op(array)))
+
+    def test_forward_binary_methods(self):
+        array = np.array([-1, 0, 1, 2])
+        array_like = ArrayLike(array)
+        for op in _ALL_BINARY_OPERATORS:
+            expected = wrap_array_like(op(array, 1))
+            actual = op(array_like, 1)
+            err_msg = f'failed for operator {op}'
+            _assert_equal_type_and_value(expected, actual, err_msg=err_msg)
+
+    def test_reflected_binary_methods(self):
+        for op in _ALL_BINARY_OPERATORS:
+            expected = wrap_array_like(op(2, 1))
+            actual = op(2, ArrayLike(1))
+            err_msg = f'failed for operator {op}'
+            _assert_equal_type_and_value(expected, actual, err_msg=err_msg)
+
+    def test_matmul(self):
+        array = np.array([1, 2], dtype=np.float64)
+        array_like = ArrayLike(array)
+        expected = ArrayLike(np.float64(5))
+        _assert_equal_type_and_value(expected, np.matmul(array_like, array))
+        _assert_equal_type_and_value(
+            expected, operator.matmul(array_like, array))
+        _assert_equal_type_and_value(
+            expected, operator.matmul(array, array_like))
+
+    def test_ufunc_at(self):
+        array = ArrayLike(np.array([1, 2, 3, 4]))
+        assert_(np.negative.at(array, np.array([0, 1])) is None)
+        _assert_equal_type_and_value(array, ArrayLike([-1, -2, 3, 4]))
+
+    def test_ufunc_two_outputs(self):
+        mantissa, exponent = np.frexp(2 ** -3)
+        expected = (ArrayLike(mantissa), ArrayLike(exponent))
+        _assert_equal_type_and_value(
+            np.frexp(ArrayLike(2 ** -3)), expected)
+        _assert_equal_type_and_value(
+            np.frexp(ArrayLike(np.array(2 ** -3))), expected)

lib/python3.11/site-packages/numpy/lib/tests/test_packbits.py

@@ -0,0 +1,376 @@
+from itertools import chain
+
+import pytest
+
+import numpy as np
+from numpy.testing import assert_array_equal, assert_equal, assert_raises
+
+
+def test_packbits():
+    # Copied from the docstring.
+    a = [[[1, 0, 1], [0, 1, 0]],
+         [[1, 1, 0], [0, 0, 1]]]
+    for dt in '?bBhHiIlLqQ':
+        arr = np.array(a, dtype=dt)
+        b = np.packbits(arr, axis=-1)
+        assert_equal(b.dtype, np.uint8)
+        assert_array_equal(b, np.array([[[160], [64]], [[192], [32]]]))
+
+    assert_raises(TypeError, np.packbits, np.array(a, dtype=float))
+
+
+def test_packbits_empty():
+    shapes = [
+        (0,), (10, 20, 0), (10, 0, 20), (0, 10, 20), (20, 0, 0), (0, 20, 0),
+        (0, 0, 20), (0, 0, 0),
+    ]
+    for dt in '?bBhHiIlLqQ':
+        for shape in shapes:
+            a = np.empty(shape, dtype=dt)
+            b = np.packbits(a)
+            assert_equal(b.dtype, np.uint8)
+            assert_equal(b.shape, (0,))
+
+
+def test_packbits_empty_with_axis():
+    # Original shapes and lists of packed shapes for different axes.
+    shapes = [
+        ((0,), [(0,)]),
+        ((10, 20, 0), [(2, 20, 0), (10, 3, 0), (10, 20, 0)]),
+        ((10, 0, 20), [(2, 0, 20), (10, 0, 20), (10, 0, 3)]),
+        ((0, 10, 20), [(0, 10, 20), (0, 2, 20), (0, 10, 3)]),
+        ((20, 0, 0), [(3, 0, 0), (20, 0, 0), (20, 0, 0)]),
+        ((0, 20, 0), [(0, 20, 0), (0, 3, 0), (0, 20, 0)]),
+        ((0, 0, 20), [(0, 0, 20), (0, 0, 20), (0, 0, 3)]),
+        ((0, 0, 0), [(0, 0, 0), (0, 0, 0), (0, 0, 0)]),
+    ]
+    for dt in '?bBhHiIlLqQ':
+        for in_shape, out_shapes in shapes:
+            for ax, out_shape in enumerate(out_shapes):
+                a = np.empty(in_shape, dtype=dt)
+                b = np.packbits(a, axis=ax)
+                assert_equal(b.dtype, np.uint8)
+                assert_equal(b.shape, out_shape)
+
+@pytest.mark.parametrize('bitorder', ('little', 'big'))
+def test_packbits_large(bitorder):
+    # test data large enough for 16 byte vectorization
+    a = np.array([1, 1, 0, 1, 1, 1, 0, 0, 0, 0, 1, 1, 1, 0, 0, 1, 1, 1, 0, 0,
+                  0, 0, 0, 1, 0, 1, 1, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 1, 1, 1,
+                  1, 1, 0, 1, 0, 1, 1, 0, 0, 0, 1, 1, 1, 1, 0, 0, 0, 1, 0, 0,
+                  1, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 1, 1, 1, 1, 1,
+                  1, 0, 1, 0, 1, 0, 0, 1, 0, 1, 1, 0, 1, 0, 1, 1, 0, 1, 0, 1,
+                  1, 0, 1, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 0, 1, 0, 0, 0, 1, 1,
+                  1, 0, 0, 0, 1, 0, 1, 0, 1, 1, 0, 1, 0, 0, 1, 0, 1, 1, 1, 1,
+                  0, 1, 1, 0, 0, 0, 1, 1, 0, 0, 1, 0, 1, 0, 0, 1, 0, 0, 1, 1,
+                  1, 1, 1, 1, 1, 1, 0, 1, 1, 0, 0, 0, 1, 0, 0, 0, 0, 1, 1, 0,
+                  1, 1, 0, 0, 0, 0, 1, 1, 1, 1, 0, 1, 0, 0, 0, 0, 0, 1, 1, 1,
+                  1, 0, 0, 0, 0, 1, 1, 1, 1, 1, 0, 1, 1, 0, 1, 1, 0, 0, 0, 0,
+                  0, 1, 0, 0, 1, 1, 0, 0, 1, 0, 1, 1, 0, 0, 0, 0, 1, 1, 0, 1,
+                  1, 1, 0, 1, 0, 1, 1, 1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 0, 0,
+                  1, 0, 0, 1, 0, 0, 0, 1, 0, 1, 1, 1, 1, 1, 1, 0, 1, 0, 1, 0,
+                  1, 0, 1, 0, 0, 1, 1, 0, 1, 0, 1, 0, 0, 1, 0, 1, 0, 1, 1, 0])
+    a = a.repeat(3)
+    for dtype in '?bBhHiIlLqQ':
+        arr = np.array(a, dtype=dtype)
+        b = np.packbits(arr, axis=None, bitorder=bitorder)
+        assert_equal(b.dtype, np.uint8)
+        r = [252, 127, 192, 3, 254, 7, 252, 0, 7, 31, 240, 0, 28, 1, 255, 252,
+             113, 248, 3, 255, 192, 28, 15, 192, 28, 126, 0, 224, 127, 255,
+             227, 142, 7, 31, 142, 63, 28, 126, 56, 227, 240, 0, 227, 128, 63,
+             224, 14, 56, 252, 112, 56, 255, 241, 248, 3, 240, 56, 224, 112,
+             63, 255, 255, 199, 224, 14, 0, 31, 143, 192, 3, 255, 199, 0, 1,
+             255, 224, 1, 255, 252, 126, 63, 0, 1, 192, 252, 14, 63, 0, 15,
+             199, 252, 113, 255, 3, 128, 56, 252, 14, 7, 0, 113, 255, 255, 142, 56, 227,
+             129, 248, 227, 129, 199, 31, 128]
+        if bitorder == 'big':
+            assert_array_equal(b, r)
+        # equal for size being multiple of 8
+        assert_array_equal(np.unpackbits(b, bitorder=bitorder)[:-4], a)
+
+        # check last byte of different remainders (16 byte vectorization)
+        b = [np.packbits(arr[:-i], axis=None)[-1] for i in range(1, 16)]
+        assert_array_equal(b, [128, 128, 128, 31, 30, 28, 24, 16, 0, 0, 0, 199,
+                               198, 196, 192])
+
+        arr = arr.reshape(36, 25)
+        b = np.packbits(arr, axis=0)
+        assert_equal(b.dtype, np.uint8)
+        assert_array_equal(b, [[190, 186, 178, 178, 150, 215, 87, 83, 83, 195,
+                                199, 206, 204, 204, 140, 140, 136, 136, 8, 40, 105,
+                                107, 75, 74, 88],
+                               [72, 216, 248, 241, 227, 195, 202, 90, 90, 83,
+                                83, 119, 127, 109, 73, 64, 208, 244, 189, 45,
+                                41, 104, 122, 90, 18],
+                               [113, 120, 248, 216, 152, 24, 60, 52, 182, 150,
+                                150, 150, 146, 210, 210, 246, 255, 255, 223,
+                                151, 21, 17, 17, 131, 163],
+                               [214, 210, 210, 64, 68, 5, 5, 1, 72, 88, 92,
+                                92, 78, 110, 39, 181, 149, 220, 222, 218, 218,
+                                202, 234, 170, 168],
+                               [0, 128, 128, 192, 80, 112, 48, 160, 160, 224,
+                                240, 208, 144, 128, 160, 224, 240, 208, 144,
+                                144, 176, 240, 224, 192, 128]])
+
+        b = np.packbits(arr, axis=1)
+        assert_equal(b.dtype, np.uint8)
+        assert_array_equal(b, [[252, 127, 192,   0],
+                               [  7, 252,  15, 128],
+                               [240,   0,  28,   0],
+                               [255, 128,   0, 128],
+                               [192,  31, 255, 128],
+                               [142,  63,   0,   0],
+                               [255, 240,   7,   0],
+                               [  7, 224,  14,   0],
+                               [126,   0, 224,   0],
+                               [255, 255, 199,   0],
+                               [ 56,  28, 126,   0],
+                               [113, 248, 227, 128],
+                               [227, 142,  63,   0],
+                               [  0,  28, 112,   0],
+                               [ 15, 248,   3, 128],
+                               [ 28, 126,  56,   0],
+                               [ 56, 255, 241, 128],
+                               [240,   7, 224,   0],
+                               [227, 129, 192, 128],
+                               [255, 255, 254,   0],
+                               [126,   0, 224,   0],
+                               [  3, 241, 248,   0],
+                               [  0, 255, 241, 128],
+                               [128,   0, 255, 128],
+                               [224,   1, 255, 128],
+                               [248, 252, 126,   0],
+                               [  0,   7,   3, 128],
+                               [224, 113, 248,   0],
+                               [  0, 252, 127, 128],
+                               [142,  63, 224,   0],
+                               [224,  14,  63,   0],
+                               [  7,   3, 128,   0],
+                               [113, 255, 255, 128],
+                               [ 28, 113, 199,   0],
+                               [  7, 227, 142,   0],
+                               [ 14,  56, 252,   0]])
+
+        arr = arr.T.copy()
+        b = np.packbits(arr, axis=0)
+        assert_equal(b.dtype, np.uint8)
+        assert_array_equal(b, [[252, 7, 240, 255, 192, 142, 255, 7, 126, 255,
+                                56, 113, 227, 0, 15, 28, 56, 240, 227, 255,
+                                126, 3, 0, 128, 224, 248, 0, 224, 0, 142, 224,
+                                7, 113, 28, 7, 14],
+                                [127, 252, 0, 128, 31, 63, 240, 224, 0, 255,
+                                 28, 248, 142, 28, 248, 126, 255, 7, 129, 255,
+                                 0, 241, 255, 0, 1, 252, 7, 113, 252, 63, 14,
+                                 3, 255, 113, 227, 56],
+                                [192, 15, 28, 0, 255, 0, 7, 14, 224, 199, 126,
+                                 227, 63, 112, 3, 56, 241, 224, 192, 254, 224,
+                                 248, 241, 255, 255, 126, 3, 248, 127, 224, 63,
+                                 128, 255, 199, 142, 252],
+                                [0, 128, 0, 128, 128, 0, 0, 0, 0, 0, 0, 128, 0,
+                                 0, 128, 0, 128, 0, 128, 0, 0, 0, 128, 128,
+                                 128, 0, 128, 0, 128, 0, 0, 0, 128, 0, 0, 0]])
+
+        b = np.packbits(arr, axis=1)
+        assert_equal(b.dtype, np.uint8)
+        assert_array_equal(b, [[190,  72, 113, 214,   0],
+                               [186, 216, 120, 210, 128],
+                               [178, 248, 248, 210, 128],
+                               [178, 241, 216,  64, 192],
+                               [150, 227, 152,  68,  80],
+                               [215, 195,  24,   5, 112],
+                               [ 87, 202,  60,   5,  48],
+                               [ 83,  90,  52,   1, 160],
+                               [ 83,  90, 182,  72, 160],
+                               [195,  83, 150,  88, 224],
+                               [199,  83, 150,  92, 240],
+                               [206, 119, 150,  92, 208],
+                               [204, 127, 146,  78, 144],
+                               [204, 109, 210, 110, 128],
+                               [140,  73, 210,  39, 160],
+                               [140,  64, 246, 181, 224],
+                               [136, 208, 255, 149, 240],
+                               [136, 244, 255, 220, 208],
+                               [  8, 189, 223, 222, 144],
+                               [ 40,  45, 151, 218, 144],
+                               [105,  41,  21, 218, 176],
+                               [107, 104,  17, 202, 240],
+                               [ 75, 122,  17, 234, 224],
+                               [ 74,  90, 131, 170, 192],
+                               [ 88,  18, 163, 168, 128]])
+
+    # result is the same if input is multiplied with a nonzero value
+    for dtype in 'bBhHiIlLqQ':
+        arr = np.array(a, dtype=dtype)
+        rnd = np.random.randint(low=np.iinfo(dtype).min,
+                                high=np.iinfo(dtype).max, size=arr.size,
+                                dtype=dtype)
+        rnd[rnd == 0] = 1
+        arr *= rnd.astype(dtype)
+        b = np.packbits(arr, axis=-1)
+        assert_array_equal(np.unpackbits(b)[:-4], a)
+
+    assert_raises(TypeError, np.packbits, np.array(a, dtype=float))
+
+
+def test_packbits_very_large():
+    # test some with a larger arrays gh-8637
+    # code is covered earlier but larger array makes crash on bug more likely
+    for s in range(950, 1050):
+        for dt in '?bBhHiIlLqQ':
+            x = np.ones((200, s), dtype=bool)
+            np.packbits(x, axis=1)
+
+
+def test_unpackbits():
+    # Copied from the docstring.
+    a = np.array([[2], [7], [23]], dtype=np.uint8)
+    b = np.unpackbits(a, axis=1)
+    assert_equal(b.dtype, np.uint8)
+    assert_array_equal(b, np.array([[0, 0, 0, 0, 0, 0, 1, 0],
+                                    [0, 0, 0, 0, 0, 1, 1, 1],
+                                    [0, 0, 0, 1, 0, 1, 1, 1]]))
+
+def test_pack_unpack_order():
+    a = np.array([[2], [7], [23]], dtype=np.uint8)
+    b = np.unpackbits(a, axis=1)
+    assert_equal(b.dtype, np.uint8)
+    b_little = np.unpackbits(a, axis=1, bitorder='little')
+    b_big = np.unpackbits(a, axis=1, bitorder='big')
+    assert_array_equal(b, b_big)
+    assert_array_equal(a, np.packbits(b_little, axis=1, bitorder='little'))
+    assert_array_equal(b[:, ::-1], b_little)
+    assert_array_equal(a, np.packbits(b_big, axis=1, bitorder='big'))
+    assert_raises(ValueError, np.unpackbits, a, bitorder='r')
+    assert_raises(TypeError, np.unpackbits, a, bitorder=10)
+
+
+def test_unpackbits_empty():
+    a = np.empty((0,), dtype=np.uint8)
+    b = np.unpackbits(a)
+    assert_equal(b.dtype, np.uint8)
+    assert_array_equal(b, np.empty((0,)))
+
+
+def test_unpackbits_empty_with_axis():
+    # Lists of packed shapes for different axes and unpacked shapes.
+    shapes = [
+        ([(0,)], (0,)),
+        ([(2, 24, 0), (16, 3, 0), (16, 24, 0)], (16, 24, 0)),
+        ([(2, 0, 24), (16, 0, 24), (16, 0, 3)], (16, 0, 24)),
+        ([(0, 16, 24), (0, 2, 24), (0, 16, 3)], (0, 16, 24)),
+        ([(3, 0, 0), (24, 0, 0), (24, 0, 0)], (24, 0, 0)),
+        ([(0, 24, 0), (0, 3, 0), (0, 24, 0)], (0, 24, 0)),
+        ([(0, 0, 24), (0, 0, 24), (0, 0, 3)], (0, 0, 24)),
+        ([(0, 0, 0), (0, 0, 0), (0, 0, 0)], (0, 0, 0)),
+    ]
+    for in_shapes, out_shape in shapes:
+        for ax, in_shape in enumerate(in_shapes):
+            a = np.empty(in_shape, dtype=np.uint8)
+            b = np.unpackbits(a, axis=ax)
+            assert_equal(b.dtype, np.uint8)
+            assert_equal(b.shape, out_shape)
+
+
+def test_unpackbits_large():
+    # test all possible numbers via comparison to already tested packbits
+    d = np.arange(277, dtype=np.uint8)
+    assert_array_equal(np.packbits(np.unpackbits(d)), d)
+    assert_array_equal(np.packbits(np.unpackbits(d[::2])), d[::2])
+    d = np.tile(d, (3, 1))
+    assert_array_equal(np.packbits(np.unpackbits(d, axis=1), axis=1), d)
+    d = d.T.copy()
+    assert_array_equal(np.packbits(np.unpackbits(d, axis=0), axis=0), d)
+
+
+class TestCount:
+    x = np.array([
+        [1, 0, 1, 0, 0, 1, 0],
+        [0, 1, 1, 1, 0, 0, 0],
+        [0, 0, 1, 0, 0, 1, 1],
+        [1, 1, 0, 0, 0, 1, 1],
+        [1, 0, 1, 0, 1, 0, 1],
+        [0, 0, 1, 1, 1, 0, 0],
+        [0, 1, 0, 1, 0, 1, 0],
+    ], dtype=np.uint8)
+    padded1 = np.zeros(57, dtype=np.uint8)
+    padded1[:49] = x.ravel()
+    padded1b = np.zeros(57, dtype=np.uint8)
+    padded1b[:49] = x[::-1].copy().ravel()
+    padded2 = np.zeros((9, 9), dtype=np.uint8)
+    padded2[:7, :7] = x
+
+    @pytest.mark.parametrize('bitorder', ('little', 'big'))
+    @pytest.mark.parametrize('count', chain(range(58), range(-1, -57, -1)))
+    def test_roundtrip(self, bitorder, count):
+        if count < 0:
+            # one extra zero of padding
+            cutoff = count - 1
+        else:
+            cutoff = count
+        # test complete invertibility of packbits and unpackbits with count
+        packed = np.packbits(self.x, bitorder=bitorder)
+        unpacked = np.unpackbits(packed, count=count, bitorder=bitorder)
+        assert_equal(unpacked.dtype, np.uint8)
+        assert_array_equal(unpacked, self.padded1[:cutoff])
+
+    @pytest.mark.parametrize('kwargs', [
+                    {}, {'count': None},
+                    ])
+    def test_count(self, kwargs):
+        packed = np.packbits(self.x)
+        unpacked = np.unpackbits(packed, **kwargs)
+        assert_equal(unpacked.dtype, np.uint8)
+        assert_array_equal(unpacked, self.padded1[:-1])
+
+    @pytest.mark.parametrize('bitorder', ('little', 'big'))
+    # delta==-1 when count<0 because one extra zero of padding
+    @pytest.mark.parametrize('count', chain(range(8), range(-1, -9, -1)))
+    def test_roundtrip_axis(self, bitorder, count):
+        if count < 0:
+            # one extra zero of padding
+            cutoff = count - 1
+        else:
+            cutoff = count
+        packed0 = np.packbits(self.x, axis=0, bitorder=bitorder)
+        unpacked0 = np.unpackbits(packed0, axis=0, count=count,
+                                  bitorder=bitorder)
+        assert_equal(unpacked0.dtype, np.uint8)
+        assert_array_equal(unpacked0, self.padded2[:cutoff, :self.x.shape[1]])
+
+        packed1 = np.packbits(self.x, axis=1, bitorder=bitorder)
+        unpacked1 = np.unpackbits(packed1, axis=1, count=count,
+                                  bitorder=bitorder)
+        assert_equal(unpacked1.dtype, np.uint8)
+        assert_array_equal(unpacked1, self.padded2[:self.x.shape[0], :cutoff])
+
+    @pytest.mark.parametrize('kwargs', [
+                    {}, {'count': None},
+                    {'bitorder': 'little'},
+                    {'bitorder': 'little', 'count': None},
+                    {'bitorder': 'big'},
+                    {'bitorder': 'big', 'count': None},
+                    ])
+    def test_axis_count(self, kwargs):
+        packed0 = np.packbits(self.x, axis=0)
+        unpacked0 = np.unpackbits(packed0, axis=0, **kwargs)
+        assert_equal(unpacked0.dtype, np.uint8)
+        if kwargs.get('bitorder', 'big') == 'big':
+            assert_array_equal(unpacked0, self.padded2[:-1, :self.x.shape[1]])
+        else:
+            assert_array_equal(unpacked0[::-1, :], self.padded2[:-1, :self.x.shape[1]])
+
+        packed1 = np.packbits(self.x, axis=1)
+        unpacked1 = np.unpackbits(packed1, axis=1, **kwargs)
+        assert_equal(unpacked1.dtype, np.uint8)
+        if kwargs.get('bitorder', 'big') == 'big':
+            assert_array_equal(unpacked1, self.padded2[:self.x.shape[0], :-1])
+        else:
+            assert_array_equal(unpacked1[:, ::-1], self.padded2[:self.x.shape[0], :-1])
+
+    def test_bad_count(self):
+        packed0 = np.packbits(self.x, axis=0)
+        assert_raises(ValueError, np.unpackbits, packed0, axis=0, count=-9)
+        packed1 = np.packbits(self.x, axis=1)
+        assert_raises(ValueError, np.unpackbits, packed1, axis=1, count=-9)
+        packed = np.packbits(self.x)
+        assert_raises(ValueError, np.unpackbits, packed, count=-57)

lib/python3.11/site-packages/numpy/lib/tests/test_polynomial.py

@@ -0,0 +1,320 @@
+import pytest
+
+import numpy as np
+import numpy.polynomial.polynomial as poly
+from numpy.testing import (
+    assert_,
+    assert_allclose,
+    assert_almost_equal,
+    assert_array_almost_equal,
+    assert_array_equal,
+    assert_equal,
+    assert_raises,
+)
+
+# `poly1d` has some support for `np.bool` and `np.timedelta64`,
+# but it is limited and they are therefore excluded here
+TYPE_CODES = np.typecodes["AllInteger"] + np.typecodes["AllFloat"] + "O"
+
+
+class TestPolynomial:
+    def test_poly1d_str_and_repr(self):
+        p = np.poly1d([1., 2, 3])
+        assert_equal(repr(p), 'poly1d([1., 2., 3.])')
+        assert_equal(str(p),
+                     '   2\n'
+                     '1 x + 2 x + 3')
+
+        q = np.poly1d([3., 2, 1])
+        assert_equal(repr(q), 'poly1d([3., 2., 1.])')
+        assert_equal(str(q),
+                     '   2\n'
+                     '3 x + 2 x + 1')
+
+        r = np.poly1d([1.89999 + 2j, -3j, -5.12345678, 2 + 1j])
+        assert_equal(str(r),
+                     '            3      2\n'
+                     '(1.9 + 2j) x - 3j x - 5.123 x + (2 + 1j)')
+
+        assert_equal(str(np.poly1d([-3, -2, -1])),
+                     '    2\n'
+                     '-3 x - 2 x - 1')
+
+    def test_poly1d_resolution(self):
+        p = np.poly1d([1., 2, 3])
+        q = np.poly1d([3., 2, 1])
+        assert_equal(p(0), 3.0)
+        assert_equal(p(5), 38.0)
+        assert_equal(q(0), 1.0)
+        assert_equal(q(5), 86.0)
+
+    def test_poly1d_math(self):
+        # here we use some simple coeffs to make calculations easier
+        p = np.poly1d([1., 2, 4])
+        q = np.poly1d([4., 2, 1])
+        assert_equal(p / q, (np.poly1d([0.25]), np.poly1d([1.5, 3.75])))
+        assert_equal(p.integ(), np.poly1d([1 / 3, 1., 4., 0.]))
+        assert_equal(p.integ(1), np.poly1d([1 / 3, 1., 4., 0.]))
+
+        p = np.poly1d([1., 2, 3])
+        q = np.poly1d([3., 2, 1])
+        assert_equal(p * q, np.poly1d([3., 8., 14., 8., 3.]))
+        assert_equal(p + q, np.poly1d([4., 4., 4.]))
+        assert_equal(p - q, np.poly1d([-2., 0., 2.]))
+        assert_equal(p ** 4, np.poly1d([1., 8., 36., 104., 214., 312., 324., 216., 81.]))
+        assert_equal(p(q), np.poly1d([9., 12., 16., 8., 6.]))
+        assert_equal(q(p), np.poly1d([3., 12., 32., 40., 34.]))
+        assert_equal(p.deriv(), np.poly1d([2., 2.]))
+        assert_equal(p.deriv(2), np.poly1d([2.]))
+        assert_equal(np.polydiv(np.poly1d([1, 0, -1]), np.poly1d([1, 1])),
+                     (np.poly1d([1., -1.]), np.poly1d([0.])))
+
+    @pytest.mark.parametrize("type_code", TYPE_CODES)
+    def test_poly1d_misc(self, type_code: str) -> None:
+        dtype = np.dtype(type_code)
+        ar = np.array([1, 2, 3], dtype=dtype)
+        p = np.poly1d(ar)
+
+        # `__eq__`
+        assert_equal(np.asarray(p), ar)
+        assert_equal(np.asarray(p).dtype, dtype)
+        assert_equal(len(p), 2)
+
+        # `__getitem__`
+        comparison_dct = {-1: 0, 0: 3, 1: 2, 2: 1, 3: 0}
+        for index, ref in comparison_dct.items():
+            scalar = p[index]
+            assert_equal(scalar, ref)
+            if dtype == np.object_:
+                assert isinstance(scalar, int)
+            else:
+                assert_equal(scalar.dtype, dtype)
+
+    def test_poly1d_variable_arg(self):
+        q = np.poly1d([1., 2, 3], variable='y')
+        assert_equal(str(q),
+                     '   2\n'
+                     '1 y + 2 y + 3')
+        q = np.poly1d([1., 2, 3], variable='lambda')
+        assert_equal(str(q),
+                     '        2\n'
+                     '1 lambda + 2 lambda + 3')
+
+    def test_poly(self):
+        assert_array_almost_equal(np.poly([3, -np.sqrt(2), np.sqrt(2)]),
+                                  [1, -3, -2, 6])
+
+        # From matlab docs
+        A = [[1, 2, 3], [4, 5, 6], [7, 8, 0]]
+        assert_array_almost_equal(np.poly(A), [1, -6, -72, -27])
+
+        # Should produce real output for perfect conjugates
+        assert_(np.isrealobj(np.poly([+1.082j, +2.613j, -2.613j, -1.082j])))
+        assert_(np.isrealobj(np.poly([0 + 1j, -0 + -1j, 1 + 2j,
+                                      1 - 2j, 1. + 3.5j, 1 - 3.5j])))
+        assert_(np.isrealobj(np.poly([1j, -1j, 1 + 2j, 1 - 2j, 1 + 3j, 1 - 3.j])))
+        assert_(np.isrealobj(np.poly([1j, -1j, 1 + 2j, 1 - 2j])))
+        assert_(np.isrealobj(np.poly([1j, -1j, 2j, -2j])))
+        assert_(np.isrealobj(np.poly([1j, -1j])))
+        assert_(np.isrealobj(np.poly([1, -1])))
+
+        assert_(np.iscomplexobj(np.poly([1j, -1.0000001j])))
+
+        np.random.seed(42)
+        a = np.random.randn(100) + 1j * np.random.randn(100)
+        assert_(np.isrealobj(np.poly(np.concatenate((a, np.conjugate(a))))))
+
+    def test_roots(self):
+        assert_array_equal(np.roots([1, 0, 0]), [0, 0])
+
+        # Testing for larger root values
+        for i in np.logspace(10, 25, num=1000, base=10):
+            tgt = np.array([-1, 1, i])
+            res = np.sort(np.roots(poly.polyfromroots(tgt)[::-1]))
+            assert_almost_equal(res, tgt, 14 - int(np.log10(i)))    # Adapting the expected precision according to the root value, to take into account numerical calculation error
+
+        for i in np.logspace(10, 25, num=1000, base=10):
+            tgt = np.array([-1, 1.01, i])
+            res = np.sort(np.roots(poly.polyfromroots(tgt)[::-1]))
+            assert_almost_equal(res, tgt, 14 - int(np.log10(i)))    # Adapting the expected precision according to the root value, to take into account numerical calculation error
+
+    def test_str_leading_zeros(self):
+        p = np.poly1d([4, 3, 2, 1])
+        p[3] = 0
+        assert_equal(str(p),
+                     "   2\n"
+                     "3 x + 2 x + 1")
+
+        p = np.poly1d([1, 2])
+        p[0] = 0
+        p[1] = 0
+        assert_equal(str(p), " \n0")
+
+    def test_polyfit(self):
+        c = np.array([3., 2., 1.])
+        x = np.linspace(0, 2, 7)
+        y = np.polyval(c, x)
+        err = [1, -1, 1, -1, 1, -1, 1]
+        weights = np.arange(8, 1, -1)**2 / 7.0
+
+        # Check exception when too few points for variance estimate. Note that
+        # the estimate requires the number of data points to exceed
+        # degree + 1
+        assert_raises(ValueError, np.polyfit,
+                      [1], [1], deg=0, cov=True)
+
+        # check 1D case
+        m, cov = np.polyfit(x, y + err, 2, cov=True)
+        est = [3.8571, 0.2857, 1.619]
+        assert_almost_equal(est, m, decimal=4)
+        val0 = [[ 1.4694, -2.9388,  0.8163],
+                [-2.9388,  6.3673, -2.1224],
+                [ 0.8163, -2.1224,  1.161 ]]  # noqa: E202
+        assert_almost_equal(val0, cov, decimal=4)
+
+        m2, cov2 = np.polyfit(x, y + err, 2, w=weights, cov=True)
+        assert_almost_equal([4.8927, -1.0177, 1.7768], m2, decimal=4)
+        val = [[ 4.3964, -5.0052,  0.4878],
+               [-5.0052,  6.8067, -0.9089],
+               [ 0.4878, -0.9089,  0.3337]]
+        assert_almost_equal(val, cov2, decimal=4)
+
+        m3, cov3 = np.polyfit(x, y + err, 2, w=weights, cov="unscaled")
+        assert_almost_equal([4.8927, -1.0177, 1.7768], m3, decimal=4)
+        val = [[ 0.1473, -0.1677,  0.0163],
+               [-0.1677,  0.228 , -0.0304],  # noqa: E203
+               [ 0.0163, -0.0304,  0.0112]]
+        assert_almost_equal(val, cov3, decimal=4)
+
+        # check 2D (n,1) case
+        y = y[:, np.newaxis]
+        c = c[:, np.newaxis]
+        assert_almost_equal(c, np.polyfit(x, y, 2))
+        # check 2D (n,2) case
+        yy = np.concatenate((y, y), axis=1)
+        cc = np.concatenate((c, c), axis=1)
+        assert_almost_equal(cc, np.polyfit(x, yy, 2))
+
+        m, cov = np.polyfit(x, yy + np.array(err)[:, np.newaxis], 2, cov=True)
+        assert_almost_equal(est, m[:, 0], decimal=4)
+        assert_almost_equal(est, m[:, 1], decimal=4)
+        assert_almost_equal(val0, cov[:, :, 0], decimal=4)
+        assert_almost_equal(val0, cov[:, :, 1], decimal=4)
+
+        # check order 1 (deg=0) case, were the analytic results are simple
+        np.random.seed(123)
+        y = np.random.normal(size=(4, 10000))
+        mean, cov = np.polyfit(np.zeros(y.shape[0]), y, deg=0, cov=True)
+        # Should get sigma_mean = sigma/sqrt(N) = 1./sqrt(4) = 0.5.
+        assert_allclose(mean.std(), 0.5, atol=0.01)
+        assert_allclose(np.sqrt(cov.mean()), 0.5, atol=0.01)
+        # Without scaling, since reduced chi2 is 1, the result should be the same.
+        mean, cov = np.polyfit(np.zeros(y.shape[0]), y, w=np.ones(y.shape[0]),
+                               deg=0, cov="unscaled")
+        assert_allclose(mean.std(), 0.5, atol=0.01)
+        assert_almost_equal(np.sqrt(cov.mean()), 0.5)
+        # If we estimate our errors wrong, no change with scaling:
+        w = np.full(y.shape[0], 1. / 0.5)
+        mean, cov = np.polyfit(np.zeros(y.shape[0]), y, w=w, deg=0, cov=True)
+        assert_allclose(mean.std(), 0.5, atol=0.01)
+        assert_allclose(np.sqrt(cov.mean()), 0.5, atol=0.01)
+        # But if we do not scale, our estimate for the error in the mean will
+        # differ.
+        mean, cov = np.polyfit(np.zeros(y.shape[0]), y, w=w, deg=0, cov="unscaled")
+        assert_allclose(mean.std(), 0.5, atol=0.01)
+        assert_almost_equal(np.sqrt(cov.mean()), 0.25)
+
+    def test_objects(self):
+        from decimal import Decimal
+        p = np.poly1d([Decimal('4.0'), Decimal('3.0'), Decimal('2.0')])
+        p2 = p * Decimal('1.333333333333333')
+        assert_(p2[1] == Decimal("3.9999999999999990"))
+        p2 = p.deriv()
+        assert_(p2[1] == Decimal('8.0'))
+        p2 = p.integ()
+        assert_(p2[3] == Decimal("1.333333333333333333333333333"))
+        assert_(p2[2] == Decimal('1.5'))
+        assert_(np.issubdtype(p2.coeffs.dtype, np.object_))
+        p = np.poly([Decimal(1), Decimal(2)])
+        assert_equal(np.poly([Decimal(1), Decimal(2)]),
+                     [1, Decimal(-3), Decimal(2)])
+
+    def test_complex(self):
+        p = np.poly1d([3j, 2j, 1j])
+        p2 = p.integ()
+        assert_((p2.coeffs == [1j, 1j, 1j, 0]).all())
+        p2 = p.deriv()
+        assert_((p2.coeffs == [6j, 2j]).all())
+
+    def test_integ_coeffs(self):
+        p = np.poly1d([3, 2, 1])
+        p2 = p.integ(3, k=[9, 7, 6])
+        assert_(
+            (p2.coeffs == [1 / 4. / 5., 1 / 3. / 4., 1 / 2. / 3., 9 / 1. / 2., 7, 6]).all())
+
+    def test_zero_dims(self):
+        try:
+            np.poly(np.zeros((0, 0)))
+        except ValueError:
+            pass
+
+    def test_poly_int_overflow(self):
+        """
+        Regression test for gh-5096.
+        """
+        v = np.arange(1, 21)
+        assert_almost_equal(np.poly(v), np.poly(np.diag(v)))
+
+    def test_zero_poly_dtype(self):
+        """
+        Regression test for gh-16354.
+        """
+        z = np.array([0, 0, 0])
+        p = np.poly1d(z.astype(np.int64))
+        assert_equal(p.coeffs.dtype, np.int64)
+
+        p = np.poly1d(z.astype(np.float32))
+        assert_equal(p.coeffs.dtype, np.float32)
+
+        p = np.poly1d(z.astype(np.complex64))
+        assert_equal(p.coeffs.dtype, np.complex64)
+
+    def test_poly_eq(self):
+        p = np.poly1d([1, 2, 3])
+        p2 = np.poly1d([1, 2, 4])
+        assert_equal(p == None, False)  # noqa: E711
+        assert_equal(p != None, True)  # noqa: E711
+        assert_equal(p == p, True)
+        assert_equal(p == p2, False)
+        assert_equal(p != p2, True)
+
+    def test_polydiv(self):
+        b = np.poly1d([2, 6, 6, 1])
+        a = np.poly1d([-1j, (1 + 2j), -(2 + 1j), 1])
+        q, r = np.polydiv(b, a)
+        assert_equal(q.coeffs.dtype, np.complex128)
+        assert_equal(r.coeffs.dtype, np.complex128)
+        assert_equal(q * a + r, b)
+
+        c = [1, 2, 3]
+        d = np.poly1d([1, 2, 3])
+        s, t = np.polydiv(c, d)
+        assert isinstance(s, np.poly1d)
+        assert isinstance(t, np.poly1d)
+        u, v = np.polydiv(d, c)
+        assert isinstance(u, np.poly1d)
+        assert isinstance(v, np.poly1d)
+
+    def test_poly_coeffs_mutable(self):
+        """ Coefficients should be modifiable """
+        p = np.poly1d([1, 2, 3])
+
+        p.coeffs += 1
+        assert_equal(p.coeffs, [2, 3, 4])
+
+        p.coeffs[2] += 10
+        assert_equal(p.coeffs, [2, 3, 14])
+
+        # this never used to be allowed - let's not add features to deprecated
+        # APIs
+        assert_raises(AttributeError, setattr, p, 'coeffs', np.array(1))

lib/python3.11/site-packages/numpy/lib/tests/test_regression.py

@@ -0,0 +1,231 @@
+import os
+
+import numpy as np
+from numpy.testing import (
+    _assert_valid_refcount,
+    assert_,
+    assert_array_almost_equal,
+    assert_array_equal,
+    assert_equal,
+    assert_raises,
+)
+
+
+class TestRegression:
+    def test_poly1d(self):
+        # Ticket #28
+        assert_equal(np.poly1d([1]) - np.poly1d([1, 0]),
+                     np.poly1d([-1, 1]))
+
+    def test_cov_parameters(self):
+        # Ticket #91
+        x = np.random.random((3, 3))
+        y = x.copy()
+        np.cov(x, rowvar=True)
+        np.cov(y, rowvar=False)
+        assert_array_equal(x, y)
+
+    def test_mem_digitize(self):
+        # Ticket #95
+        for i in range(100):
+            np.digitize([1, 2, 3, 4], [1, 3])
+            np.digitize([0, 1, 2, 3, 4], [1, 3])
+
+    def test_unique_zero_sized(self):
+        # Ticket #205
+        assert_array_equal([], np.unique(np.array([])))
+
+    def test_mem_vectorise(self):
+        # Ticket #325
+        vt = np.vectorize(lambda *args: args)
+        vt(np.zeros((1, 2, 1)), np.zeros((2, 1, 1)), np.zeros((1, 1, 2)))
+        vt(np.zeros((1, 2, 1)), np.zeros((2, 1, 1)), np.zeros((1,
+           1, 2)), np.zeros((2, 2)))
+
+    def test_mgrid_single_element(self):
+        # Ticket #339
+        assert_array_equal(np.mgrid[0:0:1j], [0])
+        assert_array_equal(np.mgrid[0:0], [])
+
+    def test_refcount_vectorize(self):
+        # Ticket #378
+        def p(x, y):
+            return 123
+        v = np.vectorize(p)
+        _assert_valid_refcount(v)
+
+    def test_poly1d_nan_roots(self):
+        # Ticket #396
+        p = np.poly1d([np.nan, np.nan, 1], r=False)
+        assert_raises(np.linalg.LinAlgError, getattr, p, "r")
+
+    def test_mem_polymul(self):
+        # Ticket #448
+        np.polymul([], [1.])
+
+    def test_mem_string_concat(self):
+        # Ticket #469
+        x = np.array([])
+        np.append(x, 'asdasd\tasdasd')
+
+    def test_poly_div(self):
+        # Ticket #553
+        u = np.poly1d([1, 2, 3])
+        v = np.poly1d([1, 2, 3, 4, 5])
+        q, r = np.polydiv(u, v)
+        assert_equal(q * v + r, u)
+
+    def test_poly_eq(self):
+        # Ticket #554
+        x = np.poly1d([1, 2, 3])
+        y = np.poly1d([3, 4])
+        assert_(x != y)
+        assert_(x == x)
+
+    def test_polyfit_build(self):
+        # Ticket #628
+        ref = [-1.06123820e-06, 5.70886914e-04, -1.13822012e-01,
+               9.95368241e+00, -3.14526520e+02]
+        x = [90, 91, 92, 93, 94, 95, 96, 97, 98, 99, 100, 101, 102, 103,
+             104, 105, 106, 107, 108, 109, 110, 111, 112, 113, 114, 115,
+             116, 117, 118, 119, 120, 121, 122, 123, 124, 125, 126, 129,
+             130, 131, 132, 133, 134, 135, 136, 137, 138, 139, 140, 141,
+             146, 147, 148, 149, 150, 151, 152, 153, 154, 155, 156, 157,
+             158, 159, 160, 161, 162, 163, 164, 165, 166, 167, 168, 169,
+             170, 171, 172, 173, 174, 175, 176]
+        y = [9.0, 3.0, 7.0, 4.0, 4.0, 8.0, 6.0, 11.0, 9.0, 8.0, 11.0, 5.0,
+             6.0, 5.0, 9.0, 8.0, 6.0, 10.0, 6.0, 10.0, 7.0, 6.0, 6.0, 6.0,
+             13.0, 4.0, 9.0, 11.0, 4.0, 5.0, 8.0, 5.0, 7.0, 7.0, 6.0, 12.0,
+             7.0, 7.0, 9.0, 4.0, 12.0, 6.0, 6.0, 4.0, 3.0, 9.0, 8.0, 8.0,
+             6.0, 7.0, 9.0, 10.0, 6.0, 8.0, 4.0, 7.0, 7.0, 10.0, 8.0, 8.0,
+             6.0, 3.0, 8.0, 4.0, 5.0, 7.0, 8.0, 6.0, 6.0, 4.0, 12.0, 9.0,
+             8.0, 8.0, 8.0, 6.0, 7.0, 4.0, 4.0, 5.0, 7.0]
+        tested = np.polyfit(x, y, 4)
+        assert_array_almost_equal(ref, tested)
+
+    def test_polydiv_type(self):
+        # Make polydiv work for complex types
+        msg = "Wrong type, should be complex"
+        x = np.ones(3, dtype=complex)
+        q, r = np.polydiv(x, x)
+        assert_(q.dtype == complex, msg)
+        msg = "Wrong type, should be float"
+        x = np.ones(3, dtype=int)
+        q, r = np.polydiv(x, x)
+        assert_(q.dtype == float, msg)
+
+    def test_histogramdd_too_many_bins(self):
+        # Ticket 928.
+        assert_raises(ValueError, np.histogramdd, np.ones((1, 10)), bins=2**10)
+
+    def test_polyint_type(self):
+        # Ticket #944
+        msg = "Wrong type, should be complex"
+        x = np.ones(3, dtype=complex)
+        assert_(np.polyint(x).dtype == complex, msg)
+        msg = "Wrong type, should be float"
+        x = np.ones(3, dtype=int)
+        assert_(np.polyint(x).dtype == float, msg)
+
+    def test_ndenumerate_crash(self):
+        # Ticket 1140
+        # Shouldn't crash:
+        list(np.ndenumerate(np.array([[]])))
+
+    def test_large_fancy_indexing(self):
+        # Large enough to fail on 64-bit.
+        nbits = np.dtype(np.intp).itemsize * 8
+        thesize = int((2**nbits)**(1.0 / 5.0) + 1)
+
+        def dp():
+            n = 3
+            a = np.ones((n,) * 5)
+            i = np.random.randint(0, n, size=thesize)
+            a[np.ix_(i, i, i, i, i)] = 0
+
+        def dp2():
+            n = 3
+            a = np.ones((n,) * 5)
+            i = np.random.randint(0, n, size=thesize)
+            a[np.ix_(i, i, i, i, i)]
+
+        assert_raises(ValueError, dp)
+        assert_raises(ValueError, dp2)
+
+    def test_void_coercion(self):
+        dt = np.dtype([('a', 'f4'), ('b', 'i4')])
+        x = np.zeros((1,), dt)
+        assert_(np.r_[x, x].dtype == dt)
+
+    def test_include_dirs(self):
+        # As a sanity check, just test that get_include
+        # includes something reasonable.  Somewhat
+        # related to ticket #1405.
+        include_dirs = [np.get_include()]
+        for path in include_dirs:
+            assert_(isinstance(path, str))
+            assert_(path != '')
+
+    def test_polyder_return_type(self):
+        # Ticket #1249
+        assert_(isinstance(np.polyder(np.poly1d([1]), 0), np.poly1d))
+        assert_(isinstance(np.polyder([1], 0), np.ndarray))
+        assert_(isinstance(np.polyder(np.poly1d([1]), 1), np.poly1d))
+        assert_(isinstance(np.polyder([1], 1), np.ndarray))
+
+    def test_append_fields_dtype_list(self):
+        # Ticket #1676
+        from numpy.lib.recfunctions import append_fields
+
+        base = np.array([1, 2, 3], dtype=np.int32)
+        names = ['a', 'b', 'c']
+        data = np.eye(3).astype(np.int32)
+        dlist = [np.float64, np.int32, np.int32]
+        try:
+            append_fields(base, names, data, dlist)
+        except Exception:
+            raise AssertionError
+
+    def test_loadtxt_fields_subarrays(self):
+        # For ticket #1936
+        from io import StringIO
+
+        dt = [("a", 'u1', 2), ("b", 'u1', 2)]
+        x = np.loadtxt(StringIO("0 1 2 3"), dtype=dt)
+        assert_equal(x, np.array([((0, 1), (2, 3))], dtype=dt))
+
+        dt = [("a", [("a", 'u1', (1, 3)), ("b", 'u1')])]
+        x = np.loadtxt(StringIO("0 1 2 3"), dtype=dt)
+        assert_equal(x, np.array([(((0, 1, 2), 3),)], dtype=dt))
+
+        dt = [("a", 'u1', (2, 2))]
+        x = np.loadtxt(StringIO("0 1 2 3"), dtype=dt)
+        assert_equal(x, np.array([(((0, 1), (2, 3)),)], dtype=dt))
+
+        dt = [("a", 'u1', (2, 3, 2))]
+        x = np.loadtxt(StringIO("0 1 2 3 4 5 6 7 8 9 10 11"), dtype=dt)
+        data = [((((0, 1), (2, 3), (4, 5)), ((6, 7), (8, 9), (10, 11))),)]
+        assert_equal(x, np.array(data, dtype=dt))
+
+    def test_nansum_with_boolean(self):
+        # gh-2978
+        a = np.zeros(2, dtype=bool)
+        try:
+            np.nansum(a)
+        except Exception:
+            raise AssertionError
+
+    def test_py3_compat(self):
+        # gh-2561
+        # Test if the oldstyle class test is bypassed in python3
+        class C:
+            """Old-style class in python2, normal class in python3"""
+            pass
+
+        out = open(os.devnull, 'w')
+        try:
+            np.info(C(), output=out)
+        except AttributeError:
+            raise AssertionError
+        finally:
+            out.close()

lib/python3.11/site-packages/numpy/lib/tests/test_shape_base.py

@@ -0,0 +1,813 @@
+import functools
+import sys
+
+import pytest
+
+import numpy as np
+from numpy import (
+    apply_along_axis,
+    apply_over_axes,
+    array_split,
+    column_stack,
+    dsplit,
+    dstack,
+    expand_dims,
+    hsplit,
+    kron,
+    put_along_axis,
+    split,
+    take_along_axis,
+    tile,
+    vsplit,
+)
+from numpy.exceptions import AxisError
+from numpy.testing import assert_, assert_array_equal, assert_equal, assert_raises
+
+IS_64BIT = sys.maxsize > 2**32
+
+
+def _add_keepdims(func):
+    """ hack in keepdims behavior into a function taking an axis """
+    @functools.wraps(func)
+    def wrapped(a, axis, **kwargs):
+        res = func(a, axis=axis, **kwargs)
+        if axis is None:
+            axis = 0  # res is now a scalar, so we can insert this anywhere
+        return np.expand_dims(res, axis=axis)
+    return wrapped
+
+
+class TestTakeAlongAxis:
+    def test_argequivalent(self):
+        """ Test it translates from arg<func> to <func> """
+        from numpy.random import rand
+        a = rand(3, 4, 5)
+
+        funcs = [
+            (np.sort, np.argsort, {}),
+            (_add_keepdims(np.min), _add_keepdims(np.argmin), {}),
+            (_add_keepdims(np.max), _add_keepdims(np.argmax), {}),
+            #(np.partition, np.argpartition, dict(kth=2)),
+        ]
+
+        for func, argfunc, kwargs in funcs:
+            for axis in list(range(a.ndim)) + [None]:
+                a_func = func(a, axis=axis, **kwargs)
+                ai_func = argfunc(a, axis=axis, **kwargs)
+                assert_equal(a_func, take_along_axis(a, ai_func, axis=axis))
+
+    def test_invalid(self):
+        """ Test it errors when indices has too few dimensions """
+        a = np.ones((10, 10))
+        ai = np.ones((10, 2), dtype=np.intp)
+
+        # sanity check
+        take_along_axis(a, ai, axis=1)
+
+        # not enough indices
+        assert_raises(ValueError, take_along_axis, a, np.array(1), axis=1)
+        # bool arrays not allowed
+        assert_raises(IndexError, take_along_axis, a, ai.astype(bool), axis=1)
+        # float arrays not allowed
+        assert_raises(IndexError, take_along_axis, a, ai.astype(float), axis=1)
+        # invalid axis
+        assert_raises(AxisError, take_along_axis, a, ai, axis=10)
+        # invalid indices
+        assert_raises(ValueError, take_along_axis, a, ai, axis=None)
+
+    def test_empty(self):
+        """ Test everything is ok with empty results, even with inserted dims """
+        a = np.ones((3, 4, 5))
+        ai = np.ones((3, 0, 5), dtype=np.intp)
+
+        actual = take_along_axis(a, ai, axis=1)
+        assert_equal(actual.shape, ai.shape)
+
+    def test_broadcast(self):
+        """ Test that non-indexing dimensions are broadcast in both directions """
+        a = np.ones((3, 4, 1))
+        ai = np.ones((1, 2, 5), dtype=np.intp)
+        actual = take_along_axis(a, ai, axis=1)
+        assert_equal(actual.shape, (3, 2, 5))
+
+
+class TestPutAlongAxis:
+    def test_replace_max(self):
+        a_base = np.array([[10, 30, 20], [60, 40, 50]])
+
+        for axis in list(range(a_base.ndim)) + [None]:
+            # we mutate this in the loop
+            a = a_base.copy()
+
+            # replace the max with a small value
+            i_max = _add_keepdims(np.argmax)(a, axis=axis)
+            put_along_axis(a, i_max, -99, axis=axis)
+
+            # find the new minimum, which should max
+            i_min = _add_keepdims(np.argmin)(a, axis=axis)
+
+            assert_equal(i_min, i_max)
+
+    def test_broadcast(self):
+        """ Test that non-indexing dimensions are broadcast in both directions """
+        a = np.ones((3, 4, 1))
+        ai = np.arange(10, dtype=np.intp).reshape((1, 2, 5)) % 4
+        put_along_axis(a, ai, 20, axis=1)
+        assert_equal(take_along_axis(a, ai, axis=1), 20)
+
+    def test_invalid(self):
+        """ Test invalid inputs """
+        a_base = np.array([[10, 30, 20], [60, 40, 50]])
+        indices = np.array([[0], [1]])
+        values = np.array([[2], [1]])
+
+        # sanity check
+        a = a_base.copy()
+        put_along_axis(a, indices, values, axis=0)
+        assert np.all(a == [[2, 2, 2], [1, 1, 1]])
+
+        # invalid indices
+        a = a_base.copy()
+        with assert_raises(ValueError) as exc:
+            put_along_axis(a, indices, values, axis=None)
+        assert "single dimension" in str(exc.exception)
+
+
+class TestApplyAlongAxis:
+    def test_simple(self):
+        a = np.ones((20, 10), 'd')
+        assert_array_equal(
+            apply_along_axis(len, 0, a), len(a) * np.ones(a.shape[1]))
+
+    def test_simple101(self):
+        a = np.ones((10, 101), 'd')
+        assert_array_equal(
+            apply_along_axis(len, 0, a), len(a) * np.ones(a.shape[1]))
+
+    def test_3d(self):
+        a = np.arange(27).reshape((3, 3, 3))
+        assert_array_equal(apply_along_axis(np.sum, 0, a),
+                           [[27, 30, 33], [36, 39, 42], [45, 48, 51]])
+
+    def test_preserve_subclass(self):
+        def double(row):
+            return row * 2
+
+        class MyNDArray(np.ndarray):
+            pass
+
+        m = np.array([[0, 1], [2, 3]]).view(MyNDArray)
+        expected = np.array([[0, 2], [4, 6]]).view(MyNDArray)
+
+        result = apply_along_axis(double, 0, m)
+        assert_(isinstance(result, MyNDArray))
+        assert_array_equal(result, expected)
+
+        result = apply_along_axis(double, 1, m)
+        assert_(isinstance(result, MyNDArray))
+        assert_array_equal(result, expected)
+
+    def test_subclass(self):
+        class MinimalSubclass(np.ndarray):
+            data = 1
+
+        def minimal_function(array):
+            return array.data
+
+        a = np.zeros((6, 3)).view(MinimalSubclass)
+
+        assert_array_equal(
+            apply_along_axis(minimal_function, 0, a), np.array([1, 1, 1])
+        )
+
+    def test_scalar_array(self, cls=np.ndarray):
+        a = np.ones((6, 3)).view(cls)
+        res = apply_along_axis(np.sum, 0, a)
+        assert_(isinstance(res, cls))
+        assert_array_equal(res, np.array([6, 6, 6]).view(cls))
+
+    def test_0d_array(self, cls=np.ndarray):
+        def sum_to_0d(x):
+            """ Sum x, returning a 0d array of the same class """
+            assert_equal(x.ndim, 1)
+            return np.squeeze(np.sum(x, keepdims=True))
+        a = np.ones((6, 3)).view(cls)
+        res = apply_along_axis(sum_to_0d, 0, a)
+        assert_(isinstance(res, cls))
+        assert_array_equal(res, np.array([6, 6, 6]).view(cls))
+
+        res = apply_along_axis(sum_to_0d, 1, a)
+        assert_(isinstance(res, cls))
+        assert_array_equal(res, np.array([3, 3, 3, 3, 3, 3]).view(cls))
+
+    def test_axis_insertion(self, cls=np.ndarray):
+        def f1to2(x):
+            """produces an asymmetric non-square matrix from x"""
+            assert_equal(x.ndim, 1)
+            return (x[::-1] * x[1:, None]).view(cls)
+
+        a2d = np.arange(6 * 3).reshape((6, 3))
+
+        # 2d insertion along first axis
+        actual = apply_along_axis(f1to2, 0, a2d)
+        expected = np.stack([
+            f1to2(a2d[:, i]) for i in range(a2d.shape[1])
+        ], axis=-1).view(cls)
+        assert_equal(type(actual), type(expected))
+        assert_equal(actual, expected)
+
+        # 2d insertion along last axis
+        actual = apply_along_axis(f1to2, 1, a2d)
+        expected = np.stack([
+            f1to2(a2d[i, :]) for i in range(a2d.shape[0])
+        ], axis=0).view(cls)
+        assert_equal(type(actual), type(expected))
+        assert_equal(actual, expected)
+
+        # 3d insertion along middle axis
+        a3d = np.arange(6 * 5 * 3).reshape((6, 5, 3))
+
+        actual = apply_along_axis(f1to2, 1, a3d)
+        expected = np.stack([
+            np.stack([
+                f1to2(a3d[i, :, j]) for i in range(a3d.shape[0])
+            ], axis=0)
+            for j in range(a3d.shape[2])
+        ], axis=-1).view(cls)
+        assert_equal(type(actual), type(expected))
+        assert_equal(actual, expected)
+
+    def test_subclass_preservation(self):
+        class MinimalSubclass(np.ndarray):
+            pass
+        self.test_scalar_array(MinimalSubclass)
+        self.test_0d_array(MinimalSubclass)
+        self.test_axis_insertion(MinimalSubclass)
+
+    def test_axis_insertion_ma(self):
+        def f1to2(x):
+            """produces an asymmetric non-square matrix from x"""
+            assert_equal(x.ndim, 1)
+            res = x[::-1] * x[1:, None]
+            return np.ma.masked_where(res % 5 == 0, res)
+        a = np.arange(6 * 3).reshape((6, 3))
+        res = apply_along_axis(f1to2, 0, a)
+        assert_(isinstance(res, np.ma.masked_array))
+        assert_equal(res.ndim, 3)
+        assert_array_equal(res[:, :, 0].mask, f1to2(a[:, 0]).mask)
+        assert_array_equal(res[:, :, 1].mask, f1to2(a[:, 1]).mask)
+        assert_array_equal(res[:, :, 2].mask, f1to2(a[:, 2]).mask)
+
+    def test_tuple_func1d(self):
+        def sample_1d(x):
+            return x[1], x[0]
+        res = np.apply_along_axis(sample_1d, 1, np.array([[1, 2], [3, 4]]))
+        assert_array_equal(res, np.array([[2, 1], [4, 3]]))
+
+    def test_empty(self):
+        # can't apply_along_axis when there's no chance to call the function
+        def never_call(x):
+            assert_(False)  # should never be reached
+
+        a = np.empty((0, 0))
+        assert_raises(ValueError, np.apply_along_axis, never_call, 0, a)
+        assert_raises(ValueError, np.apply_along_axis, never_call, 1, a)
+
+        # but it's sometimes ok with some non-zero dimensions
+        def empty_to_1(x):
+            assert_(len(x) == 0)
+            return 1
+
+        a = np.empty((10, 0))
+        actual = np.apply_along_axis(empty_to_1, 1, a)
+        assert_equal(actual, np.ones(10))
+        assert_raises(ValueError, np.apply_along_axis, empty_to_1, 0, a)
+
+    def test_with_iterable_object(self):
+        # from issue 5248
+        d = np.array([
+            [{1, 11}, {2, 22}, {3, 33}],
+            [{4, 44}, {5, 55}, {6, 66}]
+        ])
+        actual = np.apply_along_axis(lambda a: set.union(*a), 0, d)
+        expected = np.array([{1, 11, 4, 44}, {2, 22, 5, 55}, {3, 33, 6, 66}])
+
+        assert_equal(actual, expected)
+
+        # issue 8642 - assert_equal doesn't detect this!
+        for i in np.ndindex(actual.shape):
+            assert_equal(type(actual[i]), type(expected[i]))
+
+
+class TestApplyOverAxes:
+    def test_simple(self):
+        a = np.arange(24).reshape(2, 3, 4)
+        aoa_a = apply_over_axes(np.sum, a, [0, 2])
+        assert_array_equal(aoa_a, np.array([[[60], [92], [124]]]))
+
+
+class TestExpandDims:
+    def test_functionality(self):
+        s = (2, 3, 4, 5)
+        a = np.empty(s)
+        for axis in range(-5, 4):
+            b = expand_dims(a, axis)
+            assert_(b.shape[axis] == 1)
+            assert_(np.squeeze(b).shape == s)
+
+    def test_axis_tuple(self):
+        a = np.empty((3, 3, 3))
+        assert np.expand_dims(a, axis=(0, 1, 2)).shape == (1, 1, 1, 3, 3, 3)
+        assert np.expand_dims(a, axis=(0, -1, -2)).shape == (1, 3, 3, 3, 1, 1)
+        assert np.expand_dims(a, axis=(0, 3, 5)).shape == (1, 3, 3, 1, 3, 1)
+        assert np.expand_dims(a, axis=(0, -3, -5)).shape == (1, 1, 3, 1, 3, 3)
+
+    def test_axis_out_of_range(self):
+        s = (2, 3, 4, 5)
+        a = np.empty(s)
+        assert_raises(AxisError, expand_dims, a, -6)
+        assert_raises(AxisError, expand_dims, a, 5)
+
+        a = np.empty((3, 3, 3))
+        assert_raises(AxisError, expand_dims, a, (0, -6))
+        assert_raises(AxisError, expand_dims, a, (0, 5))
+
+    def test_repeated_axis(self):
+        a = np.empty((3, 3, 3))
+        assert_raises(ValueError, expand_dims, a, axis=(1, 1))
+
+    def test_subclasses(self):
+        a = np.arange(10).reshape((2, 5))
+        a = np.ma.array(a, mask=a % 3 == 0)
+
+        expanded = np.expand_dims(a, axis=1)
+        assert_(isinstance(expanded, np.ma.MaskedArray))
+        assert_equal(expanded.shape, (2, 1, 5))
+        assert_equal(expanded.mask.shape, (2, 1, 5))
+
+
+class TestArraySplit:
+    def test_integer_0_split(self):
+        a = np.arange(10)
+        assert_raises(ValueError, array_split, a, 0)
+
+    def test_integer_split(self):
+        a = np.arange(10)
+        res = array_split(a, 1)
+        desired = [np.arange(10)]
+        compare_results(res, desired)
+
+        res = array_split(a, 2)
+        desired = [np.arange(5), np.arange(5, 10)]
+        compare_results(res, desired)
+
+        res = array_split(a, 3)
+        desired = [np.arange(4), np.arange(4, 7), np.arange(7, 10)]
+        compare_results(res, desired)
+
+        res = array_split(a, 4)
+        desired = [np.arange(3), np.arange(3, 6), np.arange(6, 8),
+                   np.arange(8, 10)]
+        compare_results(res, desired)
+
+        res = array_split(a, 5)
+        desired = [np.arange(2), np.arange(2, 4), np.arange(4, 6),
+                   np.arange(6, 8), np.arange(8, 10)]
+        compare_results(res, desired)
+
+        res = array_split(a, 6)
+        desired = [np.arange(2), np.arange(2, 4), np.arange(4, 6),
+                   np.arange(6, 8), np.arange(8, 9), np.arange(9, 10)]
+        compare_results(res, desired)
+
+        res = array_split(a, 7)
+        desired = [np.arange(2), np.arange(2, 4), np.arange(4, 6),
+                   np.arange(6, 7), np.arange(7, 8), np.arange(8, 9),
+                   np.arange(9, 10)]
+        compare_results(res, desired)
+
+        res = array_split(a, 8)
+        desired = [np.arange(2), np.arange(2, 4), np.arange(4, 5),
+                   np.arange(5, 6), np.arange(6, 7), np.arange(7, 8),
+                   np.arange(8, 9), np.arange(9, 10)]
+        compare_results(res, desired)
+
+        res = array_split(a, 9)
+        desired = [np.arange(2), np.arange(2, 3), np.arange(3, 4),
+                   np.arange(4, 5), np.arange(5, 6), np.arange(6, 7),
+                   np.arange(7, 8), np.arange(8, 9), np.arange(9, 10)]
+        compare_results(res, desired)
+
+        res = array_split(a, 10)
+        desired = [np.arange(1), np.arange(1, 2), np.arange(2, 3),
+                   np.arange(3, 4), np.arange(4, 5), np.arange(5, 6),
+                   np.arange(6, 7), np.arange(7, 8), np.arange(8, 9),
+                   np.arange(9, 10)]
+        compare_results(res, desired)
+
+        res = array_split(a, 11)
+        desired = [np.arange(1), np.arange(1, 2), np.arange(2, 3),
+                   np.arange(3, 4), np.arange(4, 5), np.arange(5, 6),
+                   np.arange(6, 7), np.arange(7, 8), np.arange(8, 9),
+                   np.arange(9, 10), np.array([])]
+        compare_results(res, desired)
+
+    def test_integer_split_2D_rows(self):
+        a = np.array([np.arange(10), np.arange(10)])
+        res = array_split(a, 3, axis=0)
+        tgt = [np.array([np.arange(10)]), np.array([np.arange(10)]),
+                   np.zeros((0, 10))]
+        compare_results(res, tgt)
+        assert_(a.dtype.type is res[-1].dtype.type)
+
+        # Same thing for manual splits:
+        res = array_split(a, [0, 1], axis=0)
+        tgt = [np.zeros((0, 10)), np.array([np.arange(10)]),
+               np.array([np.arange(10)])]
+        compare_results(res, tgt)
+        assert_(a.dtype.type is res[-1].dtype.type)
+
+    def test_integer_split_2D_cols(self):
+        a = np.array([np.arange(10), np.arange(10)])
+        res = array_split(a, 3, axis=-1)
+        desired = [np.array([np.arange(4), np.arange(4)]),
+                   np.array([np.arange(4, 7), np.arange(4, 7)]),
+                   np.array([np.arange(7, 10), np.arange(7, 10)])]
+        compare_results(res, desired)
+
+    def test_integer_split_2D_default(self):
+        """ This will fail if we change default axis
+        """
+        a = np.array([np.arange(10), np.arange(10)])
+        res = array_split(a, 3)
+        tgt = [np.array([np.arange(10)]), np.array([np.arange(10)]),
+                   np.zeros((0, 10))]
+        compare_results(res, tgt)
+        assert_(a.dtype.type is res[-1].dtype.type)
+        # perhaps should check higher dimensions
+
+    @pytest.mark.skipif(not IS_64BIT, reason="Needs 64bit platform")
+    def test_integer_split_2D_rows_greater_max_int32(self):
+        a = np.broadcast_to([0], (1 << 32, 2))
+        res = array_split(a, 4)
+        chunk = np.broadcast_to([0], (1 << 30, 2))
+        tgt = [chunk] * 4
+        for i in range(len(tgt)):
+            assert_equal(res[i].shape, tgt[i].shape)
+
+    def test_index_split_simple(self):
+        a = np.arange(10)
+        indices = [1, 5, 7]
+        res = array_split(a, indices, axis=-1)
+        desired = [np.arange(0, 1), np.arange(1, 5), np.arange(5, 7),
+                   np.arange(7, 10)]
+        compare_results(res, desired)
+
+    def test_index_split_low_bound(self):
+        a = np.arange(10)
+        indices = [0, 5, 7]
+        res = array_split(a, indices, axis=-1)
+        desired = [np.array([]), np.arange(0, 5), np.arange(5, 7),
+                   np.arange(7, 10)]
+        compare_results(res, desired)
+
+    def test_index_split_high_bound(self):
+        a = np.arange(10)
+        indices = [0, 5, 7, 10, 12]
+        res = array_split(a, indices, axis=-1)
+        desired = [np.array([]), np.arange(0, 5), np.arange(5, 7),
+                   np.arange(7, 10), np.array([]), np.array([])]
+        compare_results(res, desired)
+
+
+class TestSplit:
+    # The split function is essentially the same as array_split,
+    # except that it test if splitting will result in an
+    # equal split.  Only test for this case.
+
+    def test_equal_split(self):
+        a = np.arange(10)
+        res = split(a, 2)
+        desired = [np.arange(5), np.arange(5, 10)]
+        compare_results(res, desired)
+
+    def test_unequal_split(self):
+        a = np.arange(10)
+        assert_raises(ValueError, split, a, 3)
+
+
+class TestColumnStack:
+    def test_non_iterable(self):
+        assert_raises(TypeError, column_stack, 1)
+
+    def test_1D_arrays(self):
+        # example from docstring
+        a = np.array((1, 2, 3))
+        b = np.array((2, 3, 4))
+        expected = np.array([[1, 2],
+                             [2, 3],
+                             [3, 4]])
+        actual = np.column_stack((a, b))
+        assert_equal(actual, expected)
+
+    def test_2D_arrays(self):
+        # same as hstack 2D docstring example
+        a = np.array([[1], [2], [3]])
+        b = np.array([[2], [3], [4]])
+        expected = np.array([[1, 2],
+                             [2, 3],
+                             [3, 4]])
+        actual = np.column_stack((a, b))
+        assert_equal(actual, expected)
+
+    def test_generator(self):
+        with pytest.raises(TypeError, match="arrays to stack must be"):
+            column_stack(np.arange(3) for _ in range(2))
+
+
+class TestDstack:
+    def test_non_iterable(self):
+        assert_raises(TypeError, dstack, 1)
+
+    def test_0D_array(self):
+        a = np.array(1)
+        b = np.array(2)
+        res = dstack([a, b])
+        desired = np.array([[[1, 2]]])
+        assert_array_equal(res, desired)
+
+    def test_1D_array(self):
+        a = np.array([1])
+        b = np.array([2])
+        res = dstack([a, b])
+        desired = np.array([[[1, 2]]])
+        assert_array_equal(res, desired)
+
+    def test_2D_array(self):
+        a = np.array([[1], [2]])
+        b = np.array([[1], [2]])
+        res = dstack([a, b])
+        desired = np.array([[[1, 1]], [[2, 2, ]]])
+        assert_array_equal(res, desired)
+
+    def test_2D_array2(self):
+        a = np.array([1, 2])
+        b = np.array([1, 2])
+        res = dstack([a, b])
+        desired = np.array([[[1, 1], [2, 2]]])
+        assert_array_equal(res, desired)
+
+    def test_generator(self):
+        with pytest.raises(TypeError, match="arrays to stack must be"):
+            dstack(np.arange(3) for _ in range(2))
+
+
+# array_split has more comprehensive test of splitting.
+# only do simple test on hsplit, vsplit, and dsplit
+class TestHsplit:
+    """Only testing for integer splits.
+
+    """
+    def test_non_iterable(self):
+        assert_raises(ValueError, hsplit, 1, 1)
+
+    def test_0D_array(self):
+        a = np.array(1)
+        try:
+            hsplit(a, 2)
+            assert_(0)
+        except ValueError:
+            pass
+
+    def test_1D_array(self):
+        a = np.array([1, 2, 3, 4])
+        res = hsplit(a, 2)
+        desired = [np.array([1, 2]), np.array([3, 4])]
+        compare_results(res, desired)
+
+    def test_2D_array(self):
+        a = np.array([[1, 2, 3, 4],
+                  [1, 2, 3, 4]])
+        res = hsplit(a, 2)
+        desired = [np.array([[1, 2], [1, 2]]), np.array([[3, 4], [3, 4]])]
+        compare_results(res, desired)
+
+
+class TestVsplit:
+    """Only testing for integer splits.
+
+    """
+    def test_non_iterable(self):
+        assert_raises(ValueError, vsplit, 1, 1)
+
+    def test_0D_array(self):
+        a = np.array(1)
+        assert_raises(ValueError, vsplit, a, 2)
+
+    def test_1D_array(self):
+        a = np.array([1, 2, 3, 4])
+        try:
+            vsplit(a, 2)
+            assert_(0)
+        except ValueError:
+            pass
+
+    def test_2D_array(self):
+        a = np.array([[1, 2, 3, 4],
+                  [1, 2, 3, 4]])
+        res = vsplit(a, 2)
+        desired = [np.array([[1, 2, 3, 4]]), np.array([[1, 2, 3, 4]])]
+        compare_results(res, desired)
+
+
+class TestDsplit:
+    # Only testing for integer splits.
+    def test_non_iterable(self):
+        assert_raises(ValueError, dsplit, 1, 1)
+
+    def test_0D_array(self):
+        a = np.array(1)
+        assert_raises(ValueError, dsplit, a, 2)
+
+    def test_1D_array(self):
+        a = np.array([1, 2, 3, 4])
+        assert_raises(ValueError, dsplit, a, 2)
+
+    def test_2D_array(self):
+        a = np.array([[1, 2, 3, 4],
+                  [1, 2, 3, 4]])
+        try:
+            dsplit(a, 2)
+            assert_(0)
+        except ValueError:
+            pass
+
+    def test_3D_array(self):
+        a = np.array([[[1, 2, 3, 4],
+                   [1, 2, 3, 4]],
+                  [[1, 2, 3, 4],
+                   [1, 2, 3, 4]]])
+        res = dsplit(a, 2)
+        desired = [np.array([[[1, 2], [1, 2]], [[1, 2], [1, 2]]]),
+                   np.array([[[3, 4], [3, 4]], [[3, 4], [3, 4]]])]
+        compare_results(res, desired)
+
+
+class TestSqueeze:
+    def test_basic(self):
+        from numpy.random import rand
+
+        a = rand(20, 10, 10, 1, 1)
+        b = rand(20, 1, 10, 1, 20)
+        c = rand(1, 1, 20, 10)
+        assert_array_equal(np.squeeze(a), np.reshape(a, (20, 10, 10)))
+        assert_array_equal(np.squeeze(b), np.reshape(b, (20, 10, 20)))
+        assert_array_equal(np.squeeze(c), np.reshape(c, (20, 10)))
+
+        # Squeezing to 0-dim should still give an ndarray
+        a = [[[1.5]]]
+        res = np.squeeze(a)
+        assert_equal(res, 1.5)
+        assert_equal(res.ndim, 0)
+        assert_equal(type(res), np.ndarray)
+
+
+class TestKron:
+    def test_basic(self):
+        # Using 0-dimensional ndarray
+        a = np.array(1)
+        b = np.array([[1, 2], [3, 4]])
+        k = np.array([[1, 2], [3, 4]])
+        assert_array_equal(np.kron(a, b), k)
+        a = np.array([[1, 2], [3, 4]])
+        b = np.array(1)
+        assert_array_equal(np.kron(a, b), k)
+
+        # Using 1-dimensional ndarray
+        a = np.array([3])
+        b = np.array([[1, 2], [3, 4]])
+        k = np.array([[3, 6], [9, 12]])
+        assert_array_equal(np.kron(a, b), k)
+        a = np.array([[1, 2], [3, 4]])
+        b = np.array([3])
+        assert_array_equal(np.kron(a, b), k)
+
+        # Using 3-dimensional ndarray
+        a = np.array([[[1]], [[2]]])
+        b = np.array([[1, 2], [3, 4]])
+        k = np.array([[[1, 2], [3, 4]], [[2, 4], [6, 8]]])
+        assert_array_equal(np.kron(a, b), k)
+        a = np.array([[1, 2], [3, 4]])
+        b = np.array([[[1]], [[2]]])
+        k = np.array([[[1, 2], [3, 4]], [[2, 4], [6, 8]]])
+        assert_array_equal(np.kron(a, b), k)
+
+    def test_return_type(self):
+        class myarray(np.ndarray):
+            __array_priority__ = 1.0
+
+        a = np.ones([2, 2])
+        ma = myarray(a.shape, a.dtype, a.data)
+        assert_equal(type(kron(a, a)), np.ndarray)
+        assert_equal(type(kron(ma, ma)), myarray)
+        assert_equal(type(kron(a, ma)), myarray)
+        assert_equal(type(kron(ma, a)), myarray)
+
+    @pytest.mark.parametrize(
+        "array_class", [np.asarray, np.asmatrix]
+    )
+    def test_kron_smoke(self, array_class):
+        a = array_class(np.ones([3, 3]))
+        b = array_class(np.ones([3, 3]))
+        k = array_class(np.ones([9, 9]))
+
+        assert_array_equal(np.kron(a, b), k)
+
+    def test_kron_ma(self):
+        x = np.ma.array([[1, 2], [3, 4]], mask=[[0, 1], [1, 0]])
+        k = np.ma.array(np.diag([1, 4, 4, 16]),
+                mask=~np.array(np.identity(4), dtype=bool))
+
+        assert_array_equal(k, np.kron(x, x))
+
+    @pytest.mark.parametrize(
+        "shape_a,shape_b", [
+            ((1, 1), (1, 1)),
+            ((1, 2, 3), (4, 5, 6)),
+            ((2, 2), (2, 2, 2)),
+            ((1, 0), (1, 1)),
+            ((2, 0, 2), (2, 2)),
+            ((2, 0, 0, 2), (2, 0, 2)),
+        ])
+    def test_kron_shape(self, shape_a, shape_b):
+        a = np.ones(shape_a)
+        b = np.ones(shape_b)
+        normalised_shape_a = (1,) * max(0, len(shape_b) - len(shape_a)) + shape_a
+        normalised_shape_b = (1,) * max(0, len(shape_a) - len(shape_b)) + shape_b
+        expected_shape = np.multiply(normalised_shape_a, normalised_shape_b)
+
+        k = np.kron(a, b)
+        assert np.array_equal(
+                k.shape, expected_shape), "Unexpected shape from kron"
+
+
+class TestTile:
+    def test_basic(self):
+        a = np.array([0, 1, 2])
+        b = [[1, 2], [3, 4]]
+        assert_equal(tile(a, 2), [0, 1, 2, 0, 1, 2])
+        assert_equal(tile(a, (2, 2)), [[0, 1, 2, 0, 1, 2], [0, 1, 2, 0, 1, 2]])
+        assert_equal(tile(a, (1, 2)), [[0, 1, 2, 0, 1, 2]])
+        assert_equal(tile(b, 2), [[1, 2, 1, 2], [3, 4, 3, 4]])
+        assert_equal(tile(b, (2, 1)), [[1, 2], [3, 4], [1, 2], [3, 4]])
+        assert_equal(tile(b, (2, 2)), [[1, 2, 1, 2], [3, 4, 3, 4],
+                                       [1, 2, 1, 2], [3, 4, 3, 4]])
+
+    def test_tile_one_repetition_on_array_gh4679(self):
+        a = np.arange(5)
+        b = tile(a, 1)
+        b += 2
+        assert_equal(a, np.arange(5))
+
+    def test_empty(self):
+        a = np.array([[[]]])
+        b = np.array([[], []])
+        c = tile(b, 2).shape
+        d = tile(a, (3, 2, 5)).shape
+        assert_equal(c, (2, 0))
+        assert_equal(d, (3, 2, 0))
+
+    def test_kroncompare(self):
+        from numpy.random import randint
+
+        reps = [(2,), (1, 2), (2, 1), (2, 2), (2, 3, 2), (3, 2)]
+        shape = [(3,), (2, 3), (3, 4, 3), (3, 2, 3), (4, 3, 2, 4), (2, 2)]
+        for s in shape:
+            b = randint(0, 10, size=s)
+            for r in reps:
+                a = np.ones(r, b.dtype)
+                large = tile(b, r)
+                klarge = kron(a, b)
+                assert_equal(large, klarge)
+
+
+class TestMayShareMemory:
+    def test_basic(self):
+        d = np.ones((50, 60))
+        d2 = np.ones((30, 60, 6))
+        assert_(np.may_share_memory(d, d))
+        assert_(np.may_share_memory(d, d[::-1]))
+        assert_(np.may_share_memory(d, d[::2]))
+        assert_(np.may_share_memory(d, d[1:, ::-1]))
+
+        assert_(not np.may_share_memory(d[::-1], d2))
+        assert_(not np.may_share_memory(d[::2], d2))
+        assert_(not np.may_share_memory(d[1:, ::-1], d2))
+        assert_(np.may_share_memory(d2[1:, ::-1], d2))
+
+
+# Utility
+def compare_results(res, desired):
+    """Compare lists of arrays."""
+    for x, y in zip(res, desired, strict=False):
+        assert_array_equal(x, y)

lib/python3.11/site-packages/numpy/lib/tests/test_stride_tricks.py

@@ -0,0 +1,656 @@
+import pytest
+
+import numpy as np
+from numpy._core._rational_tests import rational
+from numpy.lib._stride_tricks_impl import (
+    _broadcast_shape,
+    as_strided,
+    broadcast_arrays,
+    broadcast_shapes,
+    broadcast_to,
+    sliding_window_view,
+)
+from numpy.testing import (
+    assert_,
+    assert_array_equal,
+    assert_equal,
+    assert_raises,
+    assert_raises_regex,
+    assert_warns,
+)
+
+
+def assert_shapes_correct(input_shapes, expected_shape):
+    # Broadcast a list of arrays with the given input shapes and check the
+    # common output shape.
+
+    inarrays = [np.zeros(s) for s in input_shapes]
+    outarrays = broadcast_arrays(*inarrays)
+    outshapes = [a.shape for a in outarrays]
+    expected = [expected_shape] * len(inarrays)
+    assert_equal(outshapes, expected)
+
+
+def assert_incompatible_shapes_raise(input_shapes):
+    # Broadcast a list of arrays with the given (incompatible) input shapes
+    # and check that they raise a ValueError.
+
+    inarrays = [np.zeros(s) for s in input_shapes]
+    assert_raises(ValueError, broadcast_arrays, *inarrays)
+
+
+def assert_same_as_ufunc(shape0, shape1, transposed=False, flipped=False):
+    # Broadcast two shapes against each other and check that the data layout
+    # is the same as if a ufunc did the broadcasting.
+
+    x0 = np.zeros(shape0, dtype=int)
+    # Note that multiply.reduce's identity element is 1.0, so when shape1==(),
+    # this gives the desired n==1.
+    n = int(np.multiply.reduce(shape1))
+    x1 = np.arange(n).reshape(shape1)
+    if transposed:
+        x0 = x0.T
+        x1 = x1.T
+    if flipped:
+        x0 = x0[::-1]
+        x1 = x1[::-1]
+    # Use the add ufunc to do the broadcasting. Since we're adding 0s to x1, the
+    # result should be exactly the same as the broadcasted view of x1.
+    y = x0 + x1
+    b0, b1 = broadcast_arrays(x0, x1)
+    assert_array_equal(y, b1)
+
+
+def test_same():
+    x = np.arange(10)
+    y = np.arange(10)
+    bx, by = broadcast_arrays(x, y)
+    assert_array_equal(x, bx)
+    assert_array_equal(y, by)
+
+def test_broadcast_kwargs():
+    # ensure that a TypeError is appropriately raised when
+    # np.broadcast_arrays() is called with any keyword
+    # argument other than 'subok'
+    x = np.arange(10)
+    y = np.arange(10)
+
+    with assert_raises_regex(TypeError, 'got an unexpected keyword'):
+        broadcast_arrays(x, y, dtype='float64')
+
+
+def test_one_off():
+    x = np.array([[1, 2, 3]])
+    y = np.array([[1], [2], [3]])
+    bx, by = broadcast_arrays(x, y)
+    bx0 = np.array([[1, 2, 3], [1, 2, 3], [1, 2, 3]])
+    by0 = bx0.T
+    assert_array_equal(bx0, bx)
+    assert_array_equal(by0, by)
+
+
+def test_same_input_shapes():
+    # Check that the final shape is just the input shape.
+
+    data = [
+        (),
+        (1,),
+        (3,),
+        (0, 1),
+        (0, 3),
+        (1, 0),
+        (3, 0),
+        (1, 3),
+        (3, 1),
+        (3, 3),
+    ]
+    for shape in data:
+        input_shapes = [shape]
+        # Single input.
+        assert_shapes_correct(input_shapes, shape)
+        # Double input.
+        input_shapes2 = [shape, shape]
+        assert_shapes_correct(input_shapes2, shape)
+        # Triple input.
+        input_shapes3 = [shape, shape, shape]
+        assert_shapes_correct(input_shapes3, shape)
+
+
+def test_two_compatible_by_ones_input_shapes():
+    # Check that two different input shapes of the same length, but some have
+    # ones, broadcast to the correct shape.
+
+    data = [
+        [[(1,), (3,)], (3,)],
+        [[(1, 3), (3, 3)], (3, 3)],
+        [[(3, 1), (3, 3)], (3, 3)],
+        [[(1, 3), (3, 1)], (3, 3)],
+        [[(1, 1), (3, 3)], (3, 3)],
+        [[(1, 1), (1, 3)], (1, 3)],
+        [[(1, 1), (3, 1)], (3, 1)],
+        [[(1, 0), (0, 0)], (0, 0)],
+        [[(0, 1), (0, 0)], (0, 0)],
+        [[(1, 0), (0, 1)], (0, 0)],
+        [[(1, 1), (0, 0)], (0, 0)],
+        [[(1, 1), (1, 0)], (1, 0)],
+        [[(1, 1), (0, 1)], (0, 1)],
+    ]
+    for input_shapes, expected_shape in data:
+        assert_shapes_correct(input_shapes, expected_shape)
+        # Reverse the input shapes since broadcasting should be symmetric.
+        assert_shapes_correct(input_shapes[::-1], expected_shape)
+
+
+def test_two_compatible_by_prepending_ones_input_shapes():
+    # Check that two different input shapes (of different lengths) broadcast
+    # to the correct shape.
+
+    data = [
+        [[(), (3,)], (3,)],
+        [[(3,), (3, 3)], (3, 3)],
+        [[(3,), (3, 1)], (3, 3)],
+        [[(1,), (3, 3)], (3, 3)],
+        [[(), (3, 3)], (3, 3)],
+        [[(1, 1), (3,)], (1, 3)],
+        [[(1,), (3, 1)], (3, 1)],
+        [[(1,), (1, 3)], (1, 3)],
+        [[(), (1, 3)], (1, 3)],
+        [[(), (3, 1)], (3, 1)],
+        [[(), (0,)], (0,)],
+        [[(0,), (0, 0)], (0, 0)],
+        [[(0,), (0, 1)], (0, 0)],
+        [[(1,), (0, 0)], (0, 0)],
+        [[(), (0, 0)], (0, 0)],
+        [[(1, 1), (0,)], (1, 0)],
+        [[(1,), (0, 1)], (0, 1)],
+        [[(1,), (1, 0)], (1, 0)],
+        [[(), (1, 0)], (1, 0)],
+        [[(), (0, 1)], (0, 1)],
+    ]
+    for input_shapes, expected_shape in data:
+        assert_shapes_correct(input_shapes, expected_shape)
+        # Reverse the input shapes since broadcasting should be symmetric.
+        assert_shapes_correct(input_shapes[::-1], expected_shape)
+
+
+def test_incompatible_shapes_raise_valueerror():
+    # Check that a ValueError is raised for incompatible shapes.
+
+    data = [
+        [(3,), (4,)],
+        [(2, 3), (2,)],
+        [(3,), (3,), (4,)],
+        [(1, 3, 4), (2, 3, 3)],
+    ]
+    for input_shapes in data:
+        assert_incompatible_shapes_raise(input_shapes)
+        # Reverse the input shapes since broadcasting should be symmetric.
+        assert_incompatible_shapes_raise(input_shapes[::-1])
+
+
+def test_same_as_ufunc():
+    # Check that the data layout is the same as if a ufunc did the operation.
+
+    data = [
+        [[(1,), (3,)], (3,)],
+        [[(1, 3), (3, 3)], (3, 3)],
+        [[(3, 1), (3, 3)], (3, 3)],
+        [[(1, 3), (3, 1)], (3, 3)],
+        [[(1, 1), (3, 3)], (3, 3)],
+        [[(1, 1), (1, 3)], (1, 3)],
+        [[(1, 1), (3, 1)], (3, 1)],
+        [[(1, 0), (0, 0)], (0, 0)],
+        [[(0, 1), (0, 0)], (0, 0)],
+        [[(1, 0), (0, 1)], (0, 0)],
+        [[(1, 1), (0, 0)], (0, 0)],
+        [[(1, 1), (1, 0)], (1, 0)],
+        [[(1, 1), (0, 1)], (0, 1)],
+        [[(), (3,)], (3,)],
+        [[(3,), (3, 3)], (3, 3)],
+        [[(3,), (3, 1)], (3, 3)],
+        [[(1,), (3, 3)], (3, 3)],
+        [[(), (3, 3)], (3, 3)],
+        [[(1, 1), (3,)], (1, 3)],
+        [[(1,), (3, 1)], (3, 1)],
+        [[(1,), (1, 3)], (1, 3)],
+        [[(), (1, 3)], (1, 3)],
+        [[(), (3, 1)], (3, 1)],
+        [[(), (0,)], (0,)],
+        [[(0,), (0, 0)], (0, 0)],
+        [[(0,), (0, 1)], (0, 0)],
+        [[(1,), (0, 0)], (0, 0)],
+        [[(), (0, 0)], (0, 0)],
+        [[(1, 1), (0,)], (1, 0)],
+        [[(1,), (0, 1)], (0, 1)],
+        [[(1,), (1, 0)], (1, 0)],
+        [[(), (1, 0)], (1, 0)],
+        [[(), (0, 1)], (0, 1)],
+    ]
+    for input_shapes, expected_shape in data:
+        assert_same_as_ufunc(input_shapes[0], input_shapes[1],
+                             f"Shapes: {input_shapes[0]} {input_shapes[1]}")
+        # Reverse the input shapes since broadcasting should be symmetric.
+        assert_same_as_ufunc(input_shapes[1], input_shapes[0])
+        # Try them transposed, too.
+        assert_same_as_ufunc(input_shapes[0], input_shapes[1], True)
+        # ... and flipped for non-rank-0 inputs in order to test negative
+        # strides.
+        if () not in input_shapes:
+            assert_same_as_ufunc(input_shapes[0], input_shapes[1], False, True)
+            assert_same_as_ufunc(input_shapes[0], input_shapes[1], True, True)
+
+
+def test_broadcast_to_succeeds():
+    data = [
+        [np.array(0), (0,), np.array(0)],
+        [np.array(0), (1,), np.zeros(1)],
+        [np.array(0), (3,), np.zeros(3)],
+        [np.ones(1), (1,), np.ones(1)],
+        [np.ones(1), (2,), np.ones(2)],
+        [np.ones(1), (1, 2, 3), np.ones((1, 2, 3))],
+        [np.arange(3), (3,), np.arange(3)],
+        [np.arange(3), (1, 3), np.arange(3).reshape(1, -1)],
+        [np.arange(3), (2, 3), np.array([[0, 1, 2], [0, 1, 2]])],
+        # test if shape is not a tuple
+        [np.ones(0), 0, np.ones(0)],
+        [np.ones(1), 1, np.ones(1)],
+        [np.ones(1), 2, np.ones(2)],
+        # these cases with size 0 are strange, but they reproduce the behavior
+        # of broadcasting with ufuncs (see test_same_as_ufunc above)
+        [np.ones(1), (0,), np.ones(0)],
+        [np.ones((1, 2)), (0, 2), np.ones((0, 2))],
+        [np.ones((2, 1)), (2, 0), np.ones((2, 0))],
+    ]
+    for input_array, shape, expected in data:
+        actual = broadcast_to(input_array, shape)
+        assert_array_equal(expected, actual)
+
+
+def test_broadcast_to_raises():
+    data = [
+        [(0,), ()],
+        [(1,), ()],
+        [(3,), ()],
+        [(3,), (1,)],
+        [(3,), (2,)],
+        [(3,), (4,)],
+        [(1, 2), (2, 1)],
+        [(1, 1), (1,)],
+        [(1,), -1],
+        [(1,), (-1,)],
+        [(1, 2), (-1, 2)],
+    ]
+    for orig_shape, target_shape in data:
+        arr = np.zeros(orig_shape)
+        assert_raises(ValueError, lambda: broadcast_to(arr, target_shape))
+
+
+def test_broadcast_shape():
+    # tests internal _broadcast_shape
+    # _broadcast_shape is already exercised indirectly by broadcast_arrays
+    # _broadcast_shape is also exercised by the public broadcast_shapes function
+    assert_equal(_broadcast_shape(), ())
+    assert_equal(_broadcast_shape([1, 2]), (2,))
+    assert_equal(_broadcast_shape(np.ones((1, 1))), (1, 1))
+    assert_equal(_broadcast_shape(np.ones((1, 1)), np.ones((3, 4))), (3, 4))
+    assert_equal(_broadcast_shape(*([np.ones((1, 2))] * 32)), (1, 2))
+    assert_equal(_broadcast_shape(*([np.ones((1, 2))] * 100)), (1, 2))
+
+    # regression tests for gh-5862
+    assert_equal(_broadcast_shape(*([np.ones(2)] * 32 + [1])), (2,))
+    bad_args = [np.ones(2)] * 32 + [np.ones(3)] * 32
+    assert_raises(ValueError, lambda: _broadcast_shape(*bad_args))
+
+
+def test_broadcast_shapes_succeeds():
+    # tests public broadcast_shapes
+    data = [
+        [[], ()],
+        [[()], ()],
+        [[(7,)], (7,)],
+        [[(1, 2), (2,)], (1, 2)],
+        [[(1, 1)], (1, 1)],
+        [[(1, 1), (3, 4)], (3, 4)],
+        [[(6, 7), (5, 6, 1), (7,), (5, 1, 7)], (5, 6, 7)],
+        [[(5, 6, 1)], (5, 6, 1)],
+        [[(1, 3), (3, 1)], (3, 3)],
+        [[(1, 0), (0, 0)], (0, 0)],
+        [[(0, 1), (0, 0)], (0, 0)],
+        [[(1, 0), (0, 1)], (0, 0)],
+        [[(1, 1), (0, 0)], (0, 0)],
+        [[(1, 1), (1, 0)], (1, 0)],
+        [[(1, 1), (0, 1)], (0, 1)],
+        [[(), (0,)], (0,)],
+        [[(0,), (0, 0)], (0, 0)],
+        [[(0,), (0, 1)], (0, 0)],
+        [[(1,), (0, 0)], (0, 0)],
+        [[(), (0, 0)], (0, 0)],
+        [[(1, 1), (0,)], (1, 0)],
+        [[(1,), (0, 1)], (0, 1)],
+        [[(1,), (1, 0)], (1, 0)],
+        [[(), (1, 0)], (1, 0)],
+        [[(), (0, 1)], (0, 1)],
+        [[(1,), (3,)], (3,)],
+        [[2, (3, 2)], (3, 2)],
+    ]
+    for input_shapes, target_shape in data:
+        assert_equal(broadcast_shapes(*input_shapes), target_shape)
+
+    assert_equal(broadcast_shapes(*([(1, 2)] * 32)), (1, 2))
+    assert_equal(broadcast_shapes(*([(1, 2)] * 100)), (1, 2))
+
+    # regression tests for gh-5862
+    assert_equal(broadcast_shapes(*([(2,)] * 32)), (2,))
+
+
+def test_broadcast_shapes_raises():
+    # tests public broadcast_shapes
+    data = [
+        [(3,), (4,)],
+        [(2, 3), (2,)],
+        [(3,), (3,), (4,)],
+        [(1, 3, 4), (2, 3, 3)],
+        [(1, 2), (3, 1), (3, 2), (10, 5)],
+        [2, (2, 3)],
+    ]
+    for input_shapes in data:
+        assert_raises(ValueError, lambda: broadcast_shapes(*input_shapes))
+
+    bad_args = [(2,)] * 32 + [(3,)] * 32
+    assert_raises(ValueError, lambda: broadcast_shapes(*bad_args))
+
+
+def test_as_strided():
+    a = np.array([None])
+    a_view = as_strided(a)
+    expected = np.array([None])
+    assert_array_equal(a_view, np.array([None]))
+
+    a = np.array([1, 2, 3, 4])
+    a_view = as_strided(a, shape=(2,), strides=(2 * a.itemsize,))
+    expected = np.array([1, 3])
+    assert_array_equal(a_view, expected)
+
+    a = np.array([1, 2, 3, 4])
+    a_view = as_strided(a, shape=(3, 4), strides=(0, 1 * a.itemsize))
+    expected = np.array([[1, 2, 3, 4], [1, 2, 3, 4], [1, 2, 3, 4]])
+    assert_array_equal(a_view, expected)
+
+    # Regression test for gh-5081
+    dt = np.dtype([('num', 'i4'), ('obj', 'O')])
+    a = np.empty((4,), dtype=dt)
+    a['num'] = np.arange(1, 5)
+    a_view = as_strided(a, shape=(3, 4), strides=(0, a.itemsize))
+    expected_num = [[1, 2, 3, 4]] * 3
+    expected_obj = [[None] * 4] * 3
+    assert_equal(a_view.dtype, dt)
+    assert_array_equal(expected_num, a_view['num'])
+    assert_array_equal(expected_obj, a_view['obj'])
+
+    # Make sure that void types without fields are kept unchanged
+    a = np.empty((4,), dtype='V4')
+    a_view = as_strided(a, shape=(3, 4), strides=(0, a.itemsize))
+    assert_equal(a.dtype, a_view.dtype)
+
+    # Make sure that the only type that could fail is properly handled
+    dt = np.dtype({'names': [''], 'formats': ['V4']})
+    a = np.empty((4,), dtype=dt)
+    a_view = as_strided(a, shape=(3, 4), strides=(0, a.itemsize))
+    assert_equal(a.dtype, a_view.dtype)
+
+    # Custom dtypes should not be lost (gh-9161)
+    r = [rational(i) for i in range(4)]
+    a = np.array(r, dtype=rational)
+    a_view = as_strided(a, shape=(3, 4), strides=(0, a.itemsize))
+    assert_equal(a.dtype, a_view.dtype)
+    assert_array_equal([r] * 3, a_view)
+
+
+class TestSlidingWindowView:
+    def test_1d(self):
+        arr = np.arange(5)
+        arr_view = sliding_window_view(arr, 2)
+        expected = np.array([[0, 1],
+                             [1, 2],
+                             [2, 3],
+                             [3, 4]])
+        assert_array_equal(arr_view, expected)
+
+    def test_2d(self):
+        i, j = np.ogrid[:3, :4]
+        arr = 10 * i + j
+        shape = (2, 2)
+        arr_view = sliding_window_view(arr, shape)
+        expected = np.array([[[[0, 1], [10, 11]],
+                              [[1, 2], [11, 12]],
+                              [[2, 3], [12, 13]]],
+                             [[[10, 11], [20, 21]],
+                              [[11, 12], [21, 22]],
+                              [[12, 13], [22, 23]]]])
+        assert_array_equal(arr_view, expected)
+
+    def test_2d_with_axis(self):
+        i, j = np.ogrid[:3, :4]
+        arr = 10 * i + j
+        arr_view = sliding_window_view(arr, 3, 0)
+        expected = np.array([[[0, 10, 20],
+                              [1, 11, 21],
+                              [2, 12, 22],
+                              [3, 13, 23]]])
+        assert_array_equal(arr_view, expected)
+
+    def test_2d_repeated_axis(self):
+        i, j = np.ogrid[:3, :4]
+        arr = 10 * i + j
+        arr_view = sliding_window_view(arr, (2, 3), (1, 1))
+        expected = np.array([[[[0, 1, 2],
+                               [1, 2, 3]]],
+                             [[[10, 11, 12],
+                               [11, 12, 13]]],
+                             [[[20, 21, 22],
+                               [21, 22, 23]]]])
+        assert_array_equal(arr_view, expected)
+
+    def test_2d_without_axis(self):
+        i, j = np.ogrid[:4, :4]
+        arr = 10 * i + j
+        shape = (2, 3)
+        arr_view = sliding_window_view(arr, shape)
+        expected = np.array([[[[0, 1, 2], [10, 11, 12]],
+                              [[1, 2, 3], [11, 12, 13]]],
+                             [[[10, 11, 12], [20, 21, 22]],
+                              [[11, 12, 13], [21, 22, 23]]],
+                             [[[20, 21, 22], [30, 31, 32]],
+                              [[21, 22, 23], [31, 32, 33]]]])
+        assert_array_equal(arr_view, expected)
+
+    def test_errors(self):
+        i, j = np.ogrid[:4, :4]
+        arr = 10 * i + j
+        with pytest.raises(ValueError, match='cannot contain negative values'):
+            sliding_window_view(arr, (-1, 3))
+        with pytest.raises(
+                ValueError,
+                match='must provide window_shape for all dimensions of `x`'):
+            sliding_window_view(arr, (1,))
+        with pytest.raises(
+                ValueError,
+                match='Must provide matching length window_shape and axis'):
+            sliding_window_view(arr, (1, 3, 4), axis=(0, 1))
+        with pytest.raises(
+                ValueError,
+                match='window shape cannot be larger than input array'):
+            sliding_window_view(arr, (5, 5))
+
+    def test_writeable(self):
+        arr = np.arange(5)
+        view = sliding_window_view(arr, 2, writeable=False)
+        assert_(not view.flags.writeable)
+        with pytest.raises(
+                ValueError,
+                match='assignment destination is read-only'):
+            view[0, 0] = 3
+        view = sliding_window_view(arr, 2, writeable=True)
+        assert_(view.flags.writeable)
+        view[0, 1] = 3
+        assert_array_equal(arr, np.array([0, 3, 2, 3, 4]))
+
+    def test_subok(self):
+        class MyArray(np.ndarray):
+            pass
+
+        arr = np.arange(5).view(MyArray)
+        assert_(not isinstance(sliding_window_view(arr, 2,
+                                                   subok=False),
+                               MyArray))
+        assert_(isinstance(sliding_window_view(arr, 2, subok=True), MyArray))
+        # Default behavior
+        assert_(not isinstance(sliding_window_view(arr, 2), MyArray))
+
+
+def as_strided_writeable():
+    arr = np.ones(10)
+    view = as_strided(arr, writeable=False)
+    assert_(not view.flags.writeable)
+
+    # Check that writeable also is fine:
+    view = as_strided(arr, writeable=True)
+    assert_(view.flags.writeable)
+    view[...] = 3
+    assert_array_equal(arr, np.full_like(arr, 3))
+
+    # Test that things do not break down for readonly:
+    arr.flags.writeable = False
+    view = as_strided(arr, writeable=False)
+    view = as_strided(arr, writeable=True)
+    assert_(not view.flags.writeable)
+
+
+class VerySimpleSubClass(np.ndarray):
+    def __new__(cls, *args, **kwargs):
+        return np.array(*args, subok=True, **kwargs).view(cls)
+
+
+class SimpleSubClass(VerySimpleSubClass):
+    def __new__(cls, *args, **kwargs):
+        self = np.array(*args, subok=True, **kwargs).view(cls)
+        self.info = 'simple'
+        return self
+
+    def __array_finalize__(self, obj):
+        self.info = getattr(obj, 'info', '') + ' finalized'
+
+
+def test_subclasses():
+    # test that subclass is preserved only if subok=True
+    a = VerySimpleSubClass([1, 2, 3, 4])
+    assert_(type(a) is VerySimpleSubClass)
+    a_view = as_strided(a, shape=(2,), strides=(2 * a.itemsize,))
+    assert_(type(a_view) is np.ndarray)
+    a_view = as_strided(a, shape=(2,), strides=(2 * a.itemsize,), subok=True)
+    assert_(type(a_view) is VerySimpleSubClass)
+    # test that if a subclass has __array_finalize__, it is used
+    a = SimpleSubClass([1, 2, 3, 4])
+    a_view = as_strided(a, shape=(2,), strides=(2 * a.itemsize,), subok=True)
+    assert_(type(a_view) is SimpleSubClass)
+    assert_(a_view.info == 'simple finalized')
+
+    # similar tests for broadcast_arrays
+    b = np.arange(len(a)).reshape(-1, 1)
+    a_view, b_view = broadcast_arrays(a, b)
+    assert_(type(a_view) is np.ndarray)
+    assert_(type(b_view) is np.ndarray)
+    assert_(a_view.shape == b_view.shape)
+    a_view, b_view = broadcast_arrays(a, b, subok=True)
+    assert_(type(a_view) is SimpleSubClass)
+    assert_(a_view.info == 'simple finalized')
+    assert_(type(b_view) is np.ndarray)
+    assert_(a_view.shape == b_view.shape)
+
+    # and for broadcast_to
+    shape = (2, 4)
+    a_view = broadcast_to(a, shape)
+    assert_(type(a_view) is np.ndarray)
+    assert_(a_view.shape == shape)
+    a_view = broadcast_to(a, shape, subok=True)
+    assert_(type(a_view) is SimpleSubClass)
+    assert_(a_view.info == 'simple finalized')
+    assert_(a_view.shape == shape)
+
+
+def test_writeable():
+    # broadcast_to should return a readonly array
+    original = np.array([1, 2, 3])
+    result = broadcast_to(original, (2, 3))
+    assert_equal(result.flags.writeable, False)
+    assert_raises(ValueError, result.__setitem__, slice(None), 0)
+
+    # but the result of broadcast_arrays needs to be writeable, to
+    # preserve backwards compatibility
+    test_cases = [((False,), broadcast_arrays(original,)),
+                  ((True, False), broadcast_arrays(0, original))]
+    for is_broadcast, results in test_cases:
+        for array_is_broadcast, result in zip(is_broadcast, results):
+            # This will change to False in a future version
+            if array_is_broadcast:
+                with assert_warns(FutureWarning):
+                    assert_equal(result.flags.writeable, True)
+                with assert_warns(DeprecationWarning):
+                    result[:] = 0
+                # Warning not emitted, writing to the array resets it
+                assert_equal(result.flags.writeable, True)
+            else:
+                # No warning:
+                assert_equal(result.flags.writeable, True)
+
+    for results in [broadcast_arrays(original),
+                    broadcast_arrays(0, original)]:
+        for result in results:
+            # resets the warn_on_write DeprecationWarning
+            result.flags.writeable = True
+            # check: no warning emitted
+            assert_equal(result.flags.writeable, True)
+            result[:] = 0
+
+    # keep readonly input readonly
+    original.flags.writeable = False
+    _, result = broadcast_arrays(0, original)
+    assert_equal(result.flags.writeable, False)
+
+    # regression test for GH6491
+    shape = (2,)
+    strides = [0]
+    tricky_array = as_strided(np.array(0), shape, strides)
+    other = np.zeros((1,))
+    first, second = broadcast_arrays(tricky_array, other)
+    assert_(first.shape == second.shape)
+
+
+def test_writeable_memoryview():
+    # The result of broadcast_arrays exports as a non-writeable memoryview
+    # because otherwise there is no good way to opt in to the new behaviour
+    # (i.e. you would need to set writeable to False explicitly).
+    # See gh-13929.
+    original = np.array([1, 2, 3])
+
+    test_cases = [((False, ), broadcast_arrays(original,)),
+                  ((True, False), broadcast_arrays(0, original))]
+    for is_broadcast, results in test_cases:
+        for array_is_broadcast, result in zip(is_broadcast, results):
+            # This will change to False in a future version
+            if array_is_broadcast:
+                # memoryview(result, writable=True) will give warning but cannot
+                # be tested using the python API.
+                assert memoryview(result).readonly
+            else:
+                assert not memoryview(result).readonly
+
+
+def test_reference_types():
+    input_array = np.array('a', dtype=object)
+    expected = np.array(['a'] * 3, dtype=object)
+    actual = broadcast_to(input_array, (3,))
+    assert_array_equal(expected, actual)
+
+    actual, _ = broadcast_arrays(input_array, np.ones(3))
+    assert_array_equal(expected, actual)

lib/python3.11/site-packages/numpy/lib/tests/test_twodim_base.py

@@ -0,0 +1,559 @@
+"""Test functions for matrix module
+
+"""
+import pytest
+
+import numpy as np
+from numpy import (
+    add,
+    arange,
+    array,
+    diag,
+    eye,
+    fliplr,
+    flipud,
+    histogram2d,
+    mask_indices,
+    ones,
+    tri,
+    tril_indices,
+    tril_indices_from,
+    triu_indices,
+    triu_indices_from,
+    vander,
+    zeros,
+)
+from numpy.testing import (
+    assert_,
+    assert_array_almost_equal,
+    assert_array_equal,
+    assert_array_max_ulp,
+    assert_equal,
+    assert_raises,
+)
+
+
+def get_mat(n):
+    data = arange(n)
+    data = add.outer(data, data)
+    return data
+
+
+class TestEye:
+    def test_basic(self):
+        assert_equal(eye(4),
+                     array([[1, 0, 0, 0],
+                            [0, 1, 0, 0],
+                            [0, 0, 1, 0],
+                            [0, 0, 0, 1]]))
+
+        assert_equal(eye(4, dtype='f'),
+                     array([[1, 0, 0, 0],
+                            [0, 1, 0, 0],
+                            [0, 0, 1, 0],
+                            [0, 0, 0, 1]], 'f'))
+
+        assert_equal(eye(3) == 1,
+                     eye(3, dtype=bool))
+
+    def test_uint64(self):
+        # Regression test for gh-9982
+        assert_equal(eye(np.uint64(2), dtype=int), array([[1, 0], [0, 1]]))
+        assert_equal(eye(np.uint64(2), M=np.uint64(4), k=np.uint64(1)),
+                     array([[0, 1, 0, 0], [0, 0, 1, 0]]))
+
+    def test_diag(self):
+        assert_equal(eye(4, k=1),
+                     array([[0, 1, 0, 0],
+                            [0, 0, 1, 0],
+                            [0, 0, 0, 1],
+                            [0, 0, 0, 0]]))
+
+        assert_equal(eye(4, k=-1),
+                     array([[0, 0, 0, 0],
+                            [1, 0, 0, 0],
+                            [0, 1, 0, 0],
+                            [0, 0, 1, 0]]))
+
+    def test_2d(self):
+        assert_equal(eye(4, 3),
+                     array([[1, 0, 0],
+                            [0, 1, 0],
+                            [0, 0, 1],
+                            [0, 0, 0]]))
+
+        assert_equal(eye(3, 4),
+                     array([[1, 0, 0, 0],
+                            [0, 1, 0, 0],
+                            [0, 0, 1, 0]]))
+
+    def test_diag2d(self):
+        assert_equal(eye(3, 4, k=2),
+                     array([[0, 0, 1, 0],
+                            [0, 0, 0, 1],
+                            [0, 0, 0, 0]]))
+
+        assert_equal(eye(4, 3, k=-2),
+                     array([[0, 0, 0],
+                            [0, 0, 0],
+                            [1, 0, 0],
+                            [0, 1, 0]]))
+
+    def test_eye_bounds(self):
+        assert_equal(eye(2, 2, 1), [[0, 1], [0, 0]])
+        assert_equal(eye(2, 2, -1), [[0, 0], [1, 0]])
+        assert_equal(eye(2, 2, 2), [[0, 0], [0, 0]])
+        assert_equal(eye(2, 2, -2), [[0, 0], [0, 0]])
+        assert_equal(eye(3, 2, 2), [[0, 0], [0, 0], [0, 0]])
+        assert_equal(eye(3, 2, 1), [[0, 1], [0, 0], [0, 0]])
+        assert_equal(eye(3, 2, -1), [[0, 0], [1, 0], [0, 1]])
+        assert_equal(eye(3, 2, -2), [[0, 0], [0, 0], [1, 0]])
+        assert_equal(eye(3, 2, -3), [[0, 0], [0, 0], [0, 0]])
+
+    def test_strings(self):
+        assert_equal(eye(2, 2, dtype='S3'),
+                     [[b'1', b''], [b'', b'1']])
+
+    def test_bool(self):
+        assert_equal(eye(2, 2, dtype=bool), [[True, False], [False, True]])
+
+    def test_order(self):
+        mat_c = eye(4, 3, k=-1)
+        mat_f = eye(4, 3, k=-1, order='F')
+        assert_equal(mat_c, mat_f)
+        assert mat_c.flags.c_contiguous
+        assert not mat_c.flags.f_contiguous
+        assert not mat_f.flags.c_contiguous
+        assert mat_f.flags.f_contiguous
+
+
+class TestDiag:
+    def test_vector(self):
+        vals = (100 * arange(5)).astype('l')
+        b = zeros((5, 5))
+        for k in range(5):
+            b[k, k] = vals[k]
+        assert_equal(diag(vals), b)
+        b = zeros((7, 7))
+        c = b.copy()
+        for k in range(5):
+            b[k, k + 2] = vals[k]
+            c[k + 2, k] = vals[k]
+        assert_equal(diag(vals, k=2), b)
+        assert_equal(diag(vals, k=-2), c)
+
+    def test_matrix(self, vals=None):
+        if vals is None:
+            vals = (100 * get_mat(5) + 1).astype('l')
+        b = zeros((5,))
+        for k in range(5):
+            b[k] = vals[k, k]
+        assert_equal(diag(vals), b)
+        b = b * 0
+        for k in range(3):
+            b[k] = vals[k, k + 2]
+        assert_equal(diag(vals, 2), b[:3])
+        for k in range(3):
+            b[k] = vals[k + 2, k]
+        assert_equal(diag(vals, -2), b[:3])
+
+    def test_fortran_order(self):
+        vals = array((100 * get_mat(5) + 1), order='F', dtype='l')
+        self.test_matrix(vals)
+
+    def test_diag_bounds(self):
+        A = [[1, 2], [3, 4], [5, 6]]
+        assert_equal(diag(A, k=2), [])
+        assert_equal(diag(A, k=1), [2])
+        assert_equal(diag(A, k=0), [1, 4])
+        assert_equal(diag(A, k=-1), [3, 6])
+        assert_equal(diag(A, k=-2), [5])
+        assert_equal(diag(A, k=-3), [])
+
+    def test_failure(self):
+        assert_raises(ValueError, diag, [[[1]]])
+
+
+class TestFliplr:
+    def test_basic(self):
+        assert_raises(ValueError, fliplr, ones(4))
+        a = get_mat(4)
+        b = a[:, ::-1]
+        assert_equal(fliplr(a), b)
+        a = [[0, 1, 2],
+             [3, 4, 5]]
+        b = [[2, 1, 0],
+             [5, 4, 3]]
+        assert_equal(fliplr(a), b)
+
+
+class TestFlipud:
+    def test_basic(self):
+        a = get_mat(4)
+        b = a[::-1, :]
+        assert_equal(flipud(a), b)
+        a = [[0, 1, 2],
+             [3, 4, 5]]
+        b = [[3, 4, 5],
+             [0, 1, 2]]
+        assert_equal(flipud(a), b)
+
+
+class TestHistogram2d:
+    def test_simple(self):
+        x = array(
+            [0.41702200, 0.72032449, 1.1437481e-4, 0.302332573, 0.146755891])
+        y = array(
+            [0.09233859, 0.18626021, 0.34556073, 0.39676747, 0.53881673])
+        xedges = np.linspace(0, 1, 10)
+        yedges = np.linspace(0, 1, 10)
+        H = histogram2d(x, y, (xedges, yedges))[0]
+        answer = array(
+            [[0, 0, 0, 1, 0, 0, 0, 0, 0],
+             [0, 0, 0, 0, 0, 0, 1, 0, 0],
+             [0, 0, 0, 0, 0, 0, 0, 0, 0],
+             [1, 0, 1, 0, 0, 0, 0, 0, 0],
+             [0, 1, 0, 0, 0, 0, 0, 0, 0],
+             [0, 0, 0, 0, 0, 0, 0, 0, 0],
+             [0, 0, 0, 0, 0, 0, 0, 0, 0],
+             [0, 0, 0, 0, 0, 0, 0, 0, 0],
+             [0, 0, 0, 0, 0, 0, 0, 0, 0]])
+        assert_array_equal(H.T, answer)
+        H = histogram2d(x, y, xedges)[0]
+        assert_array_equal(H.T, answer)
+        H, xedges, yedges = histogram2d(list(range(10)), list(range(10)))
+        assert_array_equal(H, eye(10, 10))
+        assert_array_equal(xedges, np.linspace(0, 9, 11))
+        assert_array_equal(yedges, np.linspace(0, 9, 11))
+
+    def test_asym(self):
+        x = array([1, 1, 2, 3, 4, 4, 4, 5])
+        y = array([1, 3, 2, 0, 1, 2, 3, 4])
+        H, xed, yed = histogram2d(
+            x, y, (6, 5), range=[[0, 6], [0, 5]], density=True)
+        answer = array(
+            [[0., 0, 0, 0, 0],
+             [0, 1, 0, 1, 0],
+             [0, 0, 1, 0, 0],
+             [1, 0, 0, 0, 0],
+             [0, 1, 1, 1, 0],
+             [0, 0, 0, 0, 1]])
+        assert_array_almost_equal(H, answer / 8., 3)
+        assert_array_equal(xed, np.linspace(0, 6, 7))
+        assert_array_equal(yed, np.linspace(0, 5, 6))
+
+    def test_density(self):
+        x = array([1, 2, 3, 1, 2, 3, 1, 2, 3])
+        y = array([1, 1, 1, 2, 2, 2, 3, 3, 3])
+        H, xed, yed = histogram2d(
+            x, y, [[1, 2, 3, 5], [1, 2, 3, 5]], density=True)
+        answer = array([[1, 1, .5],
+                        [1, 1, .5],
+                        [.5, .5, .25]]) / 9.
+        assert_array_almost_equal(H, answer, 3)
+
+    def test_all_outliers(self):
+        r = np.random.rand(100) + 1. + 1e6  # histogramdd rounds by decimal=6
+        H, xed, yed = histogram2d(r, r, (4, 5), range=([0, 1], [0, 1]))
+        assert_array_equal(H, 0)
+
+    def test_empty(self):
+        a, edge1, edge2 = histogram2d([], [], bins=([0, 1], [0, 1]))
+        assert_array_max_ulp(a, array([[0.]]))
+
+        a, edge1, edge2 = histogram2d([], [], bins=4)
+        assert_array_max_ulp(a, np.zeros((4, 4)))
+
+    def test_binparameter_combination(self):
+        x = array(
+            [0, 0.09207008, 0.64575234, 0.12875982, 0.47390599,
+             0.59944483, 1])
+        y = array(
+            [0, 0.14344267, 0.48988575, 0.30558665, 0.44700682,
+             0.15886423, 1])
+        edges = (0, 0.1, 0.2, 0.3, 0.4, 0.5, 0.6, 0.7, 0.8, 0.9, 1)
+        H, xe, ye = histogram2d(x, y, (edges, 4))
+        answer = array(
+            [[2., 0., 0., 0.],
+             [0., 1., 0., 0.],
+             [0., 0., 0., 0.],
+             [0., 0., 0., 0.],
+             [0., 1., 0., 0.],
+             [1., 0., 0., 0.],
+             [0., 1., 0., 0.],
+             [0., 0., 0., 0.],
+             [0., 0., 0., 0.],
+             [0., 0., 0., 1.]])
+        assert_array_equal(H, answer)
+        assert_array_equal(ye, array([0., 0.25, 0.5, 0.75, 1]))
+        H, xe, ye = histogram2d(x, y, (4, edges))
+        answer = array(
+            [[1., 1., 0., 1., 0., 0., 0., 0., 0., 0.],
+             [0., 0., 0., 0., 1., 0., 0., 0., 0., 0.],
+             [0., 1., 0., 0., 1., 0., 0., 0., 0., 0.],
+             [0., 0., 0., 0., 0., 0., 0., 0., 0., 1.]])
+        assert_array_equal(H, answer)
+        assert_array_equal(xe, array([0., 0.25, 0.5, 0.75, 1]))
+
+    def test_dispatch(self):
+        class ShouldDispatch:
+            def __array_function__(self, function, types, args, kwargs):
+                return types, args, kwargs
+
+        xy = [1, 2]
+        s_d = ShouldDispatch()
+        r = histogram2d(s_d, xy)
+        # Cannot use assert_equal since that dispatches...
+        assert_(r == ((ShouldDispatch,), (s_d, xy), {}))
+        r = histogram2d(xy, s_d)
+        assert_(r == ((ShouldDispatch,), (xy, s_d), {}))
+        r = histogram2d(xy, xy, bins=s_d)
+        assert_(r, ((ShouldDispatch,), (xy, xy), {'bins': s_d}))
+        r = histogram2d(xy, xy, bins=[s_d, 5])
+        assert_(r, ((ShouldDispatch,), (xy, xy), {'bins': [s_d, 5]}))
+        assert_raises(Exception, histogram2d, xy, xy, bins=[s_d])
+        r = histogram2d(xy, xy, weights=s_d)
+        assert_(r, ((ShouldDispatch,), (xy, xy), {'weights': s_d}))
+
+    @pytest.mark.parametrize(("x_len", "y_len"), [(10, 11), (20, 19)])
+    def test_bad_length(self, x_len, y_len):
+        x, y = np.ones(x_len), np.ones(y_len)
+        with pytest.raises(ValueError,
+                           match='x and y must have the same length.'):
+            histogram2d(x, y)
+
+
+class TestTri:
+    def test_dtype(self):
+        out = array([[1, 0, 0],
+                     [1, 1, 0],
+                     [1, 1, 1]])
+        assert_array_equal(tri(3), out)
+        assert_array_equal(tri(3, dtype=bool), out.astype(bool))
+
+
+def test_tril_triu_ndim2():
+    for dtype in np.typecodes['AllFloat'] + np.typecodes['AllInteger']:
+        a = np.ones((2, 2), dtype=dtype)
+        b = np.tril(a)
+        c = np.triu(a)
+        assert_array_equal(b, [[1, 0], [1, 1]])
+        assert_array_equal(c, b.T)
+        # should return the same dtype as the original array
+        assert_equal(b.dtype, a.dtype)
+        assert_equal(c.dtype, a.dtype)
+
+
+def test_tril_triu_ndim3():
+    for dtype in np.typecodes['AllFloat'] + np.typecodes['AllInteger']:
+        a = np.array([
+            [[1, 1], [1, 1]],
+            [[1, 1], [1, 0]],
+            [[1, 1], [0, 0]],
+            ], dtype=dtype)
+        a_tril_desired = np.array([
+            [[1, 0], [1, 1]],
+            [[1, 0], [1, 0]],
+            [[1, 0], [0, 0]],
+            ], dtype=dtype)
+        a_triu_desired = np.array([
+            [[1, 1], [0, 1]],
+            [[1, 1], [0, 0]],
+            [[1, 1], [0, 0]],
+            ], dtype=dtype)
+        a_triu_observed = np.triu(a)
+        a_tril_observed = np.tril(a)
+        assert_array_equal(a_triu_observed, a_triu_desired)
+        assert_array_equal(a_tril_observed, a_tril_desired)
+        assert_equal(a_triu_observed.dtype, a.dtype)
+        assert_equal(a_tril_observed.dtype, a.dtype)
+
+
+def test_tril_triu_with_inf():
+    # Issue 4859
+    arr = np.array([[1, 1, np.inf],
+                    [1, 1, 1],
+                    [np.inf, 1, 1]])
+    out_tril = np.array([[1, 0, 0],
+                         [1, 1, 0],
+                         [np.inf, 1, 1]])
+    out_triu = out_tril.T
+    assert_array_equal(np.triu(arr), out_triu)
+    assert_array_equal(np.tril(arr), out_tril)
+
+
+def test_tril_triu_dtype():
+    # Issue 4916
+    # tril and triu should return the same dtype as input
+    for c in np.typecodes['All']:
+        if c == 'V':
+            continue
+        arr = np.zeros((3, 3), dtype=c)
+        assert_equal(np.triu(arr).dtype, arr.dtype)
+        assert_equal(np.tril(arr).dtype, arr.dtype)
+
+    # check special cases
+    arr = np.array([['2001-01-01T12:00', '2002-02-03T13:56'],
+                    ['2004-01-01T12:00', '2003-01-03T13:45']],
+                   dtype='datetime64')
+    assert_equal(np.triu(arr).dtype, arr.dtype)
+    assert_equal(np.tril(arr).dtype, arr.dtype)
+
+    arr = np.zeros((3, 3), dtype='f4,f4')
+    assert_equal(np.triu(arr).dtype, arr.dtype)
+    assert_equal(np.tril(arr).dtype, arr.dtype)
+
+
+def test_mask_indices():
+    # simple test without offset
+    iu = mask_indices(3, np.triu)
+    a = np.arange(9).reshape(3, 3)
+    assert_array_equal(a[iu], array([0, 1, 2, 4, 5, 8]))
+    # Now with an offset
+    iu1 = mask_indices(3, np.triu, 1)
+    assert_array_equal(a[iu1], array([1, 2, 5]))
+
+
+def test_tril_indices():
+    # indices without and with offset
+    il1 = tril_indices(4)
+    il2 = tril_indices(4, k=2)
+    il3 = tril_indices(4, m=5)
+    il4 = tril_indices(4, k=2, m=5)
+
+    a = np.array([[1, 2, 3, 4],
+                  [5, 6, 7, 8],
+                  [9, 10, 11, 12],
+                  [13, 14, 15, 16]])
+    b = np.arange(1, 21).reshape(4, 5)
+
+    # indexing:
+    assert_array_equal(a[il1],
+                       array([1, 5, 6, 9, 10, 11, 13, 14, 15, 16]))
+    assert_array_equal(b[il3],
+                       array([1, 6, 7, 11, 12, 13, 16, 17, 18, 19]))
+
+    # And for assigning values:
+    a[il1] = -1
+    assert_array_equal(a,
+                       array([[-1, 2, 3, 4],
+                              [-1, -1, 7, 8],
+                              [-1, -1, -1, 12],
+                              [-1, -1, -1, -1]]))
+    b[il3] = -1
+    assert_array_equal(b,
+                       array([[-1, 2, 3, 4, 5],
+                              [-1, -1, 8, 9, 10],
+                              [-1, -1, -1, 14, 15],
+                              [-1, -1, -1, -1, 20]]))
+    # These cover almost the whole array (two diagonals right of the main one):
+    a[il2] = -10
+    assert_array_equal(a,
+                       array([[-10, -10, -10, 4],
+                              [-10, -10, -10, -10],
+                              [-10, -10, -10, -10],
+                              [-10, -10, -10, -10]]))
+    b[il4] = -10
+    assert_array_equal(b,
+                       array([[-10, -10, -10, 4, 5],
+                              [-10, -10, -10, -10, 10],
+                              [-10, -10, -10, -10, -10],
+                              [-10, -10, -10, -10, -10]]))
+
+
+class TestTriuIndices:
+    def test_triu_indices(self):
+        iu1 = triu_indices(4)
+        iu2 = triu_indices(4, k=2)
+        iu3 = triu_indices(4, m=5)
+        iu4 = triu_indices(4, k=2, m=5)
+
+        a = np.array([[1, 2, 3, 4],
+                      [5, 6, 7, 8],
+                      [9, 10, 11, 12],
+                      [13, 14, 15, 16]])
+        b = np.arange(1, 21).reshape(4, 5)
+
+        # Both for indexing:
+        assert_array_equal(a[iu1],
+                           array([1, 2, 3, 4, 6, 7, 8, 11, 12, 16]))
+        assert_array_equal(b[iu3],
+                           array([1, 2, 3, 4, 5, 7, 8, 9,
+                                  10, 13, 14, 15, 19, 20]))
+
+        # And for assigning values:
+        a[iu1] = -1
+        assert_array_equal(a,
+                           array([[-1, -1, -1, -1],
+                                  [5, -1, -1, -1],
+                                  [9, 10, -1, -1],
+                                  [13, 14, 15, -1]]))
+        b[iu3] = -1
+        assert_array_equal(b,
+                           array([[-1, -1, -1, -1, -1],
+                                  [6, -1, -1, -1, -1],
+                                  [11, 12, -1, -1, -1],
+                                  [16, 17, 18, -1, -1]]))
+
+        # These cover almost the whole array (two diagonals right of the
+        # main one):
+        a[iu2] = -10
+        assert_array_equal(a,
+                           array([[-1, -1, -10, -10],
+                                  [5, -1, -1, -10],
+                                  [9, 10, -1, -1],
+                                  [13, 14, 15, -1]]))
+        b[iu4] = -10
+        assert_array_equal(b,
+                           array([[-1, -1, -10, -10, -10],
+                                  [6, -1, -1, -10, -10],
+                                  [11, 12, -1, -1, -10],
+                                  [16, 17, 18, -1, -1]]))
+
+
+class TestTrilIndicesFrom:
+    def test_exceptions(self):
+        assert_raises(ValueError, tril_indices_from, np.ones((2,)))
+        assert_raises(ValueError, tril_indices_from, np.ones((2, 2, 2)))
+        # assert_raises(ValueError, tril_indices_from, np.ones((2, 3)))
+
+
+class TestTriuIndicesFrom:
+    def test_exceptions(self):
+        assert_raises(ValueError, triu_indices_from, np.ones((2,)))
+        assert_raises(ValueError, triu_indices_from, np.ones((2, 2, 2)))
+        # assert_raises(ValueError, triu_indices_from, np.ones((2, 3)))
+
+
+class TestVander:
+    def test_basic(self):
+        c = np.array([0, 1, -2, 3])
+        v = vander(c)
+        powers = np.array([[0, 0, 0, 0, 1],
+                           [1, 1, 1, 1, 1],
+                           [16, -8, 4, -2, 1],
+                           [81, 27, 9, 3, 1]])
+        # Check default value of N:
+        assert_array_equal(v, powers[:, 1:])
+        # Check a range of N values, including 0 and 5 (greater than default)
+        m = powers.shape[1]
+        for n in range(6):
+            v = vander(c, N=n)
+            assert_array_equal(v, powers[:, m - n:m])
+
+    def test_dtypes(self):
+        c = array([11, -12, 13], dtype=np.int8)
+        v = vander(c)
+        expected = np.array([[121, 11, 1],
+                             [144, -12, 1],
+                             [169, 13, 1]])
+        assert_array_equal(v, expected)
+
+        c = array([1.0 + 1j, 1.0 - 1j])
+        v = vander(c, N=3)
+        expected = np.array([[2j, 1 + 1j, 1],
+                             [-2j, 1 - 1j, 1]])
+        # The data is floating point, but the values are small integers,
+        # so assert_array_equal *should* be safe here (rather than, say,
+        # assert_array_almost_equal).
+        assert_array_equal(v, expected)

lib/python3.11/site-packages/numpy/lib/tests/test_type_check.py

@@ -0,0 +1,473 @@
+import numpy as np
+from numpy import (
+    common_type,
+    iscomplex,
+    iscomplexobj,
+    isneginf,
+    isposinf,
+    isreal,
+    isrealobj,
+    mintypecode,
+    nan_to_num,
+    real_if_close,
+)
+from numpy.testing import assert_, assert_array_equal, assert_equal
+
+
+def assert_all(x):
+    assert_(np.all(x), x)
+
+
+class TestCommonType:
+    def test_basic(self):
+        ai32 = np.array([[1, 2], [3, 4]], dtype=np.int32)
+        af16 = np.array([[1, 2], [3, 4]], dtype=np.float16)
+        af32 = np.array([[1, 2], [3, 4]], dtype=np.float32)
+        af64 = np.array([[1, 2], [3, 4]], dtype=np.float64)
+        acs = np.array([[1 + 5j, 2 + 6j], [3 + 7j, 4 + 8j]], dtype=np.complex64)
+        acd = np.array([[1 + 5j, 2 + 6j], [3 + 7j, 4 + 8j]], dtype=np.complex128)
+        assert_(common_type(ai32) == np.float64)
+        assert_(common_type(af16) == np.float16)
+        assert_(common_type(af32) == np.float32)
+        assert_(common_type(af64) == np.float64)
+        assert_(common_type(acs) == np.complex64)
+        assert_(common_type(acd) == np.complex128)
+
+
+class TestMintypecode:
+
+    def test_default_1(self):
+        for itype in '1bcsuwil':
+            assert_equal(mintypecode(itype), 'd')
+        assert_equal(mintypecode('f'), 'f')
+        assert_equal(mintypecode('d'), 'd')
+        assert_equal(mintypecode('F'), 'F')
+        assert_equal(mintypecode('D'), 'D')
+
+    def test_default_2(self):
+        for itype in '1bcsuwil':
+            assert_equal(mintypecode(itype + 'f'), 'f')
+            assert_equal(mintypecode(itype + 'd'), 'd')
+            assert_equal(mintypecode(itype + 'F'), 'F')
+            assert_equal(mintypecode(itype + 'D'), 'D')
+        assert_equal(mintypecode('ff'), 'f')
+        assert_equal(mintypecode('fd'), 'd')
+        assert_equal(mintypecode('fF'), 'F')
+        assert_equal(mintypecode('fD'), 'D')
+        assert_equal(mintypecode('df'), 'd')
+        assert_equal(mintypecode('dd'), 'd')
+        #assert_equal(mintypecode('dF',savespace=1),'F')
+        assert_equal(mintypecode('dF'), 'D')
+        assert_equal(mintypecode('dD'), 'D')
+        assert_equal(mintypecode('Ff'), 'F')
+        #assert_equal(mintypecode('Fd',savespace=1),'F')
+        assert_equal(mintypecode('Fd'), 'D')
+        assert_equal(mintypecode('FF'), 'F')
+        assert_equal(mintypecode('FD'), 'D')
+        assert_equal(mintypecode('Df'), 'D')
+        assert_equal(mintypecode('Dd'), 'D')
+        assert_equal(mintypecode('DF'), 'D')
+        assert_equal(mintypecode('DD'), 'D')
+
+    def test_default_3(self):
+        assert_equal(mintypecode('fdF'), 'D')
+        #assert_equal(mintypecode('fdF',savespace=1),'F')
+        assert_equal(mintypecode('fdD'), 'D')
+        assert_equal(mintypecode('fFD'), 'D')
+        assert_equal(mintypecode('dFD'), 'D')
+
+        assert_equal(mintypecode('ifd'), 'd')
+        assert_equal(mintypecode('ifF'), 'F')
+        assert_equal(mintypecode('ifD'), 'D')
+        assert_equal(mintypecode('idF'), 'D')
+        #assert_equal(mintypecode('idF',savespace=1),'F')
+        assert_equal(mintypecode('idD'), 'D')
+
+
+class TestIsscalar:
+
+    def test_basic(self):
+        assert_(np.isscalar(3))
+        assert_(not np.isscalar([3]))
+        assert_(not np.isscalar((3,)))
+        assert_(np.isscalar(3j))
+        assert_(np.isscalar(4.0))
+
+
+class TestReal:
+
+    def test_real(self):
+        y = np.random.rand(10,)
+        assert_array_equal(y, np.real(y))
+
+        y = np.array(1)
+        out = np.real(y)
+        assert_array_equal(y, out)
+        assert_(isinstance(out, np.ndarray))
+
+        y = 1
+        out = np.real(y)
+        assert_equal(y, out)
+        assert_(not isinstance(out, np.ndarray))
+
+    def test_cmplx(self):
+        y = np.random.rand(10,) + 1j * np.random.rand(10,)
+        assert_array_equal(y.real, np.real(y))
+
+        y = np.array(1 + 1j)
+        out = np.real(y)
+        assert_array_equal(y.real, out)
+        assert_(isinstance(out, np.ndarray))
+
+        y = 1 + 1j
+        out = np.real(y)
+        assert_equal(1.0, out)
+        assert_(not isinstance(out, np.ndarray))
+
+
+class TestImag:
+
+    def test_real(self):
+        y = np.random.rand(10,)
+        assert_array_equal(0, np.imag(y))
+
+        y = np.array(1)
+        out = np.imag(y)
+        assert_array_equal(0, out)
+        assert_(isinstance(out, np.ndarray))
+
+        y = 1
+        out = np.imag(y)
+        assert_equal(0, out)
+        assert_(not isinstance(out, np.ndarray))
+
+    def test_cmplx(self):
+        y = np.random.rand(10,) + 1j * np.random.rand(10,)
+        assert_array_equal(y.imag, np.imag(y))
+
+        y = np.array(1 + 1j)
+        out = np.imag(y)
+        assert_array_equal(y.imag, out)
+        assert_(isinstance(out, np.ndarray))
+
+        y = 1 + 1j
+        out = np.imag(y)
+        assert_equal(1.0, out)
+        assert_(not isinstance(out, np.ndarray))
+
+
+class TestIscomplex:
+
+    def test_fail(self):
+        z = np.array([-1, 0, 1])
+        res = iscomplex(z)
+        assert_(not np.any(res, axis=0))
+
+    def test_pass(self):
+        z = np.array([-1j, 1, 0])
+        res = iscomplex(z)
+        assert_array_equal(res, [1, 0, 0])
+
+
+class TestIsreal:
+
+    def test_pass(self):
+        z = np.array([-1, 0, 1j])
+        res = isreal(z)
+        assert_array_equal(res, [1, 1, 0])
+
+    def test_fail(self):
+        z = np.array([-1j, 1, 0])
+        res = isreal(z)
+        assert_array_equal(res, [0, 1, 1])
+
+
+class TestIscomplexobj:
+
+    def test_basic(self):
+        z = np.array([-1, 0, 1])
+        assert_(not iscomplexobj(z))
+        z = np.array([-1j, 0, -1])
+        assert_(iscomplexobj(z))
+
+    def test_scalar(self):
+        assert_(not iscomplexobj(1.0))
+        assert_(iscomplexobj(1 + 0j))
+
+    def test_list(self):
+        assert_(iscomplexobj([3, 1 + 0j, True]))
+        assert_(not iscomplexobj([3, 1, True]))
+
+    def test_duck(self):
+        class DummyComplexArray:
+            @property
+            def dtype(self):
+                return np.dtype(complex)
+        dummy = DummyComplexArray()
+        assert_(iscomplexobj(dummy))
+
+    def test_pandas_duck(self):
+        # This tests a custom np.dtype duck-typed class, such as used by pandas
+        # (pandas.core.dtypes)
+        class PdComplex(np.complex128):
+            pass
+
+        class PdDtype:
+            name = 'category'
+            names = None
+            type = PdComplex
+            kind = 'c'
+            str = '<c16'
+            base = np.dtype('complex128')
+
+        class DummyPd:
+            @property
+            def dtype(self):
+                return PdDtype
+        dummy = DummyPd()
+        assert_(iscomplexobj(dummy))
+
+    def test_custom_dtype_duck(self):
+        class MyArray(list):
+            @property
+            def dtype(self):
+                return complex
+
+        a = MyArray([1 + 0j, 2 + 0j, 3 + 0j])
+        assert_(iscomplexobj(a))
+
+
+class TestIsrealobj:
+    def test_basic(self):
+        z = np.array([-1, 0, 1])
+        assert_(isrealobj(z))
+        z = np.array([-1j, 0, -1])
+        assert_(not isrealobj(z))
+
+
+class TestIsnan:
+
+    def test_goodvalues(self):
+        z = np.array((-1., 0., 1.))
+        res = np.isnan(z) == 0
+        assert_all(np.all(res, axis=0))
+
+    def test_posinf(self):
+        with np.errstate(divide='ignore'):
+            assert_all(np.isnan(np.array((1.,)) / 0.) == 0)
+
+    def test_neginf(self):
+        with np.errstate(divide='ignore'):
+            assert_all(np.isnan(np.array((-1.,)) / 0.) == 0)
+
+    def test_ind(self):
+        with np.errstate(divide='ignore', invalid='ignore'):
+            assert_all(np.isnan(np.array((0.,)) / 0.) == 1)
+
+    def test_integer(self):
+        assert_all(np.isnan(1) == 0)
+
+    def test_complex(self):
+        assert_all(np.isnan(1 + 1j) == 0)
+
+    def test_complex1(self):
+        with np.errstate(divide='ignore', invalid='ignore'):
+            assert_all(np.isnan(np.array(0 + 0j) / 0.) == 1)
+
+
+class TestIsfinite:
+    # Fixme, wrong place, isfinite now ufunc
+
+    def test_goodvalues(self):
+        z = np.array((-1., 0., 1.))
+        res = np.isfinite(z) == 1
+        assert_all(np.all(res, axis=0))
+
+    def test_posinf(self):
+        with np.errstate(divide='ignore', invalid='ignore'):
+            assert_all(np.isfinite(np.array((1.,)) / 0.) == 0)
+
+    def test_neginf(self):
+        with np.errstate(divide='ignore', invalid='ignore'):
+            assert_all(np.isfinite(np.array((-1.,)) / 0.) == 0)
+
+    def test_ind(self):
+        with np.errstate(divide='ignore', invalid='ignore'):
+            assert_all(np.isfinite(np.array((0.,)) / 0.) == 0)
+
+    def test_integer(self):
+        assert_all(np.isfinite(1) == 1)
+
+    def test_complex(self):
+        assert_all(np.isfinite(1 + 1j) == 1)
+
+    def test_complex1(self):
+        with np.errstate(divide='ignore', invalid='ignore'):
+            assert_all(np.isfinite(np.array(1 + 1j) / 0.) == 0)
+
+
+class TestIsinf:
+    # Fixme, wrong place, isinf now ufunc
+
+    def test_goodvalues(self):
+        z = np.array((-1., 0., 1.))
+        res = np.isinf(z) == 0
+        assert_all(np.all(res, axis=0))
+
+    def test_posinf(self):
+        with np.errstate(divide='ignore', invalid='ignore'):
+            assert_all(np.isinf(np.array((1.,)) / 0.) == 1)
+
+    def test_posinf_scalar(self):
+        with np.errstate(divide='ignore', invalid='ignore'):
+            assert_all(np.isinf(np.array(1.,) / 0.) == 1)
+
+    def test_neginf(self):
+        with np.errstate(divide='ignore', invalid='ignore'):
+            assert_all(np.isinf(np.array((-1.,)) / 0.) == 1)
+
+    def test_neginf_scalar(self):
+        with np.errstate(divide='ignore', invalid='ignore'):
+            assert_all(np.isinf(np.array(-1.) / 0.) == 1)
+
+    def test_ind(self):
+        with np.errstate(divide='ignore', invalid='ignore'):
+            assert_all(np.isinf(np.array((0.,)) / 0.) == 0)
+
+
+class TestIsposinf:
+
+    def test_generic(self):
+        with np.errstate(divide='ignore', invalid='ignore'):
+            vals = isposinf(np.array((-1., 0, 1)) / 0.)
+        assert_(vals[0] == 0)
+        assert_(vals[1] == 0)
+        assert_(vals[2] == 1)
+
+
+class TestIsneginf:
+
+    def test_generic(self):
+        with np.errstate(divide='ignore', invalid='ignore'):
+            vals = isneginf(np.array((-1., 0, 1)) / 0.)
+        assert_(vals[0] == 1)
+        assert_(vals[1] == 0)
+        assert_(vals[2] == 0)
+
+
+class TestNanToNum:
+
+    def test_generic(self):
+        with np.errstate(divide='ignore', invalid='ignore'):
+            vals = nan_to_num(np.array((-1., 0, 1)) / 0.)
+        assert_all(vals[0] < -1e10) and assert_all(np.isfinite(vals[0]))
+        assert_(vals[1] == 0)
+        assert_all(vals[2] > 1e10) and assert_all(np.isfinite(vals[2]))
+        assert_equal(type(vals), np.ndarray)
+
+        # perform the same tests but with nan, posinf and neginf keywords
+        with np.errstate(divide='ignore', invalid='ignore'):
+            vals = nan_to_num(np.array((-1., 0, 1)) / 0.,
+                              nan=10, posinf=20, neginf=30)
+        assert_equal(vals, [30, 10, 20])
+        assert_all(np.isfinite(vals[[0, 2]]))
+        assert_equal(type(vals), np.ndarray)
+
+        # perform the same test but in-place
+        with np.errstate(divide='ignore', invalid='ignore'):
+            vals = np.array((-1., 0, 1)) / 0.
+        result = nan_to_num(vals, copy=False)
+
+        assert_(result is vals)
+        assert_all(vals[0] < -1e10) and assert_all(np.isfinite(vals[0]))
+        assert_(vals[1] == 0)
+        assert_all(vals[2] > 1e10) and assert_all(np.isfinite(vals[2]))
+        assert_equal(type(vals), np.ndarray)
+
+        # perform the same test but in-place
+        with np.errstate(divide='ignore', invalid='ignore'):
+            vals = np.array((-1., 0, 1)) / 0.
+        result = nan_to_num(vals, copy=False, nan=10, posinf=20, neginf=30)
+
+        assert_(result is vals)
+        assert_equal(vals, [30, 10, 20])
+        assert_all(np.isfinite(vals[[0, 2]]))
+        assert_equal(type(vals), np.ndarray)
+
+    def test_array(self):
+        vals = nan_to_num([1])
+        assert_array_equal(vals, np.array([1], int))
+        assert_equal(type(vals), np.ndarray)
+        vals = nan_to_num([1], nan=10, posinf=20, neginf=30)
+        assert_array_equal(vals, np.array([1], int))
+        assert_equal(type(vals), np.ndarray)
+
+    def test_integer(self):
+        vals = nan_to_num(1)
+        assert_all(vals == 1)
+        assert_equal(type(vals), np.int_)
+        vals = nan_to_num(1, nan=10, posinf=20, neginf=30)
+        assert_all(vals == 1)
+        assert_equal(type(vals), np.int_)
+
+    def test_float(self):
+        vals = nan_to_num(1.0)
+        assert_all(vals == 1.0)
+        assert_equal(type(vals), np.float64)
+        vals = nan_to_num(1.1, nan=10, posinf=20, neginf=30)
+        assert_all(vals == 1.1)
+        assert_equal(type(vals), np.float64)
+
+    def test_complex_good(self):
+        vals = nan_to_num(1 + 1j)
+        assert_all(vals == 1 + 1j)
+        assert_equal(type(vals), np.complex128)
+        vals = nan_to_num(1 + 1j, nan=10, posinf=20, neginf=30)
+        assert_all(vals == 1 + 1j)
+        assert_equal(type(vals), np.complex128)
+
+    def test_complex_bad(self):
+        with np.errstate(divide='ignore', invalid='ignore'):
+            v = 1 + 1j
+            v += np.array(0 + 1.j) / 0.
+        vals = nan_to_num(v)
+        # !! This is actually (unexpectedly) zero
+        assert_all(np.isfinite(vals))
+        assert_equal(type(vals), np.complex128)
+
+    def test_complex_bad2(self):
+        with np.errstate(divide='ignore', invalid='ignore'):
+            v = 1 + 1j
+            v += np.array(-1 + 1.j) / 0.
+        vals = nan_to_num(v)
+        assert_all(np.isfinite(vals))
+        assert_equal(type(vals), np.complex128)
+        # Fixme
+        #assert_all(vals.imag > 1e10)  and assert_all(np.isfinite(vals))
+        # !! This is actually (unexpectedly) positive
+        # !! inf.  Comment out for now, and see if it
+        # !! changes
+        #assert_all(vals.real < -1e10) and assert_all(np.isfinite(vals))
+
+    def test_do_not_rewrite_previous_keyword(self):
+        # This is done to test that when, for instance, nan=np.inf then these
+        # values are not rewritten by posinf keyword to the posinf value.
+        with np.errstate(divide='ignore', invalid='ignore'):
+            vals = nan_to_num(np.array((-1., 0, 1)) / 0., nan=np.inf, posinf=999)
+        assert_all(np.isfinite(vals[[0, 2]]))
+        assert_all(vals[0] < -1e10)
+        assert_equal(vals[[1, 2]], [np.inf, 999])
+        assert_equal(type(vals), np.ndarray)
+
+
+class TestRealIfClose:
+
+    def test_basic(self):
+        a = np.random.rand(10)
+        b = real_if_close(a + 1e-15j)
+        assert_all(isrealobj(b))
+        assert_array_equal(a, b)
+        b = real_if_close(a + 1e-7j)
+        assert_all(iscomplexobj(b))
+        b = real_if_close(a + 1e-7j, tol=1e-6)
+        assert_all(isrealobj(b))

lib/python3.11/site-packages/numpy/lib/tests/test_ufunclike.py

@@ -0,0 +1,97 @@
+import numpy as np
+from numpy import fix, isneginf, isposinf
+from numpy.testing import assert_, assert_array_equal, assert_equal, assert_raises
+
+
+class TestUfunclike:
+
+    def test_isposinf(self):
+        a = np.array([np.inf, -np.inf, np.nan, 0.0, 3.0, -3.0])
+        out = np.zeros(a.shape, bool)
+        tgt = np.array([True, False, False, False, False, False])
+
+        res = isposinf(a)
+        assert_equal(res, tgt)
+        res = isposinf(a, out)
+        assert_equal(res, tgt)
+        assert_equal(out, tgt)
+
+        a = a.astype(np.complex128)
+        with assert_raises(TypeError):
+            isposinf(a)
+
+    def test_isneginf(self):
+        a = np.array([np.inf, -np.inf, np.nan, 0.0, 3.0, -3.0])
+        out = np.zeros(a.shape, bool)
+        tgt = np.array([False, True, False, False, False, False])
+
+        res = isneginf(a)
+        assert_equal(res, tgt)
+        res = isneginf(a, out)
+        assert_equal(res, tgt)
+        assert_equal(out, tgt)
+
+        a = a.astype(np.complex128)
+        with assert_raises(TypeError):
+            isneginf(a)
+
+    def test_fix(self):
+        a = np.array([[1.0, 1.1, 1.5, 1.8], [-1.0, -1.1, -1.5, -1.8]])
+        out = np.zeros(a.shape, float)
+        tgt = np.array([[1., 1., 1., 1.], [-1., -1., -1., -1.]])
+
+        res = fix(a)
+        assert_equal(res, tgt)
+        res = fix(a, out)
+        assert_equal(res, tgt)
+        assert_equal(out, tgt)
+        assert_equal(fix(3.14), 3)
+
+    def test_fix_with_subclass(self):
+        class MyArray(np.ndarray):
+            def __new__(cls, data, metadata=None):
+                res = np.array(data, copy=True).view(cls)
+                res.metadata = metadata
+                return res
+
+            def __array_wrap__(self, obj, context=None, return_scalar=False):
+                if not isinstance(obj, MyArray):
+                    obj = obj.view(MyArray)
+                if obj.metadata is None:
+                    obj.metadata = self.metadata
+                return obj
+
+            def __array_finalize__(self, obj):
+                self.metadata = getattr(obj, 'metadata', None)
+                return self
+
+        a = np.array([1.1, -1.1])
+        m = MyArray(a, metadata='foo')
+        f = fix(m)
+        assert_array_equal(f, np.array([1, -1]))
+        assert_(isinstance(f, MyArray))
+        assert_equal(f.metadata, 'foo')
+
+        # check 0d arrays don't decay to scalars
+        m0d = m[0, ...]
+        m0d.metadata = 'bar'
+        f0d = fix(m0d)
+        assert_(isinstance(f0d, MyArray))
+        assert_equal(f0d.metadata, 'bar')
+
+    def test_scalar(self):
+        x = np.inf
+        actual = np.isposinf(x)
+        expected = np.True_
+        assert_equal(actual, expected)
+        assert_equal(type(actual), type(expected))
+
+        x = -3.4
+        actual = np.fix(x)
+        expected = np.float64(-3.0)
+        assert_equal(actual, expected)
+        assert_equal(type(actual), type(expected))
+
+        out = np.array(0.0)
+        actual = np.fix(x, out=out)
+        assert_(actual is out)

lib/python3.11/site-packages/numpy/lib/tests/test_utils.py

@@ -0,0 +1,80 @@
+from io import StringIO
+
+import pytest
+
+import numpy as np
+import numpy.lib._utils_impl as _utils_impl
+from numpy.testing import assert_raises_regex
+
+
+def test_assert_raises_regex_context_manager():
+    with assert_raises_regex(ValueError, 'no deprecation warning'):
+        raise ValueError('no deprecation warning')
+
+
+def test_info_method_heading():
+    # info(class) should only print "Methods:" heading if methods exist
+
+    class NoPublicMethods:
+        pass
+
+    class WithPublicMethods:
+        def first_method():
+            pass
+
+    def _has_method_heading(cls):
+        out = StringIO()
+        np.info(cls, output=out)
+        return 'Methods:' in out.getvalue()
+
+    assert _has_method_heading(WithPublicMethods)
+    assert not _has_method_heading(NoPublicMethods)
+
+
+def test_drop_metadata():
+    def _compare_dtypes(dt1, dt2):
+        return np.can_cast(dt1, dt2, casting='no')
+
+    # structured dtype
+    dt = np.dtype([('l1', [('l2', np.dtype('S8', metadata={'msg': 'toto'}))])],
+                  metadata={'msg': 'titi'})
+    dt_m = _utils_impl.drop_metadata(dt)
+    assert _compare_dtypes(dt, dt_m) is True
+    assert dt_m.metadata is None
+    assert dt_m['l1'].metadata is None
+    assert dt_m['l1']['l2'].metadata is None
+
+    # alignment
+    dt = np.dtype([('x', '<f8'), ('y', '<i4')],
+                  align=True,
+                  metadata={'msg': 'toto'})
+    dt_m = _utils_impl.drop_metadata(dt)
+    assert _compare_dtypes(dt, dt_m) is True
+    assert dt_m.metadata is None
+
+    # subdtype
+    dt = np.dtype('8f',
+                  metadata={'msg': 'toto'})
+    dt_m = _utils_impl.drop_metadata(dt)
+    assert _compare_dtypes(dt, dt_m) is True
+    assert dt_m.metadata is None
+
+    # scalar
+    dt = np.dtype('uint32',
+                  metadata={'msg': 'toto'})
+    dt_m = _utils_impl.drop_metadata(dt)
+    assert _compare_dtypes(dt, dt_m) is True
+    assert dt_m.metadata is None
+
+
+@pytest.mark.parametrize("dtype",
+        [np.dtype("i,i,i,i")[["f1", "f3"]],
+        np.dtype("f8"),
+        np.dtype("10i")])
+def test_drop_metadata_identity_and_copy(dtype):
+    # If there is no metadata, the identity is preserved:
+    assert _utils_impl.drop_metadata(dtype) is dtype
+
+    # If there is any, it is dropped (subforms are checked above)
+    dtype = np.dtype(dtype, metadata={1: 2})
+    assert _utils_impl.drop_metadata(dtype).metadata is None

lib/python3.11/site-packages/numpy/lib/user_array.py

@@ -0,0 +1 @@
+from ._user_array_impl import __doc__, container  # noqa: F401

lib/python3.11/site-packages/numpy/lib/user_array.pyi

@@ -0,0 +1 @@
+from ._user_array_impl import container as container